aboutsummaryrefslogtreecommitdiff
diff options
context:
space:
mode:
-rw-r--r--LTS.md13
-rw-r--r--WORKSPACE29
-rw-r--r--absl/BUILD.bazel7
-rw-r--r--absl/algorithm/container.h2
-rw-r--r--absl/base/BUILD.bazel7
-rw-r--r--absl/base/CMakeLists.txt2
-rw-r--r--absl/base/casts.h51
-rw-r--r--absl/base/internal/direct_mmap.h12
-rw-r--r--absl/base/internal/endian_test.cc20
-rw-r--r--absl/base/internal/identity.h4
-rw-r--r--absl/base/internal/raw_logging.cc18
-rw-r--r--absl/base/internal/raw_logging.h43
-rw-r--r--absl/base/internal/spinlock_wait.h2
-rw-r--r--absl/base/macros.h5
-rw-r--r--absl/base/raw_logging_test.cc29
-rw-r--r--absl/base/thread_annotations.h1
-rw-r--r--absl/compiler_config_setting.bzl39
-rw-r--r--absl/container/BUILD.bazel11
-rw-r--r--absl/container/CMakeLists.txt19
-rw-r--r--absl/container/fixed_array.h294
-rw-r--r--absl/container/fixed_array_exception_safety_test.cc117
-rw-r--r--absl/container/inlined_vector.h36
-rw-r--r--absl/container/inlined_vector_benchmark.cc37
-rw-r--r--absl/container/inlined_vector_test.cc26
-rw-r--r--absl/copts.bzl1
-rw-r--r--absl/debugging/internal/examine_stack.cc6
-rw-r--r--absl/debugging/internal/stacktrace_config.h37
-rw-r--r--absl/memory/BUILD.bazel14
-rw-r--r--absl/memory/CMakeLists.txt19
-rw-r--r--absl/memory/memory.h33
-rw-r--r--absl/memory/memory_exception_safety_test.cc63
-rw-r--r--absl/memory/memory_test.cc43
-rw-r--r--absl/meta/type_traits.h2
-rw-r--r--absl/numeric/int128.cc26
-rw-r--r--absl/numeric/int128.h58
-rw-r--r--absl/numeric/int128_test.cc11
-rw-r--r--absl/strings/BUILD.bazel229
-rw-r--r--absl/strings/CMakeLists.txt159
-rw-r--r--absl/strings/charconv.cc982
-rw-r--r--absl/strings/charconv.h115
-rw-r--r--absl/strings/charconv_benchmark.cc204
-rw-r--r--absl/strings/charconv_test.cc766
-rw-r--r--absl/strings/internal/charconv_bigint.cc357
-rw-r--r--absl/strings/internal/charconv_bigint.h426
-rw-r--r--absl/strings/internal/charconv_bigint_test.cc203
-rw-r--r--absl/strings/internal/charconv_parse.cc496
-rw-r--r--absl/strings/internal/charconv_parse.h96
-rw-r--r--absl/strings/internal/charconv_parse_test.cc357
-rw-r--r--absl/strings/internal/str_format/arg.cc399
-rw-r--r--absl/strings/internal/str_format/arg.h434
-rw-r--r--absl/strings/internal/str_format/arg_test.cc111
-rw-r--r--absl/strings/internal/str_format/bind.cc232
-rw-r--r--absl/strings/internal/str_format/bind.h189
-rw-r--r--absl/strings/internal/str_format/bind_test.cc131
-rw-r--r--absl/strings/internal/str_format/checker.h325
-rw-r--r--absl/strings/internal/str_format/checker_test.cc150
-rw-r--r--absl/strings/internal/str_format/convert_test.cc575
-rw-r--r--absl/strings/internal/str_format/extension.cc84
-rw-r--r--absl/strings/internal/str_format/extension.h406
-rw-r--r--absl/strings/internal/str_format/extension_test.cc65
-rw-r--r--absl/strings/internal/str_format/float_conversion.cc476
-rw-r--r--absl/strings/internal/str_format/float_conversion.h21
-rw-r--r--absl/strings/internal/str_format/output.cc47
-rw-r--r--absl/strings/internal/str_format/output.h101
-rw-r--r--absl/strings/internal/str_format/output_test.cc78
-rw-r--r--absl/strings/internal/str_format/parser.cc294
-rw-r--r--absl/strings/internal/str_format/parser.h291
-rw-r--r--absl/strings/internal/str_format/parser_test.cc379
-rw-r--r--absl/strings/internal/str_split_internal.h26
-rw-r--r--absl/strings/numbers.cc86
-rw-r--r--absl/strings/numbers_benchmark.cc263
-rw-r--r--absl/strings/str_format.h512
-rw-r--r--absl/strings/str_format_test.cc603
-rw-r--r--absl/strings/str_split.h10
-rw-r--r--absl/strings/str_split_test.cc28
-rw-r--r--absl/synchronization/BUILD.bazel7
-rw-r--r--absl/synchronization/mutex.h4
-rw-r--r--absl/synchronization/mutex_test.cc575
-rw-r--r--absl/time/BUILD.bazel4
-rw-r--r--absl/time/CMakeLists.txt2
-rw-r--r--absl/time/clock_test.cc94
-rw-r--r--absl/time/duration.cc3
-rw-r--r--absl/time/format.cc15
-rw-r--r--absl/time/internal/cctz/include/cctz/civil_time_detail.h16
-rw-r--r--absl/time/internal/cctz/include/cctz/time_zone.h116
-rw-r--r--absl/time/internal/cctz/include/cctz/zone_info_source.h5
-rw-r--r--absl/time/internal/cctz/src/cctz_benchmark.cc14
-rw-r--r--absl/time/internal/cctz/src/time_zone_fixed.cc12
-rw-r--r--absl/time/internal/cctz/src/time_zone_fixed.h6
-rw-r--r--absl/time/internal/cctz/src/time_zone_format.cc15
-rw-r--r--absl/time/internal/cctz/src/time_zone_format_test.cc302
-rw-r--r--absl/time/internal/cctz/src/time_zone_if.h28
-rw-r--r--absl/time/internal/cctz/src/time_zone_impl.cc13
-rw-r--r--absl/time/internal/cctz/src/time_zone_impl.h41
-rw-r--r--absl/time/internal/cctz/src/time_zone_info.cc108
-rw-r--r--absl/time/internal/cctz/src/time_zone_info.h12
-rw-r--r--absl/time/internal/cctz/src/time_zone_libc.cc18
-rw-r--r--absl/time/internal/cctz/src/time_zone_libc.h9
-rw-r--r--absl/time/internal/cctz/src/time_zone_lookup.cc37
-rw-r--r--absl/time/internal/cctz/src/time_zone_lookup_test.cc348
-rw-r--r--absl/time/internal/cctz/src/zone_info_source.cc11
-rw-r--r--absl/time/time.cc13
-rw-r--r--absl/time/time.h8
-rw-r--r--absl/time/time_zone_test.cc2
-rw-r--r--absl/types/BUILD.bazel19
-rw-r--r--absl/types/bad_any_cast.cc4
-rw-r--r--absl/types/bad_any_cast.h14
-rw-r--r--absl/types/bad_optional_access.cc4
-rw-r--r--absl/types/bad_optional_access.h14
-rw-r--r--absl/types/bad_variant_access.cc4
-rw-r--r--absl/types/bad_variant_access.h14
-rw-r--r--absl/types/internal/variant.h362
-rw-r--r--absl/types/optional.h2
-rw-r--r--absl/types/variant.h75
-rw-r--r--absl/types/variant_benchmark.cc220
115 files changed, 13242 insertions, 1171 deletions
diff --git a/LTS.md b/LTS.md
new file mode 100644
index 00000000..385b4f06
--- /dev/null
+++ b/LTS.md
@@ -0,0 +1,13 @@
+# Long Term Support (LTS) Branches
+
+This repository contains periodic snapshots of the Abseil codebase that are
+Long Term Support (LTS) branches. An LTS branch allows you to use a known
+version of Abseil without interfering with other projects which may also, in
+turn, use Abseil. (For more information about our releases, see the
+[Abseil Release Management](https://abseil.io/about/releases) guide.)
+
+## LTS Branches
+
+The following lists LTS branches and the dates on which they have been released:
+
+* [LTS Branch June 20, 2018](https://github.com/abseil/abseil-cpp/tree/lts_2018_06_20/)
diff --git a/WORKSPACE b/WORKSPACE
index 9c950650..e4a91197 100644
--- a/WORKSPACE
+++ b/WORKSPACE
@@ -1,20 +1,23 @@
workspace(name = "com_google_absl")
+load("@bazel_tools//tools/build_defs/repo:http.bzl", "http_archive")
+
# Bazel toolchains
http_archive(
- name = "bazel_toolchains",
- urls = [
- "https://mirror.bazel.build/github.com/bazelbuild/bazel-toolchains/archive/f8847f64e6950e8ab9fde1c0aba768550b0d9ab2.tar.gz",
- "https://github.com/bazelbuild/bazel-toolchains/archive/f8847f64e6950e8ab9fde1c0aba768550b0d9ab2.tar.gz",
- ],
- strip_prefix = "bazel-toolchains-f8847f64e6950e8ab9fde1c0aba768550b0d9ab2",
- sha256 = "794366f51fea224b3656a0b0f8f1518e739748646523a572fcd3d68614a0e670",
+ name = "bazel_toolchains",
+ urls = [
+ "https://mirror.bazel.build/github.com/bazelbuild/bazel-toolchains/archive/287b64e0a211fb7c23b74695f8d5f5205b61f4eb.tar.gz",
+ "https://github.com/bazelbuild/bazel-toolchains/archive/287b64e0a211fb7c23b74695f8d5f5205b61f4eb.tar.gz",
+ ],
+ strip_prefix = "bazel-toolchains-287b64e0a211fb7c23b74695f8d5f5205b61f4eb",
+ sha256 = "aca8ac6afd7745027ee4a43032b51a725a61a75a30f02cc58681ee87e4dcdf4b",
)
# GoogleTest/GoogleMock framework. Used by most unit-tests.
http_archive(
name = "com_google_googletest",
- urls = ["https://github.com/google/googletest/archive/4e4df226fc197c0dda6e37f5c8c3845ca1e73a49.zip"],
- strip_prefix = "googletest-4e4df226fc197c0dda6e37f5c8c3845ca1e73a49",
+ urls = ["https://github.com/google/googletest/archive/b4d4438df9479675a632b2f11125e57133822ece.zip"], # 2018-07-16
+ strip_prefix = "googletest-b4d4438df9479675a632b2f11125e57133822ece",
+ sha256 = "5aaa5d566517cae711e2a3505ea9a6438be1b37fcaae0ebcb96ccba9aa56f23a",
)
# Google benchmark.
@@ -22,11 +25,5 @@ http_archive(
name = "com_github_google_benchmark",
urls = ["https://github.com/google/benchmark/archive/16703ff83c1ae6d53e5155df3bb3ab0bc96083be.zip"],
strip_prefix = "benchmark-16703ff83c1ae6d53e5155df3bb3ab0bc96083be",
-)
-
-# RE2 regular-expression framework. Used by some unit-tests.
-http_archive(
- name = "com_googlesource_code_re2",
- urls = ["https://github.com/google/re2/archive/6cf8ccd82dbaab2668e9b13596c68183c9ecd13f.zip"],
- strip_prefix = "re2-6cf8ccd82dbaab2668e9b13596c68183c9ecd13f",
+ sha256 = "59f918c8ccd4d74b6ac43484467b500f1d64b40cc1010daa055375b322a43ba3",
)
diff --git a/absl/BUILD.bazel b/absl/BUILD.bazel
index 439addbf..edd0274c 100644
--- a/absl/BUILD.bazel
+++ b/absl/BUILD.bazel
@@ -18,11 +18,10 @@ package(default_visibility = ["//visibility:public"])
licenses(["notice"]) # Apache 2.0
-config_setting(
+load(":compiler_config_setting.bzl", "create_llvm_config")
+
+create_llvm_config(
name = "llvm_compiler",
- values = {
- "compiler": "llvm",
- },
visibility = [":__subpackages__"],
)
diff --git a/absl/algorithm/container.h b/absl/algorithm/container.h
index ebe32445..acddec48 100644
--- a/absl/algorithm/container.h
+++ b/absl/algorithm/container.h
@@ -634,7 +634,7 @@ container_algorithm_internal::ContainerIter<C> c_generate_n(C& c, Size n,
// Note: `c_xx()` <algorithm> container versions for `remove()`, `remove_if()`,
// and `unique()` are omitted, because it's not clear whether or not such
-// functions should call erase their supplied sequences afterwards. Either
+// functions should call erase on their supplied sequences afterwards. Either
// behavior would be surprising for a different set of users.
//
diff --git a/absl/base/BUILD.bazel b/absl/base/BUILD.bazel
index 1e93d97e..06d092eb 100644
--- a/absl/base/BUILD.bazel
+++ b/absl/base/BUILD.bazel
@@ -362,6 +362,7 @@ cc_test(
copts = ABSL_TEST_COPTS,
deps = [
":base",
+ "//absl/strings",
"@com_google_googletest//:gtest_main",
],
)
@@ -371,11 +372,6 @@ cc_test(
size = "small",
srcs = ["internal/sysinfo_test.cc"],
copts = ABSL_TEST_COPTS,
- tags = [
- "no_test_android_arm",
- "no_test_android_arm64",
- "no_test_android_x86",
- ],
deps = [
":base",
"//absl/synchronization",
@@ -392,6 +388,7 @@ cc_test(
"//absl:windows": [],
"//conditions:default": ["-pthread"],
}),
+ tags = ["no_test_ios_x86_64"],
deps = [":malloc_internal"],
)
diff --git a/absl/base/CMakeLists.txt b/absl/base/CMakeLists.txt
index 303533e2..01d2af08 100644
--- a/absl/base/CMakeLists.txt
+++ b/absl/base/CMakeLists.txt
@@ -310,7 +310,7 @@ absl_test(
# test raw_logging_test
set(RAW_LOGGING_TEST_SRC "raw_logging_test.cc")
-set(RAW_LOGGING_TEST_PUBLIC_LIBRARIES absl::base)
+set(RAW_LOGGING_TEST_PUBLIC_LIBRARIES absl::base absl::strings)
absl_test(
TARGET
diff --git a/absl/base/casts.h b/absl/base/casts.h
index 8bd5264d..20fd34da 100644
--- a/absl/base/casts.h
+++ b/absl/base/casts.h
@@ -25,12 +25,36 @@
#define ABSL_BASE_CASTS_H_
#include <cstring>
+#include <memory>
#include <type_traits>
#include "absl/base/internal/identity.h"
+#include "absl/base/macros.h"
namespace absl {
+namespace internal_casts {
+
+// NOTE: Not a fully compliant implementation of `std::is_trivially_copyable`.
+// TODO(calabrese) Branch on implementations that directly provide
+// `std::is_trivially_copyable`, create a more rigorous workaround, and publicly
+// expose in meta/type_traits.
+template <class T>
+struct is_trivially_copyable
+ : std::integral_constant<
+ bool, std::is_destructible<T>::value&& __has_trivial_destructor(T) &&
+ __has_trivial_copy(T) && __has_trivial_assign(T)> {};
+
+template <class Dest, class Source>
+struct is_bitcastable
+ : std::integral_constant<bool,
+ sizeof(Dest) == sizeof(Source) &&
+ is_trivially_copyable<Source>::value &&
+ is_trivially_copyable<Dest>::value &&
+ std::is_default_constructible<Dest>::value> {};
+
+} // namespace internal_casts
+
// implicit_cast()
//
// Performs an implicit conversion between types following the language
@@ -125,7 +149,32 @@ inline To implicit_cast(typename absl::internal::identity_t<To> to) {
// and reading its bits back using a different type. A `bit_cast()` avoids this
// issue by implementing its casts using `memcpy()`, which avoids introducing
// this undefined behavior.
-template <typename Dest, typename Source>
+//
+// NOTE: The requirements here are more strict than the bit_cast of standard
+// proposal p0476 due to the need for workarounds and lack of intrinsics.
+// Specifically, this implementation also requires `Dest` to be
+// default-constructible.
+template <
+ typename Dest, typename Source,
+ typename std::enable_if<internal_casts::is_bitcastable<Dest, Source>::value,
+ int>::type = 0>
+inline Dest bit_cast(const Source& source) {
+ Dest dest;
+ memcpy(static_cast<void*>(std::addressof(dest)),
+ static_cast<const void*>(std::addressof(source)), sizeof(dest));
+ return dest;
+}
+
+// NOTE: This overload is only picked if the requirements of bit_cast are not
+// met. It is therefore UB, but is provided temporarily as previous versions of
+// this function template were unchecked. Do not use this in new code.
+template <
+ typename Dest, typename Source,
+ typename std::enable_if<
+ !internal_casts::is_bitcastable<Dest, Source>::value, int>::type = 0>
+ABSL_DEPRECATED(
+ "absl::bit_cast type requirements were violated. Update the types being "
+ "used such that they are the same size and are both TriviallyCopyable.")
inline Dest bit_cast(const Source& source) {
static_assert(sizeof(Dest) == sizeof(Source),
"Source and destination types should have equal sizes.");
diff --git a/absl/base/internal/direct_mmap.h b/absl/base/internal/direct_mmap.h
index 2fe345fc..0426e118 100644
--- a/absl/base/internal/direct_mmap.h
+++ b/absl/base/internal/direct_mmap.h
@@ -92,11 +92,13 @@ inline void* DirectMmap(void* start, size_t length, int prot, int flags, int fd,
#endif
#elif defined(__s390x__)
// On s390x, mmap() arguments are passed in memory.
- uint32_t buf[6] = {
- reinterpret_cast<uint32_t>(start), static_cast<uint32_t>(length),
- static_cast<uint32_t>(prot), static_cast<uint32_t>(flags),
- static_cast<uint32_t>(fd), static_cast<uint32_t>(offset)};
- return reintrepret_cast<void*>(syscall(SYS_mmap, buf));
+ unsigned long buf[6] = {reinterpret_cast<unsigned long>(start), // NOLINT
+ static_cast<unsigned long>(length), // NOLINT
+ static_cast<unsigned long>(prot), // NOLINT
+ static_cast<unsigned long>(flags), // NOLINT
+ static_cast<unsigned long>(fd), // NOLINT
+ static_cast<unsigned long>(offset)}; // NOLINT
+ return reinterpret_cast<void*>(syscall(SYS_mmap, buf));
#elif defined(__x86_64__)
// The x32 ABI has 32 bit longs, but the syscall interface is 64 bit.
// We need to explicitly cast to an unsigned 64 bit type to avoid implicit
diff --git a/absl/base/internal/endian_test.cc b/absl/base/internal/endian_test.cc
index f3ff4b39..e2769155 100644
--- a/absl/base/internal/endian_test.cc
+++ b/absl/base/internal/endian_test.cc
@@ -33,32 +33,16 @@ const uint16_t k16Value{0x0123};
const int kNumValuesToTest = 1000000;
const int kRandomSeed = 12345;
-#ifdef ABSL_IS_BIG_ENDIAN
+#if defined(ABSL_IS_BIG_ENDIAN)
const uint64_t kInitialInNetworkOrder{kInitialNumber};
const uint64_t k64ValueLE{0xefcdab8967452301};
const uint32_t k32ValueLE{0x67452301};
const uint16_t k16ValueLE{0x2301};
-const uint8_t k8ValueLE{k8Value};
-const uint64_t k64IValueLE{0xefcdab89674523a1};
-const uint32_t k32IValueLE{0x67452391};
-const uint16_t k16IValueLE{0x85ff};
-const uint8_t k8IValueLE{0xff};
-const uint64_t kDoubleValueLE{0x6e861bf0f9210940};
-const uint32_t kFloatValueLE{0xd00f4940};
-const uint8_t kBoolValueLE{0x1};
const uint64_t k64ValueBE{kInitialNumber};
const uint32_t k32ValueBE{k32Value};
const uint16_t k16ValueBE{k16Value};
-const uint8_t k8ValueBE{k8Value};
-const uint64_t k64IValueBE{0xa123456789abcdef};
-const uint32_t k32IValueBE{0x91234567};
-const uint16_t k16IValueBE{0xff85};
-const uint8_t k8IValueBE{0xff};
-const uint64_t kDoubleValueBE{0x400921f9f01b866e};
-const uint32_t kFloatValueBE{0x40490fd0};
-const uint8_t kBoolValueBE{0x1};
-#elif defined ABSL_IS_LITTLE_ENDIAN
+#elif defined(ABSL_IS_LITTLE_ENDIAN)
const uint64_t kInitialInNetworkOrder{0xefcdab8967452301};
const uint64_t k64ValueLE{kInitialNumber};
const uint32_t k32ValueLE{k32Value};
diff --git a/absl/base/internal/identity.h b/absl/base/internal/identity.h
index a6734b4d..a1a5d70a 100644
--- a/absl/base/internal/identity.h
+++ b/absl/base/internal/identity.h
@@ -27,7 +27,7 @@ struct identity {
template <typename T>
using identity_t = typename identity<T>::type;
-} // namespace internal
-} // namespace absl
+} // namespace internal
+} // namespace absl
#endif // ABSL_BASE_INTERNAL_IDENTITY_H_
diff --git a/absl/base/internal/raw_logging.cc b/absl/base/internal/raw_logging.cc
index 1ce13888..d9485a66 100644
--- a/absl/base/internal/raw_logging.cc
+++ b/absl/base/internal/raw_logging.cc
@@ -139,7 +139,7 @@ void RawLogVA(absl::LogSeverity severity, const char* file, int line,
#endif
#ifdef ABSL_MIN_LOG_LEVEL
- if (static_cast<int>(severity) < ABSL_MIN_LOG_LEVEL &&
+ if (severity < static_cast<absl::LogSeverity>(ABSL_MIN_LOG_LEVEL) &&
severity < absl::LogSeverity::kFatal) {
enabled = false;
}
@@ -206,6 +206,15 @@ void RawLog(absl::LogSeverity severity, const char* file, int line,
va_end(ap);
}
+// Non-formatting version of RawLog().
+//
+// TODO(gfalcon): When string_view no longer depends on base, change this
+// interface to take its message as a string_view instead.
+static void DefaultInternalLog(absl::LogSeverity severity, const char* file,
+ int line, const std::string& message) {
+ RawLog(severity, file, line, "%s", message.c_str());
+}
+
bool RawLoggingFullySupported() {
#ifdef ABSL_LOW_LEVEL_WRITE_SUPPORTED
return true;
@@ -214,5 +223,12 @@ bool RawLoggingFullySupported() {
#endif // !ABSL_LOW_LEVEL_WRITE_SUPPORTED
}
+ABSL_CONST_INIT absl::base_internal::AtomicHook<InternalLogFunction>
+ internal_log_function(DefaultInternalLog);
+
+void RegisterInternalLogFunction(InternalLogFunction func) {
+ internal_log_function.Store(func);
+}
+
} // namespace raw_logging_internal
} // namespace absl
diff --git a/absl/base/internal/raw_logging.h b/absl/base/internal/raw_logging.h
index a2b7207a..67abfd30 100644
--- a/absl/base/internal/raw_logging.h
+++ b/absl/base/internal/raw_logging.h
@@ -19,7 +19,10 @@
#ifndef ABSL_BASE_INTERNAL_RAW_LOGGING_H_
#define ABSL_BASE_INTERNAL_RAW_LOGGING_H_
+#include <string>
+
#include "absl/base/attributes.h"
+#include "absl/base/internal/atomic_hook.h"
#include "absl/base/log_severity.h"
#include "absl/base/macros.h"
#include "absl/base/port.h"
@@ -57,6 +60,34 @@
} \
} while (0)
+// ABSL_INTERNAL_LOG and ABSL_INTERNAL_CHECK work like the RAW variants above,
+// except that if the richer log library is linked into the binary, we dispatch
+// to that instead. This is potentially useful for internal logging and
+// assertions, where we are using RAW_LOG neither for its async-signal-safety
+// nor for its non-allocating nature, but rather because raw logging has very
+// few other dependencies.
+//
+// The API is a subset of the above: each macro only takes two arguments. Use
+// StrCat if you need to build a richer message.
+#define ABSL_INTERNAL_LOG(severity, message) \
+ do { \
+ constexpr const char* absl_raw_logging_internal_basename = \
+ ::absl::raw_logging_internal::Basename(__FILE__, \
+ sizeof(__FILE__) - 1); \
+ ::absl::raw_logging_internal::internal_log_function( \
+ ABSL_RAW_LOGGING_INTERNAL_##severity, \
+ absl_raw_logging_internal_basename, __LINE__, message); \
+ } while (0)
+
+#define ABSL_INTERNAL_CHECK(condition, message) \
+ do { \
+ if (ABSL_PREDICT_FALSE(!(condition))) { \
+ std::string death_message = "Check " #condition " failed: "; \
+ death_message += std::string(message); \
+ ABSL_INTERNAL_LOG(FATAL, death_message); \
+ } \
+ } while (0)
+
#define ABSL_RAW_LOGGING_INTERNAL_INFO ::absl::LogSeverity::kInfo
#define ABSL_RAW_LOGGING_INTERNAL_WARNING ::absl::LogSeverity::kWarning
#define ABSL_RAW_LOGGING_INTERNAL_ERROR ::absl::LogSeverity::kError
@@ -131,6 +162,18 @@ using LogPrefixHook = bool (*)(absl::LogSeverity severity, const char* file,
using AbortHook = void (*)(const char* file, int line, const char* buf_start,
const char* prefix_end, const char* buf_end);
+// Internal logging function for ABSL_INTERNAL_LOG to dispatch to.
+//
+// TODO(gfalcon): When string_view no longer depends on base, change this
+// interface to take its message as a string_view instead.
+using InternalLogFunction = void (*)(absl::LogSeverity severity,
+ const char* file, int line,
+ const std::string& message);
+
+extern base_internal::AtomicHook<InternalLogFunction> internal_log_function;
+
+void RegisterInternalLogFunction(InternalLogFunction func);
+
} // namespace raw_logging_internal
} // namespace absl
diff --git a/absl/base/internal/spinlock_wait.h b/absl/base/internal/spinlock_wait.h
index 5f658211..5c6cc7fd 100644
--- a/absl/base/internal/spinlock_wait.h
+++ b/absl/base/internal/spinlock_wait.h
@@ -84,7 +84,7 @@ inline void absl::base_internal::SpinLockWake(std::atomic<uint32_t> *w,
inline void absl::base_internal::SpinLockDelay(
std::atomic<uint32_t> *w, uint32_t value, int loop,
- base_internal::SchedulingMode scheduling_mode) {
+ absl::base_internal::SchedulingMode scheduling_mode) {
AbslInternalSpinLockDelay(w, value, loop, scheduling_mode);
}
diff --git a/absl/base/macros.h b/absl/base/macros.h
index afa30300..ca3d5edb 100644
--- a/absl/base/macros.h
+++ b/absl/base/macros.h
@@ -194,8 +194,9 @@ enum LinkerInitialized {
#if defined(NDEBUG)
#define ABSL_ASSERT(expr) (false ? (void)(expr) : (void)0)
#else
-#define ABSL_ASSERT(expr) \
- (ABSL_PREDICT_TRUE((expr)) ? (void)0 : [] { assert(false && #expr); }())
+#define ABSL_ASSERT(expr) \
+ (ABSL_PREDICT_TRUE((expr)) ? (void)0 \
+ : [] { assert(false && #expr); }()) // NOLINT
#endif
#endif // ABSL_BASE_MACROS_H_
diff --git a/absl/base/raw_logging_test.cc b/absl/base/raw_logging_test.cc
index dae4b351..ebbc5db9 100644
--- a/absl/base/raw_logging_test.cc
+++ b/absl/base/raw_logging_test.cc
@@ -18,12 +18,20 @@
#include "absl/base/internal/raw_logging.h"
+#include <tuple>
+
#include "gtest/gtest.h"
+#include "absl/strings/str_cat.h"
namespace {
TEST(RawLoggingCompilationTest, Log) {
ABSL_RAW_LOG(INFO, "RAW INFO: %d", 1);
+ ABSL_RAW_LOG(INFO, "RAW INFO: %d %d", 1, 2);
+ ABSL_RAW_LOG(INFO, "RAW INFO: %d %d %d", 1, 2, 3);
+ ABSL_RAW_LOG(INFO, "RAW INFO: %d %d %d %d", 1, 2, 3, 4);
+ ABSL_RAW_LOG(INFO, "RAW INFO: %d %d %d %d %d", 1, 2, 3, 4, 5);
+ ABSL_RAW_LOG(WARNING, "RAW WARNING: %d", 1);
ABSL_RAW_LOG(ERROR, "RAW ERROR: %d", 1);
}
@@ -47,4 +55,25 @@ TEST(RawLoggingDeathTest, LogFatal) {
kExpectedDeathOutput);
}
+TEST(InternalLog, CompilationTest) {
+ ABSL_INTERNAL_LOG(INFO, "Internal Log");
+ std::string log_msg = "Internal Log";
+ ABSL_INTERNAL_LOG(INFO, log_msg);
+
+ ABSL_INTERNAL_LOG(INFO, log_msg + " 2");
+
+ float d = 1.1f;
+ ABSL_INTERNAL_LOG(INFO, absl::StrCat("Internal log ", 3, " + ", d));
+}
+
+TEST(InternalLogDeathTest, FailingCheck) {
+ EXPECT_DEATH_IF_SUPPORTED(ABSL_INTERNAL_CHECK(1 == 0, "explanation"),
+ kExpectedDeathOutput);
+}
+
+TEST(InternalLogDeathTest, LogFatal) {
+ EXPECT_DEATH_IF_SUPPORTED(ABSL_INTERNAL_LOG(FATAL, "my dog has fleas"),
+ kExpectedDeathOutput);
+}
+
} // namespace
diff --git a/absl/base/thread_annotations.h b/absl/base/thread_annotations.h
index 8d30b932..fbb2797b 100644
--- a/absl/base/thread_annotations.h
+++ b/absl/base/thread_annotations.h
@@ -31,7 +31,6 @@
// that evaluate to a concrete mutex object whenever possible. If the mutex
// you want to refer to is not in scope, you may use a member pointer
// (e.g. &MyClass::mutex_) to refer to a mutex in some (unknown) object.
-//
#ifndef ABSL_BASE_THREAD_ANNOTATIONS_H_
#define ABSL_BASE_THREAD_ANNOTATIONS_H_
diff --git a/absl/compiler_config_setting.bzl b/absl/compiler_config_setting.bzl
new file mode 100644
index 00000000..b77c4f56
--- /dev/null
+++ b/absl/compiler_config_setting.bzl
@@ -0,0 +1,39 @@
+#
+# Copyright 2018 The Abseil Authors.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+
+"""Creates config_setting that allows selecting based on 'compiler' value."""
+
+def create_llvm_config(name, visibility):
+ # The "do_not_use_tools_cpp_compiler_present" attribute exists to
+ # distinguish between older versions of Bazel that do not support
+ # "@bazel_tools//tools/cpp:compiler" flag_value, and newer ones that do.
+ # In the future, the only way to select on the compiler will be through
+ # flag_values{"@bazel_tools//tools/cpp:compiler"} and the else branch can
+ # be removed.
+ if hasattr(cc_common, "do_not_use_tools_cpp_compiler_present"):
+ native.config_setting(
+ name = name,
+ flag_values = {
+ "@bazel_tools//tools/cpp:compiler": "llvm",
+ },
+ visibility = visibility,
+ )
+ else:
+ native.config_setting(
+ name = name,
+ values = {"compiler": "llvm"},
+ visibility = visibility,
+ )
diff --git a/absl/container/BUILD.bazel b/absl/container/BUILD.bazel
index 119d5c88..07df3675 100644
--- a/absl/container/BUILD.bazel
+++ b/absl/container/BUILD.bazel
@@ -63,6 +63,17 @@ cc_test(
)
cc_test(
+ name = "fixed_array_exception_safety_test",
+ srcs = ["fixed_array_exception_safety_test.cc"],
+ copts = ABSL_TEST_COPTS + ABSL_EXCEPTIONS_FLAG,
+ deps = [
+ ":fixed_array",
+ "//absl/base:exception_safety_testing",
+ "@com_google_googletest//:gtest_main",
+ ],
+)
+
+cc_test(
name = "fixed_array_benchmark",
srcs = ["fixed_array_benchmark.cc"],
copts = ABSL_TEST_COPTS + ["$(STACK_FRAME_UNLIMITED)"],
diff --git a/absl/container/CMakeLists.txt b/absl/container/CMakeLists.txt
index f56ce92d..d580b489 100644
--- a/absl/container/CMakeLists.txt
+++ b/absl/container/CMakeLists.txt
@@ -84,6 +84,25 @@ absl_test(
)
+# test fixed_array_exception_safety_test
+set(FIXED_ARRAY_EXCEPTION_SAFETY_TEST_SRC "fixed_array_exception_safety_test.cc")
+set(FIXED_ARRAY_EXCEPTION_SAFETY_TEST_PUBLIC_LIBRARIES
+ absl::container
+ absl_base_internal_exception_safety_testing
+)
+
+absl_test(
+ TARGET
+ fixed_array_exception_safety_test
+ SOURCES
+ ${FIXED_ARRAY_EXCEPTION_SAFETY_TEST_SRC}
+ PUBLIC_LIBRARIES
+ ${FIXED_ARRAY_EXCEPTION_SAFETY_TEST_PUBLIC_LIBRARIES}
+ PRIVATE_COMPILE_FLAGS
+ ${ABSL_EXCEPTIONS_FLAG}
+)
+
+
# test inlined_vector_test
set(INLINED_VECTOR_TEST_SRC "inlined_vector_test.cc")
set(INLINED_VECTOR_TEST_PUBLIC_LIBRARIES absl::base absl_throw_delegate test_instance_tracker_lib)
diff --git a/absl/container/fixed_array.h b/absl/container/fixed_array.h
index 06bc8009..62600df0 100644
--- a/absl/container/fixed_array.h
+++ b/absl/container/fixed_array.h
@@ -1,4 +1,4 @@
-// Copyright 2017 The Abseil Authors.
+// Copyright 2018 The Abseil Authors.
//
// Licensed under the Apache License, Version 2.0 (the "License");
// you may not use this file except in compliance with the License.
@@ -57,13 +57,13 @@ constexpr static auto kFixedArrayUseDefault = static_cast<size_t>(-1);
// FixedArray
// -----------------------------------------------------------------------------
//
-// A `FixedArray` provides a run-time fixed-size array, allocating small arrays
-// inline for efficiency and correctness.
+// A `FixedArray` provides a run-time fixed-size array, allocating a small array
+// inline for efficiency.
//
// Most users should not specify an `inline_elements` argument and let
-// `FixedArray<>` automatically determine the number of elements
+// `FixedArray` automatically determine the number of elements
// to store inline based on `sizeof(T)`. If `inline_elements` is specified, the
-// `FixedArray<>` implementation will inline arrays of
+// `FixedArray` implementation will use inline storage for arrays with a
// length <= `inline_elements`.
//
// Note that a `FixedArray` constructed with a `size_type` argument will
@@ -78,19 +78,18 @@ constexpr static auto kFixedArrayUseDefault = static_cast<size_t>(-1);
// operators.
template <typename T, size_t inlined = kFixedArrayUseDefault>
class FixedArray {
+ static_assert(!std::is_array<T>::value || std::extent<T>::value > 0,
+ "Arrays with unknown bounds cannot be used with FixedArray.");
static constexpr size_t kInlineBytesDefault = 256;
// std::iterator_traits isn't guaranteed to be SFINAE-friendly until C++17,
// but this seems to be mostly pedantic.
- template <typename Iter>
- using EnableIfForwardIterator = typename std::enable_if<
- std::is_convertible<
- typename std::iterator_traits<Iter>::iterator_category,
- std::forward_iterator_tag>::value,
- int>::type;
+ template <typename Iterator>
+ using EnableIfForwardIterator = absl::enable_if_t<std::is_convertible<
+ typename std::iterator_traits<Iterator>::iterator_category,
+ std::forward_iterator_tag>::value>;
public:
- // For playing nicely with stl:
using value_type = T;
using iterator = T*;
using const_iterator = const T*;
@@ -108,33 +107,44 @@ class FixedArray {
? kInlineBytesDefault / sizeof(value_type)
: inlined;
- FixedArray(const FixedArray& other) : rep_(other.begin(), other.end()) {}
+ FixedArray(const FixedArray& other)
+ : FixedArray(other.begin(), other.end()) {}
+
FixedArray(FixedArray&& other) noexcept(
- // clang-format off
- absl::allocator_is_nothrow<std::allocator<value_type>>::value &&
- // clang-format on
- std::is_nothrow_move_constructible<value_type>::value)
- : rep_(std::make_move_iterator(other.begin()),
- std::make_move_iterator(other.end())) {}
+ absl::conjunction<absl::allocator_is_nothrow<std::allocator<value_type>>,
+ std::is_nothrow_move_constructible<value_type>>::value)
+ : FixedArray(std::make_move_iterator(other.begin()),
+ std::make_move_iterator(other.end())) {}
// Creates an array object that can store `n` elements.
// Note that trivially constructible elements will be uninitialized.
- explicit FixedArray(size_type n) : rep_(n) {}
+ explicit FixedArray(size_type n) : storage_(n) {
+ absl::memory_internal::uninitialized_default_construct_n(storage_.begin(),
+ size());
+ }
// Creates an array initialized with `n` copies of `val`.
- FixedArray(size_type n, const value_type& val) : rep_(n, val) {}
+ FixedArray(size_type n, const value_type& val) : storage_(n) {
+ std::uninitialized_fill_n(data(), size(), val);
+ }
// Creates an array initialized with the elements from the input
// range. The array's size will always be `std::distance(first, last)`.
- // REQUIRES: Iter must be a forward_iterator or better.
- template <typename Iter, EnableIfForwardIterator<Iter> = 0>
- FixedArray(Iter first, Iter last) : rep_(first, last) {}
+ // REQUIRES: Iterator must be a forward_iterator or better.
+ template <typename Iterator, EnableIfForwardIterator<Iterator>* = nullptr>
+ FixedArray(Iterator first, Iterator last)
+ : storage_(std::distance(first, last)) {
+ std::uninitialized_copy(first, last, data());
+ }
- // Creates the array from an initializer_list.
- FixedArray(std::initializer_list<T> init_list)
+ FixedArray(std::initializer_list<value_type> init_list)
: FixedArray(init_list.begin(), init_list.end()) {}
- ~FixedArray() {}
+ ~FixedArray() noexcept {
+ for (const StorageElement& cur : storage_) {
+ cur.~StorageElement();
+ }
+ }
// Assignments are deleted because they break the invariant that the size of a
// `FixedArray` never changes.
@@ -144,7 +154,7 @@ class FixedArray {
// FixedArray::size()
//
// Returns the length of the fixed array.
- size_type size() const { return rep_.size(); }
+ size_type size() const { return storage_.size(); }
// FixedArray::max_size()
//
@@ -169,12 +179,12 @@ class FixedArray {
//
// Returns a const T* pointer to elements of the `FixedArray`. This pointer
// can be used to access (but not modify) the contained elements.
- const_pointer data() const { return AsValue(rep_.begin()); }
+ const_pointer data() const { return AsValueType(storage_.begin()); }
// Overload of FixedArray::data() to return a T* pointer to elements of the
// fixed array. This pointer can be used to access and modify the contained
// elements.
- pointer data() { return AsValue(rep_.begin()); }
+ pointer data() { return AsValueType(storage_.begin()); }
// FixedArray::operator[]
//
@@ -294,7 +304,7 @@ class FixedArray {
// FixedArray::fill()
//
// Assigns the given `value` to all elements in the fixed array.
- void fill(const T& value) { std::fill(begin(), end(), value); }
+ void fill(const value_type& val) { std::fill(begin(), end(), val); }
// Relational operators. Equality operators are elementwise using
// `operator==`, while order operators order FixedArrays lexicographically.
@@ -324,17 +334,18 @@ class FixedArray {
}
private:
- // HolderTraits
+ // StorageElement
//
- // Wrapper to hold elements of type T for the case where T is an array type.
- // If 'T' is an array type, HolderTraits::type is a struct with a 'T v;'.
- // Otherwise, HolderTraits::type is simply 'T'.
+ // For FixedArrays with a C-style-array value_type, StorageElement is a POD
+ // wrapper struct called StorageElementWrapper that holds the value_type
+ // instance inside. This is needed for construction and destruction of the
+ // entire array regardless of how many dimensions it has. For all other cases,
+ // StorageElement is just an alias of value_type.
//
- // Maintainer's Note: The simpler solution would be to simply wrap T in a
- // struct whether it's an array or not: 'struct Holder { T v; };', but
- // that causes some paranoid diagnostics to misfire about uses of data(),
- // believing that 'data()' (aka '&rep_.begin().v') is a pointer to a single
- // element, rather than the packed array that it really is.
+ // Maintainer's Note: The simpler solution would be to simply wrap value_type
+ // in a struct whether it's an array or not. That causes some paranoid
+ // diagnostics to misfire, believing that 'data()' returns a pointer to a
+ // single element, rather than the packed array that it really is.
// e.g.:
//
// FixedArray<char> buf(1);
@@ -343,149 +354,98 @@ class FixedArray {
// error: call to int __builtin___sprintf_chk(etc...)
// will always overflow destination buffer [-Werror]
//
- class HolderTraits {
- template <typename U>
- struct SelectImpl {
- using type = U;
- static pointer AsValue(type* p) { return p; }
- };
-
- // Partial specialization for elements of array type.
- template <typename U, size_t N>
- struct SelectImpl<U[N]> {
- struct Holder { U v[N]; };
- using type = Holder;
- static pointer AsValue(type* p) { return &p->v; }
- };
- using Impl = SelectImpl<value_type>;
-
- public:
- using type = typename Impl::type;
-
- static pointer AsValue(type *p) { return Impl::AsValue(p); }
-
- // TODO(billydonahue): fix the type aliasing violation
- // this assertion hints at.
- static_assert(sizeof(type) == sizeof(value_type),
- "Holder must be same size as value_type");
+ template <typename OuterT = value_type,
+ typename InnerT = absl::remove_extent_t<OuterT>,
+ size_t InnerN = std::extent<OuterT>::value>
+ struct StorageElementWrapper {
+ InnerT array[InnerN];
};
- using Holder = typename HolderTraits::type;
- static pointer AsValue(Holder *p) { return HolderTraits::AsValue(p); }
+ using StorageElement =
+ absl::conditional_t<std::is_array<value_type>::value,
+ StorageElementWrapper<value_type>, value_type>;
- // InlineSpace
- //
- // Allocate some space, not an array of elements of type T, so that we can
- // skip calling the T constructors and destructors for space we never use.
- // How many elements should we store inline?
- // a. If not specified, use a default of kInlineBytesDefault bytes (This is
- // currently 256 bytes, which seems small enough to not cause stack overflow
- // or unnecessary stack pollution, while still allowing stack allocation for
- // reasonably long character arrays).
- // b. Never use 0 length arrays (not ISO C++)
- //
- template <size_type N, typename = void>
- class InlineSpace {
- public:
- Holder* data() { return reinterpret_cast<Holder*>(space_.data()); }
- void AnnotateConstruct(size_t n) const { Annotate(n, true); }
- void AnnotateDestruct(size_t n) const { Annotate(n, false); }
+ static pointer AsValueType(pointer ptr) { return ptr; }
+ static pointer AsValueType(StorageElementWrapper<value_type>* ptr) {
+ return std::addressof(ptr->array);
+ }
- private:
-#ifndef ADDRESS_SANITIZER
- void Annotate(size_t, bool) const { }
-#else
- void Annotate(size_t n, bool creating) const {
- if (!n) return;
- const void* bot = &left_redzone_;
- const void* beg = space_.data();
- const void* end = space_.data() + n;
- const void* top = &right_redzone_ + 1;
- // args: (beg, end, old_mid, new_mid)
- if (creating) {
- ANNOTATE_CONTIGUOUS_CONTAINER(beg, top, top, end);
- ANNOTATE_CONTIGUOUS_CONTAINER(bot, beg, beg, bot);
- } else {
- ANNOTATE_CONTIGUOUS_CONTAINER(beg, top, end, top);
- ANNOTATE_CONTIGUOUS_CONTAINER(bot, beg, bot, beg);
- }
+ static_assert(sizeof(StorageElement) == sizeof(value_type), "");
+ static_assert(alignof(StorageElement) == alignof(value_type), "");
+
+ struct NonEmptyInlinedStorage {
+ using StorageElementBuffer =
+ absl::aligned_storage_t<sizeof(StorageElement),
+ alignof(StorageElement)>;
+ StorageElement* data() {
+ return reinterpret_cast<StorageElement*>(inlined_storage_.data());
}
+
+#ifdef ADDRESS_SANITIZER
+ void* RedzoneBegin() { return &redzone_begin_; }
+ void* RedzoneEnd() { return &redzone_end_ + 1; }
#endif // ADDRESS_SANITIZER
- using Buffer =
- typename std::aligned_storage<sizeof(Holder), alignof(Holder)>::type;
+ void AnnotateConstruct(size_t);
+ void AnnotateDestruct(size_t);
- ADDRESS_SANITIZER_REDZONE(left_redzone_);
- std::array<Buffer, N> space_;
- ADDRESS_SANITIZER_REDZONE(right_redzone_);
+ ADDRESS_SANITIZER_REDZONE(redzone_begin_);
+ std::array<StorageElementBuffer, inline_elements> inlined_storage_;
+ ADDRESS_SANITIZER_REDZONE(redzone_end_);
};
- // specialization when N = 0.
- template <typename U>
- class InlineSpace<0, U> {
- public:
- Holder* data() { return nullptr; }
- void AnnotateConstruct(size_t) const {}
- void AnnotateDestruct(size_t) const {}
+ struct EmptyInlinedStorage {
+ StorageElement* data() { return nullptr; }
+ void AnnotateConstruct(size_t) {}
+ void AnnotateDestruct(size_t) {}
};
- // Rep
+ using InlinedStorage =
+ absl::conditional_t<inline_elements == 0, EmptyInlinedStorage,
+ NonEmptyInlinedStorage>;
+
+ // Storage
//
- // A const Rep object holds FixedArray's size and data pointer.
+ // An instance of Storage manages the inline and out-of-line memory for
+ // instances of FixedArray. This guarantees that even when construction of
+ // individual elements fails in the FixedArray constructor body, the
+ // destructor for Storage will still be called and out-of-line memory will be
+ // properly deallocated.
//
- class Rep : public InlineSpace<inline_elements> {
+ class Storage : public InlinedStorage {
public:
- Rep(size_type n, const value_type& val) : n_(n), p_(MakeHolder(n)) {
- std::uninitialized_fill_n(p_, n, val);
- }
-
- explicit Rep(size_type n) : n_(n), p_(MakeHolder(n)) {
- // Loop optimizes to nothing for trivially constructible T.
- for (Holder* p = p_; p != p_ + n; ++p)
- // Note: no parens: default init only.
- // Also note '::' to avoid Holder class placement new operator.
- ::new (static_cast<void*>(p)) Holder;
- }
-
- template <typename Iter>
- Rep(Iter first, Iter last)
- : n_(std::distance(first, last)), p_(MakeHolder(n_)) {
- std::uninitialized_copy(first, last, AsValue(p_));
- }
-
- ~Rep() {
- // Destruction must be in reverse order.
- // Loop optimizes to nothing for trivially destructible T.
- for (Holder* p = end(); p != begin();) (--p)->~Holder();
- if (IsAllocated(size())) {
- std::allocator<Holder>().deallocate(p_, n_);
- } else {
+ explicit Storage(size_type n) : data_(CreateStorage(n)), size_(n) {}
+ ~Storage() noexcept {
+ if (UsingInlinedStorage(size())) {
this->AnnotateDestruct(size());
+ } else {
+ std::allocator<StorageElement>().deallocate(begin(), size());
}
}
- Holder* begin() const { return p_; }
- Holder* end() const { return p_ + n_; }
- size_type size() const { return n_; }
+
+ size_type size() const { return size_; }
+ StorageElement* begin() const { return data_; }
+ StorageElement* end() const { return begin() + size(); }
private:
- Holder* MakeHolder(size_type n) {
- if (IsAllocated(n)) {
- return std::allocator<Holder>().allocate(n);
- } else {
+ static bool UsingInlinedStorage(size_type n) {
+ return n <= inline_elements;
+ }
+
+ StorageElement* CreateStorage(size_type n) {
+ if (UsingInlinedStorage(n)) {
this->AnnotateConstruct(n);
- return this->data();
+ return InlinedStorage::data();
+ } else {
+ return std::allocator<StorageElement>().allocate(n);
}
}
- bool IsAllocated(size_type n) const { return n > inline_elements; }
-
- const size_type n_;
- Holder* const p_;
+ StorageElement* const data_;
+ const size_type size_;
};
-
- // Data members
- Rep rep_;
+ const Storage storage_;
};
template <typename T, size_t N>
@@ -494,5 +454,25 @@ constexpr size_t FixedArray<T, N>::inline_elements;
template <typename T, size_t N>
constexpr size_t FixedArray<T, N>::kInlineBytesDefault;
+template <typename T, size_t N>
+void FixedArray<T, N>::NonEmptyInlinedStorage::AnnotateConstruct(size_t n) {
+#ifdef ADDRESS_SANITIZER
+ if (!n) return;
+ ANNOTATE_CONTIGUOUS_CONTAINER(data(), RedzoneEnd(), RedzoneEnd(), data() + n);
+ ANNOTATE_CONTIGUOUS_CONTAINER(RedzoneBegin(), data(), data(), RedzoneBegin());
+#endif // ADDRESS_SANITIZER
+ static_cast<void>(n); // Mark used when not in asan mode
+}
+
+template <typename T, size_t N>
+void FixedArray<T, N>::NonEmptyInlinedStorage::AnnotateDestruct(size_t n) {
+#ifdef ADDRESS_SANITIZER
+ if (!n) return;
+ ANNOTATE_CONTIGUOUS_CONTAINER(data(), RedzoneEnd(), data() + n, RedzoneEnd());
+ ANNOTATE_CONTIGUOUS_CONTAINER(RedzoneBegin(), data(), RedzoneBegin(), data());
+#endif // ADDRESS_SANITIZER
+ static_cast<void>(n); // Mark used when not in asan mode
+}
+
} // namespace absl
#endif // ABSL_CONTAINER_FIXED_ARRAY_H_
diff --git a/absl/container/fixed_array_exception_safety_test.cc b/absl/container/fixed_array_exception_safety_test.cc
new file mode 100644
index 00000000..c123c2a1
--- /dev/null
+++ b/absl/container/fixed_array_exception_safety_test.cc
@@ -0,0 +1,117 @@
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include <initializer_list>
+
+#include "absl/container/fixed_array.h"
+
+#include "gtest/gtest.h"
+#include "absl/base/internal/exception_safety_testing.h"
+
+namespace absl {
+
+namespace {
+
+constexpr size_t kInlined = 25;
+constexpr size_t kSmallSize = kInlined / 2;
+constexpr size_t kLargeSize = kInlined * 2;
+
+constexpr int kInitialValue = 5;
+constexpr int kUpdatedValue = 10;
+
+using ::testing::TestThrowingCtor;
+
+using Thrower = testing::ThrowingValue<testing::TypeSpec::kEverythingThrows>;
+using FixedArr = absl::FixedArray<Thrower, kInlined>;
+
+using MoveThrower = testing::ThrowingValue<testing::TypeSpec::kNoThrowMove>;
+using MoveFixedArr = absl::FixedArray<MoveThrower, kInlined>;
+
+TEST(FixedArrayExceptionSafety, CopyConstructor) {
+ auto small = FixedArr(kSmallSize);
+ TestThrowingCtor<FixedArr>(small);
+
+ auto large = FixedArr(kLargeSize);
+ TestThrowingCtor<FixedArr>(large);
+}
+
+TEST(FixedArrayExceptionSafety, MoveConstructor) {
+ TestThrowingCtor<FixedArr>(FixedArr(kSmallSize));
+ TestThrowingCtor<FixedArr>(FixedArr(kLargeSize));
+
+ // TypeSpec::kNoThrowMove
+ TestThrowingCtor<MoveFixedArr>(MoveFixedArr(kSmallSize));
+ TestThrowingCtor<MoveFixedArr>(MoveFixedArr(kLargeSize));
+}
+
+TEST(FixedArrayExceptionSafety, SizeConstructor) {
+ TestThrowingCtor<FixedArr>(kSmallSize);
+ TestThrowingCtor<FixedArr>(kLargeSize);
+}
+
+TEST(FixedArrayExceptionSafety, SizeValueConstructor) {
+ TestThrowingCtor<FixedArr>(kSmallSize, Thrower());
+ TestThrowingCtor<FixedArr>(kLargeSize, Thrower());
+}
+
+TEST(FixedArrayExceptionSafety, IteratorConstructor) {
+ auto small = FixedArr(kSmallSize);
+ TestThrowingCtor<FixedArr>(small.begin(), small.end());
+
+ auto large = FixedArr(kLargeSize);
+ TestThrowingCtor<FixedArr>(large.begin(), large.end());
+}
+
+TEST(FixedArrayExceptionSafety, InitListConstructor) {
+ constexpr int small_inlined = 3;
+ using SmallFixedArr = absl::FixedArray<Thrower, small_inlined>;
+
+ TestThrowingCtor<SmallFixedArr>(std::initializer_list<Thrower>{});
+ // Test inlined allocation
+ TestThrowingCtor<SmallFixedArr>(
+ std::initializer_list<Thrower>{Thrower{}, Thrower{}});
+ // Test out of line allocation
+ TestThrowingCtor<SmallFixedArr>(std::initializer_list<Thrower>{
+ Thrower{}, Thrower{}, Thrower{}, Thrower{}, Thrower{}});
+}
+
+testing::AssertionResult ReadMemory(FixedArr* fixed_arr) {
+ // Marked volatile to prevent optimization. Used for running asan tests.
+ volatile int sum = 0;
+ for (const auto& thrower : *fixed_arr) {
+ sum += thrower.Get();
+ }
+ return testing::AssertionSuccess() << "Values sum to [" << sum << "]";
+}
+
+TEST(FixedArrayExceptionSafety, Fill) {
+ auto test_fill = testing::MakeExceptionSafetyTester()
+ .WithInvariants(ReadMemory)
+ .WithOperation([&](FixedArr* fixed_arr_ptr) {
+ auto thrower =
+ Thrower(kUpdatedValue, testing::nothrow_ctor);
+ fixed_arr_ptr->fill(thrower);
+ });
+
+ EXPECT_TRUE(
+ test_fill.WithInitialValue(FixedArr(kSmallSize, Thrower(kInitialValue)))
+ .Test());
+ EXPECT_TRUE(
+ test_fill.WithInitialValue(FixedArr(kLargeSize, Thrower(kInitialValue)))
+ .Test());
+}
+
+} // namespace
+
+} // namespace absl
diff --git a/absl/container/inlined_vector.h b/absl/container/inlined_vector.h
index 78f78ea7..75d98027 100644
--- a/absl/container/inlined_vector.h
+++ b/absl/container/inlined_vector.h
@@ -89,7 +89,9 @@ class InlinedVector {
: allocator_and_tag_(alloc) {}
// Create a vector with n copies of value_type().
- explicit InlinedVector(size_type n) : allocator_and_tag_(allocator_type()) {
+ explicit InlinedVector(size_type n,
+ const allocator_type& alloc = allocator_type())
+ : allocator_and_tag_(alloc) {
InitAssign(n);
}
@@ -643,12 +645,12 @@ class InlinedVector {
class AllocatorAndTag : private allocator_type {
public:
explicit AllocatorAndTag(const allocator_type& a, Tag t = Tag())
- : allocator_type(a), tag_(t) {
- }
+ : allocator_type(a), tag_(t) {}
Tag& tag() { return tag_; }
const Tag& tag() const { return tag_; }
allocator_type& allocator() { return *this; }
const allocator_type& allocator() const { return *this; }
+
private:
Tag tag_;
};
@@ -687,26 +689,23 @@ class InlinedVector {
new (&rep_.allocation_storage.allocation) Allocation(allocation);
}
+ // TODO(absl-team): investigate whether the reinterpret_cast is appropriate.
value_type* inlined_space() {
- return reinterpret_cast<value_type*>(&rep_.inlined_storage.inlined);
+ return reinterpret_cast<value_type*>(
+ std::addressof(rep_.inlined_storage.inlined[0]));
}
const value_type* inlined_space() const {
- return reinterpret_cast<const value_type*>(&rep_.inlined_storage.inlined);
+ return reinterpret_cast<const value_type*>(
+ std::addressof(rep_.inlined_storage.inlined[0]));
}
- value_type* allocated_space() {
- return allocation().buffer();
- }
- const value_type* allocated_space() const {
- return allocation().buffer();
- }
+ value_type* allocated_space() { return allocation().buffer(); }
+ const value_type* allocated_space() const { return allocation().buffer(); }
const allocator_type& allocator() const {
return allocator_and_tag_.allocator();
}
- allocator_type& allocator() {
- return allocator_and_tag_.allocator();
- }
+ allocator_type& allocator() { return allocator_and_tag_.allocator(); }
bool allocated() const { return tag().allocated(); }
@@ -1126,8 +1125,7 @@ void InlinedVector<T, N, A>::swap(InlinedVector& other) {
const size_type b_size = b->size();
assert(a_size >= b_size);
// 'a' is larger. Swap the elements up to the smaller array size.
- std::swap_ranges(a->inlined_space(),
- a->inlined_space() + b_size,
+ std::swap_ranges(a->inlined_space(), a->inlined_space() + b_size,
b->inlined_space());
// Move the remaining elements: A[b_size,a_size) -> B[b_size,a_size)
@@ -1271,8 +1269,7 @@ void InlinedVector<T, N, A>::Destroy(value_type* ptr, value_type* ptr_last) {
// scribbling on a vtable pointer.
#ifndef NDEBUG
if (ptr != ptr_last) {
- memset(reinterpret_cast<void*>(ptr), 0xab,
- sizeof(*ptr) * (ptr_last - ptr));
+ memset(reinterpret_cast<void*>(ptr), 0xab, sizeof(*ptr) * (ptr_last - ptr));
}
#endif
}
@@ -1300,8 +1297,9 @@ void InlinedVector<T, N, A>::AssignRange(Iter first, Iter last,
// Optimized to avoid reallocation.
// Prefer reassignment to copy construction for elements.
iterator out = begin();
- for ( ; first != last && out != end(); ++first, ++out)
+ for (; first != last && out != end(); ++first, ++out) {
*out = *first;
+ }
erase(out, end());
std::copy(first, last, std::back_inserter(*this));
}
diff --git a/absl/container/inlined_vector_benchmark.cc b/absl/container/inlined_vector_benchmark.cc
index 5977bc93..24f21749 100644
--- a/absl/container/inlined_vector_benchmark.cc
+++ b/absl/container/inlined_vector_benchmark.cc
@@ -63,18 +63,34 @@ void BM_StdVectorFill(benchmark::State& state) {
}
BENCHMARK(BM_StdVectorFill)->Range(0, 1024);
+// The purpose of the next two benchmarks is to verify that
+// absl::InlinedVector is efficient when moving is more efficent than
+// copying. To do so, we use strings that are larger than the short
+// std::string optimization.
bool StringRepresentedInline(std::string s) {
const char* chars = s.data();
std::string s1 = std::move(s);
return s1.data() != chars;
}
+int GetNonShortStringOptimizationSize() {
+ for (int i = 24; i <= 192; i *= 2) {
+ if (!StringRepresentedInline(std::string(i, 'A'))) {
+ return i;
+ }
+ }
+ ABSL_RAW_LOG(
+ FATAL,
+ "Failed to find a std::string larger than the short std::string optimization");
+ return -1;
+}
+
void BM_InlinedVectorFillString(benchmark::State& state) {
const int len = state.range(0);
- std::string strings[4] = {"a quite long string",
- "another long string",
- "012345678901234567",
- "to cause allocation"};
+ const int no_sso = GetNonShortStringOptimizationSize();
+ std::string strings[4] = {std::string(no_sso, 'A'), std::string(no_sso, 'B'),
+ std::string(no_sso, 'C'), std::string(no_sso, 'D')};
+
for (auto _ : state) {
absl::InlinedVector<std::string, 8> v;
for (int i = 0; i < len; i++) {
@@ -87,10 +103,10 @@ BENCHMARK(BM_InlinedVectorFillString)->Range(0, 1024);
void BM_StdVectorFillString(benchmark::State& state) {
const int len = state.range(0);
- std::string strings[4] = {"a quite long string",
- "another long string",
- "012345678901234567",
- "to cause allocation"};
+ const int no_sso = GetNonShortStringOptimizationSize();
+ std::string strings[4] = {std::string(no_sso, 'A'), std::string(no_sso, 'B'),
+ std::string(no_sso, 'C'), std::string(no_sso, 'D')};
+
for (auto _ : state) {
std::vector<std::string> v;
for (int i = 0; i < len; i++) {
@@ -98,11 +114,6 @@ void BM_StdVectorFillString(benchmark::State& state) {
}
}
state.SetItemsProcessed(static_cast<int64_t>(state.iterations()) * len);
- // The purpose of the benchmark is to verify that inlined vector is
- // efficient when moving is more efficent than copying. To do so, we
- // use strings that are larger than the small std::string optimization.
- ABSL_RAW_CHECK(!StringRepresentedInline(strings[0]),
- "benchmarked with strings that are too small");
}
BENCHMARK(BM_StdVectorFillString)->Range(0, 1024);
diff --git a/absl/container/inlined_vector_test.cc b/absl/container/inlined_vector_test.cc
index 26a7d5bc..f81fad56 100644
--- a/absl/container/inlined_vector_test.cc
+++ b/absl/container/inlined_vector_test.cc
@@ -1763,4 +1763,30 @@ TEST(AllocatorSupportTest, ScopedAllocatorWorks) {
EXPECT_EQ(allocated, 0);
}
+TEST(AllocatorSupportTest, SizeAllocConstructor) {
+ constexpr int inlined_size = 4;
+ using Alloc = CountingAllocator<int>;
+ using AllocVec = absl::InlinedVector<int, inlined_size, Alloc>;
+
+ {
+ auto len = inlined_size / 2;
+ int64_t allocated = 0;
+ auto v = AllocVec(len, Alloc(&allocated));
+
+ // Inline storage used; allocator should not be invoked
+ EXPECT_THAT(allocated, 0);
+ EXPECT_THAT(v, AllOf(SizeIs(len), Each(0)));
+ }
+
+ {
+ auto len = inlined_size * 2;
+ int64_t allocated = 0;
+ auto v = AllocVec(len, Alloc(&allocated));
+
+ // Out of line storage used; allocation of 8 elements expected
+ EXPECT_THAT(allocated, len * sizeof(int));
+ EXPECT_THAT(v, AllOf(SizeIs(len), Each(0)));
+ }
+}
+
} // anonymous namespace
diff --git a/absl/copts.bzl b/absl/copts.bzl
index 20c9b619..0168ac5a 100644
--- a/absl/copts.bzl
+++ b/absl/copts.bzl
@@ -31,7 +31,6 @@ GCC_TEST_FLAGS = [
"-Wno-unused-private-field",
]
-
# Docs on single flags is preceded by a comment.
# Docs on groups of flags is preceded by ###.
diff --git a/absl/debugging/internal/examine_stack.cc b/absl/debugging/internal/examine_stack.cc
index 261daae9..faf88836 100644
--- a/absl/debugging/internal/examine_stack.cc
+++ b/absl/debugging/internal/examine_stack.cc
@@ -46,10 +46,16 @@ void* GetProgramCounter(void* vuc) {
#elif defined(__i386__)
if (14 < ABSL_ARRAYSIZE(context->uc_mcontext.gregs))
return reinterpret_cast<void*>(context->uc_mcontext.gregs[14]);
+#elif defined(__mips__)
+ return reinterpret_cast<void*>(context->uc_mcontext.pc);
#elif defined(__powerpc64__)
return reinterpret_cast<void*>(context->uc_mcontext.gp_regs[32]);
#elif defined(__powerpc__)
return reinterpret_cast<void*>(context->uc_mcontext.regs->nip);
+#elif defined(__s390__) && !defined(__s390x__)
+ return reinterpret_cast<void*>(context->uc_mcontext.psw.addr & 0x7fffffff);
+#elif defined(__s390__) && defined(__s390x__)
+ return reinterpret_cast<void*>(context->uc_mcontext.psw.addr);
#elif defined(__x86_64__)
if (16 < ABSL_ARRAYSIZE(context->uc_mcontext.gregs))
return reinterpret_cast<void*>(context->uc_mcontext.gregs[16]);
diff --git a/absl/debugging/internal/stacktrace_config.h b/absl/debugging/internal/stacktrace_config.h
index 48adfccc..dd713da8 100644
--- a/absl/debugging/internal/stacktrace_config.h
+++ b/absl/debugging/internal/stacktrace_config.h
@@ -21,26 +21,16 @@
#ifndef ABSL_DEBUGGING_INTERNAL_STACKTRACE_CONFIG_H_
#define ABSL_DEBUGGING_INTERNAL_STACKTRACE_CONFIG_H_
-// First, test platforms which only support a stub.
-#if ABSL_STACKTRACE_INL_HEADER
+#if defined(ABSL_STACKTRACE_INL_HEADER)
#error ABSL_STACKTRACE_INL_HEADER cannot be directly set
-#elif defined(__native_client__) || defined(__APPLE__) || \
- defined(__FreeBSD__) || defined(__ANDROID__) || defined(__myriad2__) || \
- defined(__asmjs__) || defined(__wasm__) || defined(__Fuchsia__)
-#define ABSL_STACKTRACE_INL_HEADER \
- "absl/debugging/internal/stacktrace_unimplemented-inl.inc"
-// Next, test for Mips and Windows.
-// TODO(marmstrong): Mips case, remove the check for ABSL_STACKTRACE_INL_HEADER
-#elif defined(__mips__) && !defined(ABSL_STACKTRACE_INL_HEADER)
-#define ABSL_STACKTRACE_INL_HEADER \
- "absl/debugging/internal/stacktrace_unimplemented-inl.inc"
-#elif defined(_WIN32) // windows
+#elif defined(_WIN32)
#define ABSL_STACKTRACE_INL_HEADER \
"absl/debugging/internal/stacktrace_win32-inl.inc"
-// Finally, test NO_FRAME_POINTER.
-#elif !defined(NO_FRAME_POINTER)
+#elif defined(__linux__) && !defined(__ANDROID__)
+
+#if !defined(NO_FRAME_POINTER)
# if defined(__i386__) || defined(__x86_64__)
#define ABSL_STACKTRACE_INL_HEADER \
"absl/debugging/internal/stacktrace_x86-inl.inc"
@@ -53,22 +43,27 @@
# elif defined(__arm__)
#define ABSL_STACKTRACE_INL_HEADER \
"absl/debugging/internal/stacktrace_arm-inl.inc"
+# else
+#define ABSL_STACKTRACE_INL_HEADER \
+ "absl/debugging/internal/stacktrace_unimplemented-inl.inc"
# endif
#else // defined(NO_FRAME_POINTER)
# if defined(__i386__) || defined(__x86_64__) || defined(__aarch64__)
#define ABSL_STACKTRACE_INL_HEADER \
- "absl/debugging/internal/stacktrace_unimplemented-inl.inc"
+ "absl/debugging/internal/stacktrace_generic-inl.inc"
# elif defined(__ppc__) || defined(__PPC__)
-// Use glibc's backtrace.
#define ABSL_STACKTRACE_INL_HEADER \
"absl/debugging/internal/stacktrace_generic-inl.inc"
-# elif defined(__arm__)
-# error stacktrace without frame pointer is not supported on ARM
+# else
+#define ABSL_STACKTRACE_INL_HEADER \
+ "absl/debugging/internal/stacktrace_unimplemented-inl.inc"
# endif
#endif // NO_FRAME_POINTER
-#if !defined(ABSL_STACKTRACE_INL_HEADER)
-#error Not supported yet
+#else
+#define ABSL_STACKTRACE_INL_HEADER \
+ "absl/debugging/internal/stacktrace_unimplemented-inl.inc"
+
#endif
#endif // ABSL_DEBUGGING_INTERNAL_STACKTRACE_CONFIG_H_
diff --git a/absl/memory/BUILD.bazel b/absl/memory/BUILD.bazel
index d5c62265..46f47b12 100644
--- a/absl/memory/BUILD.bazel
+++ b/absl/memory/BUILD.bazel
@@ -18,6 +18,7 @@ load(
"//absl:copts.bzl",
"ABSL_DEFAULT_COPTS",
"ABSL_TEST_COPTS",
+ "ABSL_EXCEPTIONS_FLAG",
)
package(default_visibility = ["//visibility:public"])
@@ -45,3 +46,16 @@ cc_test(
"@com_google_googletest//:gtest_main",
],
)
+
+cc_test(
+ name = "memory_exception_safety_test",
+ srcs = [
+ "memory_exception_safety_test.cc",
+ ],
+ copts = ABSL_TEST_COPTS + ABSL_EXCEPTIONS_FLAG,
+ deps = [
+ ":memory",
+ "//absl/base:exception_safety_testing",
+ "@com_google_googletest//:gtest_main",
+ ],
+)
diff --git a/absl/memory/CMakeLists.txt b/absl/memory/CMakeLists.txt
index 21bfc87e..5958f5c5 100644
--- a/absl/memory/CMakeLists.txt
+++ b/absl/memory/CMakeLists.txt
@@ -49,4 +49,23 @@ absl_test(
)
+# test memory_exception_safety_test
+set(MEMORY_EXCEPTION_SAFETY_TEST_SRC "memory_exception_safety_test.cc")
+set(MEMORY_EXCEPTION_SAFETY_TEST_PUBLIC_LIBRARIES
+ absl::memory
+ absl_base_internal_exception_safety_testing
+)
+
+absl_test(
+ TARGET
+ memory_exception_safety_test
+ SOURCES
+ ${MEMORY_EXCEPTION_SAFETY_TEST_SRC}
+ PUBLIC_LIBRARIES
+ ${MEMORY_EXCEPTION_SAFETY_TEST_PUBLIC_LIBRARIES}
+ PRIVATE_COMPILE_FLAGS
+ ${ABSL_EXCEPTIONS_FLAG}
+)
+
+
diff --git a/absl/memory/memory.h b/absl/memory/memory.h
index cd818cff..c43e1566 100644
--- a/absl/memory/memory.h
+++ b/absl/memory/memory.h
@@ -636,6 +636,39 @@ struct default_allocator_is_nothrow : std::true_type {};
struct default_allocator_is_nothrow : std::false_type {};
#endif
+namespace memory_internal {
+// TODO(b110200014): Implement proper backports
+template <typename ForwardIt>
+void DefaultConstruct(ForwardIt it) {
+ using value_type = typename std::iterator_traits<ForwardIt>::value_type;
+ ::new (static_cast<void*>(std::addressof(*it))) value_type;
+} // namespace memory_internal
+
+#ifdef ABSL_HAVE_EXCEPTIONS
+template <typename ForwardIt, typename Size>
+void uninitialized_default_construct_n(ForwardIt first, Size size) {
+ for (ForwardIt cur = first; size > 0; static_cast<void>(++cur), --size) {
+ try {
+ absl::memory_internal::DefaultConstruct(cur);
+ } catch (...) {
+ using value_type = typename std::iterator_traits<ForwardIt>::value_type;
+ for (; first != cur; ++first) {
+ first->~value_type();
+ }
+ throw;
+ }
+ }
+}
+#else // ABSL_HAVE_EXCEPTIONS
+template <typename ForwardIt, typename Size>
+void uninitialized_default_construct_n(ForwardIt first, Size size) {
+ for (; size > 0; static_cast<void>(++first), --size) {
+ absl::memory_internal::DefaultConstruct(first);
+ }
+}
+#endif // ABSL_HAVE_EXCEPTIONS
+} // namespace memory_internal
+
} // namespace absl
#endif // ABSL_MEMORY_MEMORY_H_
diff --git a/absl/memory/memory_exception_safety_test.cc b/absl/memory/memory_exception_safety_test.cc
new file mode 100644
index 00000000..fb8b561d
--- /dev/null
+++ b/absl/memory/memory_exception_safety_test.cc
@@ -0,0 +1,63 @@
+// Copyright 2018 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/memory/memory.h"
+
+#include "gtest/gtest.h"
+#include "absl/base/internal/exception_safety_testing.h"
+
+namespace absl {
+namespace {
+
+constexpr int kLength = 50;
+using Thrower = testing::ThrowingValue<testing::TypeSpec::kEverythingThrows>;
+using ThrowerStorage =
+ absl::aligned_storage_t<sizeof(Thrower), alignof(Thrower)>;
+using ThrowerList = std::array<ThrowerStorage, kLength>;
+
+TEST(MakeUnique, CheckForLeaks) {
+ constexpr int kValue = 321;
+ auto tester = testing::MakeExceptionSafetyTester()
+ .WithInitialValue(Thrower(kValue))
+ // Ensures make_unique does not modify the input. The real
+ // test, though, is ConstructorTracker checking for leaks.
+ .WithInvariants(testing::strong_guarantee);
+
+ EXPECT_TRUE(tester.Test([](Thrower* thrower) {
+ static_cast<void>(absl::make_unique<Thrower>(*thrower));
+ }));
+
+ EXPECT_TRUE(tester.Test([](Thrower* thrower) {
+ static_cast<void>(absl::make_unique<Thrower>(std::move(*thrower)));
+ }));
+
+ // Test T[n] overload
+ EXPECT_TRUE(tester.Test([&](Thrower*) {
+ static_cast<void>(absl::make_unique<Thrower[]>(kLength));
+ }));
+}
+
+TEST(MemoryInternal, UninitDefaultConstructNNonTrivial) {
+ EXPECT_TRUE(testing::MakeExceptionSafetyTester()
+ .WithInitialValue(ThrowerList{})
+ .WithOperation([&](ThrowerList* list_ptr) {
+ absl::memory_internal::uninitialized_default_construct_n(
+ list_ptr->data(), kLength);
+ })
+ .WithInvariants([&](...) { return true; })
+ .Test());
+}
+
+} // namespace
+} // namespace absl
diff --git a/absl/memory/memory_test.cc b/absl/memory/memory_test.cc
index dee9b486..8ff1945d 100644
--- a/absl/memory/memory_test.cc
+++ b/absl/memory/memory_test.cc
@@ -611,4 +611,47 @@ TEST(AllocatorNoThrowTest, CustomAllocator) {
EXPECT_FALSE(absl::allocator_is_nothrow<UnspecifiedAllocator>::value);
}
+TEST(MemoryInternal, UninitDefaultConstructNTrivial) {
+ constexpr int kInitialValue = 123;
+ constexpr int kExpectedValue = kInitialValue; // Expect no-op behavior
+ constexpr int len = 5;
+
+ struct TestObj {
+ int val;
+ };
+ static_assert(absl::is_trivially_default_constructible<TestObj>::value, "");
+ static_assert(absl::is_trivially_destructible<TestObj>::value, "");
+
+ TestObj objs[len];
+ for (auto& obj : objs) {
+ obj.val = kInitialValue;
+ }
+
+ absl::memory_internal::uninitialized_default_construct_n(objs, len);
+ for (auto& obj : objs) {
+ EXPECT_EQ(obj.val, kExpectedValue);
+ }
+}
+
+TEST(MemoryInternal, UninitDefaultConstructNNonTrivial) {
+ constexpr int kInitialValue = 123;
+ constexpr int kExpectedValue = 0; // Expect value-construction behavior
+ constexpr int len = 5;
+
+ struct TestObj {
+ int val{kExpectedValue};
+ };
+ static_assert(absl::is_trivially_destructible<TestObj>::value, "");
+
+ TestObj objs[len];
+ for (auto& obj : objs) {
+ obj.val = kInitialValue;
+ }
+
+ absl::memory_internal::uninitialized_default_construct_n(objs, len);
+ for (auto& obj : objs) {
+ EXPECT_EQ(obj.val, kExpectedValue);
+ }
+}
+
} // namespace
diff --git a/absl/meta/type_traits.h b/absl/meta/type_traits.h
index 88af17c3..c3e01fe2 100644
--- a/absl/meta/type_traits.h
+++ b/absl/meta/type_traits.h
@@ -369,4 +369,6 @@ struct IsHashEnabled
} // namespace type_traits_internal
} // namespace absl
+
+
#endif // ABSL_META_TYPE_TRAITS_H_
diff --git a/absl/numeric/int128.cc b/absl/numeric/int128.cc
index 3688e5ef..cd79534f 100644
--- a/absl/numeric/int128.cc
+++ b/absl/numeric/int128.cc
@@ -223,3 +223,29 @@ std::ostream& operator<<(std::ostream& os, uint128 v) {
}
} // namespace absl
+
+namespace std {
+constexpr bool numeric_limits<absl::uint128>::is_specialized;
+constexpr bool numeric_limits<absl::uint128>::is_signed;
+constexpr bool numeric_limits<absl::uint128>::is_integer;
+constexpr bool numeric_limits<absl::uint128>::is_exact;
+constexpr bool numeric_limits<absl::uint128>::has_infinity;
+constexpr bool numeric_limits<absl::uint128>::has_quiet_NaN;
+constexpr bool numeric_limits<absl::uint128>::has_signaling_NaN;
+constexpr float_denorm_style numeric_limits<absl::uint128>::has_denorm;
+constexpr bool numeric_limits<absl::uint128>::has_denorm_loss;
+constexpr float_round_style numeric_limits<absl::uint128>::round_style;
+constexpr bool numeric_limits<absl::uint128>::is_iec559;
+constexpr bool numeric_limits<absl::uint128>::is_bounded;
+constexpr bool numeric_limits<absl::uint128>::is_modulo;
+constexpr int numeric_limits<absl::uint128>::digits;
+constexpr int numeric_limits<absl::uint128>::digits10;
+constexpr int numeric_limits<absl::uint128>::max_digits10;
+constexpr int numeric_limits<absl::uint128>::radix;
+constexpr int numeric_limits<absl::uint128>::min_exponent;
+constexpr int numeric_limits<absl::uint128>::min_exponent10;
+constexpr int numeric_limits<absl::uint128>::max_exponent;
+constexpr int numeric_limits<absl::uint128>::max_exponent10;
+constexpr bool numeric_limits<absl::uint128>::traps;
+constexpr bool numeric_limits<absl::uint128>::tinyness_before;
+} // namespace std
diff --git a/absl/numeric/int128.h b/absl/numeric/int128.h
index bc7dbb47..e4f39c30 100644
--- a/absl/numeric/int128.h
+++ b/absl/numeric/int128.h
@@ -219,21 +219,69 @@ std::ostream& operator<<(std::ostream& os, uint128 v);
// TODO(strel) add operator>>(std::istream&, uint128)
+constexpr uint128 Uint128Max() {
+ return uint128(std::numeric_limits<uint64_t>::max(),
+ std::numeric_limits<uint64_t>::max());
+}
+
+} // namespace absl
+
+// Specialized numeric_limits for uint128.
+namespace std {
+template <>
+class numeric_limits<absl::uint128> {
+ public:
+ static constexpr bool is_specialized = true;
+ static constexpr bool is_signed = false;
+ static constexpr bool is_integer = true;
+ static constexpr bool is_exact = true;
+ static constexpr bool has_infinity = false;
+ static constexpr bool has_quiet_NaN = false;
+ static constexpr bool has_signaling_NaN = false;
+ static constexpr float_denorm_style has_denorm = denorm_absent;
+ static constexpr bool has_denorm_loss = false;
+ static constexpr float_round_style round_style = round_toward_zero;
+ static constexpr bool is_iec559 = false;
+ static constexpr bool is_bounded = true;
+ static constexpr bool is_modulo = true;
+ static constexpr int digits = 128;
+ static constexpr int digits10 = 38;
+ static constexpr int max_digits10 = 0;
+ static constexpr int radix = 2;
+ static constexpr int min_exponent = 0;
+ static constexpr int min_exponent10 = 0;
+ static constexpr int max_exponent = 0;
+ static constexpr int max_exponent10 = 0;
+#ifdef ABSL_HAVE_INTRINSIC_INT128
+ static constexpr bool traps = numeric_limits<unsigned __int128>::traps;
+#else // ABSL_HAVE_INTRINSIC_INT128
+ static constexpr bool traps = numeric_limits<uint64_t>::traps;
+#endif // ABSL_HAVE_INTRINSIC_INT128
+ static constexpr bool tinyness_before = false;
+
+ static constexpr absl::uint128 min() { return 0; }
+ static constexpr absl::uint128 lowest() { return 0; }
+ static constexpr absl::uint128 max() { return absl::Uint128Max(); }
+ static constexpr absl::uint128 epsilon() { return 0; }
+ static constexpr absl::uint128 round_error() { return 0; }
+ static constexpr absl::uint128 infinity() { return 0; }
+ static constexpr absl::uint128 quiet_NaN() { return 0; }
+ static constexpr absl::uint128 signaling_NaN() { return 0; }
+ static constexpr absl::uint128 denorm_min() { return 0; }
+};
+} // namespace std
+
// TODO(absl-team): Implement signed 128-bit type
// --------------------------------------------------------------------------
// Implementation details follow
// --------------------------------------------------------------------------
+namespace absl {
constexpr uint128 MakeUint128(uint64_t high, uint64_t low) {
return uint128(high, low);
}
-constexpr uint128 Uint128Max() {
- return uint128(std::numeric_limits<uint64_t>::max(),
- std::numeric_limits<uint64_t>::max());
-}
-
// Assignment from integer types.
inline uint128& uint128::operator=(int v) { return *this = uint128(v); }
diff --git a/absl/numeric/int128_test.cc b/absl/numeric/int128_test.cc
index 79bcca90..1eb3e0ec 100644
--- a/absl/numeric/int128_test.cc
+++ b/absl/numeric/int128_test.cc
@@ -428,4 +428,15 @@ TEST(Uint128, ConstexprTest) {
EXPECT_EQ(minus_two, absl::MakeUint128(-1, -2));
}
+TEST(Uint128, NumericLimitsTest) {
+ static_assert(std::numeric_limits<absl::uint128>::is_specialized, "");
+ static_assert(!std::numeric_limits<absl::uint128>::is_signed, "");
+ static_assert(std::numeric_limits<absl::uint128>::is_integer, "");
+ EXPECT_EQ(static_cast<int>(128 * std::log10(2)),
+ std::numeric_limits<absl::uint128>::digits10);
+ EXPECT_EQ(0, std::numeric_limits<absl::uint128>::min());
+ EXPECT_EQ(0, std::numeric_limits<absl::uint128>::lowest());
+ EXPECT_EQ(absl::Uint128Max(), std::numeric_limits<absl::uint128>::max());
+}
+
} // namespace
diff --git a/absl/strings/BUILD.bazel b/absl/strings/BUILD.bazel
index f06bdc0d..3b1e0675 100644
--- a/absl/strings/BUILD.bazel
+++ b/absl/strings/BUILD.bazel
@@ -32,7 +32,12 @@ cc_library(
name = "strings",
srcs = [
"ascii.cc",
+ "charconv.cc",
"escaping.cc",
+ "internal/charconv_bigint.cc",
+ "internal/charconv_bigint.h",
+ "internal/charconv_parse.cc",
+ "internal/charconv_parse.h",
"internal/memutil.cc",
"internal/memutil.h",
"internal/stl_type_traits.h",
@@ -48,6 +53,7 @@ cc_library(
],
hdrs = [
"ascii.h",
+ "charconv.h",
"escaping.h",
"match.h",
"numbers.h",
@@ -144,11 +150,6 @@ cc_test(
size = "small",
srcs = ["ascii_test.cc"],
copts = ABSL_TEST_COPTS,
- tags = [
- "no_test_android_arm",
- "no_test_android_arm64",
- "no_test_android_x86",
- ],
visibility = ["//visibility:private"],
deps = [
":strings",
@@ -398,12 +399,6 @@ cc_test(
"numbers_test.cc",
],
copts = ABSL_TEST_COPTS,
- tags = [
- "no_test_android_arm",
- "no_test_android_arm64",
- "no_test_android_x86",
- "no_test_loonix",
- ],
visibility = ["//visibility:private"],
deps = [
":strings",
@@ -414,6 +409,19 @@ cc_test(
)
cc_test(
+ name = "numbers_benchmark",
+ srcs = ["numbers_benchmark.cc"],
+ copts = ABSL_TEST_COPTS,
+ tags = ["benchmark"],
+ visibility = ["//visibility:private"],
+ deps = [
+ ":strings",
+ "//absl/base",
+ "@com_github_google_benchmark//:benchmark_main",
+ ],
+)
+
+cc_test(
name = "strip_test",
size = "small",
srcs = ["strip_test.cc"],
@@ -429,11 +437,6 @@ cc_test(
name = "char_map_test",
srcs = ["internal/char_map_test.cc"],
copts = ABSL_TEST_COPTS,
- tags = [
- "no_test_android_arm",
- "no_test_android_arm64",
- "no_test_android_x86",
- ],
deps = [
":internal",
"@com_google_googletest//:gtest_main",
@@ -450,3 +453,197 @@ cc_test(
"@com_github_google_benchmark//:benchmark_main",
],
)
+
+cc_test(
+ name = "charconv_test",
+ srcs = ["charconv_test.cc"],
+ copts = ABSL_TEST_COPTS,
+ deps = [
+ ":strings",
+ "//absl/base",
+ "@com_google_googletest//:gtest_main",
+ ],
+)
+
+cc_test(
+ name = "charconv_parse_test",
+ srcs = [
+ "internal/charconv_parse.h",
+ "internal/charconv_parse_test.cc",
+ ],
+ copts = ABSL_TEST_COPTS,
+ deps = [
+ ":strings",
+ "//absl/base",
+ "@com_google_googletest//:gtest_main",
+ ],
+)
+
+cc_test(
+ name = "charconv_bigint_test",
+ srcs = [
+ "internal/charconv_bigint.h",
+ "internal/charconv_bigint_test.cc",
+ "internal/charconv_parse.h",
+ ],
+ copts = ABSL_TEST_COPTS,
+ deps = [
+ ":strings",
+ "//absl/base",
+ "@com_google_googletest//:gtest_main",
+ ],
+)
+
+cc_test(
+ name = "charconv_benchmark",
+ srcs = [
+ "charconv_benchmark.cc",
+ ],
+ tags = [
+ "benchmark",
+ ],
+ deps = [
+ ":strings",
+ "//absl/base",
+ "@com_github_google_benchmark//:benchmark_main",
+ ],
+)
+
+cc_library(
+ name = "str_format",
+ hdrs = [
+ "str_format.h",
+ ],
+ copts = ABSL_DEFAULT_COPTS,
+ deps = [
+ ":str_format_internal",
+ ],
+)
+
+cc_library(
+ name = "str_format_internal",
+ srcs = [
+ "internal/str_format/arg.cc",
+ "internal/str_format/bind.cc",
+ "internal/str_format/extension.cc",
+ "internal/str_format/float_conversion.cc",
+ "internal/str_format/output.cc",
+ "internal/str_format/parser.cc",
+ ],
+ hdrs = [
+ "internal/str_format/arg.h",
+ "internal/str_format/bind.h",
+ "internal/str_format/checker.h",
+ "internal/str_format/extension.h",
+ "internal/str_format/float_conversion.h",
+ "internal/str_format/output.h",
+ "internal/str_format/parser.h",
+ ],
+ copts = ABSL_DEFAULT_COPTS,
+ visibility = ["//visibility:private"],
+ deps = [
+ ":strings",
+ "//absl/base:core_headers",
+ "//absl/container:inlined_vector",
+ "//absl/meta:type_traits",
+ "//absl/numeric:int128",
+ "//absl/types:span",
+ ],
+)
+
+cc_test(
+ name = "str_format_test",
+ srcs = ["str_format_test.cc"],
+ copts = ABSL_TEST_COPTS,
+ visibility = ["//visibility:private"],
+ deps = [
+ ":str_format",
+ ":strings",
+ "//absl/base:core_headers",
+ "@com_google_googletest//:gtest_main",
+ ],
+)
+
+cc_test(
+ name = "str_format_extension_test",
+ srcs = [
+ "internal/str_format/extension_test.cc",
+ ],
+ copts = ABSL_TEST_COPTS,
+ visibility = ["//visibility:private"],
+ deps = [
+ ":str_format",
+ ":str_format_internal",
+ "@com_google_googletest//:gtest_main",
+ ],
+)
+
+cc_test(
+ name = "str_format_arg_test",
+ srcs = ["internal/str_format/arg_test.cc"],
+ copts = ABSL_TEST_COPTS,
+ visibility = ["//visibility:private"],
+ deps = [
+ ":str_format",
+ ":str_format_internal",
+ "@com_google_googletest//:gtest_main",
+ ],
+)
+
+cc_test(
+ name = "str_format_bind_test",
+ srcs = ["internal/str_format/bind_test.cc"],
+ copts = ABSL_TEST_COPTS,
+ visibility = ["//visibility:private"],
+ deps = [
+ ":str_format_internal",
+ "@com_google_googletest//:gtest_main",
+ ],
+)
+
+cc_test(
+ name = "str_format_checker_test",
+ srcs = ["internal/str_format/checker_test.cc"],
+ copts = ABSL_TEST_COPTS,
+ visibility = ["//visibility:private"],
+ deps = [
+ ":str_format",
+ "@com_google_googletest//:gtest_main",
+ ],
+)
+
+cc_test(
+ name = "str_format_convert_test",
+ size = "small",
+ srcs = ["internal/str_format/convert_test.cc"],
+ copts = ABSL_TEST_COPTS,
+ visibility = ["//visibility:private"],
+ deps = [
+ ":str_format_internal",
+ "//absl/numeric:int128",
+ "@com_google_googletest//:gtest_main",
+ ],
+)
+
+cc_test(
+ name = "str_format_output_test",
+ srcs = ["internal/str_format/output_test.cc"],
+ copts = ABSL_TEST_COPTS,
+ visibility = ["//visibility:private"],
+ deps = [
+ ":str_format_internal",
+ "@com_google_googletest//:gtest_main",
+ ],
+)
+
+cc_test(
+ name = "str_format_parser_test",
+ srcs = ["internal/str_format/parser_test.cc"],
+ copts = ABSL_TEST_COPTS,
+ visibility = ["//visibility:private"],
+ deps = [
+ ":str_format_internal",
+ "//absl/base:core_headers",
+ "@com_google_googletest//:gtest_main",
+ ],
+)
diff --git a/absl/strings/CMakeLists.txt b/absl/strings/CMakeLists.txt
index 9dc47328..cd122134 100644
--- a/absl/strings/CMakeLists.txt
+++ b/absl/strings/CMakeLists.txt
@@ -17,6 +17,7 @@
list(APPEND STRINGS_PUBLIC_HEADERS
"ascii.h"
+ "charconv.h"
"escaping.h"
"match.h"
"numbers.h"
@@ -33,6 +34,8 @@ list(APPEND STRINGS_PUBLIC_HEADERS
list(APPEND STRINGS_INTERNAL_HEADERS
"internal/bits.h"
"internal/char_map.h"
+ "internal/charconv_bigint.h"
+ "internal/charconv_parse.h"
"internal/memutil.h"
"internal/ostringstream.h"
"internal/resize_uninitialized.h"
@@ -47,7 +50,10 @@ list(APPEND STRINGS_INTERNAL_HEADERS
# add string library
list(APPEND STRINGS_SRC
"ascii.cc"
+ "charconv.cc"
"escaping.cc"
+ "internal/charconv_bigint.cc"
+ "internal/charconv_parse.cc"
"internal/memutil.cc"
"internal/memutil.h"
"internal/utf8.cc"
@@ -75,6 +81,56 @@ absl_library(
strings
)
+# add str_format library
+absl_header_library(
+ TARGET
+ absl_str_format
+ PUBLIC_LIBRARIES
+ str_format_internal
+ EXPORT_NAME
+ str_format
+)
+
+# str_format_internal
+absl_library(
+ TARGET
+ str_format_internal
+ SOURCES
+ "internal/str_format/arg.cc"
+ "internal/str_format/bind.cc"
+ "internal/str_format/extension.cc"
+ "internal/str_format/float_conversion.cc"
+ "internal/str_format/output.cc"
+ "internal/str_format/parser.cc"
+ "internal/str_format/arg.h"
+ "internal/str_format/bind.h"
+ "internal/str_format/checker.h"
+ "internal/str_format/extension.h"
+ "internal/str_format/float_conversion.h"
+ "internal/str_format/output.h"
+ "internal/str_format/parser.h"
+ PUBLIC_LIBRARIES
+ str_format_extension_internal
+ absl::strings
+ absl::base
+ absl::numeric
+ absl::container
+ absl::span
+)
+
+# str_format_extension_internal
+absl_library(
+ TARGET
+ str_format_extension_internal
+ SOURCES
+ "internal/str_format/extension.cc"
+ "internal/str_format/extension.h"
+ "internal/str_format/output.cc"
+ "internal/str_format/output.h"
+ PUBLIC_LIBRARIES
+ absl::base
+ absl::strings
+)
#
## TESTS
@@ -301,5 +357,108 @@ absl_test(
)
+# test charconv_test
+set(CHARCONV_TEST_SRC "charconv_test.cc")
+set(CHARCONV_TEST_PUBLIC_LIBRARIES absl::strings)
+
+absl_test(
+ TARGET
+ charconv_test
+ SOURCES
+ ${CHARCONV_TEST_SRC}
+ PUBLIC_LIBRARIES
+ ${CHARCONV_TEST_PUBLIC_LIBRARIES}
+)
+
+
+# test charconv_parse_test
+set(CHARCONV_PARSE_TEST_SRC "internal/charconv_parse_test.cc")
+set(CHARCONV_PARSE_TEST_PUBLIC_LIBRARIES absl::strings)
+
+absl_test(
+ TARGET
+ charconv_parse_test
+ SOURCES
+ ${CHARCONV_PARSE_TEST_SRC}
+ PUBLIC_LIBRARIES
+ ${CHARCONV_PARSE_TEST_PUBLIC_LIBRARIES}
+)
+
+
+# test charconv_bigint_test
+set(CHARCONV_BIGINT_TEST_SRC "internal/charconv_bigint_test.cc")
+set(CHARCONV_BIGINT_TEST_PUBLIC_LIBRARIES absl::strings)
+
+absl_test(
+ TARGET
+ charconv_bigint_test
+ SOURCES
+ ${CHARCONV_BIGINT_TEST_SRC}
+ PUBLIC_LIBRARIES
+ ${CHARCONV_BIGINT_TEST_PUBLIC_LIBRARIES}
+)
+# test str_format_test
+absl_test(
+ TARGET
+ str_format_test
+ SOURCES
+ "str_format_test.cc"
+ PUBLIC_LIBRARIES
+ absl::base
+ absl::str_format
+ absl::strings
+)
+
+# test str_format_bind_test
+absl_test(
+ TARGET
+ str_format_bind_test
+ SOURCES
+ "internal/str_format/bind_test.cc"
+ PUBLIC_LIBRARIES
+ str_format_internal
+)
+
+# test str_format_checker_test
+absl_test(
+ TARGET
+ str_format_checker_test
+ SOURCES
+ "internal/str_format/checker_test.cc"
+ PUBLIC_LIBRARIES
+ absl::str_format
+)
+
+# test str_format_convert_test
+absl_test(
+ TARGET
+ str_format_convert_test
+ SOURCES
+ "internal/str_format/convert_test.cc"
+ PUBLIC_LIBRARIES
+ str_format_internal
+ absl::numeric
+)
+
+# test str_format_output_test
+absl_test(
+ TARGET
+ str_format_output_test
+ SOURCES
+ "internal/str_format/output_test.cc"
+ PUBLIC_LIBRARIES
+ str_format_extension_internal
+)
+
+# test str_format_parser_test
+absl_test(
+ TARGET
+ str_format_parser_test
+ SOURCES
+ "internal/str_format/parser_test.cc"
+ PUBLIC_LIBRARIES
+ str_format_internal
+ absl::base
+)
diff --git a/absl/strings/charconv.cc b/absl/strings/charconv.cc
new file mode 100644
index 00000000..08c3947e
--- /dev/null
+++ b/absl/strings/charconv.cc
@@ -0,0 +1,982 @@
+// Copyright 2018 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/strings/charconv.h"
+
+#include <algorithm>
+#include <cassert>
+#include <cmath>
+#include <cstring>
+
+#include "absl/base/casts.h"
+#include "absl/numeric/int128.h"
+#include "absl/strings/internal/bits.h"
+#include "absl/strings/internal/charconv_bigint.h"
+#include "absl/strings/internal/charconv_parse.h"
+
+// The macro ABSL_BIT_PACK_FLOATS is defined on x86-64, where IEEE floating
+// point numbers have the same endianness in memory as a bitfield struct
+// containing the corresponding parts.
+//
+// When set, we replace calls to ldexp() with manual bit packing, which is
+// faster and is unaffected by floating point environment.
+#ifdef ABSL_BIT_PACK_FLOATS
+#error ABSL_BIT_PACK_FLOATS cannot be directly set
+#elif defined(__x86_64__) || defined(_M_X64)
+#define ABSL_BIT_PACK_FLOATS 1
+#endif
+
+// A note about subnormals:
+//
+// The code below talks about "normals" and "subnormals". A normal IEEE float
+// has a fixed-width mantissa and power of two exponent. For example, a normal
+// `double` has a 53-bit mantissa. Because the high bit is always 1, it is not
+// stored in the representation. The implicit bit buys an extra bit of
+// resolution in the datatype.
+//
+// The downside of this scheme is that there is a large gap between DBL_MIN and
+// zero. (Large, at least, relative to the different between DBL_MIN and the
+// next representable number). This gap is softened by the "subnormal" numbers,
+// which have the same power-of-two exponent as DBL_MIN, but no implicit 53rd
+// bit. An all-bits-zero exponent in the encoding represents subnormals. (Zero
+// is represented as a subnormal with an all-bits-zero mantissa.)
+//
+// The code below, in calculations, represents the mantissa as a uint64_t. The
+// end result normally has the 53rd bit set. It represents subnormals by using
+// narrower mantissas.
+
+namespace absl {
+namespace {
+
+template <typename FloatType>
+struct FloatTraits;
+
+template <>
+struct FloatTraits<double> {
+ // The number of mantissa bits in the given float type. This includes the
+ // implied high bit.
+ static constexpr int kTargetMantissaBits = 53;
+
+ // The largest supported IEEE exponent, in our integral mantissa
+ // representation.
+ //
+ // If `m` is the largest possible int kTargetMantissaBits bits wide, then
+ // m * 2**kMaxExponent is exactly equal to DBL_MAX.
+ static constexpr int kMaxExponent = 971;
+
+ // The smallest supported IEEE normal exponent, in our integral mantissa
+ // representation.
+ //
+ // If `m` is the smallest possible int kTargetMantissaBits bits wide, then
+ // m * 2**kMinNormalExponent is exactly equal to DBL_MIN.
+ static constexpr int kMinNormalExponent = -1074;
+
+ static double MakeNan(const char* tagp) {
+ // Support nan no matter which namespace it's in. Some platforms
+ // incorrectly don't put it in namespace std.
+ using namespace std; // NOLINT
+ return nan(tagp);
+ }
+
+ // Builds a nonzero floating point number out of the provided parts.
+ //
+ // This is intended to do the same operation as ldexp(mantissa, exponent),
+ // but using purely integer math, to avoid -ffastmath and floating
+ // point environment issues. Using type punning is also faster. We fall back
+ // to ldexp on a per-platform basis for portability.
+ //
+ // `exponent` must be between kMinNormalExponent and kMaxExponent.
+ //
+ // `mantissa` must either be exactly kTargetMantissaBits wide, in which case
+ // a normal value is made, or it must be less narrow than that, in which case
+ // `exponent` must be exactly kMinNormalExponent, and a subnormal value is
+ // made.
+ static double Make(uint64_t mantissa, int exponent, bool sign) {
+#ifndef ABSL_BIT_PACK_FLOATS
+ // Support ldexp no matter which namespace it's in. Some platforms
+ // incorrectly don't put it in namespace std.
+ using namespace std; // NOLINT
+ return sign ? -ldexp(mantissa, exponent) : ldexp(mantissa, exponent);
+#else
+ constexpr uint64_t kMantissaMask =
+ (uint64_t(1) << (kTargetMantissaBits - 1)) - 1;
+ uint64_t dbl = static_cast<uint64_t>(sign) << 63;
+ if (mantissa > kMantissaMask) {
+ // Normal value.
+ // Adjust by 1023 for the exponent representation bias, and an additional
+ // 52 due to the implied decimal point in the IEEE mantissa represenation.
+ dbl += uint64_t{exponent + 1023u + kTargetMantissaBits - 1} << 52;
+ mantissa &= kMantissaMask;
+ } else {
+ // subnormal value
+ assert(exponent == kMinNormalExponent);
+ }
+ dbl += mantissa;
+ return absl::bit_cast<double>(dbl);
+#endif // ABSL_BIT_PACK_FLOATS
+ }
+};
+
+// Specialization of floating point traits for the `float` type. See the
+// FloatTraits<double> specialization above for meaning of each of the following
+// members and methods.
+template <>
+struct FloatTraits<float> {
+ static constexpr int kTargetMantissaBits = 24;
+ static constexpr int kMaxExponent = 104;
+ static constexpr int kMinNormalExponent = -149;
+ static float MakeNan(const char* tagp) {
+ // Support nanf no matter which namespace it's in. Some platforms
+ // incorrectly don't put it in namespace std.
+ using namespace std; // NOLINT
+ return nanf(tagp);
+ }
+ static float Make(uint32_t mantissa, int exponent, bool sign) {
+#ifndef ABSL_BIT_PACK_FLOATS
+ // Support ldexpf no matter which namespace it's in. Some platforms
+ // incorrectly don't put it in namespace std.
+ using namespace std; // NOLINT
+ return sign ? -ldexpf(mantissa, exponent) : ldexpf(mantissa, exponent);
+#else
+ constexpr uint32_t kMantissaMask =
+ (uint32_t(1) << (kTargetMantissaBits - 1)) - 1;
+ uint32_t flt = static_cast<uint32_t>(sign) << 31;
+ if (mantissa > kMantissaMask) {
+ // Normal value.
+ // Adjust by 127 for the exponent representation bias, and an additional
+ // 23 due to the implied decimal point in the IEEE mantissa represenation.
+ flt += uint32_t{exponent + 127u + kTargetMantissaBits - 1} << 23;
+ mantissa &= kMantissaMask;
+ } else {
+ // subnormal value
+ assert(exponent == kMinNormalExponent);
+ }
+ flt += mantissa;
+ return absl::bit_cast<float>(flt);
+#endif // ABSL_BIT_PACK_FLOATS
+ }
+};
+
+// Decimal-to-binary conversions require coercing powers of 10 into a mantissa
+// and a power of 2. The two helper functions Power10Mantissa(n) and
+// Power10Exponent(n) perform this task. Together, these represent a hand-
+// rolled floating point value which is equal to or just less than 10**n.
+//
+// The return values satisfy two range guarantees:
+//
+// Power10Mantissa(n) * 2**Power10Exponent(n) <= 10**n
+// < (Power10Mantissa(n) + 1) * 2**Power10Exponent(n)
+//
+// 2**63 <= Power10Mantissa(n) < 2**64.
+//
+// Lookups into the power-of-10 table must first check the Power10Overflow() and
+// Power10Underflow() functions, to avoid out-of-bounds table access.
+//
+// Indexes into these tables are biased by -kPower10TableMin, and the table has
+// values in the range [kPower10TableMin, kPower10TableMax].
+extern const uint64_t kPower10MantissaTable[];
+extern const int16_t kPower10ExponentTable[];
+
+// The smallest allowed value for use with the Power10Mantissa() and
+// Power10Exponent() functions below. (If a smaller exponent is needed in
+// calculations, the end result is guaranteed to underflow.)
+constexpr int kPower10TableMin = -342;
+
+// The largest allowed value for use with the Power10Mantissa() and
+// Power10Exponent() functions below. (If a smaller exponent is needed in
+// calculations, the end result is guaranteed to overflow.)
+constexpr int kPower10TableMax = 308;
+
+uint64_t Power10Mantissa(int n) {
+ return kPower10MantissaTable[n - kPower10TableMin];
+}
+
+int Power10Exponent(int n) {
+ return kPower10ExponentTable[n - kPower10TableMin];
+}
+
+// Returns true if n is large enough that 10**n always results in an IEEE
+// overflow.
+bool Power10Overflow(int n) { return n > kPower10TableMax; }
+
+// Returns true if n is small enough that 10**n times a ParsedFloat mantissa
+// always results in an IEEE underflow.
+bool Power10Underflow(int n) { return n < kPower10TableMin; }
+
+// Returns true if Power10Mantissa(n) * 2**Power10Exponent(n) is exactly equal
+// to 10**n numerically. Put another way, this returns true if there is no
+// truncation error in Power10Mantissa(n).
+bool Power10Exact(int n) { return n >= 0 && n <= 27; }
+
+// Sentinel exponent values for representing numbers too large or too close to
+// zero to represent in a double.
+constexpr int kOverflow = 99999;
+constexpr int kUnderflow = -99999;
+
+// Struct representing the calculated conversion result of a positive (nonzero)
+// floating point number.
+//
+// The calculated number is mantissa * 2**exponent (mantissa is treated as an
+// integer.) `mantissa` is chosen to be the correct width for the IEEE float
+// representation being calculated. (`mantissa` will always have the same bit
+// width for normal values, and narrower bit widths for subnormals.)
+//
+// If the result of conversion was an underflow or overflow, exponent is set
+// to kUnderflow or kOverflow.
+struct CalculatedFloat {
+ uint64_t mantissa = 0;
+ int exponent = 0;
+};
+
+// Returns the bit width of the given uint128. (Equivalently, returns 128
+// minus the number of leading zero bits.)
+int BitWidth(uint128 value) {
+ if (Uint128High64(value) == 0) {
+ return 64 - strings_internal::CountLeadingZeros64(Uint128Low64(value));
+ }
+ return 128 - strings_internal::CountLeadingZeros64(Uint128High64(value));
+}
+
+// Calculates how far to the right a mantissa needs to be shifted to create a
+// properly adjusted mantissa for an IEEE floating point number.
+//
+// `mantissa_width` is the bit width of the mantissa to be shifted, and
+// `binary_exponent` is the exponent of the number before the shift.
+//
+// This accounts for subnormal values, and will return a larger-than-normal
+// shift if binary_exponent would otherwise be too low.
+template <typename FloatType>
+int NormalizedShiftSize(int mantissa_width, int binary_exponent) {
+ const int normal_shift =
+ mantissa_width - FloatTraits<FloatType>::kTargetMantissaBits;
+ const int minimum_shift =
+ FloatTraits<FloatType>::kMinNormalExponent - binary_exponent;
+ return std::max(normal_shift, minimum_shift);
+}
+
+// Right shifts a uint128 so that it has the requested bit width. (The
+// resulting value will have 128 - bit_width leading zeroes.) The initial
+// `value` must be wider than the requested bit width.
+//
+// Returns the number of bits shifted.
+int TruncateToBitWidth(int bit_width, uint128* value) {
+ const int current_bit_width = BitWidth(*value);
+ const int shift = current_bit_width - bit_width;
+ *value >>= shift;
+ return shift;
+}
+
+// Checks if the given ParsedFloat represents one of the edge cases that are
+// not dependent on number base: zero, infinity, or NaN. If so, sets *value
+// the appropriate double, and returns true.
+template <typename FloatType>
+bool HandleEdgeCase(const strings_internal::ParsedFloat& input, bool negative,
+ FloatType* value) {
+ if (input.type == strings_internal::FloatType::kNan) {
+ // A bug in both clang and gcc would cause the compiler to optimize away the
+ // buffer we are building below. Declaring the buffer volatile avoids the
+ // issue, and has no measurable performance impact in microbenchmarks.
+ //
+ // https://bugs.llvm.org/show_bug.cgi?id=37778
+ // https://gcc.gnu.org/bugzilla/show_bug.cgi?id=86113
+ constexpr ptrdiff_t kNanBufferSize = 128;
+ volatile char n_char_sequence[kNanBufferSize];
+ if (input.subrange_begin == nullptr) {
+ n_char_sequence[0] = '\0';
+ } else {
+ ptrdiff_t nan_size = input.subrange_end - input.subrange_begin;
+ nan_size = std::min(nan_size, kNanBufferSize - 1);
+ std::copy_n(input.subrange_begin, nan_size, n_char_sequence);
+ n_char_sequence[nan_size] = '\0';
+ }
+ char* nan_argument = const_cast<char*>(n_char_sequence);
+ *value = negative ? -FloatTraits<FloatType>::MakeNan(nan_argument)
+ : FloatTraits<FloatType>::MakeNan(nan_argument);
+ return true;
+ }
+ if (input.type == strings_internal::FloatType::kInfinity) {
+ *value = negative ? -std::numeric_limits<FloatType>::infinity()
+ : std::numeric_limits<FloatType>::infinity();
+ return true;
+ }
+ if (input.mantissa == 0) {
+ *value = negative ? -0.0 : 0.0;
+ return true;
+ }
+ return false;
+}
+
+// Given a CalculatedFloat result of a from_chars conversion, generate the
+// correct output values.
+//
+// CalculatedFloat can represent an underflow or overflow, in which case the
+// error code in *result is set. Otherwise, the calculated floating point
+// number is stored in *value.
+template <typename FloatType>
+void EncodeResult(const CalculatedFloat& calculated, bool negative,
+ absl::from_chars_result* result, FloatType* value) {
+ if (calculated.exponent == kOverflow) {
+ result->ec = std::errc::result_out_of_range;
+ *value = negative ? -std::numeric_limits<FloatType>::max()
+ : std::numeric_limits<FloatType>::max();
+ return;
+ } else if (calculated.mantissa == 0 || calculated.exponent == kUnderflow) {
+ result->ec = std::errc::result_out_of_range;
+ *value = negative ? -0.0 : 0.0;
+ return;
+ }
+ *value = FloatTraits<FloatType>::Make(calculated.mantissa,
+ calculated.exponent, negative);
+}
+
+// Returns the given uint128 shifted to the right by `shift` bits, and rounds
+// the remaining bits using round_to_nearest logic. The value is returned as a
+// uint64_t, since this is the type used by this library for storing calculated
+// floating point mantissas.
+//
+// It is expected that the width of the input value shifted by `shift` will
+// be the correct bit-width for the target mantissa, which is strictly narrower
+// than a uint64_t.
+//
+// If `input_exact` is false, then a nonzero error epsilon is assumed. For
+// rounding purposes, the true value being rounded is strictly greater than the
+// input value. The error may represent a single lost carry bit.
+//
+// When input_exact, shifted bits of the form 1000000... represent a tie, which
+// is broken by rounding to even -- the rounding direction is chosen so the low
+// bit of the returned value is 0.
+//
+// When !input_exact, shifted bits of the form 10000000... represent a value
+// strictly greater than one half (due to the error epsilon), and so ties are
+// always broken by rounding up.
+//
+// When !input_exact, shifted bits of the form 01111111... are uncertain;
+// the true value may or may not be greater than 10000000..., due to the
+// possible lost carry bit. The correct rounding direction is unknown. In this
+// case, the result is rounded down, and `output_exact` is set to false.
+//
+// Zero and negative values of `shift` are accepted, in which case the word is
+// shifted left, as necessary.
+uint64_t ShiftRightAndRound(uint128 value, int shift, bool input_exact,
+ bool* output_exact) {
+ if (shift <= 0) {
+ *output_exact = input_exact;
+ return static_cast<uint64_t>(value << -shift);
+ }
+ if (shift >= 128) {
+ // Exponent is so small that we are shifting away all significant bits.
+ // Answer will not be representable, even as a subnormal, so return a zero
+ // mantissa (which represents underflow).
+ *output_exact = true;
+ return 0;
+ }
+
+ *output_exact = true;
+ const uint128 shift_mask = (uint128(1) << shift) - 1;
+ const uint128 halfway_point = uint128(1) << (shift - 1);
+
+ const uint128 shifted_bits = value & shift_mask;
+ value >>= shift;
+ if (shifted_bits > halfway_point) {
+ // Shifted bits greater than 10000... require rounding up.
+ return static_cast<uint64_t>(value + 1);
+ }
+ if (shifted_bits == halfway_point) {
+ // In exact mode, shifted bits of 10000... mean we're exactly halfway
+ // between two numbers, and we must round to even. So only round up if
+ // the low bit of `value` is set.
+ //
+ // In inexact mode, the nonzero error means the actual value is greater
+ // than the halfway point and we must alway round up.
+ if ((value & 1) == 1 || !input_exact) {
+ ++value;
+ }
+ return static_cast<uint64_t>(value);
+ }
+ if (!input_exact && shifted_bits == halfway_point - 1) {
+ // Rounding direction is unclear, due to error.
+ *output_exact = false;
+ }
+ // Otherwise, round down.
+ return static_cast<uint64_t>(value);
+}
+
+// Checks if a floating point guess needs to be rounded up, using high precision
+// math.
+//
+// `guess_mantissa` and `guess_exponent` represent a candidate guess for the
+// number represented by `parsed_decimal`.
+//
+// The exact number represented by `parsed_decimal` must lie between the two
+// numbers:
+// A = `guess_mantissa * 2**guess_exponent`
+// B = `(guess_mantissa + 1) * 2**guess_exponent`
+//
+// This function returns false if `A` is the better guess, and true if `B` is
+// the better guess, with rounding ties broken by rounding to even.
+bool MustRoundUp(uint64_t guess_mantissa, int guess_exponent,
+ const strings_internal::ParsedFloat& parsed_decimal) {
+ // 768 is the number of digits needed in the worst case. We could determine a
+ // better limit dynamically based on the value of parsed_decimal.exponent.
+ // This would optimize pathological input cases only. (Sane inputs won't have
+ // hundreds of digits of mantissa.)
+ absl::strings_internal::BigUnsigned<84> exact_mantissa;
+ int exact_exponent = exact_mantissa.ReadFloatMantissa(parsed_decimal, 768);
+
+ // Adjust the `guess` arguments to be halfway between A and B.
+ guess_mantissa = guess_mantissa * 2 + 1;
+ guess_exponent -= 1;
+
+ // In our comparison:
+ // lhs = exact = exact_mantissa * 10**exact_exponent
+ // = exact_mantissa * 5**exact_exponent * 2**exact_exponent
+ // rhs = guess = guess_mantissa * 2**guess_exponent
+ //
+ // Because we are doing integer math, we can't directly deal with negative
+ // exponents. We instead move these to the other side of the inequality.
+ absl::strings_internal::BigUnsigned<84>& lhs = exact_mantissa;
+ int comparison;
+ if (exact_exponent >= 0) {
+ lhs.MultiplyByFiveToTheNth(exact_exponent);
+ absl::strings_internal::BigUnsigned<84> rhs(guess_mantissa);
+ // There are powers of 2 on both sides of the inequality; reduce this to
+ // a single bit-shift.
+ if (exact_exponent > guess_exponent) {
+ lhs.ShiftLeft(exact_exponent - guess_exponent);
+ } else {
+ rhs.ShiftLeft(guess_exponent - exact_exponent);
+ }
+ comparison = Compare(lhs, rhs);
+ } else {
+ // Move the power of 5 to the other side of the equation, giving us:
+ // lhs = exact_mantissa * 2**exact_exponent
+ // rhs = guess_mantissa * 5**(-exact_exponent) * 2**guess_exponent
+ absl::strings_internal::BigUnsigned<84> rhs =
+ absl::strings_internal::BigUnsigned<84>::FiveToTheNth(-exact_exponent);
+ rhs.MultiplyBy(guess_mantissa);
+ if (exact_exponent > guess_exponent) {
+ lhs.ShiftLeft(exact_exponent - guess_exponent);
+ } else {
+ rhs.ShiftLeft(guess_exponent - exact_exponent);
+ }
+ comparison = Compare(lhs, rhs);
+ }
+ if (comparison < 0) {
+ return false;
+ } else if (comparison > 0) {
+ return true;
+ } else {
+ // When lhs == rhs, the decimal input is exactly between A and B.
+ // Round towards even -- round up only if the low bit of the initial
+ // `guess_mantissa` was a 1. We shifted guess_mantissa left 1 bit at
+ // the beginning of this function, so test the 2nd bit here.
+ return (guess_mantissa & 2) == 2;
+ }
+}
+
+// Constructs a CalculatedFloat from a given mantissa and exponent, but
+// with the following normalizations applied:
+//
+// If rounding has caused mantissa to increase just past the allowed bit
+// width, shift and adjust exponent.
+//
+// If exponent is too high, sets kOverflow.
+//
+// If mantissa is zero (representing a non-zero value not representable, even
+// as a subnormal), sets kUnderflow.
+template <typename FloatType>
+CalculatedFloat CalculatedFloatFromRawValues(uint64_t mantissa, int exponent) {
+ CalculatedFloat result;
+ if (mantissa == uint64_t(1) << FloatTraits<FloatType>::kTargetMantissaBits) {
+ mantissa >>= 1;
+ exponent += 1;
+ }
+ if (exponent > FloatTraits<FloatType>::kMaxExponent) {
+ result.exponent = kOverflow;
+ } else if (mantissa == 0) {
+ result.exponent = kUnderflow;
+ } else {
+ result.exponent = exponent;
+ result.mantissa = mantissa;
+ }
+ return result;
+}
+
+template <typename FloatType>
+CalculatedFloat CalculateFromParsedHexadecimal(
+ const strings_internal::ParsedFloat& parsed_hex) {
+ uint64_t mantissa = parsed_hex.mantissa;
+ int exponent = parsed_hex.exponent;
+ int mantissa_width = 64 - strings_internal::CountLeadingZeros64(mantissa);
+ const int shift = NormalizedShiftSize<FloatType>(mantissa_width, exponent);
+ bool result_exact;
+ exponent += shift;
+ mantissa = ShiftRightAndRound(mantissa, shift,
+ /* input exact= */ true, &result_exact);
+ // ParseFloat handles rounding in the hexadecimal case, so we don't have to
+ // check `result_exact` here.
+ return CalculatedFloatFromRawValues<FloatType>(mantissa, exponent);
+}
+
+template <typename FloatType>
+CalculatedFloat CalculateFromParsedDecimal(
+ const strings_internal::ParsedFloat& parsed_decimal) {
+ CalculatedFloat result;
+
+ // Large or small enough decimal exponents will always result in overflow
+ // or underflow.
+ if (Power10Underflow(parsed_decimal.exponent)) {
+ result.exponent = kUnderflow;
+ return result;
+ } else if (Power10Overflow(parsed_decimal.exponent)) {
+ result.exponent = kOverflow;
+ return result;
+ }
+
+ // Otherwise convert our power of 10 into a power of 2 times an integer
+ // mantissa, and multiply this by our parsed decimal mantissa.
+ uint128 wide_binary_mantissa = parsed_decimal.mantissa;
+ wide_binary_mantissa *= Power10Mantissa(parsed_decimal.exponent);
+ int binary_exponent = Power10Exponent(parsed_decimal.exponent);
+
+ // Discard bits that are inaccurate due to truncation error. The magic
+ // `mantissa_width` constants below are justified in charconv_algorithm.md.
+ // They represent the number of bits in `wide_binary_mantissa` that are
+ // guaranteed to be unaffected by error propagation.
+ bool mantissa_exact;
+ int mantissa_width;
+ if (parsed_decimal.subrange_begin) {
+ // Truncated mantissa
+ mantissa_width = 58;
+ mantissa_exact = false;
+ binary_exponent +=
+ TruncateToBitWidth(mantissa_width, &wide_binary_mantissa);
+ } else if (!Power10Exact(parsed_decimal.exponent)) {
+ // Exact mantissa, truncated power of ten
+ mantissa_width = 63;
+ mantissa_exact = false;
+ binary_exponent +=
+ TruncateToBitWidth(mantissa_width, &wide_binary_mantissa);
+ } else {
+ // Product is exact
+ mantissa_width = BitWidth(wide_binary_mantissa);
+ mantissa_exact = true;
+ }
+
+ // Shift into an FloatType-sized mantissa, and round to nearest.
+ const int shift =
+ NormalizedShiftSize<FloatType>(mantissa_width, binary_exponent);
+ bool result_exact;
+ binary_exponent += shift;
+ uint64_t binary_mantissa = ShiftRightAndRound(wide_binary_mantissa, shift,
+ mantissa_exact, &result_exact);
+ if (!result_exact) {
+ // We could not determine the rounding direction using int128 math. Use
+ // full resolution math instead.
+ if (MustRoundUp(binary_mantissa, binary_exponent, parsed_decimal)) {
+ binary_mantissa += 1;
+ }
+ }
+
+ return CalculatedFloatFromRawValues<FloatType>(binary_mantissa,
+ binary_exponent);
+}
+
+template <typename FloatType>
+from_chars_result FromCharsImpl(const char* first, const char* last,
+ FloatType& value, chars_format fmt_flags) {
+ from_chars_result result;
+ result.ptr = first; // overwritten on successful parse
+ result.ec = std::errc();
+
+ bool negative = false;
+ if (first != last && *first == '-') {
+ ++first;
+ negative = true;
+ }
+ // If the `hex` flag is *not* set, then we will accept a 0x prefix and try
+ // to parse a hexadecimal float.
+ if ((fmt_flags & chars_format::hex) == chars_format{} && last - first >= 2 &&
+ *first == '0' && (first[1] == 'x' || first[1] == 'X')) {
+ const char* hex_first = first + 2;
+ strings_internal::ParsedFloat hex_parse =
+ strings_internal::ParseFloat<16>(hex_first, last, fmt_flags);
+ if (hex_parse.end == nullptr ||
+ hex_parse.type != strings_internal::FloatType::kNumber) {
+ // Either we failed to parse a hex float after the "0x", or we read
+ // "0xinf" or "0xnan" which we don't want to match.
+ //
+ // However, a std::string that begins with "0x" also begins with "0", which
+ // is normally a valid match for the number zero. So we want these
+ // strings to match zero unless fmt_flags is `scientific`. (This flag
+ // means an exponent is required, which the std::string "0" does not have.)
+ if (fmt_flags == chars_format::scientific) {
+ result.ec = std::errc::invalid_argument;
+ } else {
+ result.ptr = first + 1;
+ value = negative ? -0.0 : 0.0;
+ }
+ return result;
+ }
+ // We matched a value.
+ result.ptr = hex_parse.end;
+ if (HandleEdgeCase(hex_parse, negative, &value)) {
+ return result;
+ }
+ CalculatedFloat calculated =
+ CalculateFromParsedHexadecimal<FloatType>(hex_parse);
+ EncodeResult(calculated, negative, &result, &value);
+ return result;
+ }
+ // Otherwise, we choose the number base based on the flags.
+ if ((fmt_flags & chars_format::hex) == chars_format::hex) {
+ strings_internal::ParsedFloat hex_parse =
+ strings_internal::ParseFloat<16>(first, last, fmt_flags);
+ if (hex_parse.end == nullptr) {
+ result.ec = std::errc::invalid_argument;
+ return result;
+ }
+ result.ptr = hex_parse.end;
+ if (HandleEdgeCase(hex_parse, negative, &value)) {
+ return result;
+ }
+ CalculatedFloat calculated =
+ CalculateFromParsedHexadecimal<FloatType>(hex_parse);
+ EncodeResult(calculated, negative, &result, &value);
+ return result;
+ } else {
+ strings_internal::ParsedFloat decimal_parse =
+ strings_internal::ParseFloat<10>(first, last, fmt_flags);
+ if (decimal_parse.end == nullptr) {
+ result.ec = std::errc::invalid_argument;
+ return result;
+ }
+ result.ptr = decimal_parse.end;
+ if (HandleEdgeCase(decimal_parse, negative, &value)) {
+ return result;
+ }
+ CalculatedFloat calculated =
+ CalculateFromParsedDecimal<FloatType>(decimal_parse);
+ EncodeResult(calculated, negative, &result, &value);
+ return result;
+ }
+ return result;
+}
+} // namespace
+
+from_chars_result from_chars(const char* first, const char* last, double& value,
+ chars_format fmt) {
+ return FromCharsImpl(first, last, value, fmt);
+}
+
+from_chars_result from_chars(const char* first, const char* last, float& value,
+ chars_format fmt) {
+ return FromCharsImpl(first, last, value, fmt);
+}
+
+namespace {
+
+// Table of powers of 10, from kPower10TableMin to kPower10TableMax.
+//
+// kPower10MantissaTable[i - kPower10TableMin] stores the 64-bit mantissa (high
+// bit always on), and kPower10ExponentTable[i - kPower10TableMin] stores the
+// power-of-two exponent. For a given number i, this gives the unique mantissa
+// and exponent such that mantissa * 2**exponent <= 10**i < (mantissa + 1) *
+// 2**exponent.
+
+const uint64_t kPower10MantissaTable[] = {
+ 0xeef453d6923bd65aU, 0x9558b4661b6565f8U, 0xbaaee17fa23ebf76U,
+ 0xe95a99df8ace6f53U, 0x91d8a02bb6c10594U, 0xb64ec836a47146f9U,
+ 0xe3e27a444d8d98b7U, 0x8e6d8c6ab0787f72U, 0xb208ef855c969f4fU,
+ 0xde8b2b66b3bc4723U, 0x8b16fb203055ac76U, 0xaddcb9e83c6b1793U,
+ 0xd953e8624b85dd78U, 0x87d4713d6f33aa6bU, 0xa9c98d8ccb009506U,
+ 0xd43bf0effdc0ba48U, 0x84a57695fe98746dU, 0xa5ced43b7e3e9188U,
+ 0xcf42894a5dce35eaU, 0x818995ce7aa0e1b2U, 0xa1ebfb4219491a1fU,
+ 0xca66fa129f9b60a6U, 0xfd00b897478238d0U, 0x9e20735e8cb16382U,
+ 0xc5a890362fddbc62U, 0xf712b443bbd52b7bU, 0x9a6bb0aa55653b2dU,
+ 0xc1069cd4eabe89f8U, 0xf148440a256e2c76U, 0x96cd2a865764dbcaU,
+ 0xbc807527ed3e12bcU, 0xeba09271e88d976bU, 0x93445b8731587ea3U,
+ 0xb8157268fdae9e4cU, 0xe61acf033d1a45dfU, 0x8fd0c16206306babU,
+ 0xb3c4f1ba87bc8696U, 0xe0b62e2929aba83cU, 0x8c71dcd9ba0b4925U,
+ 0xaf8e5410288e1b6fU, 0xdb71e91432b1a24aU, 0x892731ac9faf056eU,
+ 0xab70fe17c79ac6caU, 0xd64d3d9db981787dU, 0x85f0468293f0eb4eU,
+ 0xa76c582338ed2621U, 0xd1476e2c07286faaU, 0x82cca4db847945caU,
+ 0xa37fce126597973cU, 0xcc5fc196fefd7d0cU, 0xff77b1fcbebcdc4fU,
+ 0x9faacf3df73609b1U, 0xc795830d75038c1dU, 0xf97ae3d0d2446f25U,
+ 0x9becce62836ac577U, 0xc2e801fb244576d5U, 0xf3a20279ed56d48aU,
+ 0x9845418c345644d6U, 0xbe5691ef416bd60cU, 0xedec366b11c6cb8fU,
+ 0x94b3a202eb1c3f39U, 0xb9e08a83a5e34f07U, 0xe858ad248f5c22c9U,
+ 0x91376c36d99995beU, 0xb58547448ffffb2dU, 0xe2e69915b3fff9f9U,
+ 0x8dd01fad907ffc3bU, 0xb1442798f49ffb4aU, 0xdd95317f31c7fa1dU,
+ 0x8a7d3eef7f1cfc52U, 0xad1c8eab5ee43b66U, 0xd863b256369d4a40U,
+ 0x873e4f75e2224e68U, 0xa90de3535aaae202U, 0xd3515c2831559a83U,
+ 0x8412d9991ed58091U, 0xa5178fff668ae0b6U, 0xce5d73ff402d98e3U,
+ 0x80fa687f881c7f8eU, 0xa139029f6a239f72U, 0xc987434744ac874eU,
+ 0xfbe9141915d7a922U, 0x9d71ac8fada6c9b5U, 0xc4ce17b399107c22U,
+ 0xf6019da07f549b2bU, 0x99c102844f94e0fbU, 0xc0314325637a1939U,
+ 0xf03d93eebc589f88U, 0x96267c7535b763b5U, 0xbbb01b9283253ca2U,
+ 0xea9c227723ee8bcbU, 0x92a1958a7675175fU, 0xb749faed14125d36U,
+ 0xe51c79a85916f484U, 0x8f31cc0937ae58d2U, 0xb2fe3f0b8599ef07U,
+ 0xdfbdcece67006ac9U, 0x8bd6a141006042bdU, 0xaecc49914078536dU,
+ 0xda7f5bf590966848U, 0x888f99797a5e012dU, 0xaab37fd7d8f58178U,
+ 0xd5605fcdcf32e1d6U, 0x855c3be0a17fcd26U, 0xa6b34ad8c9dfc06fU,
+ 0xd0601d8efc57b08bU, 0x823c12795db6ce57U, 0xa2cb1717b52481edU,
+ 0xcb7ddcdda26da268U, 0xfe5d54150b090b02U, 0x9efa548d26e5a6e1U,
+ 0xc6b8e9b0709f109aU, 0xf867241c8cc6d4c0U, 0x9b407691d7fc44f8U,
+ 0xc21094364dfb5636U, 0xf294b943e17a2bc4U, 0x979cf3ca6cec5b5aU,
+ 0xbd8430bd08277231U, 0xece53cec4a314ebdU, 0x940f4613ae5ed136U,
+ 0xb913179899f68584U, 0xe757dd7ec07426e5U, 0x9096ea6f3848984fU,
+ 0xb4bca50b065abe63U, 0xe1ebce4dc7f16dfbU, 0x8d3360f09cf6e4bdU,
+ 0xb080392cc4349decU, 0xdca04777f541c567U, 0x89e42caaf9491b60U,
+ 0xac5d37d5b79b6239U, 0xd77485cb25823ac7U, 0x86a8d39ef77164bcU,
+ 0xa8530886b54dbdebU, 0xd267caa862a12d66U, 0x8380dea93da4bc60U,
+ 0xa46116538d0deb78U, 0xcd795be870516656U, 0x806bd9714632dff6U,
+ 0xa086cfcd97bf97f3U, 0xc8a883c0fdaf7df0U, 0xfad2a4b13d1b5d6cU,
+ 0x9cc3a6eec6311a63U, 0xc3f490aa77bd60fcU, 0xf4f1b4d515acb93bU,
+ 0x991711052d8bf3c5U, 0xbf5cd54678eef0b6U, 0xef340a98172aace4U,
+ 0x9580869f0e7aac0eU, 0xbae0a846d2195712U, 0xe998d258869facd7U,
+ 0x91ff83775423cc06U, 0xb67f6455292cbf08U, 0xe41f3d6a7377eecaU,
+ 0x8e938662882af53eU, 0xb23867fb2a35b28dU, 0xdec681f9f4c31f31U,
+ 0x8b3c113c38f9f37eU, 0xae0b158b4738705eU, 0xd98ddaee19068c76U,
+ 0x87f8a8d4cfa417c9U, 0xa9f6d30a038d1dbcU, 0xd47487cc8470652bU,
+ 0x84c8d4dfd2c63f3bU, 0xa5fb0a17c777cf09U, 0xcf79cc9db955c2ccU,
+ 0x81ac1fe293d599bfU, 0xa21727db38cb002fU, 0xca9cf1d206fdc03bU,
+ 0xfd442e4688bd304aU, 0x9e4a9cec15763e2eU, 0xc5dd44271ad3cdbaU,
+ 0xf7549530e188c128U, 0x9a94dd3e8cf578b9U, 0xc13a148e3032d6e7U,
+ 0xf18899b1bc3f8ca1U, 0x96f5600f15a7b7e5U, 0xbcb2b812db11a5deU,
+ 0xebdf661791d60f56U, 0x936b9fcebb25c995U, 0xb84687c269ef3bfbU,
+ 0xe65829b3046b0afaU, 0x8ff71a0fe2c2e6dcU, 0xb3f4e093db73a093U,
+ 0xe0f218b8d25088b8U, 0x8c974f7383725573U, 0xafbd2350644eeacfU,
+ 0xdbac6c247d62a583U, 0x894bc396ce5da772U, 0xab9eb47c81f5114fU,
+ 0xd686619ba27255a2U, 0x8613fd0145877585U, 0xa798fc4196e952e7U,
+ 0xd17f3b51fca3a7a0U, 0x82ef85133de648c4U, 0xa3ab66580d5fdaf5U,
+ 0xcc963fee10b7d1b3U, 0xffbbcfe994e5c61fU, 0x9fd561f1fd0f9bd3U,
+ 0xc7caba6e7c5382c8U, 0xf9bd690a1b68637bU, 0x9c1661a651213e2dU,
+ 0xc31bfa0fe5698db8U, 0xf3e2f893dec3f126U, 0x986ddb5c6b3a76b7U,
+ 0xbe89523386091465U, 0xee2ba6c0678b597fU, 0x94db483840b717efU,
+ 0xba121a4650e4ddebU, 0xe896a0d7e51e1566U, 0x915e2486ef32cd60U,
+ 0xb5b5ada8aaff80b8U, 0xe3231912d5bf60e6U, 0x8df5efabc5979c8fU,
+ 0xb1736b96b6fd83b3U, 0xddd0467c64bce4a0U, 0x8aa22c0dbef60ee4U,
+ 0xad4ab7112eb3929dU, 0xd89d64d57a607744U, 0x87625f056c7c4a8bU,
+ 0xa93af6c6c79b5d2dU, 0xd389b47879823479U, 0x843610cb4bf160cbU,
+ 0xa54394fe1eedb8feU, 0xce947a3da6a9273eU, 0x811ccc668829b887U,
+ 0xa163ff802a3426a8U, 0xc9bcff6034c13052U, 0xfc2c3f3841f17c67U,
+ 0x9d9ba7832936edc0U, 0xc5029163f384a931U, 0xf64335bcf065d37dU,
+ 0x99ea0196163fa42eU, 0xc06481fb9bcf8d39U, 0xf07da27a82c37088U,
+ 0x964e858c91ba2655U, 0xbbe226efb628afeaU, 0xeadab0aba3b2dbe5U,
+ 0x92c8ae6b464fc96fU, 0xb77ada0617e3bbcbU, 0xe55990879ddcaabdU,
+ 0x8f57fa54c2a9eab6U, 0xb32df8e9f3546564U, 0xdff9772470297ebdU,
+ 0x8bfbea76c619ef36U, 0xaefae51477a06b03U, 0xdab99e59958885c4U,
+ 0x88b402f7fd75539bU, 0xaae103b5fcd2a881U, 0xd59944a37c0752a2U,
+ 0x857fcae62d8493a5U, 0xa6dfbd9fb8e5b88eU, 0xd097ad07a71f26b2U,
+ 0x825ecc24c873782fU, 0xa2f67f2dfa90563bU, 0xcbb41ef979346bcaU,
+ 0xfea126b7d78186bcU, 0x9f24b832e6b0f436U, 0xc6ede63fa05d3143U,
+ 0xf8a95fcf88747d94U, 0x9b69dbe1b548ce7cU, 0xc24452da229b021bU,
+ 0xf2d56790ab41c2a2U, 0x97c560ba6b0919a5U, 0xbdb6b8e905cb600fU,
+ 0xed246723473e3813U, 0x9436c0760c86e30bU, 0xb94470938fa89bceU,
+ 0xe7958cb87392c2c2U, 0x90bd77f3483bb9b9U, 0xb4ecd5f01a4aa828U,
+ 0xe2280b6c20dd5232U, 0x8d590723948a535fU, 0xb0af48ec79ace837U,
+ 0xdcdb1b2798182244U, 0x8a08f0f8bf0f156bU, 0xac8b2d36eed2dac5U,
+ 0xd7adf884aa879177U, 0x86ccbb52ea94baeaU, 0xa87fea27a539e9a5U,
+ 0xd29fe4b18e88640eU, 0x83a3eeeef9153e89U, 0xa48ceaaab75a8e2bU,
+ 0xcdb02555653131b6U, 0x808e17555f3ebf11U, 0xa0b19d2ab70e6ed6U,
+ 0xc8de047564d20a8bU, 0xfb158592be068d2eU, 0x9ced737bb6c4183dU,
+ 0xc428d05aa4751e4cU, 0xf53304714d9265dfU, 0x993fe2c6d07b7fabU,
+ 0xbf8fdb78849a5f96U, 0xef73d256a5c0f77cU, 0x95a8637627989aadU,
+ 0xbb127c53b17ec159U, 0xe9d71b689dde71afU, 0x9226712162ab070dU,
+ 0xb6b00d69bb55c8d1U, 0xe45c10c42a2b3b05U, 0x8eb98a7a9a5b04e3U,
+ 0xb267ed1940f1c61cU, 0xdf01e85f912e37a3U, 0x8b61313bbabce2c6U,
+ 0xae397d8aa96c1b77U, 0xd9c7dced53c72255U, 0x881cea14545c7575U,
+ 0xaa242499697392d2U, 0xd4ad2dbfc3d07787U, 0x84ec3c97da624ab4U,
+ 0xa6274bbdd0fadd61U, 0xcfb11ead453994baU, 0x81ceb32c4b43fcf4U,
+ 0xa2425ff75e14fc31U, 0xcad2f7f5359a3b3eU, 0xfd87b5f28300ca0dU,
+ 0x9e74d1b791e07e48U, 0xc612062576589ddaU, 0xf79687aed3eec551U,
+ 0x9abe14cd44753b52U, 0xc16d9a0095928a27U, 0xf1c90080baf72cb1U,
+ 0x971da05074da7beeU, 0xbce5086492111aeaU, 0xec1e4a7db69561a5U,
+ 0x9392ee8e921d5d07U, 0xb877aa3236a4b449U, 0xe69594bec44de15bU,
+ 0x901d7cf73ab0acd9U, 0xb424dc35095cd80fU, 0xe12e13424bb40e13U,
+ 0x8cbccc096f5088cbU, 0xafebff0bcb24aafeU, 0xdbe6fecebdedd5beU,
+ 0x89705f4136b4a597U, 0xabcc77118461cefcU, 0xd6bf94d5e57a42bcU,
+ 0x8637bd05af6c69b5U, 0xa7c5ac471b478423U, 0xd1b71758e219652bU,
+ 0x83126e978d4fdf3bU, 0xa3d70a3d70a3d70aU, 0xccccccccccccccccU,
+ 0x8000000000000000U, 0xa000000000000000U, 0xc800000000000000U,
+ 0xfa00000000000000U, 0x9c40000000000000U, 0xc350000000000000U,
+ 0xf424000000000000U, 0x9896800000000000U, 0xbebc200000000000U,
+ 0xee6b280000000000U, 0x9502f90000000000U, 0xba43b74000000000U,
+ 0xe8d4a51000000000U, 0x9184e72a00000000U, 0xb5e620f480000000U,
+ 0xe35fa931a0000000U, 0x8e1bc9bf04000000U, 0xb1a2bc2ec5000000U,
+ 0xde0b6b3a76400000U, 0x8ac7230489e80000U, 0xad78ebc5ac620000U,
+ 0xd8d726b7177a8000U, 0x878678326eac9000U, 0xa968163f0a57b400U,
+ 0xd3c21bcecceda100U, 0x84595161401484a0U, 0xa56fa5b99019a5c8U,
+ 0xcecb8f27f4200f3aU, 0x813f3978f8940984U, 0xa18f07d736b90be5U,
+ 0xc9f2c9cd04674edeU, 0xfc6f7c4045812296U, 0x9dc5ada82b70b59dU,
+ 0xc5371912364ce305U, 0xf684df56c3e01bc6U, 0x9a130b963a6c115cU,
+ 0xc097ce7bc90715b3U, 0xf0bdc21abb48db20U, 0x96769950b50d88f4U,
+ 0xbc143fa4e250eb31U, 0xeb194f8e1ae525fdU, 0x92efd1b8d0cf37beU,
+ 0xb7abc627050305adU, 0xe596b7b0c643c719U, 0x8f7e32ce7bea5c6fU,
+ 0xb35dbf821ae4f38bU, 0xe0352f62a19e306eU, 0x8c213d9da502de45U,
+ 0xaf298d050e4395d6U, 0xdaf3f04651d47b4cU, 0x88d8762bf324cd0fU,
+ 0xab0e93b6efee0053U, 0xd5d238a4abe98068U, 0x85a36366eb71f041U,
+ 0xa70c3c40a64e6c51U, 0xd0cf4b50cfe20765U, 0x82818f1281ed449fU,
+ 0xa321f2d7226895c7U, 0xcbea6f8ceb02bb39U, 0xfee50b7025c36a08U,
+ 0x9f4f2726179a2245U, 0xc722f0ef9d80aad6U, 0xf8ebad2b84e0d58bU,
+ 0x9b934c3b330c8577U, 0xc2781f49ffcfa6d5U, 0xf316271c7fc3908aU,
+ 0x97edd871cfda3a56U, 0xbde94e8e43d0c8ecU, 0xed63a231d4c4fb27U,
+ 0x945e455f24fb1cf8U, 0xb975d6b6ee39e436U, 0xe7d34c64a9c85d44U,
+ 0x90e40fbeea1d3a4aU, 0xb51d13aea4a488ddU, 0xe264589a4dcdab14U,
+ 0x8d7eb76070a08aecU, 0xb0de65388cc8ada8U, 0xdd15fe86affad912U,
+ 0x8a2dbf142dfcc7abU, 0xacb92ed9397bf996U, 0xd7e77a8f87daf7fbU,
+ 0x86f0ac99b4e8dafdU, 0xa8acd7c0222311bcU, 0xd2d80db02aabd62bU,
+ 0x83c7088e1aab65dbU, 0xa4b8cab1a1563f52U, 0xcde6fd5e09abcf26U,
+ 0x80b05e5ac60b6178U, 0xa0dc75f1778e39d6U, 0xc913936dd571c84cU,
+ 0xfb5878494ace3a5fU, 0x9d174b2dcec0e47bU, 0xc45d1df942711d9aU,
+ 0xf5746577930d6500U, 0x9968bf6abbe85f20U, 0xbfc2ef456ae276e8U,
+ 0xefb3ab16c59b14a2U, 0x95d04aee3b80ece5U, 0xbb445da9ca61281fU,
+ 0xea1575143cf97226U, 0x924d692ca61be758U, 0xb6e0c377cfa2e12eU,
+ 0xe498f455c38b997aU, 0x8edf98b59a373fecU, 0xb2977ee300c50fe7U,
+ 0xdf3d5e9bc0f653e1U, 0x8b865b215899f46cU, 0xae67f1e9aec07187U,
+ 0xda01ee641a708de9U, 0x884134fe908658b2U, 0xaa51823e34a7eedeU,
+ 0xd4e5e2cdc1d1ea96U, 0x850fadc09923329eU, 0xa6539930bf6bff45U,
+ 0xcfe87f7cef46ff16U, 0x81f14fae158c5f6eU, 0xa26da3999aef7749U,
+ 0xcb090c8001ab551cU, 0xfdcb4fa002162a63U, 0x9e9f11c4014dda7eU,
+ 0xc646d63501a1511dU, 0xf7d88bc24209a565U, 0x9ae757596946075fU,
+ 0xc1a12d2fc3978937U, 0xf209787bb47d6b84U, 0x9745eb4d50ce6332U,
+ 0xbd176620a501fbffU, 0xec5d3fa8ce427affU, 0x93ba47c980e98cdfU,
+ 0xb8a8d9bbe123f017U, 0xe6d3102ad96cec1dU, 0x9043ea1ac7e41392U,
+ 0xb454e4a179dd1877U, 0xe16a1dc9d8545e94U, 0x8ce2529e2734bb1dU,
+ 0xb01ae745b101e9e4U, 0xdc21a1171d42645dU, 0x899504ae72497ebaU,
+ 0xabfa45da0edbde69U, 0xd6f8d7509292d603U, 0x865b86925b9bc5c2U,
+ 0xa7f26836f282b732U, 0xd1ef0244af2364ffU, 0x8335616aed761f1fU,
+ 0xa402b9c5a8d3a6e7U, 0xcd036837130890a1U, 0x802221226be55a64U,
+ 0xa02aa96b06deb0fdU, 0xc83553c5c8965d3dU, 0xfa42a8b73abbf48cU,
+ 0x9c69a97284b578d7U, 0xc38413cf25e2d70dU, 0xf46518c2ef5b8cd1U,
+ 0x98bf2f79d5993802U, 0xbeeefb584aff8603U, 0xeeaaba2e5dbf6784U,
+ 0x952ab45cfa97a0b2U, 0xba756174393d88dfU, 0xe912b9d1478ceb17U,
+ 0x91abb422ccb812eeU, 0xb616a12b7fe617aaU, 0xe39c49765fdf9d94U,
+ 0x8e41ade9fbebc27dU, 0xb1d219647ae6b31cU, 0xde469fbd99a05fe3U,
+ 0x8aec23d680043beeU, 0xada72ccc20054ae9U, 0xd910f7ff28069da4U,
+ 0x87aa9aff79042286U, 0xa99541bf57452b28U, 0xd3fa922f2d1675f2U,
+ 0x847c9b5d7c2e09b7U, 0xa59bc234db398c25U, 0xcf02b2c21207ef2eU,
+ 0x8161afb94b44f57dU, 0xa1ba1ba79e1632dcU, 0xca28a291859bbf93U,
+ 0xfcb2cb35e702af78U, 0x9defbf01b061adabU, 0xc56baec21c7a1916U,
+ 0xf6c69a72a3989f5bU, 0x9a3c2087a63f6399U, 0xc0cb28a98fcf3c7fU,
+ 0xf0fdf2d3f3c30b9fU, 0x969eb7c47859e743U, 0xbc4665b596706114U,
+ 0xeb57ff22fc0c7959U, 0x9316ff75dd87cbd8U, 0xb7dcbf5354e9beceU,
+ 0xe5d3ef282a242e81U, 0x8fa475791a569d10U, 0xb38d92d760ec4455U,
+ 0xe070f78d3927556aU, 0x8c469ab843b89562U, 0xaf58416654a6babbU,
+ 0xdb2e51bfe9d0696aU, 0x88fcf317f22241e2U, 0xab3c2fddeeaad25aU,
+ 0xd60b3bd56a5586f1U, 0x85c7056562757456U, 0xa738c6bebb12d16cU,
+ 0xd106f86e69d785c7U, 0x82a45b450226b39cU, 0xa34d721642b06084U,
+ 0xcc20ce9bd35c78a5U, 0xff290242c83396ceU, 0x9f79a169bd203e41U,
+ 0xc75809c42c684dd1U, 0xf92e0c3537826145U, 0x9bbcc7a142b17ccbU,
+ 0xc2abf989935ddbfeU, 0xf356f7ebf83552feU, 0x98165af37b2153deU,
+ 0xbe1bf1b059e9a8d6U, 0xeda2ee1c7064130cU, 0x9485d4d1c63e8be7U,
+ 0xb9a74a0637ce2ee1U, 0xe8111c87c5c1ba99U, 0x910ab1d4db9914a0U,
+ 0xb54d5e4a127f59c8U, 0xe2a0b5dc971f303aU, 0x8da471a9de737e24U,
+ 0xb10d8e1456105dadU, 0xdd50f1996b947518U, 0x8a5296ffe33cc92fU,
+ 0xace73cbfdc0bfb7bU, 0xd8210befd30efa5aU, 0x8714a775e3e95c78U,
+ 0xa8d9d1535ce3b396U, 0xd31045a8341ca07cU, 0x83ea2b892091e44dU,
+ 0xa4e4b66b68b65d60U, 0xce1de40642e3f4b9U, 0x80d2ae83e9ce78f3U,
+ 0xa1075a24e4421730U, 0xc94930ae1d529cfcU, 0xfb9b7cd9a4a7443cU,
+ 0x9d412e0806e88aa5U, 0xc491798a08a2ad4eU, 0xf5b5d7ec8acb58a2U,
+ 0x9991a6f3d6bf1765U, 0xbff610b0cc6edd3fU, 0xeff394dcff8a948eU,
+ 0x95f83d0a1fb69cd9U, 0xbb764c4ca7a4440fU, 0xea53df5fd18d5513U,
+ 0x92746b9be2f8552cU, 0xb7118682dbb66a77U, 0xe4d5e82392a40515U,
+ 0x8f05b1163ba6832dU, 0xb2c71d5bca9023f8U, 0xdf78e4b2bd342cf6U,
+ 0x8bab8eefb6409c1aU, 0xae9672aba3d0c320U, 0xda3c0f568cc4f3e8U,
+ 0x8865899617fb1871U, 0xaa7eebfb9df9de8dU, 0xd51ea6fa85785631U,
+ 0x8533285c936b35deU, 0xa67ff273b8460356U, 0xd01fef10a657842cU,
+ 0x8213f56a67f6b29bU, 0xa298f2c501f45f42U, 0xcb3f2f7642717713U,
+ 0xfe0efb53d30dd4d7U, 0x9ec95d1463e8a506U, 0xc67bb4597ce2ce48U,
+ 0xf81aa16fdc1b81daU, 0x9b10a4e5e9913128U, 0xc1d4ce1f63f57d72U,
+ 0xf24a01a73cf2dccfU, 0x976e41088617ca01U, 0xbd49d14aa79dbc82U,
+ 0xec9c459d51852ba2U, 0x93e1ab8252f33b45U, 0xb8da1662e7b00a17U,
+ 0xe7109bfba19c0c9dU, 0x906a617d450187e2U, 0xb484f9dc9641e9daU,
+ 0xe1a63853bbd26451U, 0x8d07e33455637eb2U, 0xb049dc016abc5e5fU,
+ 0xdc5c5301c56b75f7U, 0x89b9b3e11b6329baU, 0xac2820d9623bf429U,
+ 0xd732290fbacaf133U, 0x867f59a9d4bed6c0U, 0xa81f301449ee8c70U,
+ 0xd226fc195c6a2f8cU, 0x83585d8fd9c25db7U, 0xa42e74f3d032f525U,
+ 0xcd3a1230c43fb26fU, 0x80444b5e7aa7cf85U, 0xa0555e361951c366U,
+ 0xc86ab5c39fa63440U, 0xfa856334878fc150U, 0x9c935e00d4b9d8d2U,
+ 0xc3b8358109e84f07U, 0xf4a642e14c6262c8U, 0x98e7e9cccfbd7dbdU,
+ 0xbf21e44003acdd2cU, 0xeeea5d5004981478U, 0x95527a5202df0ccbU,
+ 0xbaa718e68396cffdU, 0xe950df20247c83fdU, 0x91d28b7416cdd27eU,
+ 0xb6472e511c81471dU, 0xe3d8f9e563a198e5U, 0x8e679c2f5e44ff8fU,
+};
+
+const int16_t kPower10ExponentTable[] = {
+ -1200, -1196, -1193, -1190, -1186, -1183, -1180, -1176, -1173, -1170, -1166,
+ -1163, -1160, -1156, -1153, -1150, -1146, -1143, -1140, -1136, -1133, -1130,
+ -1127, -1123, -1120, -1117, -1113, -1110, -1107, -1103, -1100, -1097, -1093,
+ -1090, -1087, -1083, -1080, -1077, -1073, -1070, -1067, -1063, -1060, -1057,
+ -1053, -1050, -1047, -1043, -1040, -1037, -1034, -1030, -1027, -1024, -1020,
+ -1017, -1014, -1010, -1007, -1004, -1000, -997, -994, -990, -987, -984,
+ -980, -977, -974, -970, -967, -964, -960, -957, -954, -950, -947,
+ -944, -940, -937, -934, -931, -927, -924, -921, -917, -914, -911,
+ -907, -904, -901, -897, -894, -891, -887, -884, -881, -877, -874,
+ -871, -867, -864, -861, -857, -854, -851, -847, -844, -841, -838,
+ -834, -831, -828, -824, -821, -818, -814, -811, -808, -804, -801,
+ -798, -794, -791, -788, -784, -781, -778, -774, -771, -768, -764,
+ -761, -758, -754, -751, -748, -744, -741, -738, -735, -731, -728,
+ -725, -721, -718, -715, -711, -708, -705, -701, -698, -695, -691,
+ -688, -685, -681, -678, -675, -671, -668, -665, -661, -658, -655,
+ -651, -648, -645, -642, -638, -635, -632, -628, -625, -622, -618,
+ -615, -612, -608, -605, -602, -598, -595, -592, -588, -585, -582,
+ -578, -575, -572, -568, -565, -562, -558, -555, -552, -549, -545,
+ -542, -539, -535, -532, -529, -525, -522, -519, -515, -512, -509,
+ -505, -502, -499, -495, -492, -489, -485, -482, -479, -475, -472,
+ -469, -465, -462, -459, -455, -452, -449, -446, -442, -439, -436,
+ -432, -429, -426, -422, -419, -416, -412, -409, -406, -402, -399,
+ -396, -392, -389, -386, -382, -379, -376, -372, -369, -366, -362,
+ -359, -356, -353, -349, -346, -343, -339, -336, -333, -329, -326,
+ -323, -319, -316, -313, -309, -306, -303, -299, -296, -293, -289,
+ -286, -283, -279, -276, -273, -269, -266, -263, -259, -256, -253,
+ -250, -246, -243, -240, -236, -233, -230, -226, -223, -220, -216,
+ -213, -210, -206, -203, -200, -196, -193, -190, -186, -183, -180,
+ -176, -173, -170, -166, -163, -160, -157, -153, -150, -147, -143,
+ -140, -137, -133, -130, -127, -123, -120, -117, -113, -110, -107,
+ -103, -100, -97, -93, -90, -87, -83, -80, -77, -73, -70,
+ -67, -63, -60, -57, -54, -50, -47, -44, -40, -37, -34,
+ -30, -27, -24, -20, -17, -14, -10, -7, -4, 0, 3,
+ 6, 10, 13, 16, 20, 23, 26, 30, 33, 36, 39,
+ 43, 46, 49, 53, 56, 59, 63, 66, 69, 73, 76,
+ 79, 83, 86, 89, 93, 96, 99, 103, 106, 109, 113,
+ 116, 119, 123, 126, 129, 132, 136, 139, 142, 146, 149,
+ 152, 156, 159, 162, 166, 169, 172, 176, 179, 182, 186,
+ 189, 192, 196, 199, 202, 206, 209, 212, 216, 219, 222,
+ 226, 229, 232, 235, 239, 242, 245, 249, 252, 255, 259,
+ 262, 265, 269, 272, 275, 279, 282, 285, 289, 292, 295,
+ 299, 302, 305, 309, 312, 315, 319, 322, 325, 328, 332,
+ 335, 338, 342, 345, 348, 352, 355, 358, 362, 365, 368,
+ 372, 375, 378, 382, 385, 388, 392, 395, 398, 402, 405,
+ 408, 412, 415, 418, 422, 425, 428, 431, 435, 438, 441,
+ 445, 448, 451, 455, 458, 461, 465, 468, 471, 475, 478,
+ 481, 485, 488, 491, 495, 498, 501, 505, 508, 511, 515,
+ 518, 521, 524, 528, 531, 534, 538, 541, 544, 548, 551,
+ 554, 558, 561, 564, 568, 571, 574, 578, 581, 584, 588,
+ 591, 594, 598, 601, 604, 608, 611, 614, 617, 621, 624,
+ 627, 631, 634, 637, 641, 644, 647, 651, 654, 657, 661,
+ 664, 667, 671, 674, 677, 681, 684, 687, 691, 694, 697,
+ 701, 704, 707, 711, 714, 717, 720, 724, 727, 730, 734,
+ 737, 740, 744, 747, 750, 754, 757, 760, 764, 767, 770,
+ 774, 777, 780, 784, 787, 790, 794, 797, 800, 804, 807,
+ 810, 813, 817, 820, 823, 827, 830, 833, 837, 840, 843,
+ 847, 850, 853, 857, 860, 863, 867, 870, 873, 877, 880,
+ 883, 887, 890, 893, 897, 900, 903, 907, 910, 913, 916,
+ 920, 923, 926, 930, 933, 936, 940, 943, 946, 950, 953,
+ 956, 960,
+};
+
+} // namespace
+} // namespace absl
diff --git a/absl/strings/charconv.h b/absl/strings/charconv.h
new file mode 100644
index 00000000..3e313679
--- /dev/null
+++ b/absl/strings/charconv.h
@@ -0,0 +1,115 @@
+// Copyright 2018 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#ifndef ABSL_STRINGS_CHARCONV_H_
+#define ABSL_STRINGS_CHARCONV_H_
+
+#include <system_error> // NOLINT(build/c++11)
+
+namespace absl {
+
+// Workalike compatibilty version of std::chars_format from C++17.
+//
+// This is an bitfield enumerator which can be passed to absl::from_chars to
+// configure the std::string-to-float conversion.
+enum class chars_format {
+ scientific = 1,
+ fixed = 2,
+ hex = 4,
+ general = fixed | scientific,
+};
+
+// The return result of a std::string-to-number conversion.
+//
+// `ec` will be set to `invalid_argument` if a well-formed number was not found
+// at the start of the input range, `result_out_of_range` if a well-formed
+// number was found, but it was out of the representable range of the requested
+// type, or to std::errc() otherwise.
+//
+// If a well-formed number was found, `ptr` is set to one past the sequence of
+// characters that were successfully parsed. If none was found, `ptr` is set
+// to the `first` argument to from_chars.
+struct from_chars_result {
+ const char* ptr;
+ std::errc ec;
+};
+
+// Workalike compatibilty version of std::from_chars from C++17. Currently
+// this only supports the `double` and `float` types.
+//
+// This interface incorporates the proposed resolutions for library issues
+// DR 3800 and DR 3801. If these are adopted with different wording,
+// Abseil's behavior will change to match the standard. (The behavior most
+// likely to change is for DR 3801, which says what `value` will be set to in
+// the case of overflow and underflow. Code that wants to avoid possible
+// breaking changes in this area should not depend on `value` when the returned
+// from_chars_result indicates a range error.)
+//
+// Searches the range [first, last) for the longest matching pattern beginning
+// at `first` that represents a floating point number. If one is found, store
+// the result in `value`.
+//
+// The matching pattern format is almost the same as that of strtod(), except
+// that C locale is not respected, and an initial '+' character in the input
+// range will never be matched.
+//
+// If `fmt` is set, it must be one of the enumerator values of the chars_format.
+// (This is despite the fact that chars_format is a bitmask type.) If set to
+// `scientific`, a matching number must contain an exponent. If set to `fixed`,
+// then an exponent will never match. (For example, the std::string "1e5" will be
+// parsed as "1".) If set to `hex`, then a hexadecimal float is parsed in the
+// format that strtod() accepts, except that a "0x" prefix is NOT matched.
+// (In particular, in `hex` mode, the input "0xff" results in the largest
+// matching pattern "0".)
+absl::from_chars_result from_chars(const char* first, const char* last,
+ double& value, // NOLINT
+ chars_format fmt = chars_format::general);
+
+absl::from_chars_result from_chars(const char* first, const char* last,
+ float& value, // NOLINT
+ chars_format fmt = chars_format::general);
+
+// std::chars_format is specified as a bitmask type, which means the following
+// operations must be provided:
+inline constexpr chars_format operator&(chars_format lhs, chars_format rhs) {
+ return static_cast<chars_format>(static_cast<int>(lhs) &
+ static_cast<int>(rhs));
+}
+inline constexpr chars_format operator|(chars_format lhs, chars_format rhs) {
+ return static_cast<chars_format>(static_cast<int>(lhs) |
+ static_cast<int>(rhs));
+}
+inline constexpr chars_format operator^(chars_format lhs, chars_format rhs) {
+ return static_cast<chars_format>(static_cast<int>(lhs) ^
+ static_cast<int>(rhs));
+}
+inline constexpr chars_format operator~(chars_format arg) {
+ return static_cast<chars_format>(~static_cast<int>(arg));
+}
+inline chars_format& operator&=(chars_format& lhs, chars_format rhs) {
+ lhs = lhs & rhs;
+ return lhs;
+}
+inline chars_format& operator|=(chars_format& lhs, chars_format rhs) {
+ lhs = lhs | rhs;
+ return lhs;
+}
+inline chars_format& operator^=(chars_format& lhs, chars_format rhs) {
+ lhs = lhs ^ rhs;
+ return lhs;
+}
+
+} // namespace absl
+
+#endif // ABSL_STRINGS_CHARCONV_H_
diff --git a/absl/strings/charconv_benchmark.cc b/absl/strings/charconv_benchmark.cc
new file mode 100644
index 00000000..fd83f44e
--- /dev/null
+++ b/absl/strings/charconv_benchmark.cc
@@ -0,0 +1,204 @@
+// Copyright 2018 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/strings/charconv.h"
+
+#include <cstdlib>
+#include <cstring>
+#include <string>
+
+#include "benchmark/benchmark.h"
+
+namespace {
+
+void BM_Strtod_Pi(benchmark::State& state) {
+ const char* pi = "3.14159";
+ for (auto s : state) {
+ benchmark::DoNotOptimize(pi);
+ benchmark::DoNotOptimize(strtod(pi, nullptr));
+ }
+}
+BENCHMARK(BM_Strtod_Pi);
+
+void BM_Absl_Pi(benchmark::State& state) {
+ const char* pi = "3.14159";
+ const char* pi_end = pi + strlen(pi);
+ for (auto s : state) {
+ benchmark::DoNotOptimize(pi);
+ double v;
+ absl::from_chars(pi, pi_end, v);
+ benchmark::DoNotOptimize(v);
+ }
+}
+BENCHMARK(BM_Absl_Pi);
+
+void BM_Strtod_Pi_float(benchmark::State& state) {
+ const char* pi = "3.14159";
+ for (auto s : state) {
+ benchmark::DoNotOptimize(pi);
+ benchmark::DoNotOptimize(strtof(pi, nullptr));
+ }
+}
+BENCHMARK(BM_Strtod_Pi_float);
+
+void BM_Absl_Pi_float(benchmark::State& state) {
+ const char* pi = "3.14159";
+ const char* pi_end = pi + strlen(pi);
+ for (auto s : state) {
+ benchmark::DoNotOptimize(pi);
+ float v;
+ absl::from_chars(pi, pi_end, v);
+ benchmark::DoNotOptimize(v);
+ }
+}
+BENCHMARK(BM_Absl_Pi_float);
+
+void BM_Strtod_HardLarge(benchmark::State& state) {
+ const char* num = "272104041512242479.e200";
+ for (auto s : state) {
+ benchmark::DoNotOptimize(num);
+ benchmark::DoNotOptimize(strtod(num, nullptr));
+ }
+}
+BENCHMARK(BM_Strtod_HardLarge);
+
+void BM_Absl_HardLarge(benchmark::State& state) {
+ const char* numstr = "272104041512242479.e200";
+ const char* numstr_end = numstr + strlen(numstr);
+ for (auto s : state) {
+ benchmark::DoNotOptimize(numstr);
+ double v;
+ absl::from_chars(numstr, numstr_end, v);
+ benchmark::DoNotOptimize(v);
+ }
+}
+BENCHMARK(BM_Absl_HardLarge);
+
+void BM_Strtod_HardSmall(benchmark::State& state) {
+ const char* num = "94080055902682397.e-242";
+ for (auto s : state) {
+ benchmark::DoNotOptimize(num);
+ benchmark::DoNotOptimize(strtod(num, nullptr));
+ }
+}
+BENCHMARK(BM_Strtod_HardSmall);
+
+void BM_Absl_HardSmall(benchmark::State& state) {
+ const char* numstr = "94080055902682397.e-242";
+ const char* numstr_end = numstr + strlen(numstr);
+ for (auto s : state) {
+ benchmark::DoNotOptimize(numstr);
+ double v;
+ absl::from_chars(numstr, numstr_end, v);
+ benchmark::DoNotOptimize(v);
+ }
+}
+BENCHMARK(BM_Absl_HardSmall);
+
+void BM_Strtod_HugeMantissa(benchmark::State& state) {
+ std::string huge(200, '3');
+ const char* num = huge.c_str();
+ for (auto s : state) {
+ benchmark::DoNotOptimize(num);
+ benchmark::DoNotOptimize(strtod(num, nullptr));
+ }
+}
+BENCHMARK(BM_Strtod_HugeMantissa);
+
+void BM_Absl_HugeMantissa(benchmark::State& state) {
+ std::string huge(200, '3');
+ const char* num = huge.c_str();
+ const char* num_end = num + 200;
+ for (auto s : state) {
+ benchmark::DoNotOptimize(num);
+ double v;
+ absl::from_chars(num, num_end, v);
+ benchmark::DoNotOptimize(v);
+ }
+}
+BENCHMARK(BM_Absl_HugeMantissa);
+
+std::string MakeHardCase(int length) {
+ // The number 1.1521...e-297 is exactly halfway between 12345 * 2**-1000 and
+ // the next larger representable number. The digits of this number are in
+ // the std::string below.
+ const std::string digits =
+ "1."
+ "152113937042223790993097181572444900347587985074226836242307364987727724"
+ "831384300183638649152607195040591791364113930628852279348613864894524591"
+ "272746490313676832900762939595690019745859128071117417798540258114233761"
+ "012939937017879509401007964861774960297319002612457273148497158989073482"
+ "171377406078223015359818300988676687994537274548940612510414856761641652"
+ "513434981938564294004070500716200446656421722229202383105446378511678258"
+ "370570631774499359748259931676320916632111681001853983492795053244971606"
+ "922718923011680846577744433974087653954904214152517799883551075537146316"
+ "168973685866425605046988661997658648354773076621610279716804960009043764"
+ "038392994055171112475093876476783502487512538082706095923790634572014823"
+ "78877699375152587890625" +
+ std::string(5000, '0');
+ // generate the hard cases on either side for the given length.
+ // Lengths between 3 and 1000 are reasonable.
+ return digits.substr(0, length) + "1e-297";
+}
+
+void BM_Strtod_Big_And_Difficult(benchmark::State& state) {
+ std::string testcase = MakeHardCase(state.range(0));
+ const char* begin = testcase.c_str();
+ for (auto s : state) {
+ benchmark::DoNotOptimize(begin);
+ benchmark::DoNotOptimize(strtod(begin, nullptr));
+ }
+}
+BENCHMARK(BM_Strtod_Big_And_Difficult)->Range(3, 5000);
+
+void BM_Absl_Big_And_Difficult(benchmark::State& state) {
+ std::string testcase = MakeHardCase(state.range(0));
+ const char* begin = testcase.c_str();
+ const char* end = begin + testcase.size();
+ for (auto s : state) {
+ benchmark::DoNotOptimize(begin);
+ double v;
+ absl::from_chars(begin, end, v);
+ benchmark::DoNotOptimize(v);
+ }
+}
+BENCHMARK(BM_Absl_Big_And_Difficult)->Range(3, 5000);
+
+} // namespace
+
+// ------------------------------------------------------------------------
+// Benchmark Time CPU Iterations
+// ------------------------------------------------------------------------
+// BM_Strtod_Pi 96 ns 96 ns 6337454
+// BM_Absl_Pi 35 ns 35 ns 20031996
+// BM_Strtod_Pi_float 91 ns 91 ns 7745851
+// BM_Absl_Pi_float 35 ns 35 ns 20430298
+// BM_Strtod_HardLarge 133 ns 133 ns 5288341
+// BM_Absl_HardLarge 181 ns 181 ns 3855615
+// BM_Strtod_HardSmall 279 ns 279 ns 2517243
+// BM_Absl_HardSmall 287 ns 287 ns 2458744
+// BM_Strtod_HugeMantissa 433 ns 433 ns 1604293
+// BM_Absl_HugeMantissa 160 ns 160 ns 4403671
+// BM_Strtod_Big_And_Difficult/3 236 ns 236 ns 2942496
+// BM_Strtod_Big_And_Difficult/8 232 ns 232 ns 2983796
+// BM_Strtod_Big_And_Difficult/64 437 ns 437 ns 1591951
+// BM_Strtod_Big_And_Difficult/512 1738 ns 1738 ns 402519
+// BM_Strtod_Big_And_Difficult/4096 3943 ns 3943 ns 176128
+// BM_Strtod_Big_And_Difficult/5000 4397 ns 4397 ns 157878
+// BM_Absl_Big_And_Difficult/3 39 ns 39 ns 17799583
+// BM_Absl_Big_And_Difficult/8 43 ns 43 ns 16096859
+// BM_Absl_Big_And_Difficult/64 550 ns 550 ns 1259717
+// BM_Absl_Big_And_Difficult/512 4167 ns 4167 ns 171414
+// BM_Absl_Big_And_Difficult/4096 9160 ns 9159 ns 76297
+// BM_Absl_Big_And_Difficult/5000 9738 ns 9738 ns 70140
diff --git a/absl/strings/charconv_test.cc b/absl/strings/charconv_test.cc
new file mode 100644
index 00000000..f8d71cc6
--- /dev/null
+++ b/absl/strings/charconv_test.cc
@@ -0,0 +1,766 @@
+// Copyright 2018 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/strings/charconv.h"
+
+#include <cstdlib>
+#include <string>
+
+#include "gmock/gmock.h"
+#include "gtest/gtest.h"
+#include "absl/strings/str_cat.h"
+
+#ifdef _MSC_FULL_VER
+#define ABSL_COMPILER_DOES_EXACT_ROUNDING 0
+#define ABSL_STRTOD_HANDLES_NAN_CORRECTLY 0
+#else
+#define ABSL_COMPILER_DOES_EXACT_ROUNDING 1
+#define ABSL_STRTOD_HANDLES_NAN_CORRECTLY 1
+#endif
+
+namespace {
+
+#if ABSL_COMPILER_DOES_EXACT_ROUNDING
+
+// Tests that the given std::string is accepted by absl::from_chars, and that it
+// converts exactly equal to the given number.
+void TestDoubleParse(absl::string_view str, double expected_number) {
+ SCOPED_TRACE(str);
+ double actual_number = 0.0;
+ absl::from_chars_result result =
+ absl::from_chars(str.data(), str.data() + str.length(), actual_number);
+ EXPECT_EQ(result.ec, std::errc());
+ EXPECT_EQ(result.ptr, str.data() + str.length());
+ EXPECT_EQ(actual_number, expected_number);
+}
+
+void TestFloatParse(absl::string_view str, float expected_number) {
+ SCOPED_TRACE(str);
+ float actual_number = 0.0;
+ absl::from_chars_result result =
+ absl::from_chars(str.data(), str.data() + str.length(), actual_number);
+ EXPECT_EQ(result.ec, std::errc());
+ EXPECT_EQ(result.ptr, str.data() + str.length());
+ EXPECT_EQ(actual_number, expected_number);
+}
+
+// Tests that the given double or single precision floating point literal is
+// parsed correctly by absl::from_chars.
+//
+// These convenience macros assume that the C++ compiler being used also does
+// fully correct decimal-to-binary conversions.
+#define FROM_CHARS_TEST_DOUBLE(number) \
+ { \
+ TestDoubleParse(#number, number); \
+ TestDoubleParse("-" #number, -number); \
+ }
+
+#define FROM_CHARS_TEST_FLOAT(number) \
+ { \
+ TestFloatParse(#number, number##f); \
+ TestFloatParse("-" #number, -number##f); \
+ }
+
+TEST(FromChars, NearRoundingCases) {
+ // Cases from "A Program for Testing IEEE Decimal-Binary Conversion"
+ // by Vern Paxson.
+
+ // Forms that should round towards zero. (These are the hardest cases for
+ // each decimal mantissa size.)
+ FROM_CHARS_TEST_DOUBLE(5.e125);
+ FROM_CHARS_TEST_DOUBLE(69.e267);
+ FROM_CHARS_TEST_DOUBLE(999.e-026);
+ FROM_CHARS_TEST_DOUBLE(7861.e-034);
+ FROM_CHARS_TEST_DOUBLE(75569.e-254);
+ FROM_CHARS_TEST_DOUBLE(928609.e-261);
+ FROM_CHARS_TEST_DOUBLE(9210917.e080);
+ FROM_CHARS_TEST_DOUBLE(84863171.e114);
+ FROM_CHARS_TEST_DOUBLE(653777767.e273);
+ FROM_CHARS_TEST_DOUBLE(5232604057.e-298);
+ FROM_CHARS_TEST_DOUBLE(27235667517.e-109);
+ FROM_CHARS_TEST_DOUBLE(653532977297.e-123);
+ FROM_CHARS_TEST_DOUBLE(3142213164987.e-294);
+ FROM_CHARS_TEST_DOUBLE(46202199371337.e-072);
+ FROM_CHARS_TEST_DOUBLE(231010996856685.e-073);
+ FROM_CHARS_TEST_DOUBLE(9324754620109615.e212);
+ FROM_CHARS_TEST_DOUBLE(78459735791271921.e049);
+ FROM_CHARS_TEST_DOUBLE(272104041512242479.e200);
+ FROM_CHARS_TEST_DOUBLE(6802601037806061975.e198);
+ FROM_CHARS_TEST_DOUBLE(20505426358836677347.e-221);
+ FROM_CHARS_TEST_DOUBLE(836168422905420598437.e-234);
+ FROM_CHARS_TEST_DOUBLE(4891559871276714924261.e222);
+ FROM_CHARS_TEST_FLOAT(5.e-20);
+ FROM_CHARS_TEST_FLOAT(67.e14);
+ FROM_CHARS_TEST_FLOAT(985.e15);
+ FROM_CHARS_TEST_FLOAT(7693.e-42);
+ FROM_CHARS_TEST_FLOAT(55895.e-16);
+ FROM_CHARS_TEST_FLOAT(996622.e-44);
+ FROM_CHARS_TEST_FLOAT(7038531.e-32);
+ FROM_CHARS_TEST_FLOAT(60419369.e-46);
+ FROM_CHARS_TEST_FLOAT(702990899.e-20);
+ FROM_CHARS_TEST_FLOAT(6930161142.e-48);
+ FROM_CHARS_TEST_FLOAT(25933168707.e-13);
+ FROM_CHARS_TEST_FLOAT(596428896559.e20);
+
+ // Similarly, forms that should round away from zero.
+ FROM_CHARS_TEST_DOUBLE(9.e-265);
+ FROM_CHARS_TEST_DOUBLE(85.e-037);
+ FROM_CHARS_TEST_DOUBLE(623.e100);
+ FROM_CHARS_TEST_DOUBLE(3571.e263);
+ FROM_CHARS_TEST_DOUBLE(81661.e153);
+ FROM_CHARS_TEST_DOUBLE(920657.e-023);
+ FROM_CHARS_TEST_DOUBLE(4603285.e-024);
+ FROM_CHARS_TEST_DOUBLE(87575437.e-309);
+ FROM_CHARS_TEST_DOUBLE(245540327.e122);
+ FROM_CHARS_TEST_DOUBLE(6138508175.e120);
+ FROM_CHARS_TEST_DOUBLE(83356057653.e193);
+ FROM_CHARS_TEST_DOUBLE(619534293513.e124);
+ FROM_CHARS_TEST_DOUBLE(2335141086879.e218);
+ FROM_CHARS_TEST_DOUBLE(36167929443327.e-159);
+ FROM_CHARS_TEST_DOUBLE(609610927149051.e-255);
+ FROM_CHARS_TEST_DOUBLE(3743626360493413.e-165);
+ FROM_CHARS_TEST_DOUBLE(94080055902682397.e-242);
+ FROM_CHARS_TEST_DOUBLE(899810892172646163.e283);
+ FROM_CHARS_TEST_DOUBLE(7120190517612959703.e120);
+ FROM_CHARS_TEST_DOUBLE(25188282901709339043.e-252);
+ FROM_CHARS_TEST_DOUBLE(308984926168550152811.e-052);
+ FROM_CHARS_TEST_DOUBLE(6372891218502368041059.e064);
+ FROM_CHARS_TEST_FLOAT(3.e-23);
+ FROM_CHARS_TEST_FLOAT(57.e18);
+ FROM_CHARS_TEST_FLOAT(789.e-35);
+ FROM_CHARS_TEST_FLOAT(2539.e-18);
+ FROM_CHARS_TEST_FLOAT(76173.e28);
+ FROM_CHARS_TEST_FLOAT(887745.e-11);
+ FROM_CHARS_TEST_FLOAT(5382571.e-37);
+ FROM_CHARS_TEST_FLOAT(82381273.e-35);
+ FROM_CHARS_TEST_FLOAT(750486563.e-38);
+ FROM_CHARS_TEST_FLOAT(3752432815.e-39);
+ FROM_CHARS_TEST_FLOAT(75224575729.e-45);
+ FROM_CHARS_TEST_FLOAT(459926601011.e15);
+}
+
+#undef FROM_CHARS_TEST_DOUBLE
+#undef FROM_CHARS_TEST_FLOAT
+#endif
+
+float ToFloat(absl::string_view s) {
+ float f;
+ absl::from_chars(s.data(), s.data() + s.size(), f);
+ return f;
+}
+
+double ToDouble(absl::string_view s) {
+ double d;
+ absl::from_chars(s.data(), s.data() + s.size(), d);
+ return d;
+}
+
+// A duplication of the test cases in "NearRoundingCases" above, but with
+// expected values expressed with integers, using ldexp/ldexpf. These test
+// cases will work even on compilers that do not accurately round floating point
+// literals.
+TEST(FromChars, NearRoundingCasesExplicit) {
+ EXPECT_EQ(ToDouble("5.e125"), ldexp(6653062250012735, 365));
+ EXPECT_EQ(ToDouble("69.e267"), ldexp(4705683757438170, 841));
+ EXPECT_EQ(ToDouble("999.e-026"), ldexp(6798841691080350, -129));
+ EXPECT_EQ(ToDouble("7861.e-034"), ldexp(8975675289889240, -153));
+ EXPECT_EQ(ToDouble("75569.e-254"), ldexp(6091718967192243, -880));
+ EXPECT_EQ(ToDouble("928609.e-261"), ldexp(7849264900213743, -900));
+ EXPECT_EQ(ToDouble("9210917.e080"), ldexp(8341110837370930, 236));
+ EXPECT_EQ(ToDouble("84863171.e114"), ldexp(4625202867375927, 353));
+ EXPECT_EQ(ToDouble("653777767.e273"), ldexp(5068902999763073, 884));
+ EXPECT_EQ(ToDouble("5232604057.e-298"), ldexp(5741343011915040, -1010));
+ EXPECT_EQ(ToDouble("27235667517.e-109"), ldexp(6707124626673586, -380));
+ EXPECT_EQ(ToDouble("653532977297.e-123"), ldexp(7078246407265384, -422));
+ EXPECT_EQ(ToDouble("3142213164987.e-294"), ldexp(8219991337640559, -988));
+ EXPECT_EQ(ToDouble("46202199371337.e-072"), ldexp(5224462102115359, -246));
+ EXPECT_EQ(ToDouble("231010996856685.e-073"), ldexp(5224462102115359, -247));
+ EXPECT_EQ(ToDouble("9324754620109615.e212"), ldexp(5539753864394442, 705));
+ EXPECT_EQ(ToDouble("78459735791271921.e049"), ldexp(8388176519442766, 166));
+ EXPECT_EQ(ToDouble("272104041512242479.e200"), ldexp(5554409530847367, 670));
+ EXPECT_EQ(ToDouble("6802601037806061975.e198"), ldexp(5554409530847367, 668));
+ EXPECT_EQ(ToDouble("20505426358836677347.e-221"),
+ ldexp(4524032052079546, -722));
+ EXPECT_EQ(ToDouble("836168422905420598437.e-234"),
+ ldexp(5070963299887562, -760));
+ EXPECT_EQ(ToDouble("4891559871276714924261.e222"),
+ ldexp(6452687840519111, 757));
+ EXPECT_EQ(ToFloat("5.e-20"), ldexpf(15474250, -88));
+ EXPECT_EQ(ToFloat("67.e14"), ldexpf(12479722, 29));
+ EXPECT_EQ(ToFloat("985.e15"), ldexpf(14333636, 36));
+ EXPECT_EQ(ToFloat("7693.e-42"), ldexpf(10979816, -150));
+ EXPECT_EQ(ToFloat("55895.e-16"), ldexpf(12888509, -61));
+ EXPECT_EQ(ToFloat("996622.e-44"), ldexpf(14224264, -150));
+ EXPECT_EQ(ToFloat("7038531.e-32"), ldexpf(11420669, -107));
+ EXPECT_EQ(ToFloat("60419369.e-46"), ldexpf(8623340, -150));
+ EXPECT_EQ(ToFloat("702990899.e-20"), ldexpf(16209866, -61));
+ EXPECT_EQ(ToFloat("6930161142.e-48"), ldexpf(9891056, -150));
+ EXPECT_EQ(ToFloat("25933168707.e-13"), ldexpf(11138211, -32));
+ EXPECT_EQ(ToFloat("596428896559.e20"), ldexpf(12333860, 82));
+
+
+ EXPECT_EQ(ToDouble("9.e-265"), ldexp(8168427841980010, -930));
+ EXPECT_EQ(ToDouble("85.e-037"), ldexp(6360455125664090, -169));
+ EXPECT_EQ(ToDouble("623.e100"), ldexp(6263531988747231, 289));
+ EXPECT_EQ(ToDouble("3571.e263"), ldexp(6234526311072170, 833));
+ EXPECT_EQ(ToDouble("81661.e153"), ldexp(6696636728760206, 472));
+ EXPECT_EQ(ToDouble("920657.e-023"), ldexp(5975405561110124, -109));
+ EXPECT_EQ(ToDouble("4603285.e-024"), ldexp(5975405561110124, -110));
+ EXPECT_EQ(ToDouble("87575437.e-309"), ldexp(8452160731874668, -1053));
+ EXPECT_EQ(ToDouble("245540327.e122"), ldexp(4985336549131723, 381));
+ EXPECT_EQ(ToDouble("6138508175.e120"), ldexp(4985336549131723, 379));
+ EXPECT_EQ(ToDouble("83356057653.e193"), ldexp(5986732817132056, 625));
+ EXPECT_EQ(ToDouble("619534293513.e124"), ldexp(4798406992060657, 399));
+ EXPECT_EQ(ToDouble("2335141086879.e218"), ldexp(5419088166961646, 713));
+ EXPECT_EQ(ToDouble("36167929443327.e-159"), ldexp(8135819834632444, -536));
+ EXPECT_EQ(ToDouble("609610927149051.e-255"), ldexp(4576664294594737, -850));
+ EXPECT_EQ(ToDouble("3743626360493413.e-165"), ldexp(6898586531774201, -549));
+ EXPECT_EQ(ToDouble("94080055902682397.e-242"), ldexp(6273271706052298, -800));
+ EXPECT_EQ(ToDouble("899810892172646163.e283"), ldexp(7563892574477827, 947));
+ EXPECT_EQ(ToDouble("7120190517612959703.e120"), ldexp(5385467232557565, 409));
+ EXPECT_EQ(ToDouble("25188282901709339043.e-252"),
+ ldexp(5635662608542340, -825));
+ EXPECT_EQ(ToDouble("308984926168550152811.e-052"),
+ ldexp(5644774693823803, -157));
+ EXPECT_EQ(ToDouble("6372891218502368041059.e064"),
+ ldexp(4616868614322430, 233));
+
+ EXPECT_EQ(ToFloat("3.e-23"), ldexpf(9507380, -98));
+ EXPECT_EQ(ToFloat("57.e18"), ldexpf(12960300, 42));
+ EXPECT_EQ(ToFloat("789.e-35"), ldexpf(10739312, -130));
+ EXPECT_EQ(ToFloat("2539.e-18"), ldexpf(11990089, -72));
+ EXPECT_EQ(ToFloat("76173.e28"), ldexpf(9845130, 86));
+ EXPECT_EQ(ToFloat("887745.e-11"), ldexpf(9760860, -40));
+ EXPECT_EQ(ToFloat("5382571.e-37"), ldexpf(11447463, -124));
+ EXPECT_EQ(ToFloat("82381273.e-35"), ldexpf(8554961, -113));
+ EXPECT_EQ(ToFloat("750486563.e-38"), ldexpf(9975678, -120));
+ EXPECT_EQ(ToFloat("3752432815.e-39"), ldexpf(9975678, -121));
+ EXPECT_EQ(ToFloat("75224575729.e-45"), ldexpf(13105970, -137));
+ EXPECT_EQ(ToFloat("459926601011.e15"), ldexpf(12466336, 65));
+}
+
+// Common test logic for converting a std::string which lies exactly halfway between
+// two target floats.
+//
+// mantissa and exponent represent the precise value between two floating point
+// numbers, `expected_low` and `expected_high`. The floating point
+// representation to parse in `StrCat(mantissa, "e", exponent)`.
+//
+// This function checks that an input just slightly less than the exact value
+// is rounded down to `expected_low`, and an input just slightly greater than
+// the exact value is rounded up to `expected_high`.
+//
+// The exact value should round to `expected_half`, which must be either
+// `expected_low` or `expected_high`.
+template <typename FloatType>
+void TestHalfwayValue(const std::string& mantissa, int exponent,
+ FloatType expected_low, FloatType expected_high,
+ FloatType expected_half) {
+ std::string low_rep = mantissa;
+ low_rep[low_rep.size() - 1] -= 1;
+ absl::StrAppend(&low_rep, std::string(1000, '9'), "e", exponent);
+
+ FloatType actual_low = 0;
+ absl::from_chars(low_rep.data(), low_rep.data() + low_rep.size(), actual_low);
+ EXPECT_EQ(expected_low, actual_low);
+
+ std::string high_rep = absl::StrCat(mantissa, std::string(1000, '0'), "1e", exponent);
+ FloatType actual_high = 0;
+ absl::from_chars(high_rep.data(), high_rep.data() + high_rep.size(),
+ actual_high);
+ EXPECT_EQ(expected_high, actual_high);
+
+ std::string halfway_rep = absl::StrCat(mantissa, "e", exponent);
+ FloatType actual_half = 0;
+ absl::from_chars(halfway_rep.data(), halfway_rep.data() + halfway_rep.size(),
+ actual_half);
+ EXPECT_EQ(expected_half, actual_half);
+}
+
+TEST(FromChars, DoubleRounding) {
+ const double zero = 0.0;
+ const double first_subnormal = nextafter(zero, 1.0);
+ const double second_subnormal = nextafter(first_subnormal, 1.0);
+
+ const double first_normal = DBL_MIN;
+ const double last_subnormal = nextafter(first_normal, 0.0);
+ const double second_normal = nextafter(first_normal, 1.0);
+
+ const double last_normal = DBL_MAX;
+ const double penultimate_normal = nextafter(last_normal, 0.0);
+
+ // Various test cases for numbers between two representable floats. Each
+ // call to TestHalfwayValue tests a number just below and just above the
+ // halfway point, as well as the number exactly between them.
+
+ // Test between zero and first_subnormal. Round-to-even tie rounds down.
+ TestHalfwayValue(
+ "2."
+ "470328229206232720882843964341106861825299013071623822127928412503377536"
+ "351043759326499181808179961898982823477228588654633283551779698981993873"
+ "980053909390631503565951557022639229085839244910518443593180284993653615"
+ "250031937045767824921936562366986365848075700158576926990370631192827955"
+ "855133292783433840935197801553124659726357957462276646527282722005637400"
+ "648549997709659947045402082816622623785739345073633900796776193057750674"
+ "017632467360096895134053553745851666113422376667860416215968046191446729"
+ "184030053005753084904876539171138659164623952491262365388187963623937328"
+ "042389101867234849766823508986338858792562830275599565752445550725518931"
+ "369083625477918694866799496832404970582102851318545139621383772282614543"
+ "7693412532098591327667236328125",
+ -324, zero, first_subnormal, zero);
+
+ // first_subnormal and second_subnormal. Round-to-even tie rounds up.
+ TestHalfwayValue(
+ "7."
+ "410984687618698162648531893023320585475897039214871466383785237510132609"
+ "053131277979497545424539885696948470431685765963899850655339096945981621"
+ "940161728171894510697854671067917687257517734731555330779540854980960845"
+ "750095811137303474765809687100959097544227100475730780971111893578483867"
+ "565399878350301522805593404659373979179073872386829939581848166016912201"
+ "945649993128979841136206248449867871357218035220901702390328579173252022"
+ "052897402080290685402160661237554998340267130003581248647904138574340187"
+ "552090159017259254714629617513415977493871857473787096164563890871811984"
+ "127167305601704549300470526959016576377688490826798697257336652176556794"
+ "107250876433756084600398490497214911746308553955635418864151316847843631"
+ "3080237596295773983001708984375",
+ -324, first_subnormal, second_subnormal, second_subnormal);
+
+ // last_subnormal and first_normal. Round-to-even tie rounds up.
+ TestHalfwayValue(
+ "2."
+ "225073858507201136057409796709131975934819546351645648023426109724822222"
+ "021076945516529523908135087914149158913039621106870086438694594645527657"
+ "207407820621743379988141063267329253552286881372149012981122451451889849"
+ "057222307285255133155755015914397476397983411801999323962548289017107081"
+ "850690630666655994938275772572015763062690663332647565300009245888316433"
+ "037779791869612049497390377829704905051080609940730262937128958950003583"
+ "799967207254304360284078895771796150945516748243471030702609144621572289"
+ "880258182545180325707018860872113128079512233426288368622321503775666622"
+ "503982534335974568884423900265498198385487948292206894721689831099698365"
+ "846814022854243330660339850886445804001034933970427567186443383770486037"
+ "86162277173854562306587467901408672332763671875",
+ -308, last_subnormal, first_normal, first_normal);
+
+ // first_normal and second_normal. Round-to-even tie rounds down.
+ TestHalfwayValue(
+ "2."
+ "225073858507201630123055637955676152503612414573018013083228724049586647"
+ "606759446192036794116886953213985520549032000903434781884412325572184367"
+ "563347617020518175998922941393629966742598285899994830148971433555578567"
+ "693279306015978183162142425067962460785295885199272493577688320732492479"
+ "924816869232247165964934329258783950102250973957579510571600738343645738"
+ "494324192997092179207389919761694314131497173265255020084997973676783743"
+ "155205818804439163810572367791175177756227497413804253387084478193655533"
+ "073867420834526162513029462022730109054820067654020201547112002028139700"
+ "141575259123440177362244273712468151750189745559978653234255886219611516"
+ "335924167958029604477064946470184777360934300451421683607013647479513962"
+ "13837722826145437693412532098591327667236328125",
+ -308, first_normal, second_normal, first_normal);
+
+ // penultimate_normal and last_normal. Round-to-even rounds down.
+ TestHalfwayValue(
+ "1."
+ "797693134862315608353258760581052985162070023416521662616611746258695532"
+ "672923265745300992879465492467506314903358770175220871059269879629062776"
+ "047355692132901909191523941804762171253349609463563872612866401980290377"
+ "995141836029815117562837277714038305214839639239356331336428021390916694"
+ "57927874464075218944",
+ 308, penultimate_normal, last_normal, penultimate_normal);
+}
+
+// Same test cases as DoubleRounding, now with new and improved Much Smaller
+// Precision!
+TEST(FromChars, FloatRounding) {
+ const float zero = 0.0;
+ const float first_subnormal = nextafterf(zero, 1.0);
+ const float second_subnormal = nextafterf(first_subnormal, 1.0);
+
+ const float first_normal = FLT_MIN;
+ const float last_subnormal = nextafterf(first_normal, 0.0);
+ const float second_normal = nextafterf(first_normal, 1.0);
+
+ const float last_normal = FLT_MAX;
+ const float penultimate_normal = nextafterf(last_normal, 0.0);
+
+ // Test between zero and first_subnormal. Round-to-even tie rounds down.
+ TestHalfwayValue(
+ "7."
+ "006492321624085354618647916449580656401309709382578858785341419448955413"
+ "42930300743319094181060791015625",
+ -46, zero, first_subnormal, zero);
+
+ // first_subnormal and second_subnormal. Round-to-even tie rounds up.
+ TestHalfwayValue(
+ "2."
+ "101947696487225606385594374934874196920392912814773657635602425834686624"
+ "028790902229957282543182373046875",
+ -45, first_subnormal, second_subnormal, second_subnormal);
+
+ // last_subnormal and first_normal. Round-to-even tie rounds up.
+ TestHalfwayValue(
+ "1."
+ "175494280757364291727882991035766513322858992758990427682963118425003064"
+ "9651730385585324256680905818939208984375",
+ -38, last_subnormal, first_normal, first_normal);
+
+ // first_normal and second_normal. Round-to-even tie rounds down.
+ TestHalfwayValue(
+ "1."
+ "175494420887210724209590083408724842314472120785184615334540294131831453"
+ "9442813071445925743319094181060791015625",
+ -38, first_normal, second_normal, first_normal);
+
+ // penultimate_normal and last_normal. Round-to-even rounds down.
+ TestHalfwayValue("3.40282336497324057985868971510891282432", 38,
+ penultimate_normal, last_normal, penultimate_normal);
+}
+
+TEST(FromChars, Underflow) {
+ // Check that underflow is handled correctly, according to the specification
+ // in DR 3081.
+ double d;
+ float f;
+ absl::from_chars_result result;
+
+ std::string negative_underflow = "-1e-1000";
+ const char* begin = negative_underflow.data();
+ const char* end = begin + negative_underflow.size();
+ d = 100.0;
+ result = absl::from_chars(begin, end, d);
+ EXPECT_EQ(result.ptr, end);
+ EXPECT_EQ(result.ec, std::errc::result_out_of_range);
+ EXPECT_TRUE(std::signbit(d)); // negative
+ EXPECT_GE(d, -std::numeric_limits<double>::min());
+ f = 100.0;
+ result = absl::from_chars(begin, end, f);
+ EXPECT_EQ(result.ptr, end);
+ EXPECT_EQ(result.ec, std::errc::result_out_of_range);
+ EXPECT_TRUE(std::signbit(f)); // negative
+ EXPECT_GE(f, -std::numeric_limits<float>::min());
+
+ std::string positive_underflow = "1e-1000";
+ begin = positive_underflow.data();
+ end = begin + positive_underflow.size();
+ d = -100.0;
+ result = absl::from_chars(begin, end, d);
+ EXPECT_EQ(result.ptr, end);
+ EXPECT_EQ(result.ec, std::errc::result_out_of_range);
+ EXPECT_FALSE(std::signbit(d)); // positive
+ EXPECT_LE(d, std::numeric_limits<double>::min());
+ f = -100.0;
+ result = absl::from_chars(begin, end, f);
+ EXPECT_EQ(result.ptr, end);
+ EXPECT_EQ(result.ec, std::errc::result_out_of_range);
+ EXPECT_FALSE(std::signbit(f)); // positive
+ EXPECT_LE(f, std::numeric_limits<float>::min());
+}
+
+TEST(FromChars, Overflow) {
+ // Check that overflow is handled correctly, according to the specification
+ // in DR 3081.
+ double d;
+ float f;
+ absl::from_chars_result result;
+
+ std::string negative_overflow = "-1e1000";
+ const char* begin = negative_overflow.data();
+ const char* end = begin + negative_overflow.size();
+ d = 100.0;
+ result = absl::from_chars(begin, end, d);
+ EXPECT_EQ(result.ptr, end);
+ EXPECT_EQ(result.ec, std::errc::result_out_of_range);
+ EXPECT_TRUE(std::signbit(d)); // negative
+ EXPECT_EQ(d, -std::numeric_limits<double>::max());
+ f = 100.0;
+ result = absl::from_chars(begin, end, f);
+ EXPECT_EQ(result.ptr, end);
+ EXPECT_EQ(result.ec, std::errc::result_out_of_range);
+ EXPECT_TRUE(std::signbit(f)); // negative
+ EXPECT_EQ(f, -std::numeric_limits<float>::max());
+
+ std::string positive_overflow = "1e1000";
+ begin = positive_overflow.data();
+ end = begin + positive_overflow.size();
+ d = -100.0;
+ result = absl::from_chars(begin, end, d);
+ EXPECT_EQ(result.ptr, end);
+ EXPECT_EQ(result.ec, std::errc::result_out_of_range);
+ EXPECT_FALSE(std::signbit(d)); // positive
+ EXPECT_EQ(d, std::numeric_limits<double>::max());
+ f = -100.0;
+ result = absl::from_chars(begin, end, f);
+ EXPECT_EQ(result.ptr, end);
+ EXPECT_EQ(result.ec, std::errc::result_out_of_range);
+ EXPECT_FALSE(std::signbit(f)); // positive
+ EXPECT_EQ(f, std::numeric_limits<float>::max());
+}
+
+TEST(FromChars, ReturnValuePtr) {
+ // Check that `ptr` points one past the number scanned, even if that number
+ // is not representable.
+ double d;
+ absl::from_chars_result result;
+
+ std::string normal = "3.14@#$%@#$%";
+ result = absl::from_chars(normal.data(), normal.data() + normal.size(), d);
+ EXPECT_EQ(result.ec, std::errc());
+ EXPECT_EQ(result.ptr - normal.data(), 4);
+
+ std::string overflow = "1e1000@#$%@#$%";
+ result = absl::from_chars(overflow.data(),
+ overflow.data() + overflow.size(), d);
+ EXPECT_EQ(result.ec, std::errc::result_out_of_range);
+ EXPECT_EQ(result.ptr - overflow.data(), 6);
+
+ std::string garbage = "#$%@#$%";
+ result = absl::from_chars(garbage.data(),
+ garbage.data() + garbage.size(), d);
+ EXPECT_EQ(result.ec, std::errc::invalid_argument);
+ EXPECT_EQ(result.ptr - garbage.data(), 0);
+}
+
+// Check for a wide range of inputs that strtod() and absl::from_chars() exactly
+// agree on the conversion amount.
+//
+// This test assumes the platform's strtod() uses perfect round_to_nearest
+// rounding.
+TEST(FromChars, TestVersusStrtod) {
+ for (int mantissa = 1000000; mantissa <= 9999999; mantissa += 501) {
+ for (int exponent = -300; exponent < 300; ++exponent) {
+ std::string candidate = absl::StrCat(mantissa, "e", exponent);
+ double strtod_value = strtod(candidate.c_str(), nullptr);
+ double absl_value = 0;
+ absl::from_chars(candidate.data(), candidate.data() + candidate.size(),
+ absl_value);
+ ASSERT_EQ(strtod_value, absl_value) << candidate;
+ }
+ }
+}
+
+// Check for a wide range of inputs that strtof() and absl::from_chars() exactly
+// agree on the conversion amount.
+//
+// This test assumes the platform's strtof() uses perfect round_to_nearest
+// rounding.
+TEST(FromChars, TestVersusStrtof) {
+ for (int mantissa = 1000000; mantissa <= 9999999; mantissa += 501) {
+ for (int exponent = -43; exponent < 32; ++exponent) {
+ std::string candidate = absl::StrCat(mantissa, "e", exponent);
+ float strtod_value = strtof(candidate.c_str(), nullptr);
+ float absl_value = 0;
+ absl::from_chars(candidate.data(), candidate.data() + candidate.size(),
+ absl_value);
+ ASSERT_EQ(strtod_value, absl_value) << candidate;
+ }
+ }
+}
+
+// Tests if two floating point values have identical bit layouts. (EXPECT_EQ
+// is not suitable for NaN testing, since NaNs are never equal.)
+template <typename Float>
+bool Identical(Float a, Float b) {
+ return 0 == memcmp(&a, &b, sizeof(Float));
+}
+
+// Check that NaNs are parsed correctly. The spec requires that
+// std::from_chars on "NaN(123abc)" return the same value as std::nan("123abc").
+// How such an n-char-sequence affects the generated NaN is unspecified, so we
+// just test for symmetry with std::nan and strtod here.
+//
+// (In Linux, this parses the value as a number and stuffs that number into the
+// free bits of a quiet NaN.)
+TEST(FromChars, NaNDoubles) {
+ for (std::string n_char_sequence :
+ {"", "1", "2", "3", "fff", "FFF", "200000", "400000", "4000000000000",
+ "8000000000000", "abc123", "legal_but_unexpected",
+ "99999999999999999999999", "_"}) {
+ std::string input = absl::StrCat("nan(", n_char_sequence, ")");
+ SCOPED_TRACE(input);
+ double from_chars_double;
+ absl::from_chars(input.data(), input.data() + input.size(),
+ from_chars_double);
+ double std_nan_double = std::nan(n_char_sequence.c_str());
+ EXPECT_TRUE(Identical(from_chars_double, std_nan_double));
+
+ // Also check that we match strtod()'s behavior. This test assumes that the
+ // platform has a compliant strtod().
+#if ABSL_STRTOD_HANDLES_NAN_CORRECTLY
+ double strtod_double = strtod(input.c_str(), nullptr);
+ EXPECT_TRUE(Identical(from_chars_double, strtod_double));
+#endif // ABSL_STRTOD_HANDLES_NAN_CORRECTLY
+
+ // Check that we can parse a negative NaN
+ std::string negative_input = "-" + input;
+ double negative_from_chars_double;
+ absl::from_chars(negative_input.data(),
+ negative_input.data() + negative_input.size(),
+ negative_from_chars_double);
+ EXPECT_TRUE(std::signbit(negative_from_chars_double));
+ EXPECT_FALSE(Identical(negative_from_chars_double, from_chars_double));
+ from_chars_double = std::copysign(from_chars_double, -1.0);
+ EXPECT_TRUE(Identical(negative_from_chars_double, from_chars_double));
+ }
+}
+
+TEST(FromChars, NaNFloats) {
+ for (std::string n_char_sequence :
+ {"", "1", "2", "3", "fff", "FFF", "200000", "400000", "4000000000000",
+ "8000000000000", "abc123", "legal_but_unexpected",
+ "99999999999999999999999", "_"}) {
+ std::string input = absl::StrCat("nan(", n_char_sequence, ")");
+ SCOPED_TRACE(input);
+ float from_chars_float;
+ absl::from_chars(input.data(), input.data() + input.size(),
+ from_chars_float);
+ float std_nan_float = std::nanf(n_char_sequence.c_str());
+ EXPECT_TRUE(Identical(from_chars_float, std_nan_float));
+
+ // Also check that we match strtof()'s behavior. This test assumes that the
+ // platform has a compliant strtof().
+#if ABSL_STRTOD_HANDLES_NAN_CORRECTLY
+ float strtof_float = strtof(input.c_str(), nullptr);
+ EXPECT_TRUE(Identical(from_chars_float, strtof_float));
+#endif // ABSL_STRTOD_HANDLES_NAN_CORRECTLY
+
+ // Check that we can parse a negative NaN
+ std::string negative_input = "-" + input;
+ float negative_from_chars_float;
+ absl::from_chars(negative_input.data(),
+ negative_input.data() + negative_input.size(),
+ negative_from_chars_float);
+ EXPECT_TRUE(std::signbit(negative_from_chars_float));
+ EXPECT_FALSE(Identical(negative_from_chars_float, from_chars_float));
+ from_chars_float = std::copysign(from_chars_float, -1.0);
+ EXPECT_TRUE(Identical(negative_from_chars_float, from_chars_float));
+ }
+}
+
+// Returns an integer larger than step. The values grow exponentially.
+int NextStep(int step) {
+ return step + (step >> 2) + 1;
+}
+
+// Test a conversion on a family of input strings, checking that the calculation
+// is correct for in-bounds values, and that overflow and underflow are done
+// correctly for out-of-bounds values.
+//
+// input_generator maps from an integer index to a std::string to test.
+// expected_generator maps from an integer index to an expected Float value.
+// from_chars conversion of input_generator(i) should result in
+// expected_generator(i).
+//
+// lower_bound and upper_bound denote the smallest and largest values for which
+// the conversion is expected to succeed.
+template <typename Float>
+void TestOverflowAndUnderflow(
+ const std::function<std::string(int)>& input_generator,
+ const std::function<Float(int)>& expected_generator, int lower_bound,
+ int upper_bound) {
+ // test legal values near lower_bound
+ int index, step;
+ for (index = lower_bound, step = 1; index < upper_bound;
+ index += step, step = NextStep(step)) {
+ std::string input = input_generator(index);
+ SCOPED_TRACE(input);
+ Float expected = expected_generator(index);
+ Float actual;
+ auto result =
+ absl::from_chars(input.data(), input.data() + input.size(), actual);
+ EXPECT_EQ(result.ec, std::errc());
+ EXPECT_EQ(expected, actual);
+ }
+ // test legal values near upper_bound
+ for (index = upper_bound, step = 1; index > lower_bound;
+ index -= step, step = NextStep(step)) {
+ std::string input = input_generator(index);
+ SCOPED_TRACE(input);
+ Float expected = expected_generator(index);
+ Float actual;
+ auto result =
+ absl::from_chars(input.data(), input.data() + input.size(), actual);
+ EXPECT_EQ(result.ec, std::errc());
+ EXPECT_EQ(expected, actual);
+ }
+ // Test underflow values below lower_bound
+ for (index = lower_bound - 1, step = 1; index > -1000000;
+ index -= step, step = NextStep(step)) {
+ std::string input = input_generator(index);
+ SCOPED_TRACE(input);
+ Float actual;
+ auto result =
+ absl::from_chars(input.data(), input.data() + input.size(), actual);
+ EXPECT_EQ(result.ec, std::errc::result_out_of_range);
+ EXPECT_LT(actual, 1.0); // check for underflow
+ }
+ // Test overflow values above upper_bound
+ for (index = upper_bound + 1, step = 1; index < 1000000;
+ index += step, step = NextStep(step)) {
+ std::string input = input_generator(index);
+ SCOPED_TRACE(input);
+ Float actual;
+ auto result =
+ absl::from_chars(input.data(), input.data() + input.size(), actual);
+ EXPECT_EQ(result.ec, std::errc::result_out_of_range);
+ EXPECT_GT(actual, 1.0); // check for overflow
+ }
+}
+
+// Check that overflow and underflow are caught correctly for hex doubles.
+//
+// The largest representable double is 0x1.fffffffffffffp+1023, and the
+// smallest representable subnormal is 0x0.0000000000001p-1022, which equals
+// 0x1p-1074. Therefore 1023 and -1074 are the limits of acceptable exponents
+// in this test.
+TEST(FromChars, HexdecimalDoubleLimits) {
+ auto input_gen = [](int index) { return absl::StrCat("0x1.0p", index); };
+ auto expected_gen = [](int index) { return std::ldexp(1.0, index); };
+ TestOverflowAndUnderflow<double>(input_gen, expected_gen, -1074, 1023);
+}
+
+// Check that overflow and underflow are caught correctly for hex floats.
+//
+// The largest representable float is 0x1.fffffep+127, and the smallest
+// representable subnormal is 0x0.000002p-126, which equals 0x1p-149.
+// Therefore 127 and -149 are the limits of acceptable exponents in this test.
+TEST(FromChars, HexdecimalFloatLimits) {
+ auto input_gen = [](int index) { return absl::StrCat("0x1.0p", index); };
+ auto expected_gen = [](int index) { return std::ldexp(1.0f, index); };
+ TestOverflowAndUnderflow<float>(input_gen, expected_gen, -149, 127);
+}
+
+// Check that overflow and underflow are caught correctly for decimal doubles.
+//
+// The largest representable double is about 1.8e308, and the smallest
+// representable subnormal is about 5e-324. '1e-324' therefore rounds away from
+// the smallest representable positive value. -323 and 308 are the limits of
+// acceptable exponents in this test.
+TEST(FromChars, DecimalDoubleLimits) {
+ auto input_gen = [](int index) { return absl::StrCat("1.0e", index); };
+ auto expected_gen = [](int index) { return std::pow(10.0, index); };
+ TestOverflowAndUnderflow<double>(input_gen, expected_gen, -323, 308);
+}
+
+// Check that overflow and underflow are caught correctly for decimal floats.
+//
+// The largest representable float is about 3.4e38, and the smallest
+// representable subnormal is about 1.45e-45. '1e-45' therefore rounds towards
+// the smallest representable positive value. -45 and 38 are the limits of
+// acceptable exponents in this test.
+TEST(FromChars, DecimalFloatLimits) {
+ auto input_gen = [](int index) { return absl::StrCat("1.0e", index); };
+ auto expected_gen = [](int index) { return std::pow(10.0, index); };
+ TestOverflowAndUnderflow<float>(input_gen, expected_gen, -45, 38);
+}
+
+} // namespace
diff --git a/absl/strings/internal/charconv_bigint.cc b/absl/strings/internal/charconv_bigint.cc
new file mode 100644
index 00000000..3e7296e7
--- /dev/null
+++ b/absl/strings/internal/charconv_bigint.cc
@@ -0,0 +1,357 @@
+// Copyright 2018 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/strings/internal/charconv_bigint.h"
+
+#include <algorithm>
+#include <cassert>
+#include <string>
+
+namespace absl {
+namespace strings_internal {
+
+namespace {
+
+// Table containing some large powers of 5, for fast computation.
+
+// Constant step size for entries in the kLargePowersOfFive table. Each entry
+// is larger than the previous entry by a factor of 5**kLargePowerOfFiveStep
+// (or 5**27).
+//
+// In other words, the Nth entry in the table is 5**(27*N).
+//
+// 5**27 is the largest power of 5 that fits in 64 bits.
+constexpr int kLargePowerOfFiveStep = 27;
+
+// The largest legal index into the kLargePowersOfFive table.
+//
+// In other words, the largest precomputed power of 5 is 5**(27*20).
+constexpr int kLargestPowerOfFiveIndex = 20;
+
+// Table of powers of (5**27), up to (5**27)**20 == 5**540.
+//
+// Used to generate large powers of 5 while limiting the number of repeated
+// multiplications required.
+//
+// clang-format off
+const uint32_t kLargePowersOfFive[] = {
+// 5**27 (i=1), start=0, end=2
+ 0xfa10079dU, 0x6765c793U,
+// 5**54 (i=2), start=2, end=6
+ 0x97d9f649U, 0x6664242dU, 0x29939b14U, 0x29c30f10U,
+// 5**81 (i=3), start=6, end=12
+ 0xc4f809c5U, 0x7bf3f22aU, 0x67bdae34U, 0xad340517U, 0x369d1b5fU, 0x10de1593U,
+// 5**108 (i=4), start=12, end=20
+ 0x92b260d1U, 0x9efff7c7U, 0x81de0ec6U, 0xaeba5d56U, 0x410664a4U, 0x4f40737aU,
+ 0x20d3846fU, 0x06d00f73U,
+// 5**135 (i=5), start=20, end=30
+ 0xff1b172dU, 0x13a1d71cU, 0xefa07617U, 0x7f682d3dU, 0xff8c90c0U, 0x3f0131e7U,
+ 0x3fdcb9feU, 0x917b0177U, 0x16c407a7U, 0x02c06b9dU,
+// 5**162 (i=6), start=30, end=42
+ 0x960f7199U, 0x056667ecU, 0xe07aefd8U, 0x80f2b9ccU, 0x8273f5e3U, 0xeb9a214aU,
+ 0x40b38005U, 0x0e477ad4U, 0x277d08e6U, 0xfa28b11eU, 0xd3f7d784U, 0x011c835bU,
+// 5**189 (i=7), start=42, end=56
+ 0xf723d9d5U, 0x3282d3f3U, 0xe00857d1U, 0x69659d25U, 0x2cf117cfU, 0x24da6d07U,
+ 0x954d1417U, 0x3e5d8cedU, 0x7a8bb766U, 0xfd785ae6U, 0x645436d2U, 0x40c78b34U,
+ 0x94151217U, 0x0072e9f7U,
+// 5**216 (i=8), start=56, end=72
+ 0x2b416aa1U, 0x7893c5a7U, 0xe37dc6d4U, 0x2bad2beaU, 0xf0fc846cU, 0x7575ae4bU,
+ 0x62587b14U, 0x83b67a34U, 0x02110cdbU, 0xf7992f55U, 0x00deb022U, 0xa4a23becU,
+ 0x8af5c5cdU, 0xb85b654fU, 0x818df38bU, 0x002e69d2U,
+// 5**243 (i=9), start=72, end=90
+ 0x3518cbbdU, 0x20b0c15fU, 0x38756c2fU, 0xfb5dc3ddU, 0x22ad2d94U, 0xbf35a952U,
+ 0xa699192aU, 0x9a613326U, 0xad2a9cedU, 0xd7f48968U, 0xe87dfb54U, 0xc8f05db6U,
+ 0x5ef67531U, 0x31c1ab49U, 0xe202ac9fU, 0x9b2957b5U, 0xa143f6d3U, 0x0012bf07U,
+// 5**270 (i=10), start=90, end=110
+ 0x8b971de9U, 0x21aba2e1U, 0x63944362U, 0x57172336U, 0xd9544225U, 0xfb534166U,
+ 0x08c563eeU, 0x14640ee2U, 0x24e40d31U, 0x02b06537U, 0x03887f14U, 0x0285e533U,
+ 0xb744ef26U, 0x8be3a6c4U, 0x266979b4U, 0x6761ece2U, 0xd9cb39e4U, 0xe67de319U,
+ 0x0d39e796U, 0x00079250U,
+// 5**297 (i=11), start=110, end=132
+ 0x260eb6e5U, 0xf414a796U, 0xee1a7491U, 0xdb9368ebU, 0xf50c105bU, 0x59157750U,
+ 0x9ed2fb5cU, 0xf6e56d8bU, 0xeaee8d23U, 0x0f319f75U, 0x2aa134d6U, 0xac2908e9U,
+ 0xd4413298U, 0x02f02a55U, 0x989d5a7aU, 0x70dde184U, 0xba8040a7U, 0x03200981U,
+ 0xbe03b11cU, 0x3c1c2a18U, 0xd60427a1U, 0x00030ee0U,
+// 5**324 (i=12), start=132, end=156
+ 0xce566d71U, 0xf1c4aa25U, 0x4e93ca53U, 0xa72283d0U, 0x551a73eaU, 0x3d0538e2U,
+ 0x8da4303fU, 0x6a58de60U, 0x0e660221U, 0x49cf61a6U, 0x8d058fc1U, 0xb9d1a14cU,
+ 0x4bab157dU, 0xc85c6932U, 0x518c8b9eU, 0x9b92b8d0U, 0x0d8a0e21U, 0xbd855df9U,
+ 0xb3ea59a1U, 0x8da29289U, 0x4584d506U, 0x3752d80fU, 0xb72569c6U, 0x00013c33U,
+// 5**351 (i=13), start=156, end=182
+ 0x190f354dU, 0x83695cfeU, 0xe5a4d0c7U, 0xb60fb7e8U, 0xee5bbcc4U, 0xb922054cU,
+ 0xbb4f0d85U, 0x48394028U, 0x1d8957dbU, 0x0d7edb14U, 0x4ecc7587U, 0x505e9e02U,
+ 0x4c87f36bU, 0x99e66bd6U, 0x44b9ed35U, 0x753037d4U, 0xe5fe5f27U, 0x2742c203U,
+ 0x13b2ed2bU, 0xdc525d2cU, 0xe6fde59aU, 0x77ffb18fU, 0x13c5752cU, 0x08a84bccU,
+ 0x859a4940U, 0x00007fb6U,
+// 5**378 (i=14), start=182, end=210
+ 0x4f98cb39U, 0xa60edbbcU, 0x83b5872eU, 0xa501acffU, 0x9cc76f78U, 0xbadd4c73U,
+ 0x43e989faU, 0xca7acf80U, 0x2e0c824fU, 0xb19f4ffcU, 0x092fd81cU, 0xe4eb645bU,
+ 0xa1ff84c2U, 0x8a5a83baU, 0xa8a1fae9U, 0x1db43609U, 0xb0fed50bU, 0x0dd7d2bdU,
+ 0x7d7accd8U, 0x91fa640fU, 0x37dcc6c5U, 0x1c417fd5U, 0xe4d462adU, 0xe8a43399U,
+ 0x131bf9a5U, 0x8df54d29U, 0x36547dc1U, 0x00003395U,
+// 5**405 (i=15), start=210, end=240
+ 0x5bd330f5U, 0x77d21967U, 0x1ac481b7U, 0x6be2f7ceU, 0x7f4792a9U, 0xe84c2c52U,
+ 0x84592228U, 0x9dcaf829U, 0xdab44ce1U, 0x3d0c311bU, 0x532e297dU, 0x4704e8b4U,
+ 0x9cdc32beU, 0x41e64d9dU, 0x7717bea1U, 0xa824c00dU, 0x08f50b27U, 0x0f198d77U,
+ 0x49bbfdf0U, 0x025c6c69U, 0xd4e55cd3U, 0xf083602bU, 0xb9f0fecdU, 0xc0864aeaU,
+ 0x9cb98681U, 0xaaf620e9U, 0xacb6df30U, 0x4faafe66U, 0x8af13c3bU, 0x000014d5U,
+// 5**432 (i=16), start=240, end=272
+ 0x682bb941U, 0x89a9f297U, 0xcba75d7bU, 0x404217b1U, 0xb4e519e9U, 0xa1bc162bU,
+ 0xf7f5910aU, 0x98715af5U, 0x2ff53e57U, 0xe3ef118cU, 0x490c4543U, 0xbc9b1734U,
+ 0x2affbe4dU, 0x4cedcb4cU, 0xfb14e99eU, 0x35e34212U, 0xece39c24U, 0x07673ab3U,
+ 0xe73115ddU, 0xd15d38e7U, 0x093eed3bU, 0xf8e7eac5U, 0x78a8cc80U, 0x25227aacU,
+ 0x3f590551U, 0x413da1cbU, 0xdf643a55U, 0xab65ad44U, 0xd70b23d7U, 0xc672cd76U,
+ 0x3364ea62U, 0x0000086aU,
+// 5**459 (i=17), start=272, end=306
+ 0x22f163ddU, 0x23cf07acU, 0xbe2af6c2U, 0xf412f6f6U, 0xc3ff541eU, 0x6eeaf7deU,
+ 0xa47047e0U, 0x408cda92U, 0x0f0eeb08U, 0x56deba9dU, 0xcfc6b090U, 0x8bbbdf04U,
+ 0x3933cdb3U, 0x9e7bb67dU, 0x9f297035U, 0x38946244U, 0xee1d37bbU, 0xde898174U,
+ 0x63f3559dU, 0x705b72fbU, 0x138d27d9U, 0xf8603a78U, 0x735eec44U, 0xe30987d5U,
+ 0xc6d38070U, 0x9cfe548eU, 0x9ff01422U, 0x7c564aa8U, 0x91cc60baU, 0xcbc3565dU,
+ 0x7550a50bU, 0x6909aeadU, 0x13234c45U, 0x00000366U,
+// 5**486 (i=18), start=306, end=342
+ 0x17954989U, 0x3a7d7709U, 0x98042de5U, 0xa9011443U, 0x45e723c2U, 0x269ffd6fU,
+ 0x58852a46U, 0xaaa1042aU, 0x2eee8153U, 0xb2b6c39eU, 0xaf845b65U, 0xf6c365d7U,
+ 0xe4cffb2bU, 0xc840e90cU, 0xabea8abbU, 0x5c58f8d2U, 0x5c19fa3aU, 0x4670910aU,
+ 0x4449f21cU, 0xefa645b3U, 0xcc427decU, 0x083c3d73U, 0x467cb413U, 0x6fe10ae4U,
+ 0x3caffc72U, 0x9f8da55eU, 0x5e5c8ea7U, 0x490594bbU, 0xf0871b0bU, 0xdd89816cU,
+ 0x8e931df8U, 0xe85ce1c9U, 0xcca090a5U, 0x575fa16bU, 0x6b9f106cU, 0x0000015fU,
+// 5**513 (i=19), start=342, end=380
+ 0xee20d805U, 0x57bc3c07U, 0xcdea624eU, 0xd3f0f52dU, 0x9924b4f4U, 0xcf968640U,
+ 0x61d41962U, 0xe87fb464U, 0xeaaf51c7U, 0x564c8b60U, 0xccda4028U, 0x529428bbU,
+ 0x313a1fa8U, 0x96bd0f94U, 0x7a82ebaaU, 0xad99e7e9U, 0xf2668cd4U, 0xbe33a45eU,
+ 0xfd0db669U, 0x87ee369fU, 0xd3ec20edU, 0x9c4d7db7U, 0xdedcf0d8U, 0x7cd2ca64U,
+ 0xe25a6577U, 0x61003fd4U, 0xe56f54ccU, 0x10b7c748U, 0x40526e5eU, 0x7300ae87U,
+ 0x5c439261U, 0x2c0ff469U, 0xbf723f12U, 0xb2379b61U, 0xbf59b4f5U, 0xc91b1c3fU,
+ 0xf0046d27U, 0x0000008dU,
+// 5**540 (i=20), start=380, end=420
+ 0x525c9e11U, 0xf4e0eb41U, 0xebb2895dU, 0x5da512f9U, 0x7d9b29d4U, 0x452f4edcU,
+ 0x0b90bc37U, 0x341777cbU, 0x63d269afU, 0x1da77929U, 0x0a5c1826U, 0x77991898U,
+ 0x5aeddf86U, 0xf853a877U, 0x538c31ccU, 0xe84896daU, 0xb7a0010bU, 0x17ef4de5U,
+ 0xa52a2adeU, 0x029fd81cU, 0x987ce701U, 0x27fefd77U, 0xdb46c66fU, 0x5d301900U,
+ 0x496998c0U, 0xbb6598b9U, 0x5eebb607U, 0xe547354aU, 0xdf4a2f7eU, 0xf06c4955U,
+ 0x96242ffaU, 0x1775fb27U, 0xbecc58ceU, 0xebf2a53bU, 0x3eaad82aU, 0xf41137baU,
+ 0x573e6fbaU, 0xfb4866b8U, 0x54002148U, 0x00000039U,
+};
+// clang-format on
+
+// Returns a pointer to the big integer data for (5**27)**i. i must be
+// between 1 and 20, inclusive.
+const uint32_t* LargePowerOfFiveData(int i) {
+ return kLargePowersOfFive + i * (i - 1);
+}
+
+// Returns the size of the big integer data for (5**27)**i, in words. i must be
+// between 1 and 20, inclusive.
+int LargePowerOfFiveSize(int i) { return 2 * i; }
+} // namespace
+
+const uint32_t kFiveToNth[14] = {
+ 1, 5, 25, 125, 625, 3125, 15625,
+ 78125, 390625, 1953125, 9765625, 48828125, 244140625, 1220703125,
+};
+
+const uint32_t kTenToNth[10] = {
+ 1, 10, 100, 1000, 10000, 100000, 1000000, 10000000, 100000000, 1000000000,
+};
+
+template <int max_words>
+int BigUnsigned<max_words>::ReadFloatMantissa(const ParsedFloat& fp,
+ int significant_digits) {
+ SetToZero();
+ assert(fp.type == FloatType::kNumber);
+
+ if (fp.subrange_begin == nullptr) {
+ // We already exactly parsed the mantissa, so no more work is necessary.
+ words_[0] = fp.mantissa & 0xffffffffu;
+ words_[1] = fp.mantissa >> 32;
+ if (words_[1]) {
+ size_ = 2;
+ } else if (words_[0]) {
+ size_ = 1;
+ }
+ return fp.exponent;
+ }
+ int exponent_adjust =
+ ReadDigits(fp.subrange_begin, fp.subrange_end, significant_digits);
+ return fp.literal_exponent + exponent_adjust;
+}
+
+template <int max_words>
+int BigUnsigned<max_words>::ReadDigits(const char* begin, const char* end,
+ int significant_digits) {
+ assert(significant_digits <= Digits10() + 1);
+ SetToZero();
+
+ bool after_decimal_point = false;
+ // Discard any leading zeroes before the decimal point
+ while (begin < end && *begin == '0') {
+ ++begin;
+ }
+ int dropped_digits = 0;
+ // Discard any trailing zeroes. These may or may not be after the decimal
+ // point.
+ while (begin < end && *std::prev(end) == '0') {
+ --end;
+ ++dropped_digits;
+ }
+ if (begin < end && *std::prev(end) == '.') {
+ // If the std::string ends in '.', either before or after dropping zeroes, then
+ // drop the decimal point and look for more digits to drop.
+ dropped_digits = 0;
+ --end;
+ while (begin < end && *std::prev(end) == '0') {
+ --end;
+ ++dropped_digits;
+ }
+ } else if (dropped_digits) {
+ // We dropped digits, and aren't sure if they're before or after the decimal
+ // point. Figure that out now.
+ const char* dp = std::find(begin, end, '.');
+ if (dp != end) {
+ // The dropped trailing digits were after the decimal point, so don't
+ // count them.
+ dropped_digits = 0;
+ }
+ }
+ // Any non-fraction digits we dropped need to be accounted for in our exponent
+ // adjustment.
+ int exponent_adjust = dropped_digits;
+
+ uint32_t queued = 0;
+ int digits_queued = 0;
+ for (; begin != end && significant_digits > 0; ++begin) {
+ if (*begin == '.') {
+ after_decimal_point = true;
+ continue;
+ }
+ if (after_decimal_point) {
+ // For each fractional digit we emit in our parsed integer, adjust our
+ // decimal exponent to compensate.
+ --exponent_adjust;
+ }
+ int digit = (*begin - '0');
+ --significant_digits;
+ if (significant_digits == 0 && std::next(begin) != end &&
+ (digit == 0 || digit == 5)) {
+ // If this is the very last significant digit, but insignificant digits
+ // remain, we know that the last of those remaining significant digits is
+ // nonzero. (If it wasn't, we would have stripped it before we got here.)
+ // So if this final digit is a 0 or 5, adjust it upward by 1.
+ //
+ // This adjustment is what allows incredibly large mantissas ending in
+ // 500000...000000000001 to correctly round up, rather than to nearest.
+ ++digit;
+ }
+ queued = 10 * queued + digit;
+ ++digits_queued;
+ if (digits_queued == kMaxSmallPowerOfTen) {
+ MultiplyBy(kTenToNth[kMaxSmallPowerOfTen]);
+ AddWithCarry(0, queued);
+ queued = digits_queued = 0;
+ }
+ }
+ // Encode any remaining digits.
+ if (digits_queued) {
+ MultiplyBy(kTenToNth[digits_queued]);
+ AddWithCarry(0, queued);
+ }
+
+ // If any insignificant digits remain, we will drop them. But if we have not
+ // yet read the decimal point, then we have to adjust the exponent to account
+ // for the dropped digits.
+ if (begin < end && !after_decimal_point) {
+ // This call to std::find will result in a pointer either to the decimal
+ // point, or to the end of our buffer if there was none.
+ //
+ // Either way, [begin, decimal_point) will contain the set of dropped digits
+ // that require an exponent adjustment.
+ const char* decimal_point = std::find(begin, end, '.');
+ exponent_adjust += (decimal_point - begin);
+ }
+ return exponent_adjust;
+}
+
+template <int max_words>
+/* static */ BigUnsigned<max_words> BigUnsigned<max_words>::FiveToTheNth(
+ int n) {
+ BigUnsigned answer(1u);
+
+ // Seed from the table of large powers, if possible.
+ bool first_pass = true;
+ while (n >= kLargePowerOfFiveStep) {
+ int big_power =
+ std::min(n / kLargePowerOfFiveStep, kLargestPowerOfFiveIndex);
+ if (first_pass) {
+ // just copy, rather than multiplying by 1
+ std::copy(
+ LargePowerOfFiveData(big_power),
+ LargePowerOfFiveData(big_power) + LargePowerOfFiveSize(big_power),
+ answer.words_);
+ answer.size_ = LargePowerOfFiveSize(big_power);
+ first_pass = false;
+ } else {
+ answer.MultiplyBy(LargePowerOfFiveSize(big_power),
+ LargePowerOfFiveData(big_power));
+ }
+ n -= kLargePowerOfFiveStep * big_power;
+ }
+ answer.MultiplyByFiveToTheNth(n);
+ return answer;
+}
+
+template <int max_words>
+void BigUnsigned<max_words>::MultiplyStep(int original_size,
+ const uint32_t* other_words,
+ int other_size, int step) {
+ int this_i = std::min(original_size - 1, step);
+ int other_i = step - this_i;
+
+ uint64_t this_word = 0;
+ uint64_t carry = 0;
+ for (; this_i >= 0 && other_i < other_size; --this_i, ++other_i) {
+ uint64_t product = words_[this_i];
+ product *= other_words[other_i];
+ this_word += product;
+ carry += (this_word >> 32);
+ this_word &= 0xffffffff;
+ }
+ AddWithCarry(step + 1, carry);
+ words_[step] = this_word & 0xffffffff;
+ if (this_word > 0 && size_ <= step) {
+ size_ = step + 1;
+ }
+}
+
+template <int max_words>
+std::string BigUnsigned<max_words>::ToString() const {
+ BigUnsigned<max_words> copy = *this;
+ std::string result;
+ // Build result in reverse order
+ while (copy.size() > 0) {
+ int next_digit = copy.DivMod<10>();
+ result.push_back('0' + next_digit);
+ }
+ if (result.empty()) {
+ result.push_back('0');
+ }
+ std::reverse(result.begin(), result.end());
+ return result;
+}
+
+template class BigUnsigned<4>;
+template class BigUnsigned<84>;
+
+} // namespace strings_internal
+} // namespace absl
diff --git a/absl/strings/internal/charconv_bigint.h b/absl/strings/internal/charconv_bigint.h
new file mode 100644
index 00000000..aa70af2c
--- /dev/null
+++ b/absl/strings/internal/charconv_bigint.h
@@ -0,0 +1,426 @@
+// Copyright 2018 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#ifndef ABSL_STRINGS_INTERNAL_CHARCONV_BIGINT_H_
+#define ABSL_STRINGS_INTERNAL_CHARCONV_BIGINT_H_
+
+#include <algorithm>
+#include <cstdint>
+#include <iostream>
+#include <string>
+
+#include "absl/strings/ascii.h"
+#include "absl/strings/internal/charconv_parse.h"
+#include "absl/strings/string_view.h"
+
+namespace absl {
+namespace strings_internal {
+
+// The largest power that 5 that can be raised to, and still fit in a uint32_t.
+constexpr int kMaxSmallPowerOfFive = 13;
+// The largest power that 10 that can be raised to, and still fit in a uint32_t.
+constexpr int kMaxSmallPowerOfTen = 9;
+
+extern const uint32_t kFiveToNth[kMaxSmallPowerOfFive + 1];
+extern const uint32_t kTenToNth[kMaxSmallPowerOfTen + 1];
+
+// Large, fixed-width unsigned integer.
+//
+// Exact rounding for decimal-to-binary floating point conversion requires very
+// large integer math, but a design goal of absl::from_chars is to avoid
+// allocating memory. The integer precision needed for decimal-to-binary
+// conversions is large but bounded, so a huge fixed-width integer class
+// suffices.
+//
+// This is an intentionally limited big integer class. Only needed operations
+// are implemented. All storage lives in an array data member, and all
+// arithmetic is done in-place, to avoid requiring separate storage for operand
+// and result.
+//
+// This is an internal class. Some methods live in the .cc file, and are
+// instantiated only for the values of max_words we need.
+template <int max_words>
+class BigUnsigned {
+ public:
+ static_assert(max_words == 4 || max_words == 84,
+ "unsupported max_words value");
+
+ BigUnsigned() : size_(0), words_{} {}
+ explicit BigUnsigned(uint32_t v) : size_(v > 0 ? 1 : 0), words_{v} {}
+ explicit BigUnsigned(uint64_t v)
+ : size_(0),
+ words_{static_cast<uint32_t>(v & 0xffffffff),
+ static_cast<uint32_t>(v >> 32)} {
+ if (words_[1]) {
+ size_ = 2;
+ } else if (words_[0]) {
+ size_ = 1;
+ }
+ }
+
+ // Constructs a BigUnsigned from the given string_view containing a decimal
+ // value. If the input std::string is not a decimal integer, constructs a 0
+ // instead.
+ explicit BigUnsigned(absl::string_view sv) : size_(0), words_{} {
+ // Check for valid input, returning a 0 otherwise. This is reasonable
+ // behavior only because this constructor is for unit tests.
+ if (std::find_if_not(sv.begin(), sv.end(), ascii_isdigit) != sv.end() ||
+ sv.empty()) {
+ return;
+ }
+ int exponent_adjust =
+ ReadDigits(sv.data(), sv.data() + sv.size(), Digits10() + 1);
+ if (exponent_adjust > 0) {
+ MultiplyByTenToTheNth(exponent_adjust);
+ }
+ }
+
+ // Loads the mantissa value of a previously-parsed float.
+ //
+ // Returns the associated decimal exponent. The value of the parsed float is
+ // exactly *this * 10**exponent.
+ int ReadFloatMantissa(const ParsedFloat& fp, int significant_digits);
+
+ // Returns the number of decimal digits of precision this type provides. All
+ // numbers with this many decimal digits or fewer are representable by this
+ // type.
+ //
+ // Analagous to std::numeric_limits<BigUnsigned>::digits10.
+ static constexpr int Digits10() {
+ // 9975007/1035508 is very slightly less than log10(2**32).
+ return static_cast<uint64_t>(max_words) * 9975007 / 1035508;
+ }
+
+ // Shifts left by the given number of bits.
+ void ShiftLeft(int count) {
+ if (count > 0) {
+ const int word_shift = count / 32;
+ if (word_shift >= max_words) {
+ SetToZero();
+ return;
+ }
+ size_ = std::min(size_ + word_shift, max_words);
+ count %= 32;
+ if (count == 0) {
+ std::copy_backward(words_, words_ + size_ - word_shift, words_ + size_);
+ } else {
+ for (int i = std::min(size_, max_words - 1); i > word_shift; --i) {
+ words_[i] = (words_[i - word_shift] << count) |
+ (words_[i - word_shift - 1] >> (32 - count));
+ }
+ words_[word_shift] = words_[0] << count;
+ // Grow size_ if necessary.
+ if (size_ < max_words && words_[size_]) {
+ ++size_;
+ }
+ }
+ std::fill(words_, words_ + word_shift, 0u);
+ }
+ }
+
+
+ // Multiplies by v in-place.
+ void MultiplyBy(uint32_t v) {
+ if (size_ == 0 || v == 1) {
+ return;
+ }
+ if (v == 0) {
+ SetToZero();
+ return;
+ }
+ const uint64_t factor = v;
+ uint64_t window = 0;
+ for (int i = 0; i < size_; ++i) {
+ window += factor * words_[i];
+ words_[i] = window & 0xffffffff;
+ window >>= 32;
+ }
+ // If carry bits remain and there's space for them, grow size_.
+ if (window && size_ < max_words) {
+ words_[size_] = window & 0xffffffff;
+ ++size_;
+ }
+ }
+
+ void MultiplyBy(uint64_t v) {
+ uint32_t words[2];
+ words[0] = static_cast<uint32_t>(v);
+ words[1] = static_cast<uint32_t>(v >> 32);
+ if (words[1] == 0) {
+ MultiplyBy(words[0]);
+ } else {
+ MultiplyBy(2, words);
+ }
+ }
+
+ // Multiplies in place by 5 to the power of n. n must be non-negative.
+ void MultiplyByFiveToTheNth(int n) {
+ while (n >= kMaxSmallPowerOfFive) {
+ MultiplyBy(kFiveToNth[kMaxSmallPowerOfFive]);
+ n -= kMaxSmallPowerOfFive;
+ }
+ if (n > 0) {
+ MultiplyBy(kFiveToNth[n]);
+ }
+ }
+
+ // Multiplies in place by 10 to the power of n. n must be non-negative.
+ void MultiplyByTenToTheNth(int n) {
+ if (n > kMaxSmallPowerOfTen) {
+ // For large n, raise to a power of 5, then shift left by the same amount.
+ // (10**n == 5**n * 2**n.) This requires fewer multiplications overall.
+ MultiplyByFiveToTheNth(n);
+ ShiftLeft(n);
+ } else if (n > 0) {
+ // We can do this more quickly for very small N by using a single
+ // multiplication.
+ MultiplyBy(kTenToNth[n]);
+ }
+ }
+
+ // Returns the value of 5**n, for non-negative n. This implementation uses
+ // a lookup table, and is faster then seeding a BigUnsigned with 1 and calling
+ // MultiplyByFiveToTheNth().
+ static BigUnsigned FiveToTheNth(int n);
+
+ // Multiplies by another BigUnsigned, in-place.
+ template <int M>
+ void MultiplyBy(const BigUnsigned<M>& other) {
+ MultiplyBy(other.size(), other.words());
+ }
+
+ void SetToZero() {
+ std::fill(words_, words_ + size_, 0u);
+ size_ = 0;
+ }
+
+ // Returns the value of the nth word of this BigUnsigned. This is
+ // range-checked, and returns 0 on out-of-bounds accesses.
+ uint32_t GetWord(int index) const {
+ if (index < 0 || index >= size_) {
+ return 0;
+ }
+ return words_[index];
+ }
+
+ // Returns this integer as a decimal std::string. This is not used in the decimal-
+ // to-binary conversion; it is intended to aid in testing.
+ std::string ToString() const;
+
+ int size() const { return size_; }
+ const uint32_t* words() const { return words_; }
+
+ private:
+ // Reads the number between [begin, end), possibly containing a decimal point,
+ // into this BigUnsigned.
+ //
+ // Callers are required to ensure [begin, end) contains a valid number, with
+ // one or more decimal digits and at most one decimal point. This routine
+ // will behave unpredictably if these preconditions are not met.
+ //
+ // Only the first `significant_digits` digits are read. Digits beyond this
+ // limit are "sticky": If the final significant digit is 0 or 5, and if any
+ // dropped digit is nonzero, then that final significant digit is adjusted up
+ // to 1 or 6. This adjustment allows for precise rounding.
+ //
+ // Returns `exponent_adjustment`, a power-of-ten exponent adjustment to
+ // account for the decimal point and for dropped significant digits. After
+ // this function returns,
+ // actual_value_of_parsed_string ~= *this * 10**exponent_adjustment.
+ int ReadDigits(const char* begin, const char* end, int significant_digits);
+
+ // Performs a step of big integer multiplication. This computes the full
+ // (64-bit-wide) values that should be added at the given index (step), and
+ // adds to that location in-place.
+ //
+ // Because our math all occurs in place, we must multiply starting from the
+ // highest word working downward. (This is a bit more expensive due to the
+ // extra carries involved.)
+ //
+ // This must be called in steps, for each word to be calculated, starting from
+ // the high end and working down to 0. The first value of `step` should be
+ // `std::min(original_size + other.size_ - 2, max_words - 1)`.
+ // The reason for this expression is that multiplying the i'th word from one
+ // multiplicand and the j'th word of another multiplicand creates a
+ // two-word-wide value to be stored at the (i+j)'th element. The highest
+ // word indices we will access are `original_size - 1` from this object, and
+ // `other.size_ - 1` from our operand. Therefore,
+ // `original_size + other.size_ - 2` is the first step we should calculate,
+ // but limited on an upper bound by max_words.
+
+ // Working from high-to-low ensures that we do not overwrite the portions of
+ // the initial value of *this which are still needed for later steps.
+ //
+ // Once called with step == 0, *this contains the result of the
+ // multiplication.
+ //
+ // `original_size` is the size_ of *this before the first call to
+ // MultiplyStep(). `other_words` and `other_size` are the contents of our
+ // operand. `step` is the step to perform, as described above.
+ void MultiplyStep(int original_size, const uint32_t* other_words,
+ int other_size, int step);
+
+ void MultiplyBy(int other_size, const uint32_t* other_words) {
+ const int original_size = size_;
+ const int first_step =
+ std::min(original_size + other_size - 2, max_words - 1);
+ for (int step = first_step; step >= 0; --step) {
+ MultiplyStep(original_size, other_words, other_size, step);
+ }
+ }
+
+ // Adds a 32-bit value to the index'th word, with carry.
+ void AddWithCarry(int index, uint32_t value) {
+ if (value) {
+ while (index < max_words && value > 0) {
+ words_[index] += value;
+ // carry if we overflowed in this word:
+ if (value > words_[index]) {
+ value = 1;
+ ++index;
+ } else {
+ value = 0;
+ }
+ }
+ size_ = std::min(max_words, std::max(index + 1, size_));
+ }
+ }
+
+ void AddWithCarry(int index, uint64_t value) {
+ if (value && index < max_words) {
+ uint32_t high = value >> 32;
+ uint32_t low = value & 0xffffffff;
+ words_[index] += low;
+ if (words_[index] < low) {
+ ++high;
+ if (high == 0) {
+ // Carry from the low word caused our high word to overflow.
+ // Short circuit here to do the right thing.
+ AddWithCarry(index + 2, static_cast<uint32_t>(1));
+ return;
+ }
+ }
+ if (high > 0) {
+ AddWithCarry(index + 1, high);
+ } else {
+ // Normally 32-bit AddWithCarry() sets size_, but since we don't call
+ // it when `high` is 0, do it ourselves here.
+ size_ = std::min(max_words, std::max(index + 1, size_));
+ }
+ }
+ }
+
+ // Divide this in place by a constant divisor. Returns the remainder of the
+ // division.
+ template <uint32_t divisor>
+ uint32_t DivMod() {
+ uint64_t accumulator = 0;
+ for (int i = size_ - 1; i >= 0; --i) {
+ accumulator <<= 32;
+ accumulator += words_[i];
+ // accumulator / divisor will never overflow an int32_t in this loop
+ words_[i] = static_cast<uint32_t>(accumulator / divisor);
+ accumulator = accumulator % divisor;
+ }
+ while (size_ > 0 && words_[size_ - 1] == 0) {
+ --size_;
+ }
+ return static_cast<uint32_t>(accumulator);
+ }
+
+ // The number of elements in words_ that may carry significant values.
+ // All elements beyond this point are 0.
+ //
+ // When size_ is 0, this BigUnsigned stores the value 0.
+ // When size_ is nonzero, is *not* guaranteed that words_[size_ - 1] is
+ // nonzero. This can occur due to overflow truncation.
+ // In particular, x.size_ != y.size_ does *not* imply x != y.
+ int size_;
+ uint32_t words_[max_words];
+};
+
+// Compares two big integer instances.
+//
+// Returns -1 if lhs < rhs, 0 if lhs == rhs, and 1 if lhs > rhs.
+template <int N, int M>
+int Compare(const BigUnsigned<N>& lhs, const BigUnsigned<M>& rhs) {
+ int limit = std::max(lhs.size(), rhs.size());
+ for (int i = limit - 1; i >= 0; --i) {
+ const uint32_t lhs_word = lhs.GetWord(i);
+ const uint32_t rhs_word = rhs.GetWord(i);
+ if (lhs_word < rhs_word) {
+ return -1;
+ } else if (lhs_word > rhs_word) {
+ return 1;
+ }
+ }
+ return 0;
+}
+
+template <int N, int M>
+bool operator==(const BigUnsigned<N>& lhs, const BigUnsigned<M>& rhs) {
+ int limit = std::max(lhs.size(), rhs.size());
+ for (int i = 0; i < limit; ++i) {
+ if (lhs.GetWord(i) != rhs.GetWord(i)) {
+ return false;
+ }
+ }
+ return true;
+}
+
+template <int N, int M>
+bool operator!=(const BigUnsigned<N>& lhs, const BigUnsigned<M>& rhs) {
+ return !(lhs == rhs);
+}
+
+template <int N, int M>
+bool operator<(const BigUnsigned<N>& lhs, const BigUnsigned<M>& rhs) {
+ return Compare(lhs, rhs) == -1;
+}
+
+template <int N, int M>
+bool operator>(const BigUnsigned<N>& lhs, const BigUnsigned<M>& rhs) {
+ return rhs < lhs;
+}
+template <int N, int M>
+bool operator<=(const BigUnsigned<N>& lhs, const BigUnsigned<M>& rhs) {
+ return !(rhs < lhs);
+}
+template <int N, int M>
+bool operator>=(const BigUnsigned<N>& lhs, const BigUnsigned<M>& rhs) {
+ return !(lhs < rhs);
+}
+
+// Output operator for BigUnsigned, for testing purposes only.
+template <int N>
+std::ostream& operator<<(std::ostream& os, const BigUnsigned<N>& num) {
+ return os << num.ToString();
+}
+
+// Explicit instantiation declarations for the sizes of BigUnsigned that we
+// are using.
+//
+// For now, the choices of 4 and 84 are arbitrary; 4 is a small value that is
+// still bigger than an int128, and 84 is a large value we will want to use
+// in the from_chars implementation.
+//
+// Comments justifying the use of 84 belong in the from_chars implementation,
+// and will be added in a follow-up CL.
+extern template class BigUnsigned<4>;
+extern template class BigUnsigned<84>;
+
+} // namespace strings_internal
+} // namespace absl
+
+#endif // ABSL_STRINGS_INTERNAL_CHARCONV_BIGINT_H_
diff --git a/absl/strings/internal/charconv_bigint_test.cc b/absl/strings/internal/charconv_bigint_test.cc
new file mode 100644
index 00000000..9b635788
--- /dev/null
+++ b/absl/strings/internal/charconv_bigint_test.cc
@@ -0,0 +1,203 @@
+// Copyright 2018 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/strings/internal/charconv_bigint.h"
+
+#include <string>
+
+#include "gtest/gtest.h"
+
+namespace absl {
+namespace strings_internal {
+
+TEST(BigUnsigned, ShiftLeft) {
+ {
+ // Check that 3 * 2**100 is calculated correctly
+ BigUnsigned<4> num(3u);
+ num.ShiftLeft(100);
+ EXPECT_EQ(num, BigUnsigned<4>("3802951800684688204490109616128"));
+ }
+ {
+ // Test that overflow is truncated properly.
+ // 15 is 4 bits long, and BigUnsigned<4> is a 128-bit bigint.
+ // Shifting left by 125 bits should truncate off the high bit, so that
+ // 15 << 125 == 7 << 125
+ // after truncation.
+ BigUnsigned<4> a(15u);
+ BigUnsigned<4> b(7u);
+ BigUnsigned<4> c(3u);
+ a.ShiftLeft(125);
+ b.ShiftLeft(125);
+ c.ShiftLeft(125);
+ EXPECT_EQ(a, b);
+ EXPECT_NE(a, c);
+ }
+ {
+ // Same test, larger bigint:
+ BigUnsigned<84> a(15u);
+ BigUnsigned<84> b(7u);
+ BigUnsigned<84> c(3u);
+ a.ShiftLeft(84 * 32 - 3);
+ b.ShiftLeft(84 * 32 - 3);
+ c.ShiftLeft(84 * 32 - 3);
+ EXPECT_EQ(a, b);
+ EXPECT_NE(a, c);
+ }
+ {
+ // Check that incrementally shifting has the same result as doing it all at
+ // once (attempting to capture corner cases.)
+ const std::string seed = "1234567890123456789012345678901234567890";
+ BigUnsigned<84> a(seed);
+ for (int i = 1; i <= 84 * 32; ++i) {
+ a.ShiftLeft(1);
+ BigUnsigned<84> b(seed);
+ b.ShiftLeft(i);
+ EXPECT_EQ(a, b);
+ }
+ // And we should have fully rotated all bits off by now:
+ EXPECT_EQ(a, BigUnsigned<84>(0u));
+ }
+}
+
+TEST(BigUnsigned, MultiplyByUint32) {
+ const BigUnsigned<84> factorial_100(
+ "933262154439441526816992388562667004907159682643816214685929638952175999"
+ "932299156089414639761565182862536979208272237582511852109168640000000000"
+ "00000000000000");
+ BigUnsigned<84> a(1u);
+ for (uint32_t i = 1; i <= 100; ++i) {
+ a.MultiplyBy(i);
+ }
+ EXPECT_EQ(a, BigUnsigned<84>(factorial_100));
+}
+
+TEST(BigUnsigned, MultiplyByBigUnsigned) {
+ {
+ // Put the terms of factorial_200 into two bigints, and multiply them
+ // together.
+ const BigUnsigned<84> factorial_200(
+ "7886578673647905035523632139321850622951359776871732632947425332443594"
+ "4996340334292030428401198462390417721213891963883025764279024263710506"
+ "1926624952829931113462857270763317237396988943922445621451664240254033"
+ "2918641312274282948532775242424075739032403212574055795686602260319041"
+ "7032406235170085879617892222278962370389737472000000000000000000000000"
+ "0000000000000000000000000");
+ BigUnsigned<84> evens(1u);
+ BigUnsigned<84> odds(1u);
+ for (uint32_t i = 1; i < 200; i += 2) {
+ odds.MultiplyBy(i);
+ evens.MultiplyBy(i + 1);
+ }
+ evens.MultiplyBy(odds);
+ EXPECT_EQ(evens, factorial_200);
+ }
+ {
+ // Multiply various powers of 10 together.
+ for (int a = 0 ; a < 700; a += 25) {
+ SCOPED_TRACE(a);
+ BigUnsigned<84> a_value("3" + std::string(a, '0'));
+ for (int b = 0; b < (700 - a); b += 25) {
+ SCOPED_TRACE(b);
+ BigUnsigned<84> b_value("2" + std::string(b, '0'));
+ BigUnsigned<84> expected_product("6" + std::string(a + b, '0'));
+ b_value.MultiplyBy(a_value);
+ EXPECT_EQ(b_value, expected_product);
+ }
+ }
+ }
+}
+
+TEST(BigUnsigned, MultiplyByOverflow) {
+ {
+ // Check that multiplcation overflow predictably truncates.
+
+ // A big int with all bits on.
+ BigUnsigned<4> all_bits_on("340282366920938463463374607431768211455");
+ // Modulo 2**128, this is equal to -1. Therefore the square of this,
+ // modulo 2**128, should be 1.
+ all_bits_on.MultiplyBy(all_bits_on);
+ EXPECT_EQ(all_bits_on, BigUnsigned<4>(1u));
+ }
+ {
+ // Try multiplying a large bigint by 2**50, and compare the result to
+ // shifting.
+ BigUnsigned<4> value_1("12345678901234567890123456789012345678");
+ BigUnsigned<4> value_2("12345678901234567890123456789012345678");
+ BigUnsigned<4> two_to_fiftieth(1u);
+ two_to_fiftieth.ShiftLeft(50);
+
+ value_1.ShiftLeft(50);
+ value_2.MultiplyBy(two_to_fiftieth);
+ EXPECT_EQ(value_1, value_2);
+ }
+}
+
+TEST(BigUnsigned, FiveToTheNth) {
+ {
+ // Sanity check that MultiplyByFiveToTheNth gives consistent answers, up to
+ // and including overflow.
+ for (int i = 0; i < 1160; ++i) {
+ SCOPED_TRACE(i);
+ BigUnsigned<84> value_1(123u);
+ BigUnsigned<84> value_2(123u);
+ value_1.MultiplyByFiveToTheNth(i);
+ for (int j = 0; j < i; j++) {
+ value_2.MultiplyBy(5u);
+ }
+ EXPECT_EQ(value_1, value_2);
+ }
+ }
+ {
+ // Check that the faster, table-lookup-based static method returns the same
+ // result that multiplying in-place would return, up to and including
+ // overflow.
+ for (int i = 0; i < 1160; ++i) {
+ SCOPED_TRACE(i);
+ BigUnsigned<84> value_1(1u);
+ value_1.MultiplyByFiveToTheNth(i);
+ BigUnsigned<84> value_2 = BigUnsigned<84>::FiveToTheNth(i);
+ EXPECT_EQ(value_1, value_2);
+ }
+ }
+}
+
+TEST(BigUnsigned, TenToTheNth) {
+ {
+ // Sanity check MultiplyByTenToTheNth.
+ for (int i = 0; i < 800; ++i) {
+ SCOPED_TRACE(i);
+ BigUnsigned<84> value_1(123u);
+ BigUnsigned<84> value_2(123u);
+ value_1.MultiplyByTenToTheNth(i);
+ for (int j = 0; j < i; j++) {
+ value_2.MultiplyBy(10u);
+ }
+ EXPECT_EQ(value_1, value_2);
+ }
+ }
+ {
+ // Alternate testing approach, taking advantage of the decimal parser.
+ for (int i = 0; i < 200; ++i) {
+ SCOPED_TRACE(i);
+ BigUnsigned<84> value_1(135u);
+ value_1.MultiplyByTenToTheNth(i);
+ BigUnsigned<84> value_2("135" + std::string(i, '0'));
+ EXPECT_EQ(value_1, value_2);
+ }
+ }
+}
+
+
+} // namespace strings_internal
+} // namespace absl
diff --git a/absl/strings/internal/charconv_parse.cc b/absl/strings/internal/charconv_parse.cc
new file mode 100644
index 00000000..a04cc676
--- /dev/null
+++ b/absl/strings/internal/charconv_parse.cc
@@ -0,0 +1,496 @@
+// Copyright 2018 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/strings/internal/charconv_parse.h"
+#include "absl/strings/charconv.h"
+
+#include <cassert>
+#include <cstdint>
+#include <limits>
+
+#include "absl/strings/internal/memutil.h"
+
+namespace absl {
+namespace {
+
+// ParseFloat<10> will read the first 19 significant digits of the mantissa.
+// This number was chosen for multiple reasons.
+//
+// (a) First, for whatever integer type we choose to represent the mantissa, we
+// want to choose the largest possible number of decimal digits for that integer
+// type. We are using uint64_t, which can express any 19-digit unsigned
+// integer.
+//
+// (b) Second, we need to parse enough digits that the binary value of any
+// mantissa we capture has more bits of resolution than the mantissa
+// representation in the target float. Our algorithm requires at least 3 bits
+// of headway, but 19 decimal digits give a little more than that.
+//
+// The following static assertions verify the above comments:
+constexpr int kDecimalMantissaDigitsMax = 19;
+
+static_assert(std::numeric_limits<uint64_t>::digits10 ==
+ kDecimalMantissaDigitsMax,
+ "(a) above");
+
+// IEEE doubles, which we assume in Abseil, have 53 binary bits of mantissa.
+static_assert(std::numeric_limits<double>::is_iec559, "IEEE double assumed");
+static_assert(std::numeric_limits<double>::radix == 2, "IEEE double fact");
+static_assert(std::numeric_limits<double>::digits == 53, "IEEE double fact");
+
+// The lowest valued 19-digit decimal mantissa we can read still contains
+// sufficient information to reconstruct a binary mantissa.
+static_assert(1000000000000000000u > (uint64_t(1) << (53 + 3)), "(b) above");
+
+// ParseFloat<16> will read the first 15 significant digits of the mantissa.
+//
+// Because a base-16-to-base-2 conversion can be done exactly, we do not need
+// to maximize the number of scanned hex digits to improve our conversion. What
+// is required is to scan two more bits than the mantissa can represent, so that
+// we always round correctly.
+//
+// (One extra bit does not suffice to perform correct rounding, since a number
+// exactly halfway between two representable floats has unique rounding rules,
+// so we need to differentiate between a "halfway between" number and a "closer
+// to the larger value" number.)
+constexpr int kHexadecimalMantissaDigitsMax = 15;
+
+// The minimum number of significant bits that will be read from
+// kHexadecimalMantissaDigitsMax hex digits. We must subtract by three, since
+// the most significant digit can be a "1", which only contributes a single
+// significant bit.
+constexpr int kGuaranteedHexadecimalMantissaBitPrecision =
+ 4 * kHexadecimalMantissaDigitsMax - 3;
+
+static_assert(kGuaranteedHexadecimalMantissaBitPrecision >
+ std::numeric_limits<double>::digits + 2,
+ "kHexadecimalMantissaDigitsMax too small");
+
+// We also impose a limit on the number of significant digits we will read from
+// an exponent, to avoid having to deal with integer overflow. We use 9 for
+// this purpose.
+//
+// If we read a 9 digit exponent, the end result of the conversion will
+// necessarily be infinity or zero, depending on the sign of the exponent.
+// Therefore we can just drop extra digits on the floor without any extra
+// logic.
+constexpr int kDecimalExponentDigitsMax = 9;
+static_assert(std::numeric_limits<int>::digits10 >= kDecimalExponentDigitsMax,
+ "int type too small");
+
+// To avoid incredibly large inputs causing integer overflow for our exponent,
+// we impose an arbitrary but very large limit on the number of significant
+// digits we will accept. The implementation refuses to match a std::string with
+// more consecutive significant mantissa digits than this.
+constexpr int kDecimalDigitLimit = 50000000;
+
+// Corresponding limit for hexadecimal digit inputs. This is one fourth the
+// amount of kDecimalDigitLimit, since each dropped hexadecimal digit requires
+// a binary exponent adjustment of 4.
+constexpr int kHexadecimalDigitLimit = kDecimalDigitLimit / 4;
+
+// The largest exponent we can read is 999999999 (per
+// kDecimalExponentDigitsMax), and the largest exponent adjustment we can get
+// from dropped mantissa digits is 2 * kDecimalDigitLimit, and the sum of these
+// comfortably fits in an integer.
+//
+// We count kDecimalDigitLimit twice because there are independent limits for
+// numbers before and after the decimal point. (In the case where there are no
+// significant digits before the decimal point, there are independent limits for
+// post-decimal-point leading zeroes and for significant digits.)
+static_assert(999999999 + 2 * kDecimalDigitLimit <
+ std::numeric_limits<int>::max(),
+ "int type too small");
+static_assert(999999999 + 2 * (4 * kHexadecimalDigitLimit) <
+ std::numeric_limits<int>::max(),
+ "int type too small");
+
+// Returns true if the provided bitfield allows parsing an exponent value
+// (e.g., "1.5e100").
+bool AllowExponent(chars_format flags) {
+ bool fixed = (flags & chars_format::fixed) == chars_format::fixed;
+ bool scientific =
+ (flags & chars_format::scientific) == chars_format::scientific;
+ return scientific || !fixed;
+}
+
+// Returns true if the provided bitfield requires an exponent value be present.
+bool RequireExponent(chars_format flags) {
+ bool fixed = (flags & chars_format::fixed) == chars_format::fixed;
+ bool scientific =
+ (flags & chars_format::scientific) == chars_format::scientific;
+ return scientific && !fixed;
+}
+
+const int8_t kAsciiToInt[256] = {
+ -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
+ -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
+ -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, 0, 1, 2, 3, 4, 5, 6, 7, 8,
+ 9, -1, -1, -1, -1, -1, -1, -1, 10, 11, 12, 13, 14, 15, -1, -1, -1, -1, -1,
+ -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
+ -1, -1, 10, 11, 12, 13, 14, 15, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
+ -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
+ -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
+ -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
+ -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
+ -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
+ -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
+ -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
+ -1, -1, -1, -1, -1, -1, -1, -1, -1};
+
+// Returns true if `ch` is a digit in the given base
+template <int base>
+bool IsDigit(char ch);
+
+// Converts a valid `ch` to its digit value in the given base.
+template <int base>
+unsigned ToDigit(char ch);
+
+// Returns true if `ch` is the exponent delimiter for the given base.
+template <int base>
+bool IsExponentCharacter(char ch);
+
+// Returns the maximum number of significant digits we will read for a float
+// in the given base.
+template <int base>
+constexpr int MantissaDigitsMax();
+
+// Returns the largest consecutive run of digits we will accept when parsing a
+// number in the given base.
+template <int base>
+constexpr int DigitLimit();
+
+// Returns the amount the exponent must be adjusted by for each dropped digit.
+// (For decimal this is 1, since the digits are in base 10 and the exponent base
+// is also 10, but for hexadecimal this is 4, since the digits are base 16 but
+// the exponent base is 2.)
+template <int base>
+constexpr int DigitMagnitude();
+
+template <>
+bool IsDigit<10>(char ch) {
+ return ch >= '0' && ch <= '9';
+}
+template <>
+bool IsDigit<16>(char ch) {
+ return kAsciiToInt[static_cast<unsigned char>(ch)] >= 0;
+}
+
+template <>
+unsigned ToDigit<10>(char ch) {
+ return ch - '0';
+}
+template <>
+unsigned ToDigit<16>(char ch) {
+ return kAsciiToInt[static_cast<unsigned char>(ch)];
+}
+
+template <>
+bool IsExponentCharacter<10>(char ch) {
+ return ch == 'e' || ch == 'E';
+}
+
+template <>
+bool IsExponentCharacter<16>(char ch) {
+ return ch == 'p' || ch == 'P';
+}
+
+template <>
+constexpr int MantissaDigitsMax<10>() {
+ return kDecimalMantissaDigitsMax;
+}
+template <>
+constexpr int MantissaDigitsMax<16>() {
+ return kHexadecimalMantissaDigitsMax;
+}
+
+template <>
+constexpr int DigitLimit<10>() {
+ return kDecimalDigitLimit;
+}
+template <>
+constexpr int DigitLimit<16>() {
+ return kHexadecimalDigitLimit;
+}
+
+template <>
+constexpr int DigitMagnitude<10>() {
+ return 1;
+}
+template <>
+constexpr int DigitMagnitude<16>() {
+ return 4;
+}
+
+// Reads decimal digits from [begin, end) into *out. Returns the number of
+// digits consumed.
+//
+// After max_digits has been read, keeps consuming characters, but no longer
+// adjusts *out. If a nonzero digit is dropped this way, *dropped_nonzero_digit
+// is set; otherwise, it is left unmodified.
+//
+// If no digits are matched, returns 0 and leaves *out unchanged.
+//
+// ConsumeDigits does not protect against overflow on *out; max_digits must
+// be chosen with respect to type T to avoid the possibility of overflow.
+template <int base, typename T>
+std::size_t ConsumeDigits(const char* begin, const char* end, int max_digits,
+ T* out, bool* dropped_nonzero_digit) {
+ if (base == 10) {
+ assert(max_digits <= std::numeric_limits<T>::digits10);
+ } else if (base == 16) {
+ assert(max_digits * 4 <= std::numeric_limits<T>::digits);
+ }
+ const char* const original_begin = begin;
+ T accumulator = *out;
+ const char* significant_digits_end =
+ (end - begin > max_digits) ? begin + max_digits : end;
+ while (begin < significant_digits_end && IsDigit<base>(*begin)) {
+ // Do not guard against *out overflow; max_digits was chosen to avoid this.
+ // Do assert against it, to detect problems in debug builds.
+ auto digit = static_cast<T>(ToDigit<base>(*begin));
+ assert(accumulator * base >= accumulator);
+ accumulator *= base;
+ assert(accumulator + digit >= accumulator);
+ accumulator += digit;
+ ++begin;
+ }
+ bool dropped_nonzero = false;
+ while (begin < end && IsDigit<base>(*begin)) {
+ dropped_nonzero = dropped_nonzero || (*begin != '0');
+ ++begin;
+ }
+ if (dropped_nonzero && dropped_nonzero_digit != nullptr) {
+ *dropped_nonzero_digit = true;
+ }
+ *out = accumulator;
+ return begin - original_begin;
+}
+
+// Returns true if `v` is one of the chars allowed inside parentheses following
+// a NaN.
+bool IsNanChar(char v) {
+ return (v == '_') || (v >= '0' && v <= '9') || (v >= 'a' && v <= 'z') ||
+ (v >= 'A' && v <= 'Z');
+}
+
+// Checks the range [begin, end) for a strtod()-formatted infinity or NaN. If
+// one is found, sets `out` appropriately and returns true.
+bool ParseInfinityOrNan(const char* begin, const char* end,
+ strings_internal::ParsedFloat* out) {
+ if (end - begin < 3) {
+ return false;
+ }
+ switch (*begin) {
+ case 'i':
+ case 'I': {
+ // An infinity std::string consists of the characters "inf" or "infinity",
+ // case insensitive.
+ if (strings_internal::memcasecmp(begin + 1, "nf", 2) != 0) {
+ return false;
+ }
+ out->type = strings_internal::FloatType::kInfinity;
+ if (end - begin >= 8 &&
+ strings_internal::memcasecmp(begin + 3, "inity", 5) == 0) {
+ out->end = begin + 8;
+ } else {
+ out->end = begin + 3;
+ }
+ return true;
+ }
+ case 'n':
+ case 'N': {
+ // A NaN consists of the characters "nan", case insensitive, optionally
+ // followed by a parenthesized sequence of zero or more alphanumeric
+ // characters and/or underscores.
+ if (strings_internal::memcasecmp(begin + 1, "an", 2) != 0) {
+ return false;
+ }
+ out->type = strings_internal::FloatType::kNan;
+ out->end = begin + 3;
+ // NaN is allowed to be followed by a parenthesized std::string, consisting of
+ // only the characters [a-zA-Z0-9_]. Match that if it's present.
+ begin += 3;
+ if (begin < end && *begin == '(') {
+ const char* nan_begin = begin + 1;
+ while (nan_begin < end && IsNanChar(*nan_begin)) {
+ ++nan_begin;
+ }
+ if (nan_begin < end && *nan_begin == ')') {
+ // We found an extra NaN specifier range
+ out->subrange_begin = begin + 1;
+ out->subrange_end = nan_begin;
+ out->end = nan_begin + 1;
+ }
+ }
+ return true;
+ }
+ default:
+ return false;
+ }
+}
+} // namespace
+
+namespace strings_internal {
+
+template <int base>
+strings_internal::ParsedFloat ParseFloat(const char* begin, const char* end,
+ chars_format format_flags) {
+ strings_internal::ParsedFloat result;
+
+ // Exit early if we're given an empty range.
+ if (begin == end) return result;
+
+ // Handle the infinity and NaN cases.
+ if (ParseInfinityOrNan(begin, end, &result)) {
+ return result;
+ }
+
+ const char* const mantissa_begin = begin;
+ while (begin < end && *begin == '0') {
+ ++begin; // skip leading zeros
+ }
+ uint64_t mantissa = 0;
+
+ int exponent_adjustment = 0;
+ bool mantissa_is_inexact = false;
+ std::size_t pre_decimal_digits = ConsumeDigits<base>(
+ begin, end, MantissaDigitsMax<base>(), &mantissa, &mantissa_is_inexact);
+ begin += pre_decimal_digits;
+ int digits_left;
+ if (pre_decimal_digits >= DigitLimit<base>()) {
+ // refuse to parse pathological inputs
+ return result;
+ } else if (pre_decimal_digits > MantissaDigitsMax<base>()) {
+ // We dropped some non-fraction digits on the floor. Adjust our exponent
+ // to compensate.
+ exponent_adjustment =
+ static_cast<int>(pre_decimal_digits - MantissaDigitsMax<base>());
+ digits_left = 0;
+ } else {
+ digits_left =
+ static_cast<int>(MantissaDigitsMax<base>() - pre_decimal_digits);
+ }
+ if (begin < end && *begin == '.') {
+ ++begin;
+ if (mantissa == 0) {
+ // If we haven't seen any nonzero digits yet, keep skipping zeros. We
+ // have to adjust the exponent to reflect the changed place value.
+ const char* begin_zeros = begin;
+ while (begin < end && *begin == '0') {
+ ++begin;
+ }
+ std::size_t zeros_skipped = begin - begin_zeros;
+ if (zeros_skipped >= DigitLimit<base>()) {
+ // refuse to parse pathological inputs
+ return result;
+ }
+ exponent_adjustment -= static_cast<int>(zeros_skipped);
+ }
+ std::size_t post_decimal_digits = ConsumeDigits<base>(
+ begin, end, digits_left, &mantissa, &mantissa_is_inexact);
+ begin += post_decimal_digits;
+
+ // Since `mantissa` is an integer, each significant digit we read after
+ // the decimal point requires an adjustment to the exponent. "1.23e0" will
+ // be stored as `mantissa` == 123 and `exponent` == -2 (that is,
+ // "123e-2").
+ if (post_decimal_digits >= DigitLimit<base>()) {
+ // refuse to parse pathological inputs
+ return result;
+ } else if (post_decimal_digits > digits_left) {
+ exponent_adjustment -= digits_left;
+ } else {
+ exponent_adjustment -= post_decimal_digits;
+ }
+ }
+ // If we've found no mantissa whatsoever, this isn't a number.
+ if (mantissa_begin == begin) {
+ return result;
+ }
+ // A bare "." doesn't count as a mantissa either.
+ if (begin - mantissa_begin == 1 && *mantissa_begin == '.') {
+ return result;
+ }
+
+ if (mantissa_is_inexact) {
+ // We dropped significant digits on the floor. Handle this appropriately.
+ if (base == 10) {
+ // If we truncated significant decimal digits, store the full range of the
+ // mantissa for future big integer math for exact rounding.
+ result.subrange_begin = mantissa_begin;
+ result.subrange_end = begin;
+ } else if (base == 16) {
+ // If we truncated hex digits, reflect this fact by setting the low
+ // ("sticky") bit. This allows for correct rounding in all cases.
+ mantissa |= 1;
+ }
+ }
+ result.mantissa = mantissa;
+
+ const char* const exponent_begin = begin;
+ result.literal_exponent = 0;
+ bool found_exponent = false;
+ if (AllowExponent(format_flags) && begin < end &&
+ IsExponentCharacter<base>(*begin)) {
+ bool negative_exponent = false;
+ ++begin;
+ if (begin < end && *begin == '-') {
+ negative_exponent = true;
+ ++begin;
+ } else if (begin < end && *begin == '+') {
+ ++begin;
+ }
+ const char* const exponent_digits_begin = begin;
+ // Exponent is always expressed in decimal, even for hexadecimal floats.
+ begin += ConsumeDigits<10>(begin, end, kDecimalExponentDigitsMax,
+ &result.literal_exponent, nullptr);
+ if (begin == exponent_digits_begin) {
+ // there were no digits where we expected an exponent. We failed to read
+ // an exponent and should not consume the 'e' after all. Rewind 'begin'.
+ found_exponent = false;
+ begin = exponent_begin;
+ } else {
+ found_exponent = true;
+ if (negative_exponent) {
+ result.literal_exponent = -result.literal_exponent;
+ }
+ }
+ }
+
+ if (!found_exponent && RequireExponent(format_flags)) {
+ // Provided flags required an exponent, but none was found. This results
+ // in a failure to scan.
+ return result;
+ }
+
+ // Success!
+ result.type = strings_internal::FloatType::kNumber;
+ if (result.mantissa > 0) {
+ result.exponent = result.literal_exponent +
+ (DigitMagnitude<base>() * exponent_adjustment);
+ } else {
+ result.exponent = 0;
+ }
+ result.end = begin;
+ return result;
+}
+
+template ParsedFloat ParseFloat<10>(const char* begin, const char* end,
+ chars_format format_flags);
+template ParsedFloat ParseFloat<16>(const char* begin, const char* end,
+ chars_format format_flags);
+
+} // namespace strings_internal
+} // namespace absl
diff --git a/absl/strings/internal/charconv_parse.h b/absl/strings/internal/charconv_parse.h
new file mode 100644
index 00000000..7a5c0874
--- /dev/null
+++ b/absl/strings/internal/charconv_parse.h
@@ -0,0 +1,96 @@
+// Copyright 2018 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#ifndef ABSL_STRINGS_INTERNAL_CHARCONV_PARSE_H_
+#define ABSL_STRINGS_INTERNAL_CHARCONV_PARSE_H_
+
+#include <cstdint>
+
+#include "absl/strings/charconv.h"
+
+namespace absl {
+namespace strings_internal {
+
+// Enum indicating whether a parsed float is a number or special value.
+enum class FloatType { kNumber, kInfinity, kNan };
+
+// The decomposed parts of a parsed `float` or `double`.
+struct ParsedFloat {
+ // Representation of the parsed mantissa, with the decimal point adjusted to
+ // make it an integer.
+ //
+ // During decimal scanning, this contains 19 significant digits worth of
+ // mantissa value. If digits beyond this point are found, they
+ // are truncated, and if any of these dropped digits are nonzero, then
+ // `mantissa` is inexact, and the full mantissa is stored in [subrange_begin,
+ // subrange_end).
+ //
+ // During hexadecimal scanning, this contains 15 significant hex digits worth
+ // of mantissa value. Digits beyond this point are sticky -- they are
+ // truncated, but if any dropped digits are nonzero, the low bit of mantissa
+ // will be set. (This allows for precise rounding, and avoids the need
+ // to store the full mantissa in [subrange_begin, subrange_end).)
+ uint64_t mantissa = 0;
+
+ // Floating point expontent. This reflects any decimal point adjustments and
+ // any truncated digits from the mantissa. The absolute value of the parsed
+ // number is represented by mantissa * (base ** exponent), where base==10 for
+ // decimal floats, and base==2 for hexadecimal floats.
+ int exponent = 0;
+
+ // The literal exponent value scanned from the input, or 0 if none was
+ // present. This does not reflect any adjustments applied to mantissa.
+ int literal_exponent = 0;
+
+ // The type of number scanned.
+ FloatType type = FloatType::kNumber;
+
+ // When non-null, [subrange_begin, subrange_end) marks a range of characters
+ // that require further processing. The meaning is dependent on float type.
+ // If type == kNumber and this is set, this is a "wide input": the input
+ // mantissa contained more than 19 digits. The range contains the full
+ // mantissa. It plus `literal_exponent` need to be examined to find the best
+ // floating point match.
+ // If type == kNan and this is set, the range marks the contents of a
+ // matched parenthesized character region after the NaN.
+ const char* subrange_begin = nullptr;
+ const char* subrange_end = nullptr;
+
+ // One-past-the-end of the successfully parsed region, or nullptr if no
+ // matching pattern was found.
+ const char* end = nullptr;
+};
+
+// Read the floating point number in the provided range, and populate
+// ParsedFloat accordingly.
+//
+// format_flags is a bitmask value specifying what patterns this API will match.
+// `scientific` and `fixed` are honored per std::from_chars rules
+// ([utility.from.chars], C++17): if exactly one of these bits is set, then an
+// exponent is required, or dislallowed, respectively.
+//
+// Template parameter `base` must be either 10 or 16. For base 16, a "0x" is
+// *not* consumed. The `hex` bit from format_flags is ignored by ParseFloat.
+template <int base>
+ParsedFloat ParseFloat(const char* begin, const char* end,
+ absl::chars_format format_flags);
+
+extern template ParsedFloat ParseFloat<10>(const char* begin, const char* end,
+ absl::chars_format format_flags);
+extern template ParsedFloat ParseFloat<16>(const char* begin, const char* end,
+ absl::chars_format format_flags);
+
+} // namespace strings_internal
+} // namespace absl
+#endif // ABSL_STRINGS_INTERNAL_CHARCONV_PARSE_H_
diff --git a/absl/strings/internal/charconv_parse_test.cc b/absl/strings/internal/charconv_parse_test.cc
new file mode 100644
index 00000000..1ff86004
--- /dev/null
+++ b/absl/strings/internal/charconv_parse_test.cc
@@ -0,0 +1,357 @@
+// Copyright 2018 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/strings/internal/charconv_parse.h"
+
+#include <string>
+#include <utility>
+
+#include "gmock/gmock.h"
+#include "gtest/gtest.h"
+#include "absl/base/internal/raw_logging.h"
+#include "absl/strings/str_cat.h"
+
+using absl::chars_format;
+using absl::strings_internal::FloatType;
+using absl::strings_internal::ParsedFloat;
+using absl::strings_internal::ParseFloat;
+
+namespace {
+
+// Check that a given std::string input is parsed to the expected mantissa and
+// exponent.
+//
+// Input std::string `s` must contain a '$' character. It marks the end of the
+// characters that should be consumed by the match. It is stripped from the
+// input to ParseFloat.
+//
+// If input std::string `s` contains '[' and ']' characters, these mark the region
+// of characters that should be marked as the "subrange". For NaNs, this is
+// the location of the extended NaN std::string. For numbers, this is the location
+// of the full, over-large mantissa.
+template <int base>
+void ExpectParsedFloat(std::string s, absl::chars_format format_flags,
+ FloatType expected_type, uint64_t expected_mantissa,
+ int expected_exponent,
+ int expected_literal_exponent = -999) {
+ SCOPED_TRACE(s);
+
+ int begin_subrange = -1;
+ int end_subrange = -1;
+ // If s contains '[' and ']', then strip these characters and set the subrange
+ // indices appropriately.
+ std::string::size_type open_bracket_pos = s.find('[');
+ if (open_bracket_pos != std::string::npos) {
+ begin_subrange = static_cast<int>(open_bracket_pos);
+ s.replace(open_bracket_pos, 1, "");
+ std::string::size_type close_bracket_pos = s.find(']');
+ ABSL_RAW_CHECK(close_bracket_pos != absl::string_view::npos,
+ "Test input contains [ without matching ]");
+ end_subrange = static_cast<int>(close_bracket_pos);
+ s.replace(close_bracket_pos, 1, "");
+ }
+ const std::string::size_type expected_characters_matched = s.find('$');
+ ABSL_RAW_CHECK(expected_characters_matched != std::string::npos,
+ "Input std::string must contain $");
+ s.replace(expected_characters_matched, 1, "");
+
+ ParsedFloat parsed =
+ ParseFloat<base>(s.data(), s.data() + s.size(), format_flags);
+
+ EXPECT_NE(parsed.end, nullptr);
+ if (parsed.end == nullptr) {
+ return; // The following tests are not useful if we fully failed to parse
+ }
+ EXPECT_EQ(parsed.type, expected_type);
+ if (begin_subrange == -1) {
+ EXPECT_EQ(parsed.subrange_begin, nullptr);
+ EXPECT_EQ(parsed.subrange_end, nullptr);
+ } else {
+ EXPECT_EQ(parsed.subrange_begin, s.data() + begin_subrange);
+ EXPECT_EQ(parsed.subrange_end, s.data() + end_subrange);
+ }
+ if (parsed.type == FloatType::kNumber) {
+ EXPECT_EQ(parsed.mantissa, expected_mantissa);
+ EXPECT_EQ(parsed.exponent, expected_exponent);
+ if (expected_literal_exponent != -999) {
+ EXPECT_EQ(parsed.literal_exponent, expected_literal_exponent);
+ }
+ }
+ auto characters_matched = static_cast<int>(parsed.end - s.data());
+ EXPECT_EQ(characters_matched, expected_characters_matched);
+}
+
+// Check that a given std::string input is parsed to the expected mantissa and
+// exponent.
+//
+// Input std::string `s` must contain a '$' character. It marks the end of the
+// characters that were consumed by the match.
+template <int base>
+void ExpectNumber(std::string s, absl::chars_format format_flags,
+ uint64_t expected_mantissa, int expected_exponent,
+ int expected_literal_exponent = -999) {
+ ExpectParsedFloat<base>(std::move(s), format_flags, FloatType::kNumber,
+ expected_mantissa, expected_exponent,
+ expected_literal_exponent);
+}
+
+// Check that a given std::string input is parsed to the given special value.
+//
+// This tests against both number bases, since infinities and NaNs have
+// identical representations in both modes.
+void ExpectSpecial(const std::string& s, absl::chars_format format_flags,
+ FloatType type) {
+ ExpectParsedFloat<10>(s, format_flags, type, 0, 0);
+ ExpectParsedFloat<16>(s, format_flags, type, 0, 0);
+}
+
+// Check that a given input std::string is not matched by Float.
+template <int base>
+void ExpectFailedParse(absl::string_view s, absl::chars_format format_flags) {
+ ParsedFloat parsed =
+ ParseFloat<base>(s.data(), s.data() + s.size(), format_flags);
+ EXPECT_EQ(parsed.end, nullptr);
+}
+
+TEST(ParseFloat, SimpleValue) {
+ // Test that various forms of floating point numbers all parse correctly.
+ ExpectNumber<10>("1.23456789e5$", chars_format::general, 123456789, -3);
+ ExpectNumber<10>("1.23456789e+5$", chars_format::general, 123456789, -3);
+ ExpectNumber<10>("1.23456789E5$", chars_format::general, 123456789, -3);
+ ExpectNumber<10>("1.23456789e05$", chars_format::general, 123456789, -3);
+ ExpectNumber<10>("123.456789e3$", chars_format::general, 123456789, -3);
+ ExpectNumber<10>("0.000123456789e9$", chars_format::general, 123456789, -3);
+ ExpectNumber<10>("123456.789$", chars_format::general, 123456789, -3);
+ ExpectNumber<10>("123456789e-3$", chars_format::general, 123456789, -3);
+
+ ExpectNumber<16>("1.234abcdefp28$", chars_format::general, 0x1234abcdef, -8);
+ ExpectNumber<16>("1.234abcdefp+28$", chars_format::general, 0x1234abcdef, -8);
+ ExpectNumber<16>("1.234ABCDEFp28$", chars_format::general, 0x1234abcdef, -8);
+ ExpectNumber<16>("1.234AbCdEfP0028$", chars_format::general, 0x1234abcdef,
+ -8);
+ ExpectNumber<16>("123.4abcdefp20$", chars_format::general, 0x1234abcdef, -8);
+ ExpectNumber<16>("0.0001234abcdefp44$", chars_format::general, 0x1234abcdef,
+ -8);
+ ExpectNumber<16>("1234abcd.ef$", chars_format::general, 0x1234abcdef, -8);
+ ExpectNumber<16>("1234abcdefp-8$", chars_format::general, 0x1234abcdef, -8);
+
+ // ExpectNumber does not attempt to drop trailing zeroes.
+ ExpectNumber<10>("0001.2345678900e005$", chars_format::general, 12345678900,
+ -5);
+ ExpectNumber<16>("0001.234abcdef000p28$", chars_format::general,
+ 0x1234abcdef000, -20);
+
+ // Ensure non-matching characters after a number are ignored, even when they
+ // look like potentially matching characters.
+ ExpectNumber<10>("1.23456789e5$ ", chars_format::general, 123456789, -3);
+ ExpectNumber<10>("1.23456789e5$e5e5", chars_format::general, 123456789, -3);
+ ExpectNumber<10>("1.23456789e5$.25", chars_format::general, 123456789, -3);
+ ExpectNumber<10>("1.23456789e5$-", chars_format::general, 123456789, -3);
+ ExpectNumber<10>("1.23456789e5$PUPPERS!!!", chars_format::general, 123456789,
+ -3);
+ ExpectNumber<10>("123456.789$efghij", chars_format::general, 123456789, -3);
+ ExpectNumber<10>("123456.789$e", chars_format::general, 123456789, -3);
+ ExpectNumber<10>("123456.789$p5", chars_format::general, 123456789, -3);
+ ExpectNumber<10>("123456.789$.10", chars_format::general, 123456789, -3);
+
+ ExpectNumber<16>("1.234abcdefp28$ ", chars_format::general, 0x1234abcdef,
+ -8);
+ ExpectNumber<16>("1.234abcdefp28$p28", chars_format::general, 0x1234abcdef,
+ -8);
+ ExpectNumber<16>("1.234abcdefp28$.125", chars_format::general, 0x1234abcdef,
+ -8);
+ ExpectNumber<16>("1.234abcdefp28$-", chars_format::general, 0x1234abcdef, -8);
+ ExpectNumber<16>("1.234abcdefp28$KITTEHS!!!", chars_format::general,
+ 0x1234abcdef, -8);
+ ExpectNumber<16>("1234abcd.ef$ghijk", chars_format::general, 0x1234abcdef,
+ -8);
+ ExpectNumber<16>("1234abcd.ef$p", chars_format::general, 0x1234abcdef, -8);
+ ExpectNumber<16>("1234abcd.ef$.10", chars_format::general, 0x1234abcdef, -8);
+
+ // Ensure we can read a full resolution mantissa without overflow.
+ ExpectNumber<10>("9999999999999999999$", chars_format::general,
+ 9999999999999999999u, 0);
+ ExpectNumber<16>("fffffffffffffff$", chars_format::general,
+ 0xfffffffffffffffu, 0);
+
+ // Check that zero is consistently read.
+ ExpectNumber<10>("0$", chars_format::general, 0, 0);
+ ExpectNumber<16>("0$", chars_format::general, 0, 0);
+ ExpectNumber<10>("000000000000000000000000000000000000000$",
+ chars_format::general, 0, 0);
+ ExpectNumber<16>("000000000000000000000000000000000000000$",
+ chars_format::general, 0, 0);
+ ExpectNumber<10>("0000000000000000000000.000000000000000000$",
+ chars_format::general, 0, 0);
+ ExpectNumber<16>("0000000000000000000000.000000000000000000$",
+ chars_format::general, 0, 0);
+ ExpectNumber<10>("0.00000000000000000000000000000000e123456$",
+ chars_format::general, 0, 0);
+ ExpectNumber<16>("0.00000000000000000000000000000000p123456$",
+ chars_format::general, 0, 0);
+}
+
+TEST(ParseFloat, LargeDecimalMantissa) {
+ // After 19 significant decimal digits in the mantissa, ParsedFloat will
+ // truncate additional digits. We need to test that:
+ // 1) the truncation to 19 digits happens
+ // 2) the returned exponent reflects the dropped significant digits
+ // 3) a correct literal_exponent is set
+ //
+ // If and only if a significant digit is found after 19 digits, then the
+ // entirety of the mantissa in case the exact value is needed to make a
+ // rounding decision. The [ and ] characters below denote where such a
+ // subregion was marked by by ParseFloat. They are not part of the input.
+
+ // Mark a capture group only if a dropped digit is significant (nonzero).
+ ExpectNumber<10>("100000000000000000000000000$", chars_format::general,
+ 1000000000000000000,
+ /* adjusted exponent */ 8);
+
+ ExpectNumber<10>("123456789123456789100000000$", chars_format::general,
+ 1234567891234567891,
+ /* adjusted exponent */ 8);
+
+ ExpectNumber<10>("[123456789123456789123456789]$", chars_format::general,
+ 1234567891234567891,
+ /* adjusted exponent */ 8,
+ /* literal exponent */ 0);
+
+ ExpectNumber<10>("[123456789123456789100000009]$", chars_format::general,
+ 1234567891234567891,
+ /* adjusted exponent */ 8,
+ /* literal exponent */ 0);
+
+ ExpectNumber<10>("[123456789123456789120000000]$", chars_format::general,
+ 1234567891234567891,
+ /* adjusted exponent */ 8,
+ /* literal exponent */ 0);
+
+ // Leading zeroes should not count towards the 19 significant digit limit
+ ExpectNumber<10>("[00000000123456789123456789123456789]$",
+ chars_format::general, 1234567891234567891,
+ /* adjusted exponent */ 8,
+ /* literal exponent */ 0);
+
+ ExpectNumber<10>("00000000123456789123456789100000000$",
+ chars_format::general, 1234567891234567891,
+ /* adjusted exponent */ 8);
+
+ // Truncated digits after the decimal point should not cause a further
+ // exponent adjustment.
+ ExpectNumber<10>("1.234567891234567891e123$", chars_format::general,
+ 1234567891234567891, 105);
+ ExpectNumber<10>("[1.23456789123456789123456789]e123$", chars_format::general,
+ 1234567891234567891,
+ /* adjusted exponent */ 105,
+ /* literal exponent */ 123);
+
+ // Ensure we truncate, and not round. (The from_chars algorithm we use
+ // depends on our guess missing low, if it misses, so we need the rounding
+ // error to be downward.)
+ ExpectNumber<10>("[1999999999999999999999]$", chars_format::general,
+ 1999999999999999999,
+ /* adjusted exponent */ 3,
+ /* literal exponent */ 0);
+}
+
+TEST(ParseFloat, LargeHexadecimalMantissa) {
+ // After 15 significant hex digits in the mantissa, ParsedFloat will treat
+ // additional digits as sticky, We need to test that:
+ // 1) The truncation to 15 digits happens
+ // 2) The returned exponent reflects the dropped significant digits
+ // 3) If a nonzero digit is dropped, the low bit of mantissa is set.
+
+ ExpectNumber<16>("123456789abcdef123456789abcdef$", chars_format::general,
+ 0x123456789abcdef, 60);
+
+ // Leading zeroes should not count towards the 15 significant digit limit
+ ExpectNumber<16>("000000123456789abcdef123456789abcdef$",
+ chars_format::general, 0x123456789abcdef, 60);
+
+ // Truncated digits after the radix point should not cause a further
+ // exponent adjustment.
+ ExpectNumber<16>("1.23456789abcdefp100$", chars_format::general,
+ 0x123456789abcdef, 44);
+ ExpectNumber<16>("1.23456789abcdef123456789abcdefp100$",
+ chars_format::general, 0x123456789abcdef, 44);
+
+ // test sticky digit behavior. The low bit should be set iff any dropped
+ // digit is nonzero.
+ ExpectNumber<16>("123456789abcdee123456789abcdee$", chars_format::general,
+ 0x123456789abcdef, 60);
+ ExpectNumber<16>("123456789abcdee000000000000001$", chars_format::general,
+ 0x123456789abcdef, 60);
+ ExpectNumber<16>("123456789abcdee000000000000000$", chars_format::general,
+ 0x123456789abcdee, 60);
+}
+
+TEST(ParseFloat, ScientificVsFixed) {
+ // In fixed mode, an exponent is never matched (but the remainder of the
+ // number will be matched.)
+ ExpectNumber<10>("1.23456789$e5", chars_format::fixed, 123456789, -8);
+ ExpectNumber<10>("123456.789$", chars_format::fixed, 123456789, -3);
+ ExpectNumber<16>("1.234abcdef$p28", chars_format::fixed, 0x1234abcdef, -36);
+ ExpectNumber<16>("1234abcd.ef$", chars_format::fixed, 0x1234abcdef, -8);
+
+ // In scientific mode, numbers don't match *unless* they have an exponent.
+ ExpectNumber<10>("1.23456789e5$", chars_format::scientific, 123456789, -3);
+ ExpectFailedParse<10>("-123456.789$", chars_format::scientific);
+ ExpectNumber<16>("1.234abcdefp28$", chars_format::scientific, 0x1234abcdef,
+ -8);
+ ExpectFailedParse<16>("1234abcd.ef$", chars_format::scientific);
+}
+
+TEST(ParseFloat, Infinity) {
+ ExpectFailedParse<10>("in", chars_format::general);
+ ExpectFailedParse<16>("in", chars_format::general);
+ ExpectFailedParse<10>("inx", chars_format::general);
+ ExpectFailedParse<16>("inx", chars_format::general);
+ ExpectSpecial("inf$", chars_format::general, FloatType::kInfinity);
+ ExpectSpecial("Inf$", chars_format::general, FloatType::kInfinity);
+ ExpectSpecial("INF$", chars_format::general, FloatType::kInfinity);
+ ExpectSpecial("inf$inite", chars_format::general, FloatType::kInfinity);
+ ExpectSpecial("iNfInItY$", chars_format::general, FloatType::kInfinity);
+ ExpectSpecial("infinity$!!!", chars_format::general, FloatType::kInfinity);
+}
+
+TEST(ParseFloat, NaN) {
+ ExpectFailedParse<10>("na", chars_format::general);
+ ExpectFailedParse<16>("na", chars_format::general);
+ ExpectFailedParse<10>("nah", chars_format::general);
+ ExpectFailedParse<16>("nah", chars_format::general);
+ ExpectSpecial("nan$", chars_format::general, FloatType::kNan);
+ ExpectSpecial("NaN$", chars_format::general, FloatType::kNan);
+ ExpectSpecial("nAn$", chars_format::general, FloatType::kNan);
+ ExpectSpecial("NAN$", chars_format::general, FloatType::kNan);
+ ExpectSpecial("NaN$aNaNaNaNaBatman!", chars_format::general, FloatType::kNan);
+
+ // A parenthesized sequence of the characters [a-zA-Z0-9_] is allowed to
+ // appear after an NaN. Check that this is allowed, and that the correct
+ // characters are grouped.
+ //
+ // (The characters [ and ] in the pattern below delimit the expected matched
+ // subgroup; they are not part of the input passed to ParseFloat.)
+ ExpectSpecial("nan([0xabcdef])$", chars_format::general, FloatType::kNan);
+ ExpectSpecial("nan([0xabcdef])$...", chars_format::general, FloatType::kNan);
+ ExpectSpecial("nan([0xabcdef])$)...", chars_format::general, FloatType::kNan);
+ ExpectSpecial("nan([])$", chars_format::general, FloatType::kNan);
+ ExpectSpecial("nan([aAzZ09_])$", chars_format::general, FloatType::kNan);
+ // If the subgroup contains illegal characters, don't match it at all.
+ ExpectSpecial("nan$(bad-char)", chars_format::general, FloatType::kNan);
+ // Also cope with a missing close paren.
+ ExpectSpecial("nan$(0xabcdef", chars_format::general, FloatType::kNan);
+}
+
+} // namespace
diff --git a/absl/strings/internal/str_format/arg.cc b/absl/strings/internal/str_format/arg.cc
new file mode 100644
index 00000000..eafb068f
--- /dev/null
+++ b/absl/strings/internal/str_format/arg.cc
@@ -0,0 +1,399 @@
+//
+// POSIX spec:
+// http://pubs.opengroup.org/onlinepubs/009695399/functions/fprintf.html
+//
+#include "absl/strings/internal/str_format/arg.h"
+
+#include <cassert>
+#include <cerrno>
+#include <cstdlib>
+#include <string>
+#include <type_traits>
+
+#include "absl/base/port.h"
+#include "absl/strings/internal/str_format/float_conversion.h"
+
+namespace absl {
+namespace str_format_internal {
+namespace {
+
+const char kDigit[2][32] = { "0123456789abcdef", "0123456789ABCDEF" };
+
+// Reduce *capacity by s.size(), clipped to a 0 minimum.
+void ReducePadding(string_view s, size_t *capacity) {
+ *capacity = Excess(s.size(), *capacity);
+}
+
+// Reduce *capacity by n, clipped to a 0 minimum.
+void ReducePadding(size_t n, size_t *capacity) {
+ *capacity = Excess(n, *capacity);
+}
+
+template <typename T>
+struct MakeUnsigned : std::make_unsigned<T> {};
+template <>
+struct MakeUnsigned<absl::uint128> {
+ using type = absl::uint128;
+};
+
+template <typename T>
+struct IsSigned : std::is_signed<T> {};
+template <>
+struct IsSigned<absl::uint128> : std::false_type {};
+
+class ConvertedIntInfo {
+ public:
+ template <typename T>
+ ConvertedIntInfo(T v, ConversionChar conv) {
+ using Unsigned = typename MakeUnsigned<T>::type;
+ auto u = static_cast<Unsigned>(v);
+ if (IsNeg(v)) {
+ is_neg_ = true;
+ u = Unsigned{} - u;
+ } else {
+ is_neg_ = false;
+ }
+ UnsignedToStringRight(u, conv);
+ }
+
+ string_view digits() const {
+ return {end() - size_, static_cast<size_t>(size_)};
+ }
+ bool is_neg() const { return is_neg_; }
+
+ private:
+ template <typename T, bool IsSigned>
+ struct IsNegImpl {
+ static bool Eval(T v) { return v < 0; }
+ };
+ template <typename T>
+ struct IsNegImpl<T, false> {
+ static bool Eval(T) {
+ return false;
+ }
+ };
+
+ template <typename T>
+ bool IsNeg(T v) {
+ return IsNegImpl<T, IsSigned<T>::value>::Eval(v);
+ }
+
+ template <typename T>
+ void UnsignedToStringRight(T u, ConversionChar conv) {
+ char *p = end();
+ switch (conv.radix()) {
+ default:
+ case 10:
+ for (; u; u /= 10)
+ *--p = static_cast<char>('0' + static_cast<size_t>(u % 10));
+ break;
+ case 8:
+ for (; u; u /= 8)
+ *--p = static_cast<char>('0' + static_cast<size_t>(u % 8));
+ break;
+ case 16: {
+ const char *digits = kDigit[conv.upper() ? 1 : 0];
+ for (; u; u /= 16) *--p = digits[static_cast<size_t>(u % 16)];
+ break;
+ }
+ }
+ size_ = static_cast<int>(end() - p);
+ }
+
+ const char *end() const { return storage_ + sizeof(storage_); }
+ char *end() { return storage_ + sizeof(storage_); }
+
+ bool is_neg_;
+ int size_;
+ // Max size: 128 bit value as octal -> 43 digits
+ char storage_[128 / 3 + 1];
+};
+
+// Note: 'o' conversions do not have a base indicator, it's just that
+// the '#' flag is specified to modify the precision for 'o' conversions.
+string_view BaseIndicator(const ConvertedIntInfo &info,
+ const ConversionSpec &conv) {
+ bool alt = conv.flags().alt;
+ int radix = conv.conv().radix();
+ if (conv.conv().id() == ConversionChar::p)
+ alt = true; // always show 0x for %p.
+ // From the POSIX description of '#' flag:
+ // "For x or X conversion specifiers, a non-zero result shall have
+ // 0x (or 0X) prefixed to it."
+ if (alt && radix == 16 && !info.digits().empty()) {
+ if (conv.conv().upper()) return "0X";
+ return "0x";
+ }
+ return {};
+}
+
+string_view SignColumn(bool neg, const ConversionSpec &conv) {
+ if (conv.conv().is_signed()) {
+ if (neg) return "-";
+ if (conv.flags().show_pos) return "+";
+ if (conv.flags().sign_col) return " ";
+ }
+ return {};
+}
+
+bool ConvertCharImpl(unsigned char v, const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ size_t fill = 0;
+ if (conv.width() >= 0) fill = conv.width();
+ ReducePadding(1, &fill);
+ if (!conv.flags().left) sink->Append(fill, ' ');
+ sink->Append(1, v);
+ if (conv.flags().left) sink->Append(fill, ' ');
+ return true;
+}
+
+bool ConvertIntImplInner(const ConvertedIntInfo &info,
+ const ConversionSpec &conv, FormatSinkImpl *sink) {
+ // Print as a sequence of Substrings:
+ // [left_spaces][sign][base_indicator][zeroes][formatted][right_spaces]
+ size_t fill = 0;
+ if (conv.width() >= 0) fill = conv.width();
+
+ string_view formatted = info.digits();
+ ReducePadding(formatted, &fill);
+
+ string_view sign = SignColumn(info.is_neg(), conv);
+ ReducePadding(sign, &fill);
+
+ string_view base_indicator = BaseIndicator(info, conv);
+ ReducePadding(base_indicator, &fill);
+
+ int precision = conv.precision();
+ bool precision_specified = precision >= 0;
+ if (!precision_specified)
+ precision = 1;
+
+ if (conv.flags().alt && conv.conv().id() == ConversionChar::o) {
+ // From POSIX description of the '#' (alt) flag:
+ // "For o conversion, it increases the precision (if necessary) to
+ // force the first digit of the result to be zero."
+ if (formatted.empty() || *formatted.begin() != '0') {
+ int needed = static_cast<int>(formatted.size()) + 1;
+ precision = std::max(precision, needed);
+ }
+ }
+
+ size_t num_zeroes = Excess(formatted.size(), precision);
+ ReducePadding(num_zeroes, &fill);
+
+ size_t num_left_spaces = !conv.flags().left ? fill : 0;
+ size_t num_right_spaces = conv.flags().left ? fill : 0;
+
+ // From POSIX description of the '0' (zero) flag:
+ // "For d, i, o, u, x, and X conversion specifiers, if a precision
+ // is specified, the '0' flag is ignored."
+ if (!precision_specified && conv.flags().zero) {
+ num_zeroes += num_left_spaces;
+ num_left_spaces = 0;
+ }
+
+ sink->Append(num_left_spaces, ' ');
+ sink->Append(sign);
+ sink->Append(base_indicator);
+ sink->Append(num_zeroes, '0');
+ sink->Append(formatted);
+ sink->Append(num_right_spaces, ' ');
+ return true;
+}
+
+template <typename T>
+bool ConvertIntImplInner(T v, const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ ConvertedIntInfo info(v, conv.conv());
+ if (conv.flags().basic && conv.conv().id() != ConversionChar::p) {
+ if (info.is_neg()) sink->Append(1, '-');
+ if (info.digits().empty()) {
+ sink->Append(1, '0');
+ } else {
+ sink->Append(info.digits());
+ }
+ return true;
+ }
+ return ConvertIntImplInner(info, conv, sink);
+}
+
+template <typename T>
+bool ConvertIntArg(T v, const ConversionSpec &conv, FormatSinkImpl *sink) {
+ if (conv.conv().is_float()) {
+ return FormatConvertImpl(static_cast<double>(v), conv, sink).value;
+ }
+ if (conv.conv().id() == ConversionChar::c)
+ return ConvertCharImpl(static_cast<unsigned char>(v), conv, sink);
+ if (!conv.conv().is_integral())
+ return false;
+ if (!conv.conv().is_signed() && IsSigned<T>::value) {
+ using U = typename MakeUnsigned<T>::type;
+ return FormatConvertImpl(static_cast<U>(v), conv, sink).value;
+ }
+ return ConvertIntImplInner(v, conv, sink);
+}
+
+template <typename T>
+bool ConvertFloatArg(T v, const ConversionSpec &conv, FormatSinkImpl *sink) {
+ return conv.conv().is_float() && ConvertFloatImpl(v, conv, sink);
+}
+
+inline bool ConvertStringArg(string_view v, const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ if (conv.conv().id() != ConversionChar::s)
+ return false;
+ if (conv.flags().basic) {
+ sink->Append(v);
+ return true;
+ }
+ return sink->PutPaddedString(v, conv.width(), conv.precision(),
+ conv.flags().left);
+}
+
+} // namespace
+
+// ==================== Strings ====================
+ConvertResult<Conv::s> FormatConvertImpl(const std::string &v,
+ const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ return {ConvertStringArg(v, conv, sink)};
+}
+
+ConvertResult<Conv::s> FormatConvertImpl(string_view v,
+ const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ return {ConvertStringArg(v, conv, sink)};
+}
+
+ConvertResult<Conv::s | Conv::p> FormatConvertImpl(const char *v,
+ const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ if (conv.conv().id() == ConversionChar::p)
+ return {FormatConvertImpl(VoidPtr(v), conv, sink).value};
+ size_t len;
+ if (v == nullptr) {
+ len = 0;
+ } else if (conv.precision() < 0) {
+ len = std::strlen(v);
+ } else {
+ // If precision is set, we look for the null terminator on the valid range.
+ len = std::find(v, v + conv.precision(), '\0') - v;
+ }
+ return {ConvertStringArg(string_view(v, len), conv, sink)};
+}
+
+// ==================== Raw pointers ====================
+ConvertResult<Conv::p> FormatConvertImpl(VoidPtr v, const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ if (conv.conv().id() != ConversionChar::p)
+ return {false};
+ if (!v.value) {
+ sink->Append("(nil)");
+ return {true};
+ }
+ return {ConvertIntImplInner(v.value, conv, sink)};
+}
+
+// ==================== Floats ====================
+FloatingConvertResult FormatConvertImpl(float v, const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ return {ConvertFloatArg(v, conv, sink)};
+}
+FloatingConvertResult FormatConvertImpl(double v, const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ return {ConvertFloatArg(v, conv, sink)};
+}
+FloatingConvertResult FormatConvertImpl(long double v,
+ const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ return {ConvertFloatArg(v, conv, sink)};
+}
+
+// ==================== Chars ====================
+IntegralConvertResult FormatConvertImpl(char v, const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ return {ConvertIntArg(v, conv, sink)};
+}
+IntegralConvertResult FormatConvertImpl(signed char v,
+ const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ return {ConvertIntArg(v, conv, sink)};
+}
+IntegralConvertResult FormatConvertImpl(unsigned char v,
+ const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ return {ConvertIntArg(v, conv, sink)};
+}
+
+// ==================== Ints ====================
+IntegralConvertResult FormatConvertImpl(short v, // NOLINT
+ const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ return {ConvertIntArg(v, conv, sink)};
+}
+IntegralConvertResult FormatConvertImpl(unsigned short v, // NOLINT
+ const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ return {ConvertIntArg(v, conv, sink)};
+}
+IntegralConvertResult FormatConvertImpl(int v, const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ return {ConvertIntArg(v, conv, sink)};
+}
+IntegralConvertResult FormatConvertImpl(unsigned v, const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ return {ConvertIntArg(v, conv, sink)};
+}
+IntegralConvertResult FormatConvertImpl(long v, // NOLINT
+ const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ return {ConvertIntArg(v, conv, sink)};
+}
+IntegralConvertResult FormatConvertImpl(unsigned long v, // NOLINT
+ const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ return {ConvertIntArg(v, conv, sink)};
+}
+IntegralConvertResult FormatConvertImpl(long long v, // NOLINT
+ const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ return {ConvertIntArg(v, conv, sink)};
+}
+IntegralConvertResult FormatConvertImpl(unsigned long long v, // NOLINT
+ const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ return {ConvertIntArg(v, conv, sink)};
+}
+IntegralConvertResult FormatConvertImpl(absl::uint128 v,
+ const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ return {ConvertIntArg(v, conv, sink)};
+}
+
+template struct FormatArgImpl::TypedVTable<str_format_internal::VoidPtr>;
+
+template struct FormatArgImpl::TypedVTable<bool>;
+template struct FormatArgImpl::TypedVTable<char>;
+template struct FormatArgImpl::TypedVTable<signed char>;
+template struct FormatArgImpl::TypedVTable<unsigned char>;
+template struct FormatArgImpl::TypedVTable<short>; // NOLINT
+template struct FormatArgImpl::TypedVTable<unsigned short>; // NOLINT
+template struct FormatArgImpl::TypedVTable<int>;
+template struct FormatArgImpl::TypedVTable<unsigned>;
+template struct FormatArgImpl::TypedVTable<long>; // NOLINT
+template struct FormatArgImpl::TypedVTable<unsigned long>; // NOLINT
+template struct FormatArgImpl::TypedVTable<long long>; // NOLINT
+template struct FormatArgImpl::TypedVTable<unsigned long long>; // NOLINT
+template struct FormatArgImpl::TypedVTable<absl::uint128>;
+
+template struct FormatArgImpl::TypedVTable<float>;
+template struct FormatArgImpl::TypedVTable<double>;
+template struct FormatArgImpl::TypedVTable<long double>;
+
+template struct FormatArgImpl::TypedVTable<const char *>;
+template struct FormatArgImpl::TypedVTable<std::string>;
+template struct FormatArgImpl::TypedVTable<string_view>;
+
+} // namespace str_format_internal
+
+} // namespace absl
diff --git a/absl/strings/internal/str_format/arg.h b/absl/strings/internal/str_format/arg.h
new file mode 100644
index 00000000..a9562188
--- /dev/null
+++ b/absl/strings/internal/str_format/arg.h
@@ -0,0 +1,434 @@
+#ifndef ABSL_STRINGS_INTERNAL_STR_FORMAT_ARG_H_
+#define ABSL_STRINGS_INTERNAL_STR_FORMAT_ARG_H_
+
+#include <string.h>
+#include <wchar.h>
+
+#include <cstdio>
+#include <iomanip>
+#include <limits>
+#include <sstream>
+#include <string>
+#include <type_traits>
+
+#include "absl/base/port.h"
+#include "absl/meta/type_traits.h"
+#include "absl/numeric/int128.h"
+#include "absl/strings/internal/str_format/extension.h"
+#include "absl/strings/string_view.h"
+
+class Cord;
+class CordReader;
+
+namespace absl {
+
+class FormatCountCapture;
+class FormatSink;
+
+namespace str_format_internal {
+
+template <typename T, typename = void>
+struct HasUserDefinedConvert : std::false_type {};
+
+template <typename T>
+struct HasUserDefinedConvert<
+ T, void_t<decltype(AbslFormatConvert(
+ std::declval<const T&>(), std::declval<const ConversionSpec&>(),
+ std::declval<FormatSink*>()))>> : std::true_type {};
+template <typename T>
+class StreamedWrapper;
+
+// If 'v' can be converted (in the printf sense) according to 'conv',
+// then convert it, appending to `sink` and return `true`.
+// Otherwise fail and return `false`.
+// Raw pointers.
+struct VoidPtr {
+ VoidPtr() = default;
+ template <typename T,
+ decltype(reinterpret_cast<uintptr_t>(std::declval<T*>())) = 0>
+ VoidPtr(T* ptr) // NOLINT
+ : value(ptr ? reinterpret_cast<uintptr_t>(ptr) : 0) {}
+ uintptr_t value;
+};
+ConvertResult<Conv::p> FormatConvertImpl(VoidPtr v, const ConversionSpec& conv,
+ FormatSinkImpl* sink);
+
+// Strings.
+ConvertResult<Conv::s> FormatConvertImpl(const std::string& v,
+ const ConversionSpec& conv,
+ FormatSinkImpl* sink);
+ConvertResult<Conv::s> FormatConvertImpl(string_view v,
+ const ConversionSpec& conv,
+ FormatSinkImpl* sink);
+ConvertResult<Conv::s | Conv::p> FormatConvertImpl(const char* v,
+ const ConversionSpec& conv,
+ FormatSinkImpl* sink);
+template <class AbslCord,
+ typename std::enable_if<
+ std::is_same<AbslCord, ::Cord>::value>::type* = nullptr,
+ class AbslCordReader = ::CordReader>
+ConvertResult<Conv::s> FormatConvertImpl(const AbslCord& value,
+ const ConversionSpec& conv,
+ FormatSinkImpl* sink) {
+ if (conv.conv().id() != ConversionChar::s) return {false};
+
+ bool is_left = conv.flags().left;
+ size_t space_remaining = 0;
+
+ int width = conv.width();
+ if (width >= 0) space_remaining = width;
+
+ size_t to_write = value.size();
+
+ int precision = conv.precision();
+ if (precision >= 0)
+ to_write = std::min(to_write, static_cast<size_t>(precision));
+
+ space_remaining = Excess(to_write, space_remaining);
+
+ if (space_remaining > 0 && !is_left) sink->Append(space_remaining, ' ');
+
+ string_view piece;
+ for (AbslCordReader reader(value);
+ to_write > 0 && reader.ReadFragment(&piece); to_write -= piece.size()) {
+ if (piece.size() > to_write) piece.remove_suffix(piece.size() - to_write);
+ sink->Append(piece);
+ }
+
+ if (space_remaining > 0 && is_left) sink->Append(space_remaining, ' ');
+ return {true};
+}
+
+using IntegralConvertResult =
+ ConvertResult<Conv::c | Conv::numeric | Conv::star>;
+using FloatingConvertResult = ConvertResult<Conv::floating>;
+
+// Floats.
+FloatingConvertResult FormatConvertImpl(float v, const ConversionSpec& conv,
+ FormatSinkImpl* sink);
+FloatingConvertResult FormatConvertImpl(double v, const ConversionSpec& conv,
+ FormatSinkImpl* sink);
+FloatingConvertResult FormatConvertImpl(long double v,
+ const ConversionSpec& conv,
+ FormatSinkImpl* sink);
+
+// Chars.
+IntegralConvertResult FormatConvertImpl(char v, const ConversionSpec& conv,
+ FormatSinkImpl* sink);
+IntegralConvertResult FormatConvertImpl(signed char v,
+ const ConversionSpec& conv,
+ FormatSinkImpl* sink);
+IntegralConvertResult FormatConvertImpl(unsigned char v,
+ const ConversionSpec& conv,
+ FormatSinkImpl* sink);
+
+// Ints.
+IntegralConvertResult FormatConvertImpl(short v, // NOLINT
+ const ConversionSpec& conv,
+ FormatSinkImpl* sink);
+IntegralConvertResult FormatConvertImpl(unsigned short v, // NOLINT
+ const ConversionSpec& conv,
+ FormatSinkImpl* sink);
+IntegralConvertResult FormatConvertImpl(int v, const ConversionSpec& conv,
+ FormatSinkImpl* sink);
+IntegralConvertResult FormatConvertImpl(unsigned v, const ConversionSpec& conv,
+ FormatSinkImpl* sink);
+IntegralConvertResult FormatConvertImpl(long v, // NOLINT
+ const ConversionSpec& conv,
+ FormatSinkImpl* sink);
+IntegralConvertResult FormatConvertImpl(unsigned long v, // NOLINT
+ const ConversionSpec& conv,
+ FormatSinkImpl* sink);
+IntegralConvertResult FormatConvertImpl(long long v, // NOLINT
+ const ConversionSpec& conv,
+ FormatSinkImpl* sink);
+IntegralConvertResult FormatConvertImpl(unsigned long long v, // NOLINT
+ const ConversionSpec& conv,
+ FormatSinkImpl* sink);
+IntegralConvertResult FormatConvertImpl(uint128 v, const ConversionSpec& conv,
+ FormatSinkImpl* sink);
+template <typename T, enable_if_t<std::is_same<T, bool>::value, int> = 0>
+IntegralConvertResult FormatConvertImpl(T v, const ConversionSpec& conv,
+ FormatSinkImpl* sink) {
+ return FormatConvertImpl(static_cast<int>(v), conv, sink);
+}
+
+// We provide this function to help the checker, but it is never defined.
+// FormatArgImpl will use the underlying Convert functions instead.
+template <typename T>
+typename std::enable_if<std::is_enum<T>::value &&
+ !HasUserDefinedConvert<T>::value,
+ IntegralConvertResult>::type
+FormatConvertImpl(T v, const ConversionSpec& conv, FormatSinkImpl* sink);
+
+template <typename T>
+ConvertResult<Conv::s> FormatConvertImpl(const StreamedWrapper<T>& v,
+ const ConversionSpec& conv,
+ FormatSinkImpl* out) {
+ std::ostringstream oss;
+ oss << v.v_;
+ if (!oss) return {false};
+ return str_format_internal::FormatConvertImpl(oss.str(), conv, out);
+}
+
+// Use templates and dependent types to delay evaluation of the function
+// until after FormatCountCapture is fully defined.
+struct FormatCountCaptureHelper {
+ template <class T = int>
+ static ConvertResult<Conv::n> ConvertHelper(const FormatCountCapture& v,
+ const ConversionSpec& conv,
+ FormatSinkImpl* sink) {
+ const absl::enable_if_t<sizeof(T) != 0, FormatCountCapture>& v2 = v;
+
+ if (conv.conv().id() != str_format_internal::ConversionChar::n)
+ return {false};
+ *v2.p_ = static_cast<int>(sink->size());
+ return {true};
+ }
+};
+
+template <class T = int>
+ConvertResult<Conv::n> FormatConvertImpl(const FormatCountCapture& v,
+ const ConversionSpec& conv,
+ FormatSinkImpl* sink) {
+ return FormatCountCaptureHelper::ConvertHelper(v, conv, sink);
+}
+
+// Helper friend struct to hide implementation details from the public API of
+// FormatArgImpl.
+struct FormatArgImplFriend {
+ template <typename Arg>
+ static bool ToInt(Arg arg, int* out) {
+ if (!arg.vtbl_->to_int) return false;
+ *out = arg.vtbl_->to_int(arg.data_);
+ return true;
+ }
+
+ template <typename Arg>
+ static bool Convert(Arg arg, const str_format_internal::ConversionSpec& conv,
+ FormatSinkImpl* out) {
+ return arg.vtbl_->convert(arg.data_, conv, out);
+ }
+
+ template <typename Arg>
+ static const void* GetVTablePtrForTest(Arg arg) {
+ return arg.vtbl_;
+ }
+};
+
+// A type-erased handle to a format argument.
+class FormatArgImpl {
+ private:
+ enum { kInlinedSpace = 8 };
+
+ using VoidPtr = str_format_internal::VoidPtr;
+
+ union Data {
+ const void* ptr;
+ const volatile void* volatile_ptr;
+ char buf[kInlinedSpace];
+ };
+
+ struct VTable {
+ bool (*convert)(Data, const str_format_internal::ConversionSpec& conv,
+ FormatSinkImpl* out);
+ int (*to_int)(Data);
+ };
+
+ template <typename T>
+ struct store_by_value
+ : std::integral_constant<bool, (sizeof(T) <= kInlinedSpace) &&
+ (std::is_integral<T>::value ||
+ std::is_floating_point<T>::value ||
+ std::is_pointer<T>::value ||
+ std::is_same<VoidPtr, T>::value)> {};
+
+ enum StoragePolicy { ByPointer, ByVolatilePointer, ByValue };
+ template <typename T>
+ struct storage_policy
+ : std::integral_constant<StoragePolicy,
+ (std::is_volatile<T>::value
+ ? ByVolatilePointer
+ : (store_by_value<T>::value ? ByValue
+ : ByPointer))> {
+ };
+
+ // An instance of an FormatArgImpl::VTable suitable for 'T'.
+ template <typename T>
+ struct TypedVTable;
+
+ // To reduce the number of vtables we will decay values before hand.
+ // Anything with a user-defined Convert will get its own vtable.
+ // For everything else:
+ // - Decay char* and char arrays into `const char*`
+ // - Decay any other pointer to `const void*`
+ // - Decay all enums to their underlying type.
+ // - Decay function pointers to void*.
+ template <typename T, typename = void>
+ struct DecayType {
+ static constexpr bool kHasUserDefined =
+ str_format_internal::HasUserDefinedConvert<T>::value;
+ using type = typename std::conditional<
+ !kHasUserDefined && std::is_convertible<T, const char*>::value,
+ const char*,
+ typename std::conditional<!kHasUserDefined &&
+ std::is_convertible<T, VoidPtr>::value,
+ VoidPtr, const T&>::type>::type;
+ };
+ template <typename T>
+ struct DecayType<T,
+ typename std::enable_if<
+ !str_format_internal::HasUserDefinedConvert<T>::value &&
+ std::is_enum<T>::value>::type> {
+ using type = typename std::underlying_type<T>::type;
+ };
+
+ public:
+ template <typename T>
+ explicit FormatArgImpl(const T& value) {
+ using D = typename DecayType<T>::type;
+ static_assert(
+ std::is_same<D, const T&>::value || storage_policy<D>::value == ByValue,
+ "Decayed types must be stored by value");
+ Init(static_cast<D>(value));
+ }
+
+ private:
+ friend struct str_format_internal::FormatArgImplFriend;
+ template <typename T, StoragePolicy = storage_policy<T>::value>
+ struct Manager;
+
+ template <typename T>
+ struct Manager<T, ByPointer> {
+ static Data SetValue(const T& value) {
+ Data data;
+ data.ptr = &value;
+ return data;
+ }
+
+ static const T& Value(Data arg) { return *static_cast<const T*>(arg.ptr); }
+ };
+
+ template <typename T>
+ struct Manager<T, ByVolatilePointer> {
+ static Data SetValue(const T& value) {
+ Data data;
+ data.volatile_ptr = &value;
+ return data;
+ }
+
+ static const T& Value(Data arg) {
+ return *static_cast<const T*>(arg.volatile_ptr);
+ }
+ };
+
+ template <typename T>
+ struct Manager<T, ByValue> {
+ static Data SetValue(const T& value) {
+ Data data;
+ memcpy(data.buf, &value, sizeof(value));
+ return data;
+ }
+
+ static T Value(Data arg) {
+ T value;
+ memcpy(&value, arg.buf, sizeof(T));
+ return value;
+ }
+ };
+
+ template <typename T>
+ void Init(const T& value);
+
+ template <typename T>
+ static int ToIntVal(const T& val) {
+ using CommonType = typename std::conditional<std::is_signed<T>::value,
+ int64_t, uint64_t>::type;
+ if (static_cast<CommonType>(val) >
+ static_cast<CommonType>(std::numeric_limits<int>::max())) {
+ return std::numeric_limits<int>::max();
+ } else if (std::is_signed<T>::value &&
+ static_cast<CommonType>(val) <
+ static_cast<CommonType>(std::numeric_limits<int>::min())) {
+ return std::numeric_limits<int>::min();
+ }
+ return static_cast<int>(val);
+ }
+
+ Data data_;
+ const VTable* vtbl_;
+};
+
+template <typename T>
+struct FormatArgImpl::TypedVTable {
+ private:
+ static bool ConvertImpl(Data arg,
+ const str_format_internal::ConversionSpec& conv,
+ FormatSinkImpl* out) {
+ return str_format_internal::FormatConvertImpl(Manager<T>::Value(arg), conv,
+ out)
+ .value;
+ }
+
+ template <typename U = T, typename = void>
+ struct ToIntImpl {
+ static constexpr int (*value)(Data) = nullptr;
+ };
+
+ template <typename U>
+ struct ToIntImpl<U,
+ typename std::enable_if<std::is_integral<U>::value>::type> {
+ static int Invoke(Data arg) { return ToIntVal(Manager<T>::Value(arg)); }
+ static constexpr int (*value)(Data) = &Invoke;
+ };
+
+ template <typename U>
+ struct ToIntImpl<U, typename std::enable_if<std::is_enum<U>::value>::type> {
+ static int Invoke(Data arg) {
+ return ToIntVal(static_cast<typename std::underlying_type<T>::type>(
+ Manager<T>::Value(arg)));
+ }
+ static constexpr int (*value)(Data) = &Invoke;
+ };
+
+ public:
+ static constexpr VTable value{&ConvertImpl, ToIntImpl<>::value};
+};
+
+template <typename T>
+constexpr FormatArgImpl::VTable FormatArgImpl::TypedVTable<T>::value;
+
+template <typename T>
+void FormatArgImpl::Init(const T& value) {
+ data_ = Manager<T>::SetValue(value);
+ vtbl_ = &TypedVTable<T>::value;
+}
+
+extern template struct FormatArgImpl::TypedVTable<str_format_internal::VoidPtr>;
+
+extern template struct FormatArgImpl::TypedVTable<bool>;
+extern template struct FormatArgImpl::TypedVTable<char>;
+extern template struct FormatArgImpl::TypedVTable<signed char>;
+extern template struct FormatArgImpl::TypedVTable<unsigned char>;
+extern template struct FormatArgImpl::TypedVTable<short>; // NOLINT
+extern template struct FormatArgImpl::TypedVTable<unsigned short>; // NOLINT
+extern template struct FormatArgImpl::TypedVTable<int>;
+extern template struct FormatArgImpl::TypedVTable<unsigned>;
+extern template struct FormatArgImpl::TypedVTable<long>; // NOLINT
+extern template struct FormatArgImpl::TypedVTable<unsigned long>; // NOLINT
+extern template struct FormatArgImpl::TypedVTable<long long>; // NOLINT
+extern template struct FormatArgImpl::TypedVTable<
+ unsigned long long>; // NOLINT
+extern template struct FormatArgImpl::TypedVTable<uint128>;
+
+extern template struct FormatArgImpl::TypedVTable<float>;
+extern template struct FormatArgImpl::TypedVTable<double>;
+extern template struct FormatArgImpl::TypedVTable<long double>;
+
+extern template struct FormatArgImpl::TypedVTable<const char*>;
+extern template struct FormatArgImpl::TypedVTable<std::string>;
+extern template struct FormatArgImpl::TypedVTable<string_view>;
+} // namespace str_format_internal
+} // namespace absl
+
+#endif // ABSL_STRINGS_INTERNAL_STR_FORMAT_ARG_H_
diff --git a/absl/strings/internal/str_format/arg_test.cc b/absl/strings/internal/str_format/arg_test.cc
new file mode 100644
index 00000000..83d59048
--- /dev/null
+++ b/absl/strings/internal/str_format/arg_test.cc
@@ -0,0 +1,111 @@
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+#include "absl/strings/internal/str_format/arg.h"
+
+#include <ostream>
+#include <string>
+#include "gtest/gtest.h"
+#include "absl/strings/str_format.h"
+
+namespace absl {
+namespace str_format_internal {
+namespace {
+
+class FormatArgImplTest : public ::testing::Test {
+ public:
+ enum Color { kRed, kGreen, kBlue };
+
+ static const char *hi() { return "hi"; }
+};
+
+TEST_F(FormatArgImplTest, ToInt) {
+ int out = 0;
+ EXPECT_TRUE(FormatArgImplFriend::ToInt(FormatArgImpl(1), &out));
+ EXPECT_EQ(1, out);
+ EXPECT_TRUE(FormatArgImplFriend::ToInt(FormatArgImpl(-1), &out));
+ EXPECT_EQ(-1, out);
+ EXPECT_TRUE(
+ FormatArgImplFriend::ToInt(FormatArgImpl(static_cast<char>(64)), &out));
+ EXPECT_EQ(64, out);
+ EXPECT_TRUE(FormatArgImplFriend::ToInt(
+ FormatArgImpl(static_cast<unsigned long long>(123456)), &out)); // NOLINT
+ EXPECT_EQ(123456, out);
+ EXPECT_TRUE(FormatArgImplFriend::ToInt(
+ FormatArgImpl(static_cast<unsigned long long>( // NOLINT
+ std::numeric_limits<int>::max()) +
+ 1),
+ &out));
+ EXPECT_EQ(std::numeric_limits<int>::max(), out);
+ EXPECT_TRUE(FormatArgImplFriend::ToInt(
+ FormatArgImpl(static_cast<long long>( // NOLINT
+ std::numeric_limits<int>::min()) -
+ 10),
+ &out));
+ EXPECT_EQ(std::numeric_limits<int>::min(), out);
+ EXPECT_TRUE(FormatArgImplFriend::ToInt(FormatArgImpl(false), &out));
+ EXPECT_EQ(0, out);
+ EXPECT_TRUE(FormatArgImplFriend::ToInt(FormatArgImpl(true), &out));
+ EXPECT_EQ(1, out);
+ EXPECT_FALSE(FormatArgImplFriend::ToInt(FormatArgImpl(2.2), &out));
+ EXPECT_FALSE(FormatArgImplFriend::ToInt(FormatArgImpl(3.2f), &out));
+ EXPECT_FALSE(FormatArgImplFriend::ToInt(
+ FormatArgImpl(static_cast<int *>(nullptr)), &out));
+ EXPECT_FALSE(FormatArgImplFriend::ToInt(FormatArgImpl(hi()), &out));
+ EXPECT_FALSE(FormatArgImplFriend::ToInt(FormatArgImpl("hi"), &out));
+ EXPECT_TRUE(FormatArgImplFriend::ToInt(FormatArgImpl(kBlue), &out));
+ EXPECT_EQ(2, out);
+}
+
+extern const char kMyArray[];
+
+TEST_F(FormatArgImplTest, CharArraysDecayToCharPtr) {
+ const char* a = "";
+ EXPECT_EQ(FormatArgImplFriend::GetVTablePtrForTest(FormatArgImpl(a)),
+ FormatArgImplFriend::GetVTablePtrForTest(FormatArgImpl("")));
+ EXPECT_EQ(FormatArgImplFriend::GetVTablePtrForTest(FormatArgImpl(a)),
+ FormatArgImplFriend::GetVTablePtrForTest(FormatArgImpl("A")));
+ EXPECT_EQ(FormatArgImplFriend::GetVTablePtrForTest(FormatArgImpl(a)),
+ FormatArgImplFriend::GetVTablePtrForTest(FormatArgImpl("ABC")));
+ EXPECT_EQ(FormatArgImplFriend::GetVTablePtrForTest(FormatArgImpl(a)),
+ FormatArgImplFriend::GetVTablePtrForTest(FormatArgImpl(kMyArray)));
+}
+
+TEST_F(FormatArgImplTest, OtherPtrDecayToVoidPtr) {
+ auto expected = FormatArgImplFriend::GetVTablePtrForTest(
+ FormatArgImpl(static_cast<void *>(nullptr)));
+ EXPECT_EQ(FormatArgImplFriend::GetVTablePtrForTest(
+ FormatArgImpl(static_cast<int *>(nullptr))),
+ expected);
+ EXPECT_EQ(FormatArgImplFriend::GetVTablePtrForTest(
+ FormatArgImpl(static_cast<volatile int *>(nullptr))),
+ expected);
+
+ auto p = static_cast<void (*)()>([] {});
+ EXPECT_EQ(FormatArgImplFriend::GetVTablePtrForTest(FormatArgImpl(p)),
+ expected);
+}
+
+TEST_F(FormatArgImplTest, WorksWithCharArraysOfUnknownSize) {
+ std::string s;
+ FormatSinkImpl sink(&s);
+ ConversionSpec conv;
+ conv.set_conv(ConversionChar::FromChar('s'));
+ conv.set_flags(Flags());
+ conv.set_width(-1);
+ conv.set_precision(-1);
+ EXPECT_TRUE(
+ FormatArgImplFriend::Convert(FormatArgImpl(kMyArray), conv, &sink));
+ sink.Flush();
+ EXPECT_EQ("ABCDE", s);
+}
+const char kMyArray[] = "ABCDE";
+
+} // namespace
+} // namespace str_format_internal
+} // namespace absl
diff --git a/absl/strings/internal/str_format/bind.cc b/absl/strings/internal/str_format/bind.cc
new file mode 100644
index 00000000..33e86415
--- /dev/null
+++ b/absl/strings/internal/str_format/bind.cc
@@ -0,0 +1,232 @@
+#include "absl/strings/internal/str_format/bind.h"
+
+#include <cerrno>
+#include <limits>
+#include <sstream>
+#include <string>
+
+namespace absl {
+namespace str_format_internal {
+
+namespace {
+
+inline bool BindFromPosition(int position, int* value,
+ absl::Span<const FormatArgImpl> pack) {
+ assert(position > 0);
+ if (static_cast<size_t>(position) > pack.size()) {
+ return false;
+ }
+ // -1 because positions are 1-based
+ return FormatArgImplFriend::ToInt(pack[position - 1], value);
+}
+
+class ArgContext {
+ public:
+ explicit ArgContext(absl::Span<const FormatArgImpl> pack) : pack_(pack) {}
+
+ // Fill 'bound' with the results of applying the context's argument pack
+ // to the specified 'props'. We synthesize a BoundConversion by
+ // lining up a UnboundConversion with a user argument. We also
+ // resolve any '*' specifiers for width and precision, so after
+ // this call, 'bound' has all the information it needs to be formatted.
+ // Returns false on failure.
+ bool Bind(const UnboundConversion *props, BoundConversion *bound);
+
+ private:
+ absl::Span<const FormatArgImpl> pack_;
+};
+
+inline bool ArgContext::Bind(const UnboundConversion* unbound,
+ BoundConversion* bound) {
+ const FormatArgImpl* arg = nullptr;
+ int arg_position = unbound->arg_position;
+ if (static_cast<size_t>(arg_position - 1) >= pack_.size()) return false;
+ arg = &pack_[arg_position - 1]; // 1-based
+
+ if (!unbound->flags.basic) {
+ int width = unbound->width.value();
+ bool force_left = false;
+ if (unbound->width.is_from_arg()) {
+ if (!BindFromPosition(unbound->width.get_from_arg(), &width, pack_))
+ return false;
+ if (width < 0) {
+ // "A negative field width is taken as a '-' flag followed by a
+ // positive field width."
+ force_left = true;
+ width = -width;
+ }
+ }
+
+ int precision = unbound->precision.value();
+ if (unbound->precision.is_from_arg()) {
+ if (!BindFromPosition(unbound->precision.get_from_arg(), &precision,
+ pack_))
+ return false;
+ }
+
+ bound->set_width(width);
+ bound->set_precision(precision);
+ bound->set_flags(unbound->flags);
+ if (force_left)
+ bound->set_left(true);
+ } else {
+ bound->set_flags(unbound->flags);
+ bound->set_width(-1);
+ bound->set_precision(-1);
+ }
+
+ bound->set_length_mod(unbound->length_mod);
+ bound->set_conv(unbound->conv);
+ bound->set_arg(arg);
+ return true;
+}
+
+template <typename Converter>
+class ConverterConsumer {
+ public:
+ ConverterConsumer(Converter converter, absl::Span<const FormatArgImpl> pack)
+ : converter_(converter), arg_context_(pack) {}
+
+ bool Append(string_view s) {
+ converter_.Append(s);
+ return true;
+ }
+ bool ConvertOne(const UnboundConversion& conv, string_view conv_string) {
+ BoundConversion bound;
+ if (!arg_context_.Bind(&conv, &bound)) return false;
+ return converter_.ConvertOne(bound, conv_string);
+ }
+
+ private:
+ Converter converter_;
+ ArgContext arg_context_;
+};
+
+template <typename Converter>
+bool ConvertAll(const UntypedFormatSpecImpl& format,
+ absl::Span<const FormatArgImpl> args,
+ const Converter& converter) {
+ const ParsedFormatBase* pc = format.parsed_conversion();
+ if (pc)
+ return pc->ProcessFormat(ConverterConsumer<Converter>(converter, args));
+
+ return ParseFormatString(format.str(),
+ ConverterConsumer<Converter>(converter, args));
+}
+
+class DefaultConverter {
+ public:
+ explicit DefaultConverter(FormatSinkImpl* sink) : sink_(sink) {}
+
+ void Append(string_view s) const { sink_->Append(s); }
+
+ bool ConvertOne(const BoundConversion& bound, string_view /*conv*/) const {
+ return FormatArgImplFriend::Convert(*bound.arg(), bound, sink_);
+ }
+
+ private:
+ FormatSinkImpl* sink_;
+};
+
+class SummarizingConverter {
+ public:
+ explicit SummarizingConverter(FormatSinkImpl* sink) : sink_(sink) {}
+
+ void Append(string_view s) const { sink_->Append(s); }
+
+ bool ConvertOne(const BoundConversion& bound, string_view /*conv*/) const {
+ UntypedFormatSpecImpl spec("%d");
+
+ std::ostringstream ss;
+ ss << "{" << Streamable(spec, {*bound.arg()}) << ":" << bound.flags();
+ if (bound.width() >= 0) ss << bound.width();
+ if (bound.precision() >= 0) ss << "." << bound.precision();
+ ss << bound.length_mod() << bound.conv() << "}";
+ Append(ss.str());
+ return true;
+ }
+
+ private:
+ FormatSinkImpl* sink_;
+};
+
+} // namespace
+
+bool BindWithPack(const UnboundConversion* props,
+ absl::Span<const FormatArgImpl> pack,
+ BoundConversion* bound) {
+ return ArgContext(pack).Bind(props, bound);
+}
+
+std::string Summarize(const UntypedFormatSpecImpl& format,
+ absl::Span<const FormatArgImpl> args) {
+ typedef SummarizingConverter Converter;
+ std::string out;
+ {
+ // inner block to destroy sink before returning out. It ensures a last
+ // flush.
+ FormatSinkImpl sink(&out);
+ if (!ConvertAll(format, args, Converter(&sink))) {
+ sink.Flush();
+ out.clear();
+ }
+ }
+ return out;
+}
+
+bool FormatUntyped(FormatRawSinkImpl raw_sink,
+ const UntypedFormatSpecImpl& format,
+ absl::Span<const FormatArgImpl> args) {
+ FormatSinkImpl sink(raw_sink);
+ using Converter = DefaultConverter;
+ if (!ConvertAll(format, args, Converter(&sink))) {
+ sink.Flush();
+ return false;
+ }
+ return true;
+}
+
+std::ostream& Streamable::Print(std::ostream& os) const {
+ if (!FormatUntyped(&os, format_, args_)) os.setstate(std::ios::failbit);
+ return os;
+}
+
+std::string& AppendPack(std::string* out, const UntypedFormatSpecImpl& format,
+ absl::Span<const FormatArgImpl> args) {
+ size_t orig = out->size();
+ if (!FormatUntyped(out, format, args)) out->resize(orig);
+ return *out;
+}
+
+int FprintF(std::FILE* output, const UntypedFormatSpecImpl& format,
+ absl::Span<const FormatArgImpl> args) {
+ FILERawSink sink(output);
+ if (!FormatUntyped(&sink, format, args)) {
+ errno = EINVAL;
+ return -1;
+ }
+ if (sink.error()) {
+ errno = sink.error();
+ return -1;
+ }
+ if (sink.count() > std::numeric_limits<int>::max()) {
+ errno = EFBIG;
+ return -1;
+ }
+ return static_cast<int>(sink.count());
+}
+
+int SnprintF(char* output, size_t size, const UntypedFormatSpecImpl& format,
+ absl::Span<const FormatArgImpl> args) {
+ BufferRawSink sink(output, size ? size - 1 : 0);
+ if (!FormatUntyped(&sink, format, args)) {
+ errno = EINVAL;
+ return -1;
+ }
+ size_t total = sink.total_written();
+ if (size) output[std::min(total, size - 1)] = 0;
+ return static_cast<int>(total);
+}
+
+} // namespace str_format_internal
+} // namespace absl
diff --git a/absl/strings/internal/str_format/bind.h b/absl/strings/internal/str_format/bind.h
new file mode 100644
index 00000000..40086112
--- /dev/null
+++ b/absl/strings/internal/str_format/bind.h
@@ -0,0 +1,189 @@
+#ifndef ABSL_STRINGS_INTERNAL_STR_FORMAT_BIND_H_
+#define ABSL_STRINGS_INTERNAL_STR_FORMAT_BIND_H_
+
+#include <array>
+#include <cstdio>
+#include <sstream>
+#include <string>
+
+#include "absl/base/port.h"
+#include "absl/container/inlined_vector.h"
+#include "absl/strings/internal/str_format/arg.h"
+#include "absl/strings/internal/str_format/checker.h"
+#include "absl/strings/internal/str_format/parser.h"
+#include "absl/types/span.h"
+
+namespace absl {
+
+class UntypedFormatSpec;
+
+namespace str_format_internal {
+
+class BoundConversion : public ConversionSpec {
+ public:
+ const FormatArgImpl* arg() const { return arg_; }
+ void set_arg(const FormatArgImpl* a) { arg_ = a; }
+
+ private:
+ const FormatArgImpl* arg_;
+};
+
+// This is the type-erased class that the implementation uses.
+class UntypedFormatSpecImpl {
+ public:
+ UntypedFormatSpecImpl() = delete;
+
+ explicit UntypedFormatSpecImpl(string_view s) : str_(s), pc_() {}
+ explicit UntypedFormatSpecImpl(
+ const str_format_internal::ParsedFormatBase* pc)
+ : pc_(pc) {}
+ string_view str() const { return str_; }
+ const str_format_internal::ParsedFormatBase* parsed_conversion() const {
+ return pc_;
+ }
+
+ template <typename T>
+ static const UntypedFormatSpecImpl& Extract(const T& s) {
+ return s.spec_;
+ }
+
+ private:
+ string_view str_;
+ const str_format_internal::ParsedFormatBase* pc_;
+};
+
+template <typename T, typename...>
+struct MakeDependent {
+ using type = T;
+};
+
+// Implicitly convertible from `const char*`, `string_view`, and the
+// `ExtendedParsedFormat` type. This abstraction allows all format functions to
+// operate on any without providing too many overloads.
+template <typename... Args>
+class FormatSpecTemplate
+ : public MakeDependent<UntypedFormatSpec, Args...>::type {
+ using Base = typename MakeDependent<UntypedFormatSpec, Args...>::type;
+
+ public:
+#if ABSL_INTERNAL_ENABLE_FORMAT_CHECKER
+
+ // Honeypot overload for when the std::string is not constexpr.
+ // We use the 'unavailable' attribute to give a better compiler error than
+ // just 'method is deleted'.
+ FormatSpecTemplate(...) // NOLINT
+ __attribute__((unavailable("Format std::string is not constexpr.")));
+
+ // Honeypot overload for when the format is constexpr and invalid.
+ // We use the 'unavailable' attribute to give a better compiler error than
+ // just 'method is deleted'.
+ // To avoid checking the format twice, we just check that the format is
+ // constexpr. If is it valid, then the overload below will kick in.
+ // We add the template here to make this overload have lower priority.
+ template <typename = void>
+ FormatSpecTemplate(const char* s) // NOLINT
+ __attribute__((
+ enable_if(str_format_internal::EnsureConstexpr(s), "constexpr trap"),
+ unavailable(
+ "Format specified does not match the arguments passed.")));
+
+ template <typename T = void>
+ FormatSpecTemplate(string_view s) // NOLINT
+ __attribute__((enable_if(str_format_internal::EnsureConstexpr(s),
+ "constexpr trap"))) {
+ static_assert(sizeof(T*) == 0,
+ "Format specified does not match the arguments passed.");
+ }
+
+ // Good format overload.
+ FormatSpecTemplate(const char* s) // NOLINT
+ __attribute__((enable_if(ValidFormatImpl<ArgumentToConv<Args>()...>(s),
+ "bad format trap")))
+ : Base(s) {}
+
+ FormatSpecTemplate(string_view s) // NOLINT
+ __attribute__((enable_if(ValidFormatImpl<ArgumentToConv<Args>()...>(s),
+ "bad format trap")))
+ : Base(s) {}
+
+#else // ABSL_INTERNAL_ENABLE_FORMAT_CHECKER
+
+ FormatSpecTemplate(const char* s) : Base(s) {} // NOLINT
+ FormatSpecTemplate(string_view s) : Base(s) {} // NOLINT
+
+#endif // ABSL_INTERNAL_ENABLE_FORMAT_CHECKER
+
+ template <Conv... C, typename = typename std::enable_if<
+ sizeof...(C) == sizeof...(Args) &&
+ AllOf(Contains(ArgumentToConv<Args>(),
+ C)...)>::type>
+ FormatSpecTemplate(const ExtendedParsedFormat<C...>& pc) // NOLINT
+ : Base(&pc) {}
+};
+
+template <typename... Args>
+struct FormatSpecDeductionBarrier {
+ using type = FormatSpecTemplate<Args...>;
+};
+
+class Streamable {
+ public:
+ Streamable(const UntypedFormatSpecImpl& format,
+ absl::Span<const FormatArgImpl> args)
+ : format_(format), args_(args.begin(), args.end()) {}
+
+ std::ostream& Print(std::ostream& os) const;
+
+ friend std::ostream& operator<<(std::ostream& os, const Streamable& l) {
+ return l.Print(os);
+ }
+
+ private:
+ const UntypedFormatSpecImpl& format_;
+ absl::InlinedVector<FormatArgImpl, 4> args_;
+};
+
+// for testing
+std::string Summarize(const UntypedFormatSpecImpl& format,
+ absl::Span<const FormatArgImpl> args);
+bool BindWithPack(const UnboundConversion* props,
+ absl::Span<const FormatArgImpl> pack, BoundConversion* bound);
+
+bool FormatUntyped(FormatRawSinkImpl raw_sink,
+ const UntypedFormatSpecImpl& format,
+ absl::Span<const FormatArgImpl> args);
+
+std::string& AppendPack(std::string* out, const UntypedFormatSpecImpl& format,
+ absl::Span<const FormatArgImpl> args);
+
+inline std::string FormatPack(const UntypedFormatSpecImpl& format,
+ absl::Span<const FormatArgImpl> args) {
+ std::string out;
+ AppendPack(&out, format, args);
+ return out;
+}
+
+int FprintF(std::FILE* output, const UntypedFormatSpecImpl& format,
+ absl::Span<const FormatArgImpl> args);
+int SnprintF(char* output, size_t size, const UntypedFormatSpecImpl& format,
+ absl::Span<const FormatArgImpl> args);
+
+// Returned by Streamed(v). Converts via '%s' to the std::string created
+// by std::ostream << v.
+template <typename T>
+class StreamedWrapper {
+ public:
+ explicit StreamedWrapper(const T& v) : v_(v) { }
+
+ private:
+ template <typename S>
+ friend ConvertResult<Conv::s> FormatConvertImpl(const StreamedWrapper<S>& v,
+ const ConversionSpec& conv,
+ FormatSinkImpl* out);
+ const T& v_;
+};
+
+} // namespace str_format_internal
+} // namespace absl
+
+#endif // ABSL_STRINGS_INTERNAL_STR_FORMAT_BIND_H_
diff --git a/absl/strings/internal/str_format/bind_test.cc b/absl/strings/internal/str_format/bind_test.cc
new file mode 100644
index 00000000..47575739
--- /dev/null
+++ b/absl/strings/internal/str_format/bind_test.cc
@@ -0,0 +1,131 @@
+#include "absl/strings/internal/str_format/bind.h"
+
+#include <string.h>
+
+#include "gtest/gtest.h"
+
+namespace absl {
+namespace str_format_internal {
+namespace {
+
+template <typename T, size_t N>
+size_t ArraySize(T (&)[N]) {
+ return N;
+}
+
+class FormatBindTest : public ::testing::Test {
+ public:
+ bool Extract(const char *s, UnboundConversion *props, int *next) const {
+ absl::string_view src = s;
+ return ConsumeUnboundConversion(&src, props, next) && src.empty();
+ }
+};
+
+TEST_F(FormatBindTest, BindSingle) {
+ struct Expectation {
+ int line;
+ const char *fmt;
+ int ok_phases;
+ const FormatArgImpl *arg;
+ int width;
+ int precision;
+ int next_arg;
+ };
+ const int no = -1;
+ const int ia[] = { 10, 20, 30, 40};
+ const FormatArgImpl args[] = {FormatArgImpl(ia[0]), FormatArgImpl(ia[1]),
+ FormatArgImpl(ia[2]), FormatArgImpl(ia[3])};
+#pragma GCC diagnostic push
+#pragma GCC diagnostic ignored "-Wmissing-field-initializers"
+ const Expectation kExpect[] = {
+ {__LINE__, "d", 2, &args[0], no, no, 2},
+ {__LINE__, "4d", 2, &args[0], 4, no, 2},
+ {__LINE__, ".5d", 2, &args[0], no, 5, 2},
+ {__LINE__, "4.5d", 2, &args[0], 4, 5, 2},
+ {__LINE__, "*d", 2, &args[1], 10, no, 3},
+ {__LINE__, ".*d", 2, &args[1], no, 10, 3},
+ {__LINE__, "*.*d", 2, &args[2], 10, 20, 4},
+ {__LINE__, "1$d", 2, &args[0], no, no, 0},
+ {__LINE__, "2$d", 2, &args[1], no, no, 0},
+ {__LINE__, "3$d", 2, &args[2], no, no, 0},
+ {__LINE__, "4$d", 2, &args[3], no, no, 0},
+ {__LINE__, "2$*1$d", 2, &args[1], 10, no, 0},
+ {__LINE__, "2$*2$d", 2, &args[1], 20, no, 0},
+ {__LINE__, "2$*3$d", 2, &args[1], 30, no, 0},
+ {__LINE__, "2$.*1$d", 2, &args[1], no, 10, 0},
+ {__LINE__, "2$.*2$d", 2, &args[1], no, 20, 0},
+ {__LINE__, "2$.*3$d", 2, &args[1], no, 30, 0},
+ {__LINE__, "2$*3$.*1$d", 2, &args[1], 30, 10, 0},
+ {__LINE__, "2$*2$.*2$d", 2, &args[1], 20, 20, 0},
+ {__LINE__, "2$*1$.*3$d", 2, &args[1], 10, 30, 0},
+ {__LINE__, "2$*3$.*1$d", 2, &args[1], 30, 10, 0},
+ {__LINE__, "1$*d", 0}, // indexed, then positional
+ {__LINE__, "*2$d", 0}, // positional, then indexed
+ {__LINE__, "6$d", 1}, // arg position out of bounds
+ {__LINE__, "1$6$d", 0}, // width position incorrectly specified
+ {__LINE__, "1$.6$d", 0}, // precision position incorrectly specified
+ {__LINE__, "1$*6$d", 1}, // width position out of bounds
+ {__LINE__, "1$.*6$d", 1}, // precision position out of bounds
+ };
+#pragma GCC diagnostic pop
+ for (const Expectation &e : kExpect) {
+ SCOPED_TRACE(e.line);
+ SCOPED_TRACE(e.fmt);
+ UnboundConversion props;
+ BoundConversion bound;
+ int ok_phases = 0;
+ int next = 0;
+ if (Extract(e.fmt, &props, &next)) {
+ ++ok_phases;
+ if (BindWithPack(&props, args, &bound)) {
+ ++ok_phases;
+ }
+ }
+ EXPECT_EQ(e.ok_phases, ok_phases);
+ if (e.ok_phases < 2) continue;
+ if (e.arg != nullptr) {
+ EXPECT_EQ(e.arg, bound.arg());
+ }
+ EXPECT_EQ(e.width, bound.width());
+ EXPECT_EQ(e.precision, bound.precision());
+ }
+}
+
+TEST_F(FormatBindTest, FormatPack) {
+ struct Expectation {
+ int line;
+ const char *fmt;
+ const char *summary;
+ };
+ const int ia[] = { 10, 20, 30, 40, -10 };
+ const FormatArgImpl args[] = {FormatArgImpl(ia[0]), FormatArgImpl(ia[1]),
+ FormatArgImpl(ia[2]), FormatArgImpl(ia[3]),
+ FormatArgImpl(ia[4])};
+ const Expectation kExpect[] = {
+ {__LINE__, "a%4db%dc", "a{10:4d}b{20:d}c"},
+ {__LINE__, "a%.4db%dc", "a{10:.4d}b{20:d}c"},
+ {__LINE__, "a%4.5db%dc", "a{10:4.5d}b{20:d}c"},
+ {__LINE__, "a%db%4.5dc", "a{10:d}b{20:4.5d}c"},
+ {__LINE__, "a%db%*.*dc", "a{10:d}b{40:20.30d}c"},
+ {__LINE__, "a%.*fb", "a{20:.10f}b"},
+ {__LINE__, "a%1$db%2$*3$.*4$dc", "a{10:d}b{20:30.40d}c"},
+ {__LINE__, "a%4$db%3$*2$.*1$dc", "a{40:d}b{30:20.10d}c"},
+ {__LINE__, "a%04ldb", "a{10:04ld}b"},
+ {__LINE__, "a%-#04lldb", "a{10:-#04lld}b"},
+ {__LINE__, "a%1$*5$db", "a{10:-10d}b"},
+ {__LINE__, "a%1$.*5$db", "a{10:d}b"},
+ };
+ for (const Expectation &e : kExpect) {
+ absl::string_view fmt = e.fmt;
+ SCOPED_TRACE(e.line);
+ SCOPED_TRACE(e.fmt);
+ UntypedFormatSpecImpl format(fmt);
+ EXPECT_EQ(e.summary,
+ str_format_internal::Summarize(format, absl::MakeSpan(args)))
+ << "line:" << e.line;
+ }
+}
+
+} // namespace
+} // namespace str_format_internal
+} // namespace absl
diff --git a/absl/strings/internal/str_format/checker.h b/absl/strings/internal/str_format/checker.h
new file mode 100644
index 00000000..8b594f2d
--- /dev/null
+++ b/absl/strings/internal/str_format/checker.h
@@ -0,0 +1,325 @@
+#ifndef ABSL_STRINGS_INTERNAL_STR_FORMAT_CHECKER_H_
+#define ABSL_STRINGS_INTERNAL_STR_FORMAT_CHECKER_H_
+
+#include "absl/strings/internal/str_format/arg.h"
+#include "absl/strings/internal/str_format/extension.h"
+
+// Compile time check support for entry points.
+
+#ifndef ABSL_INTERNAL_ENABLE_FORMAT_CHECKER
+#if defined(__clang__) && !defined(__native_client__)
+#if __has_attribute(enable_if)
+#define ABSL_INTERNAL_ENABLE_FORMAT_CHECKER 1
+#endif // __has_attribute(enable_if)
+#endif // defined(__clang__) && !defined(__native_client__)
+#endif // ABSL_INTERNAL_ENABLE_FORMAT_CHECKER
+
+namespace absl {
+namespace str_format_internal {
+
+constexpr bool AllOf() { return true; }
+
+template <typename... T>
+constexpr bool AllOf(bool b, T... t) {
+ return b && AllOf(t...);
+}
+
+template <typename Arg>
+constexpr Conv ArgumentToConv() {
+ return decltype(str_format_internal::FormatConvertImpl(
+ std::declval<const Arg&>(), std::declval<const ConversionSpec&>(),
+ std::declval<FormatSinkImpl*>()))::kConv;
+}
+
+#if ABSL_INTERNAL_ENABLE_FORMAT_CHECKER
+
+constexpr bool ContainsChar(const char* chars, char c) {
+ return *chars == c || (*chars && ContainsChar(chars + 1, c));
+}
+
+// A constexpr compatible list of Convs.
+struct ConvList {
+ const Conv* array;
+ int count;
+
+ // We do the bound check here to avoid having to do it on the callers.
+ // Returning an empty Conv has the same effect as short circuiting because it
+ // will never match any conversion.
+ constexpr Conv operator[](int i) const {
+ return i < count ? array[i] : Conv{};
+ }
+
+ constexpr ConvList without_front() const {
+ return count != 0 ? ConvList{array + 1, count - 1} : *this;
+ }
+};
+
+template <size_t count>
+struct ConvListT {
+ // Make sure the array has size > 0.
+ Conv list[count ? count : 1];
+};
+
+constexpr char GetChar(string_view str, size_t index) {
+ return index < str.size() ? str[index] : char{};
+}
+
+constexpr string_view ConsumeFront(string_view str, size_t len = 1) {
+ return len <= str.size() ? string_view(str.data() + len, str.size() - len)
+ : string_view();
+}
+
+constexpr string_view ConsumeAnyOf(string_view format, const char* chars) {
+ return ContainsChar(chars, GetChar(format, 0))
+ ? ConsumeAnyOf(ConsumeFront(format), chars)
+ : format;
+}
+
+constexpr bool IsDigit(char c) { return c >= '0' && c <= '9'; }
+
+// Helper class for the ParseDigits function.
+// It encapsulates the two return values we need there.
+struct Integer {
+ string_view format;
+ int value;
+
+ // If the next character is a '$', consume it.
+ // Otherwise, make `this` an invalid positional argument.
+ constexpr Integer ConsumePositionalDollar() const {
+ return GetChar(format, 0) == '$' ? Integer{ConsumeFront(format), value}
+ : Integer{format, 0};
+ }
+};
+
+constexpr Integer ParseDigits(string_view format, int value = 0) {
+ return IsDigit(GetChar(format, 0))
+ ? ParseDigits(ConsumeFront(format),
+ 10 * value + GetChar(format, 0) - '0')
+ : Integer{format, value};
+}
+
+// Parse digits for a positional argument.
+// The parsing also consumes the '$'.
+constexpr Integer ParsePositional(string_view format) {
+ return ParseDigits(format).ConsumePositionalDollar();
+}
+
+// Parses a single conversion specifier.
+// See ConvParser::Run() for post conditions.
+class ConvParser {
+ constexpr ConvParser SetFormat(string_view format) const {
+ return ConvParser(format, args_, error_, arg_position_, is_positional_);
+ }
+
+ constexpr ConvParser SetArgs(ConvList args) const {
+ return ConvParser(format_, args, error_, arg_position_, is_positional_);
+ }
+
+ constexpr ConvParser SetError(bool error) const {
+ return ConvParser(format_, args_, error_ || error, arg_position_,
+ is_positional_);
+ }
+
+ constexpr ConvParser SetArgPosition(int arg_position) const {
+ return ConvParser(format_, args_, error_, arg_position, is_positional_);
+ }
+
+ // Consumes the next arg and verifies that it matches `conv`.
+ // `error_` is set if there is no next arg or if it doesn't match `conv`.
+ constexpr ConvParser ConsumeNextArg(char conv) const {
+ return SetArgs(args_.without_front()).SetError(!Contains(args_[0], conv));
+ }
+
+ // Verify that positional argument `i.value` matches `conv`.
+ // `error_` is set if `i.value` is not a valid argument or if it doesn't
+ // match.
+ constexpr ConvParser VerifyPositional(Integer i, char conv) const {
+ return SetFormat(i.format).SetError(!Contains(args_[i.value - 1], conv));
+ }
+
+ // Parse the position of the arg and store it in `arg_position_`.
+ constexpr ConvParser ParseArgPosition(Integer arg) const {
+ return SetFormat(arg.format).SetArgPosition(arg.value);
+ }
+
+ // Consume the flags.
+ constexpr ConvParser ParseFlags() const {
+ return SetFormat(ConsumeAnyOf(format_, "-+ #0"));
+ }
+
+ // Consume the width.
+ // If it is '*', we verify that it matches `args_`. `error_` is set if it
+ // doesn't match.
+ constexpr ConvParser ParseWidth() const {
+ return IsDigit(GetChar(format_, 0))
+ ? SetFormat(ParseDigits(format_).format)
+ : GetChar(format_, 0) == '*'
+ ? is_positional_
+ ? VerifyPositional(
+ ParsePositional(ConsumeFront(format_)), '*')
+ : SetFormat(ConsumeFront(format_))
+ .ConsumeNextArg('*')
+ : *this;
+ }
+
+ // Consume the precision.
+ // If it is '*', we verify that it matches `args_`. `error_` is set if it
+ // doesn't match.
+ constexpr ConvParser ParsePrecision() const {
+ return GetChar(format_, 0) != '.'
+ ? *this
+ : GetChar(format_, 1) == '*'
+ ? is_positional_
+ ? VerifyPositional(
+ ParsePositional(ConsumeFront(format_, 2)), '*')
+ : SetFormat(ConsumeFront(format_, 2))
+ .ConsumeNextArg('*')
+ : SetFormat(ParseDigits(ConsumeFront(format_)).format);
+ }
+
+ // Consume the length characters.
+ constexpr ConvParser ParseLength() const {
+ return SetFormat(ConsumeAnyOf(format_, "lLhjztq"));
+ }
+
+ // Consume the conversion character and verify that it matches `args_`.
+ // `error_` is set if it doesn't match.
+ constexpr ConvParser ParseConversion() const {
+ return is_positional_
+ ? VerifyPositional({ConsumeFront(format_), arg_position_},
+ GetChar(format_, 0))
+ : ConsumeNextArg(GetChar(format_, 0))
+ .SetFormat(ConsumeFront(format_));
+ }
+
+ constexpr ConvParser(string_view format, ConvList args, bool error,
+ int arg_position, bool is_positional)
+ : format_(format),
+ args_(args),
+ error_(error),
+ arg_position_(arg_position),
+ is_positional_(is_positional) {}
+
+ public:
+ constexpr ConvParser(string_view format, ConvList args, bool is_positional)
+ : format_(format),
+ args_(args),
+ error_(false),
+ arg_position_(0),
+ is_positional_(is_positional) {}
+
+ // Consume the whole conversion specifier.
+ // `format()` will be set to the character after the conversion character.
+ // `error()` will be set if any of the arguments do not match.
+ constexpr ConvParser Run() const {
+ return (is_positional_ ? ParseArgPosition(ParsePositional(format_)) : *this)
+ .ParseFlags()
+ .ParseWidth()
+ .ParsePrecision()
+ .ParseLength()
+ .ParseConversion();
+ }
+
+ constexpr string_view format() const { return format_; }
+ constexpr ConvList args() const { return args_; }
+ constexpr bool error() const { return error_; }
+ constexpr bool is_positional() const { return is_positional_; }
+
+ private:
+ string_view format_;
+ // Current list of arguments. If we are not in positional mode we will consume
+ // from the front.
+ ConvList args_;
+ bool error_;
+ // Holds the argument position of the conversion character, if we are in
+ // positional mode. Otherwise, it is unspecified.
+ int arg_position_;
+ // Whether we are in positional mode.
+ // It changes the behavior of '*' and where to find the converted argument.
+ bool is_positional_;
+};
+
+// Parses a whole format expression.
+// See FormatParser::Run().
+class FormatParser {
+ static constexpr bool FoundPercent(string_view format) {
+ return format.empty() ||
+ (GetChar(format, 0) == '%' && GetChar(format, 1) != '%');
+ }
+
+ // We use an inner function to increase the recursion limit.
+ // The inner function consumes up to `limit` characters on every run.
+ // This increases the limit from 512 to ~512*limit.
+ static constexpr string_view ConsumeNonPercentInner(string_view format,
+ int limit = 20) {
+ return FoundPercent(format) || !limit
+ ? format
+ : ConsumeNonPercentInner(
+ ConsumeFront(format, GetChar(format, 0) == '%' &&
+ GetChar(format, 1) == '%'
+ ? 2
+ : 1),
+ limit - 1);
+ }
+
+ // Consume characters until the next conversion spec %.
+ // It skips %%.
+ static constexpr string_view ConsumeNonPercent(string_view format) {
+ return FoundPercent(format)
+ ? format
+ : ConsumeNonPercent(ConsumeNonPercentInner(format));
+ }
+
+ static constexpr bool IsPositional(string_view format) {
+ return IsDigit(GetChar(format, 0)) ? IsPositional(ConsumeFront(format))
+ : GetChar(format, 0) == '$';
+ }
+
+ constexpr bool RunImpl(bool is_positional) const {
+ // In non-positional mode we require all arguments to be consumed.
+ // In positional mode just reaching the end of the format without errors is
+ // enough.
+ return (format_.empty() && (is_positional || args_.count == 0)) ||
+ (!format_.empty() &&
+ ValidateArg(
+ ConvParser(ConsumeFront(format_), args_, is_positional).Run()));
+ }
+
+ constexpr bool ValidateArg(ConvParser conv) const {
+ return !conv.error() && FormatParser(conv.format(), conv.args())
+ .RunImpl(conv.is_positional());
+ }
+
+ public:
+ constexpr FormatParser(string_view format, ConvList args)
+ : format_(ConsumeNonPercent(format)), args_(args) {}
+
+ // Runs the parser for `format` and `args`.
+ // It verifies that the format is valid and that all conversion specifiers
+ // match the arguments passed.
+ // In non-positional mode it also verfies that all arguments are consumed.
+ constexpr bool Run() const {
+ return RunImpl(!format_.empty() && IsPositional(ConsumeFront(format_)));
+ }
+
+ private:
+ string_view format_;
+ // Current list of arguments.
+ // If we are not in positional mode we will consume from the front and will
+ // have to be empty in the end.
+ ConvList args_;
+};
+
+template <Conv... C>
+constexpr bool ValidFormatImpl(string_view format) {
+ return FormatParser(format,
+ {ConvListT<sizeof...(C)>{{C...}}.list, sizeof...(C)})
+ .Run();
+}
+
+#endif // ABSL_INTERNAL_ENABLE_FORMAT_CHECKER
+
+} // namespace str_format_internal
+} // namespace absl
+
+#endif // ABSL_STRINGS_INTERNAL_STR_FORMAT_CHECKER_H_
diff --git a/absl/strings/internal/str_format/checker_test.cc b/absl/strings/internal/str_format/checker_test.cc
new file mode 100644
index 00000000..14d11ea8
--- /dev/null
+++ b/absl/strings/internal/str_format/checker_test.cc
@@ -0,0 +1,150 @@
+#include <string>
+
+#include "gmock/gmock.h"
+#include "gtest/gtest.h"
+#include "absl/strings/str_format.h"
+
+namespace absl {
+namespace str_format_internal {
+namespace {
+
+std::string ConvToString(Conv conv) {
+ std::string out;
+#define CONV_SET_CASE(c) \
+ if (Contains(conv, Conv::c)) out += #c;
+ ABSL_CONVERSION_CHARS_EXPAND_(CONV_SET_CASE, )
+#undef CONV_SET_CASE
+ if (Contains(conv, Conv::star)) out += "*";
+ return out;
+}
+
+TEST(StrFormatChecker, ArgumentToConv) {
+ Conv conv = ArgumentToConv<std::string>();
+ EXPECT_EQ(ConvToString(conv), "s");
+
+ conv = ArgumentToConv<const char*>();
+ EXPECT_EQ(ConvToString(conv), "sp");
+
+ conv = ArgumentToConv<double>();
+ EXPECT_EQ(ConvToString(conv), "fFeEgGaA");
+
+ conv = ArgumentToConv<int>();
+ EXPECT_EQ(ConvToString(conv), "cdiouxXfFeEgGaA*");
+
+ conv = ArgumentToConv<std::string*>();
+ EXPECT_EQ(ConvToString(conv), "p");
+}
+
+#if ABSL_INTERNAL_ENABLE_FORMAT_CHECKER
+
+struct Case {
+ bool result;
+ const char* format;
+};
+
+template <typename... Args>
+constexpr Case ValidFormat(const char* format) {
+ return {ValidFormatImpl<ArgumentToConv<Args>()...>(format), format};
+}
+
+TEST(StrFormatChecker, ValidFormat) {
+ // We want to make sure these expressions are constexpr and they have the
+ // expected value.
+ // If they are not constexpr the attribute will just ignore them and not give
+ // a compile time error.
+ enum e {};
+ enum class e2 {};
+ constexpr Case trues[] = {
+ ValidFormat<>("abc"), //
+
+ ValidFormat<e>("%d"), //
+ ValidFormat<e2>("%d"), //
+ ValidFormat<int>("%% %d"), //
+ ValidFormat<int>("%ld"), //
+ ValidFormat<int>("%lld"), //
+ ValidFormat<std::string>("%s"), //
+ ValidFormat<std::string>("%10s"), //
+ ValidFormat<int>("%.10x"), //
+ ValidFormat<int, int>("%*.3x"), //
+ ValidFormat<int>("%1.d"), //
+ ValidFormat<int>("%.d"), //
+ ValidFormat<int, double>("%d %g"), //
+ ValidFormat<int, std::string>("%*s"), //
+ ValidFormat<int, double>("%.*f"), //
+ ValidFormat<void (*)(), volatile int*>("%p %p"), //
+ ValidFormat<string_view, const char*, double, void*>(
+ "string_view=%s const char*=%s double=%f void*=%p)"),
+
+ ValidFormat<int>("%% %1$d"), //
+ ValidFormat<int>("%1$ld"), //
+ ValidFormat<int>("%1$lld"), //
+ ValidFormat<std::string>("%1$s"), //
+ ValidFormat<std::string>("%1$10s"), //
+ ValidFormat<int>("%1$.10x"), //
+ ValidFormat<int>("%1$*1$.*1$d"), //
+ ValidFormat<int, int>("%1$*2$.3x"), //
+ ValidFormat<int>("%1$1.d"), //
+ ValidFormat<int>("%1$.d"), //
+ ValidFormat<double, int>("%2$d %1$g"), //
+ ValidFormat<int, std::string>("%2$*1$s"), //
+ ValidFormat<int, double>("%2$.*1$f"), //
+ ValidFormat<void*, string_view, const char*, double>(
+ "string_view=%2$s const char*=%3$s double=%4$f void*=%1$p "
+ "repeat=%3$s)")};
+
+ for (Case c : trues) {
+ EXPECT_TRUE(c.result) << c.format;
+ }
+
+ constexpr Case falses[] = {
+ ValidFormat<int>(""), //
+
+ ValidFormat<e>("%s"), //
+ ValidFormat<e2>("%s"), //
+ ValidFormat<>("%s"), //
+ ValidFormat<>("%r"), //
+ ValidFormat<int>("%s"), //
+ ValidFormat<int>("%.1.d"), //
+ ValidFormat<int>("%*1d"), //
+ ValidFormat<int>("%1-d"), //
+ ValidFormat<std::string, int>("%*s"), //
+ ValidFormat<int>("%*d"), //
+ ValidFormat<std::string>("%p"), //
+ ValidFormat<int (*)(int)>("%d"), //
+
+ ValidFormat<>("%3$d"), //
+ ValidFormat<>("%1$r"), //
+ ValidFormat<int>("%1$s"), //
+ ValidFormat<int>("%1$.1.d"), //
+ ValidFormat<int>("%1$*2$1d"), //
+ ValidFormat<int>("%1$1-d"), //
+ ValidFormat<std::string, int>("%2$*1$s"), //
+ ValidFormat<std::string>("%1$p"),
+
+ ValidFormat<int, int>("%d %2$d"), //
+ };
+
+ for (Case c : falses) {
+ EXPECT_FALSE(c.result) << c.format;
+ }
+}
+
+TEST(StrFormatChecker, LongFormat) {
+#define CHARS_X_40 "1234567890123456789012345678901234567890"
+#define CHARS_X_400 \
+ CHARS_X_40 CHARS_X_40 CHARS_X_40 CHARS_X_40 CHARS_X_40 CHARS_X_40 CHARS_X_40 \
+ CHARS_X_40 CHARS_X_40 CHARS_X_40
+#define CHARS_X_4000 \
+ CHARS_X_400 CHARS_X_400 CHARS_X_400 CHARS_X_400 CHARS_X_400 CHARS_X_400 \
+ CHARS_X_400 CHARS_X_400 CHARS_X_400 CHARS_X_400
+ constexpr char long_format[] =
+ CHARS_X_4000 "%d" CHARS_X_4000 "%s" CHARS_X_4000;
+ constexpr bool is_valid = ValidFormat<int, std::string>(long_format).result;
+ EXPECT_TRUE(is_valid);
+}
+
+#endif // ABSL_INTERNAL_ENABLE_FORMAT_CHECKER
+
+} // namespace
+} // namespace str_format_internal
+} // namespace absl
diff --git a/absl/strings/internal/str_format/convert_test.cc b/absl/strings/internal/str_format/convert_test.cc
new file mode 100644
index 00000000..32f8a0f9
--- /dev/null
+++ b/absl/strings/internal/str_format/convert_test.cc
@@ -0,0 +1,575 @@
+#include <errno.h>
+#include <stdarg.h>
+#include <stdio.h>
+#include <cmath>
+#include <string>
+
+#include "gtest/gtest.h"
+#include "absl/strings/internal/str_format/bind.h"
+
+namespace absl {
+namespace str_format_internal {
+namespace {
+
+template <typename T, size_t N>
+size_t ArraySize(T (&)[N]) {
+ return N;
+}
+
+std::string LengthModFor(float) { return ""; }
+std::string LengthModFor(double) { return ""; }
+std::string LengthModFor(long double) { return "L"; }
+std::string LengthModFor(char) { return "hh"; }
+std::string LengthModFor(signed char) { return "hh"; }
+std::string LengthModFor(unsigned char) { return "hh"; }
+std::string LengthModFor(short) { return "h"; } // NOLINT
+std::string LengthModFor(unsigned short) { return "h"; } // NOLINT
+std::string LengthModFor(int) { return ""; }
+std::string LengthModFor(unsigned) { return ""; }
+std::string LengthModFor(long) { return "l"; } // NOLINT
+std::string LengthModFor(unsigned long) { return "l"; } // NOLINT
+std::string LengthModFor(long long) { return "ll"; } // NOLINT
+std::string LengthModFor(unsigned long long) { return "ll"; } // NOLINT
+
+std::string EscCharImpl(int v) {
+ if (isprint(v)) return std::string(1, static_cast<char>(v));
+ char buf[64];
+ int n = snprintf(buf, sizeof(buf), "\\%#.2x",
+ static_cast<unsigned>(v & 0xff));
+ assert(n > 0 && n < sizeof(buf));
+ return std::string(buf, n);
+}
+
+std::string Esc(char v) { return EscCharImpl(v); }
+std::string Esc(signed char v) { return EscCharImpl(v); }
+std::string Esc(unsigned char v) { return EscCharImpl(v); }
+
+template <typename T>
+std::string Esc(const T &v) {
+ std::ostringstream oss;
+ oss << v;
+ return oss.str();
+}
+
+void StrAppend(std::string *dst, const char *format, va_list ap) {
+ // First try with a small fixed size buffer
+ static const int kSpaceLength = 1024;
+ char space[kSpaceLength];
+
+ // It's possible for methods that use a va_list to invalidate
+ // the data in it upon use. The fix is to make a copy
+ // of the structure before using it and use that copy instead.
+ va_list backup_ap;
+ va_copy(backup_ap, ap);
+ int result = vsnprintf(space, kSpaceLength, format, backup_ap);
+ va_end(backup_ap);
+ if (result < kSpaceLength) {
+ if (result >= 0) {
+ // Normal case -- everything fit.
+ dst->append(space, result);
+ return;
+ }
+ if (result < 0) {
+ // Just an error.
+ return;
+ }
+ }
+
+ // Increase the buffer size to the size requested by vsnprintf,
+ // plus one for the closing \0.
+ int length = result + 1;
+ char *buf = new char[length];
+
+ // Restore the va_list before we use it again
+ va_copy(backup_ap, ap);
+ result = vsnprintf(buf, length, format, backup_ap);
+ va_end(backup_ap);
+
+ if (result >= 0 && result < length) {
+ // It fit
+ dst->append(buf, result);
+ }
+ delete[] buf;
+}
+
+std::string StrPrint(const char *format, ...) {
+ va_list ap;
+ va_start(ap, format);
+ std::string result;
+ StrAppend(&result, format, ap);
+ va_end(ap);
+ return result;
+}
+
+class FormatConvertTest : public ::testing::Test { };
+
+template <typename T>
+void TestStringConvert(const T& str) {
+ const FormatArgImpl args[] = {FormatArgImpl(str)};
+ struct Expectation {
+ const char *out;
+ const char *fmt;
+ };
+ const Expectation kExpect[] = {
+ {"hello", "%1$s" },
+ {"", "%1$.s" },
+ {"", "%1$.0s" },
+ {"h", "%1$.1s" },
+ {"he", "%1$.2s" },
+ {"hello", "%1$.10s" },
+ {" hello", "%1$6s" },
+ {" he", "%1$5.2s" },
+ {"he ", "%1$-5.2s" },
+ {"hello ", "%1$-6.10s" },
+ };
+ for (const Expectation &e : kExpect) {
+ UntypedFormatSpecImpl format(e.fmt);
+ EXPECT_EQ(e.out, FormatPack(format, absl::MakeSpan(args)));
+ }
+}
+
+TEST_F(FormatConvertTest, BasicString) {
+ TestStringConvert("hello"); // As char array.
+ TestStringConvert(static_cast<const char*>("hello"));
+ TestStringConvert(std::string("hello"));
+ TestStringConvert(string_view("hello"));
+}
+
+TEST_F(FormatConvertTest, NullString) {
+ const char* p = nullptr;
+ UntypedFormatSpecImpl format("%s");
+ EXPECT_EQ("", FormatPack(format, {FormatArgImpl(p)}));
+}
+
+TEST_F(FormatConvertTest, StringPrecision) {
+ // We cap at the precision.
+ char c = 'a';
+ const char* p = &c;
+ UntypedFormatSpecImpl format("%.1s");
+ EXPECT_EQ("a", FormatPack(format, {FormatArgImpl(p)}));
+
+ // We cap at the nul terminator.
+ p = "ABC";
+ UntypedFormatSpecImpl format2("%.10s");
+ EXPECT_EQ("ABC", FormatPack(format2, {FormatArgImpl(p)}));
+}
+
+TEST_F(FormatConvertTest, Pointer) {
+#if _MSC_VER
+ // MSVC's printf implementation prints pointers differently. We can't easily
+ // compare our implementation to theirs.
+ return;
+#endif
+ static int x = 0;
+ const int *xp = &x;
+ char c = 'h';
+ char *mcp = &c;
+ const char *cp = "hi";
+ const char *cnil = nullptr;
+ const int *inil = nullptr;
+ using VoidF = void (*)();
+ VoidF fp = [] {}, fnil = nullptr;
+ volatile char vc;
+ volatile char* vcp = &vc;
+ volatile char* vcnil = nullptr;
+ const FormatArgImpl args[] = {
+ FormatArgImpl(xp), FormatArgImpl(cp), FormatArgImpl(inil),
+ FormatArgImpl(cnil), FormatArgImpl(mcp), FormatArgImpl(fp),
+ FormatArgImpl(fnil), FormatArgImpl(vcp), FormatArgImpl(vcnil),
+ };
+ struct Expectation {
+ std::string out;
+ const char *fmt;
+ };
+ const Expectation kExpect[] = {
+ {StrPrint("%p", &x), "%p"},
+ {StrPrint("%20p", &x), "%20p"},
+ {StrPrint("%.1p", &x), "%.1p"},
+ {StrPrint("%.20p", &x), "%.20p"},
+ {StrPrint("%30.20p", &x), "%30.20p"},
+
+ {StrPrint("%-p", &x), "%-p"},
+ {StrPrint("%-20p", &x), "%-20p"},
+ {StrPrint("%-.1p", &x), "%-.1p"},
+ {StrPrint("%.20p", &x), "%.20p"},
+ {StrPrint("%-30.20p", &x), "%-30.20p"},
+
+ {StrPrint("%p", cp), "%2$p"}, // const char*
+ {"(nil)", "%3$p"}, // null const char *
+ {"(nil)", "%4$p"}, // null const int *
+ {StrPrint("%p", mcp), "%5$p"}, // nonconst char*
+
+ {StrPrint("%p", fp), "%6$p"}, // function pointer
+ {StrPrint("%p", vcp), "%8$p"}, // function pointer
+
+#ifndef __APPLE__
+ // Apple's printf differs here (0x0 vs. nil)
+ {StrPrint("%p", fnil), "%7$p"}, // null function pointer
+ {StrPrint("%p", vcnil), "%9$p"}, // null function pointer
+#endif
+ };
+ for (const Expectation &e : kExpect) {
+ UntypedFormatSpecImpl format(e.fmt);
+ EXPECT_EQ(e.out, FormatPack(format, absl::MakeSpan(args))) << e.fmt;
+ }
+}
+
+struct Cardinal {
+ enum Pos { k1 = 1, k2 = 2, k3 = 3 };
+ enum Neg { kM1 = -1, kM2 = -2, kM3 = -3 };
+};
+
+TEST_F(FormatConvertTest, Enum) {
+ const Cardinal::Pos k3 = Cardinal::k3;
+ const Cardinal::Neg km3 = Cardinal::kM3;
+ const FormatArgImpl args[] = {FormatArgImpl(k3), FormatArgImpl(km3)};
+ UntypedFormatSpecImpl format("%1$d");
+ UntypedFormatSpecImpl format2("%2$d");
+ EXPECT_EQ("3", FormatPack(format, absl::MakeSpan(args)));
+ EXPECT_EQ("-3", FormatPack(format2, absl::MakeSpan(args)));
+}
+
+template <typename T>
+class TypedFormatConvertTest : public FormatConvertTest { };
+
+TYPED_TEST_CASE_P(TypedFormatConvertTest);
+
+std::vector<std::string> AllFlagCombinations() {
+ const char kFlags[] = {'-', '#', '0', '+', ' '};
+ std::vector<std::string> result;
+ for (size_t fsi = 0; fsi < (1ull << ArraySize(kFlags)); ++fsi) {
+ std::string flag_set;
+ for (size_t fi = 0; fi < ArraySize(kFlags); ++fi)
+ if (fsi & (1ull << fi))
+ flag_set += kFlags[fi];
+ result.push_back(flag_set);
+ }
+ return result;
+}
+
+TYPED_TEST_P(TypedFormatConvertTest, AllIntsWithFlags) {
+ typedef TypeParam T;
+ typedef typename std::make_unsigned<T>::type UnsignedT;
+ using remove_volatile_t = typename std::remove_volatile<T>::type;
+ const T kMin = std::numeric_limits<remove_volatile_t>::min();
+ const T kMax = std::numeric_limits<remove_volatile_t>::max();
+ const T kVals[] = {
+ remove_volatile_t(1),
+ remove_volatile_t(2),
+ remove_volatile_t(3),
+ remove_volatile_t(123),
+ remove_volatile_t(-1),
+ remove_volatile_t(-2),
+ remove_volatile_t(-3),
+ remove_volatile_t(-123),
+ remove_volatile_t(0),
+ kMax - remove_volatile_t(1),
+ kMax,
+ kMin + remove_volatile_t(1),
+ kMin,
+ };
+ const char kConvChars[] = {'d', 'i', 'u', 'o', 'x', 'X'};
+ const std::string kWid[] = {"", "4", "10"};
+ const std::string kPrec[] = {"", ".", ".0", ".4", ".10"};
+
+ const std::vector<std::string> flag_sets = AllFlagCombinations();
+
+ for (size_t vi = 0; vi < ArraySize(kVals); ++vi) {
+ const T val = kVals[vi];
+ SCOPED_TRACE(Esc(val));
+ const FormatArgImpl args[] = {FormatArgImpl(val)};
+ for (size_t ci = 0; ci < ArraySize(kConvChars); ++ci) {
+ const char conv_char = kConvChars[ci];
+ for (size_t fsi = 0; fsi < flag_sets.size(); ++fsi) {
+ const std::string &flag_set = flag_sets[fsi];
+ for (size_t wi = 0; wi < ArraySize(kWid); ++wi) {
+ const std::string &wid = kWid[wi];
+ for (size_t pi = 0; pi < ArraySize(kPrec); ++pi) {
+ const std::string &prec = kPrec[pi];
+
+ const bool is_signed_conv = (conv_char == 'd' || conv_char == 'i');
+ const bool is_unsigned_to_signed =
+ !std::is_signed<T>::value && is_signed_conv;
+ // Don't consider sign-related flags '+' and ' ' when doing
+ // unsigned to signed conversions.
+ if (is_unsigned_to_signed &&
+ flag_set.find_first_of("+ ") != std::string::npos) {
+ continue;
+ }
+
+ std::string new_fmt("%");
+ new_fmt += flag_set;
+ new_fmt += wid;
+ new_fmt += prec;
+ // old and new always agree up to here.
+ std::string old_fmt = new_fmt;
+ new_fmt += conv_char;
+ std::string old_result;
+ if (is_unsigned_to_signed) {
+ // don't expect agreement on unsigned formatted as signed,
+ // as printf can't do that conversion properly. For those
+ // cases, we do expect agreement with printf with a "%u"
+ // and the unsigned equivalent of 'val'.
+ UnsignedT uval = val;
+ old_fmt += LengthModFor(uval);
+ old_fmt += "u";
+ old_result = StrPrint(old_fmt.c_str(), uval);
+ } else {
+ old_fmt += LengthModFor(val);
+ old_fmt += conv_char;
+ old_result = StrPrint(old_fmt.c_str(), val);
+ }
+
+ SCOPED_TRACE(std::string() + " old_fmt: \"" + old_fmt +
+ "\"'"
+ " new_fmt: \"" +
+ new_fmt + "\"");
+ UntypedFormatSpecImpl format(new_fmt);
+ EXPECT_EQ(old_result, FormatPack(format, absl::MakeSpan(args)));
+ }
+ }
+ }
+ }
+ }
+}
+
+TYPED_TEST_P(TypedFormatConvertTest, Char) {
+ typedef TypeParam T;
+ using remove_volatile_t = typename std::remove_volatile<T>::type;
+ static const T kMin = std::numeric_limits<remove_volatile_t>::min();
+ static const T kMax = std::numeric_limits<remove_volatile_t>::max();
+ T kVals[] = {
+ remove_volatile_t(1), remove_volatile_t(2), remove_volatile_t(10),
+ remove_volatile_t(-1), remove_volatile_t(-2), remove_volatile_t(-10),
+ remove_volatile_t(0),
+ kMin + remove_volatile_t(1), kMin,
+ kMax - remove_volatile_t(1), kMax
+ };
+ for (const T &c : kVals) {
+ const FormatArgImpl args[] = {FormatArgImpl(c)};
+ UntypedFormatSpecImpl format("%c");
+ EXPECT_EQ(StrPrint("%c", c), FormatPack(format, absl::MakeSpan(args)));
+ }
+}
+
+REGISTER_TYPED_TEST_CASE_P(TypedFormatConvertTest, AllIntsWithFlags, Char);
+
+typedef ::testing::Types<
+ int, unsigned, volatile int,
+ short, unsigned short,
+ long, unsigned long,
+ long long, unsigned long long,
+ signed char, unsigned char, char>
+ AllIntTypes;
+INSTANTIATE_TYPED_TEST_CASE_P(TypedFormatConvertTestWithAllIntTypes,
+ TypedFormatConvertTest, AllIntTypes);
+TEST_F(FormatConvertTest, Uint128) {
+ absl::uint128 v = static_cast<absl::uint128>(0x1234567890abcdef) * 1979;
+ absl::uint128 max = absl::Uint128Max();
+ const FormatArgImpl args[] = {FormatArgImpl(v), FormatArgImpl(max)};
+
+ struct Case {
+ const char* format;
+ const char* expected;
+ } cases[] = {
+ {"%1$d", "2595989796776606496405"},
+ {"%1$30d", " 2595989796776606496405"},
+ {"%1$-30d", "2595989796776606496405 "},
+ {"%1$u", "2595989796776606496405"},
+ {"%1$x", "8cba9876066020f695"},
+ {"%2$d", "340282366920938463463374607431768211455"},
+ {"%2$u", "340282366920938463463374607431768211455"},
+ {"%2$x", "ffffffffffffffffffffffffffffffff"},
+ };
+
+ for (auto c : cases) {
+ UntypedFormatSpecImpl format(c.format);
+ EXPECT_EQ(c.expected, FormatPack(format, absl::MakeSpan(args)));
+ }
+}
+
+TEST_F(FormatConvertTest, Float) {
+#if _MSC_VER
+ // MSVC has a different rounding policy than us so we can't test our
+ // implementation against the native one there.
+ return;
+#endif // _MSC_VER
+
+ const char *const kFormats[] = {
+ "%", "%.3", "%8.5", "%9", "%.60", "%.30", "%03", "%+",
+ "% ", "%-10", "%#15.3", "%#.0", "%.0", "%1$*2$", "%1$.*2$"};
+
+ std::vector<double> doubles = {0.0,
+ -0.0,
+ .99999999999999,
+ 99999999999999.,
+ std::numeric_limits<double>::max(),
+ -std::numeric_limits<double>::max(),
+ std::numeric_limits<double>::min(),
+ -std::numeric_limits<double>::min(),
+ std::numeric_limits<double>::lowest(),
+ -std::numeric_limits<double>::lowest(),
+ std::numeric_limits<double>::epsilon(),
+ std::numeric_limits<double>::epsilon() + 1,
+ std::numeric_limits<double>::infinity(),
+ -std::numeric_limits<double>::infinity()};
+
+#ifndef __APPLE__
+ // Apple formats NaN differently (+nan) vs. (nan)
+ doubles.push_back(std::nan(""));
+#endif
+
+ // Some regression tests.
+ doubles.push_back(0.99999999999999989);
+
+ if (std::numeric_limits<double>::has_denorm != std::denorm_absent) {
+ doubles.push_back(std::numeric_limits<double>::denorm_min());
+ doubles.push_back(-std::numeric_limits<double>::denorm_min());
+ }
+
+ for (double base :
+ {1., 12., 123., 1234., 12345., 123456., 1234567., 12345678., 123456789.,
+ 1234567890., 12345678901., 123456789012., 1234567890123.}) {
+ for (int exp = -123; exp <= 123; ++exp) {
+ for (int sign : {1, -1}) {
+ doubles.push_back(sign * std::ldexp(base, exp));
+ }
+ }
+ }
+
+ for (const char *fmt : kFormats) {
+ for (char f : {'f', 'F', //
+ 'g', 'G', //
+ 'a', 'A', //
+ 'e', 'E'}) {
+ std::string fmt_str = std::string(fmt) + f;
+ for (double d : doubles) {
+ int i = -10;
+ FormatArgImpl args[2] = {FormatArgImpl(d), FormatArgImpl(i)};
+ UntypedFormatSpecImpl format(fmt_str);
+ // We use ASSERT_EQ here because failures are usually correlated and a
+ // bug would print way too many failed expectations causing the test to
+ // time out.
+ ASSERT_EQ(StrPrint(fmt_str.c_str(), d, i),
+ FormatPack(format, absl::MakeSpan(args)))
+ << fmt_str << " " << StrPrint("%.18g", d) << " "
+ << StrPrint("%.999f", d);
+ }
+ }
+ }
+}
+
+TEST_F(FormatConvertTest, LongDouble) {
+ const char *const kFormats[] = {"%", "%.3", "%8.5", "%9",
+ "%.60", "%+", "% ", "%-10"};
+
+ // This value is not representable in double, but it is in long double that
+ // uses the extended format.
+ // This is to verify that we are not truncating the value mistakenly through a
+ // double.
+ long double very_precise = 10000000000000000.25L;
+
+ std::vector<long double> doubles = {
+ 0.0,
+ -0.0,
+ very_precise,
+ 1 / very_precise,
+ std::numeric_limits<long double>::max(),
+ -std::numeric_limits<long double>::max(),
+ std::numeric_limits<long double>::min(),
+ -std::numeric_limits<long double>::min(),
+ std::numeric_limits<long double>::infinity(),
+ -std::numeric_limits<long double>::infinity()};
+
+ for (const char *fmt : kFormats) {
+ for (char f : {'f', 'F', //
+ 'g', 'G', //
+ 'a', 'A', //
+ 'e', 'E'}) {
+ std::string fmt_str = std::string(fmt) + 'L' + f;
+ for (auto d : doubles) {
+ FormatArgImpl arg(d);
+ UntypedFormatSpecImpl format(fmt_str);
+ // We use ASSERT_EQ here because failures are usually correlated and a
+ // bug would print way too many failed expectations causing the test to
+ // time out.
+ ASSERT_EQ(StrPrint(fmt_str.c_str(), d),
+ FormatPack(format, {&arg, 1}))
+ << fmt_str << " " << StrPrint("%.18Lg", d) << " "
+ << StrPrint("%.999Lf", d);
+ }
+ }
+ }
+}
+
+TEST_F(FormatConvertTest, IntAsFloat) {
+ const int kMin = std::numeric_limits<int>::min();
+ const int kMax = std::numeric_limits<int>::max();
+ const int ia[] = {
+ 1, 2, 3, 123,
+ -1, -2, -3, -123,
+ 0, kMax - 1, kMax, kMin + 1, kMin };
+ for (const int fx : ia) {
+ SCOPED_TRACE(fx);
+ const FormatArgImpl args[] = {FormatArgImpl(fx)};
+ struct Expectation {
+ int line;
+ std::string out;
+ const char *fmt;
+ };
+ const double dx = static_cast<double>(fx);
+ const Expectation kExpect[] = {
+ { __LINE__, StrPrint("%f", dx), "%f" },
+ { __LINE__, StrPrint("%12f", dx), "%12f" },
+ { __LINE__, StrPrint("%.12f", dx), "%.12f" },
+ { __LINE__, StrPrint("%12a", dx), "%12a" },
+ { __LINE__, StrPrint("%.12a", dx), "%.12a" },
+ };
+ for (const Expectation &e : kExpect) {
+ SCOPED_TRACE(e.line);
+ SCOPED_TRACE(e.fmt);
+ UntypedFormatSpecImpl format(e.fmt);
+ EXPECT_EQ(e.out, FormatPack(format, absl::MakeSpan(args)));
+ }
+ }
+}
+
+template <typename T>
+bool FormatFails(const char* test_format, T value) {
+ std::string format_string = std::string("<<") + test_format + ">>";
+ UntypedFormatSpecImpl format(format_string);
+
+ int one = 1;
+ const FormatArgImpl args[] = {FormatArgImpl(value), FormatArgImpl(one)};
+ EXPECT_EQ(FormatPack(format, absl::MakeSpan(args)), "")
+ << "format=" << test_format << " value=" << value;
+ return FormatPack(format, absl::MakeSpan(args)).empty();
+}
+
+TEST_F(FormatConvertTest, ExpectedFailures) {
+ // Int input
+ EXPECT_TRUE(FormatFails("%p", 1));
+ EXPECT_TRUE(FormatFails("%s", 1));
+ EXPECT_TRUE(FormatFails("%n", 1));
+
+ // Double input
+ EXPECT_TRUE(FormatFails("%p", 1.));
+ EXPECT_TRUE(FormatFails("%s", 1.));
+ EXPECT_TRUE(FormatFails("%n", 1.));
+ EXPECT_TRUE(FormatFails("%c", 1.));
+ EXPECT_TRUE(FormatFails("%d", 1.));
+ EXPECT_TRUE(FormatFails("%x", 1.));
+ EXPECT_TRUE(FormatFails("%*d", 1.));
+
+ // String input
+ EXPECT_TRUE(FormatFails("%n", ""));
+ EXPECT_TRUE(FormatFails("%c", ""));
+ EXPECT_TRUE(FormatFails("%d", ""));
+ EXPECT_TRUE(FormatFails("%x", ""));
+ EXPECT_TRUE(FormatFails("%f", ""));
+ EXPECT_TRUE(FormatFails("%*d", ""));
+}
+
+} // namespace
+} // namespace str_format_internal
+} // namespace absl
diff --git a/absl/strings/internal/str_format/extension.cc b/absl/strings/internal/str_format/extension.cc
new file mode 100644
index 00000000..c2174703
--- /dev/null
+++ b/absl/strings/internal/str_format/extension.cc
@@ -0,0 +1,84 @@
+//
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/strings/internal/str_format/extension.h"
+
+#include <errno.h>
+#include <algorithm>
+#include <string>
+
+namespace absl {
+namespace str_format_internal {
+namespace {
+// clang-format off
+#define ABSL_LENGTH_MODS_EXPAND_ \
+ X_VAL(h) X_SEP \
+ X_VAL(hh) X_SEP \
+ X_VAL(l) X_SEP \
+ X_VAL(ll) X_SEP \
+ X_VAL(L) X_SEP \
+ X_VAL(j) X_SEP \
+ X_VAL(z) X_SEP \
+ X_VAL(t) X_SEP \
+ X_VAL(q)
+// clang-format on
+} // namespace
+
+const LengthMod::Spec LengthMod::kSpecs[] = {
+#define X_VAL(id) { LengthMod::id, #id, strlen(#id) }
+#define X_SEP ,
+ ABSL_LENGTH_MODS_EXPAND_, {LengthMod::none, "", 0}
+#undef X_VAL
+#undef X_SEP
+};
+
+const ConversionChar::Spec ConversionChar::kSpecs[] = {
+#define X_VAL(id) { ConversionChar::id, #id[0] }
+#define X_SEP ,
+ ABSL_CONVERSION_CHARS_EXPAND_(X_VAL, X_SEP),
+ {ConversionChar::none, '\0'},
+#undef X_VAL
+#undef X_SEP
+};
+
+std::string Flags::ToString() const {
+ std::string s;
+ s.append(left ? "-" : "");
+ s.append(show_pos ? "+" : "");
+ s.append(sign_col ? " " : "");
+ s.append(alt ? "#" : "");
+ s.append(zero ? "0" : "");
+ return s;
+}
+
+const size_t LengthMod::kNumValues;
+
+const size_t ConversionChar::kNumValues;
+
+bool FormatSinkImpl::PutPaddedString(string_view v, int w, int p, bool l) {
+ size_t space_remaining = 0;
+ if (w >= 0) space_remaining = w;
+ size_t n = v.size();
+ if (p >= 0) n = std::min(n, static_cast<size_t>(p));
+ string_view shown(v.data(), n);
+ space_remaining = Excess(shown.size(), space_remaining);
+ if (!l) Append(space_remaining, ' ');
+ Append(shown);
+ if (l) Append(space_remaining, ' ');
+ return true;
+}
+
+} // namespace str_format_internal
+} // namespace absl
diff --git a/absl/strings/internal/str_format/extension.h b/absl/strings/internal/str_format/extension.h
new file mode 100644
index 00000000..810330b9
--- /dev/null
+++ b/absl/strings/internal/str_format/extension.h
@@ -0,0 +1,406 @@
+//
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+//
+//
+#ifndef ABSL_STRINGS_INTERNAL_STR_FORMAT_EXTENSION_H_
+#define ABSL_STRINGS_INTERNAL_STR_FORMAT_EXTENSION_H_
+
+#include <limits.h>
+#include <cstring>
+#include <ostream>
+
+#include "absl/base/port.h"
+#include "absl/strings/internal/str_format/output.h"
+#include "absl/strings/string_view.h"
+
+class Cord;
+
+namespace absl {
+
+namespace str_format_internal {
+
+class FormatRawSinkImpl {
+ public:
+ // Implicitly convert from any type that provides the hook function as
+ // described above.
+ template <typename T, decltype(str_format_internal::InvokeFlush(
+ std::declval<T*>(), string_view()))* = nullptr>
+ FormatRawSinkImpl(T* raw) // NOLINT
+ : sink_(raw), write_(&FormatRawSinkImpl::Flush<T>) {}
+
+ void Write(string_view s) { write_(sink_, s); }
+
+ template <typename T>
+ static FormatRawSinkImpl Extract(T s) {
+ return s.sink_;
+ }
+
+ private:
+ template <typename T>
+ static void Flush(void* r, string_view s) {
+ str_format_internal::InvokeFlush(static_cast<T*>(r), s);
+ }
+
+ void* sink_;
+ void (*write_)(void*, string_view);
+};
+
+// An abstraction to which conversions write their std::string data.
+class FormatSinkImpl {
+ public:
+ explicit FormatSinkImpl(FormatRawSinkImpl raw) : raw_(raw) {}
+
+ ~FormatSinkImpl() { Flush(); }
+
+ void Flush() {
+ raw_.Write(string_view(buf_, pos_ - buf_));
+ pos_ = buf_;
+ }
+
+ void Append(size_t n, char c) {
+ if (n == 0) return;
+ size_ += n;
+ auto raw_append = [&](size_t count) {
+ memset(pos_, c, count);
+ pos_ += count;
+ };
+ while (n > Avail()) {
+ n -= Avail();
+ if (Avail() > 0) {
+ raw_append(Avail());
+ }
+ Flush();
+ }
+ raw_append(n);
+ }
+
+ void Append(string_view v) {
+ size_t n = v.size();
+ if (n == 0) return;
+ size_ += n;
+ if (n >= Avail()) {
+ Flush();
+ raw_.Write(v);
+ return;
+ }
+ memcpy(pos_, v.data(), n);
+ pos_ += n;
+ }
+
+ size_t size() const { return size_; }
+
+ // Put 'v' to 'sink' with specified width, precision, and left flag.
+ bool PutPaddedString(string_view v, int w, int p, bool l);
+
+ template <typename T>
+ T Wrap() {
+ return T(this);
+ }
+
+ template <typename T>
+ static FormatSinkImpl* Extract(T* s) {
+ return s->sink_;
+ }
+
+ private:
+ size_t Avail() const { return buf_ + sizeof(buf_) - pos_; }
+
+ FormatRawSinkImpl raw_;
+ size_t size_ = 0;
+ char* pos_ = buf_;
+ char buf_[1024];
+};
+
+struct Flags {
+ bool basic : 1; // fastest conversion: no flags, width, or precision
+ bool left : 1; // "-"
+ bool show_pos : 1; // "+"
+ bool sign_col : 1; // " "
+ bool alt : 1; // "#"
+ bool zero : 1; // "0"
+ std::string ToString() const;
+ friend std::ostream& operator<<(std::ostream& os, const Flags& v) {
+ return os << v.ToString();
+ }
+};
+
+struct LengthMod {
+ public:
+ enum Id : uint8_t {
+ h, hh, l, ll, L, j, z, t, q, none
+ };
+ static const size_t kNumValues = none + 1;
+
+ LengthMod() : id_(none) {}
+
+ // Index into the opaque array of LengthMod enums.
+ // Requires: i < kNumValues
+ static LengthMod FromIndex(size_t i) {
+ return LengthMod(kSpecs[i].value);
+ }
+
+ static LengthMod FromId(Id id) { return LengthMod(id); }
+
+ // The length modifier std::string associated with a specified LengthMod.
+ string_view name() const {
+ const Spec& spec = kSpecs[id_];
+ return {spec.name, spec.name_length};
+ }
+
+ Id id() const { return id_; }
+
+ friend bool operator==(const LengthMod& a, const LengthMod& b) {
+ return a.id() == b.id();
+ }
+ friend bool operator!=(const LengthMod& a, const LengthMod& b) {
+ return !(a == b);
+ }
+ friend std::ostream& operator<<(std::ostream& os, const LengthMod& v) {
+ return os << v.name();
+ }
+
+ private:
+ struct Spec {
+ Id value;
+ const char *name;
+ size_t name_length;
+ };
+ static const Spec kSpecs[];
+
+ explicit LengthMod(Id id) : id_(id) {}
+
+ Id id_;
+};
+
+// clang-format off
+#define ABSL_CONVERSION_CHARS_EXPAND_(X_VAL, X_SEP) \
+ /* text */ \
+ X_VAL(c) X_SEP X_VAL(C) X_SEP X_VAL(s) X_SEP X_VAL(S) X_SEP \
+ /* ints */ \
+ X_VAL(d) X_SEP X_VAL(i) X_SEP X_VAL(o) X_SEP \
+ X_VAL(u) X_SEP X_VAL(x) X_SEP X_VAL(X) X_SEP \
+ /* floats */ \
+ X_VAL(f) X_SEP X_VAL(F) X_SEP X_VAL(e) X_SEP X_VAL(E) X_SEP \
+ X_VAL(g) X_SEP X_VAL(G) X_SEP X_VAL(a) X_SEP X_VAL(A) X_SEP \
+ /* misc */ \
+ X_VAL(n) X_SEP X_VAL(p)
+// clang-format on
+
+struct ConversionChar {
+ public:
+ enum Id : uint8_t {
+ c, C, s, S, // text
+ d, i, o, u, x, X, // int
+ f, F, e, E, g, G, a, A, // float
+ n, p, // misc
+ none
+ };
+ static const size_t kNumValues = none + 1;
+
+ ConversionChar() : id_(none) {}
+
+ public:
+ // Index into the opaque array of ConversionChar enums.
+ // Requires: i < kNumValues
+ static ConversionChar FromIndex(size_t i) {
+ return ConversionChar(kSpecs[i].value);
+ }
+
+ static ConversionChar FromChar(char c) {
+ ConversionChar::Id out_id = ConversionChar::none;
+ switch (c) {
+#define X_VAL(id) \
+ case #id[0]: \
+ out_id = ConversionChar::id; \
+ break;
+ ABSL_CONVERSION_CHARS_EXPAND_(X_VAL, )
+#undef X_VAL
+ default:
+ break;
+ }
+ return ConversionChar(out_id);
+ }
+
+ static ConversionChar FromId(Id id) { return ConversionChar(id); }
+ Id id() const { return id_; }
+
+ int radix() const {
+ switch (id()) {
+ case x: case X: case a: case A: case p: return 16;
+ case o: return 8;
+ default: return 10;
+ }
+ }
+
+ bool upper() const {
+ switch (id()) {
+ case X: case F: case E: case G: case A: return true;
+ default: return false;
+ }
+ }
+
+ bool is_signed() const {
+ switch (id()) {
+ case d: case i: return true;
+ default: return false;
+ }
+ }
+
+ bool is_integral() const {
+ switch (id()) {
+ case d: case i: case u: case o: case x: case X:
+ return true;
+ default: return false;
+ }
+ }
+
+ bool is_float() const {
+ switch (id()) {
+ case a: case e: case f: case g: case A: case E: case F: case G:
+ return true;
+ default: return false;
+ }
+ }
+
+ bool IsValid() const { return id() != none; }
+
+ // The associated char.
+ char Char() const { return kSpecs[id_].name; }
+
+ friend bool operator==(const ConversionChar& a, const ConversionChar& b) {
+ return a.id() == b.id();
+ }
+ friend bool operator!=(const ConversionChar& a, const ConversionChar& b) {
+ return !(a == b);
+ }
+ friend std::ostream& operator<<(std::ostream& os, const ConversionChar& v) {
+ char c = v.Char();
+ if (!c) c = '?';
+ return os << c;
+ }
+
+ private:
+ struct Spec {
+ Id value;
+ char name;
+ };
+ static const Spec kSpecs[];
+
+ explicit ConversionChar(Id id) : id_(id) {}
+
+ Id id_;
+};
+
+class ConversionSpec {
+ public:
+ Flags flags() const { return flags_; }
+ LengthMod length_mod() const { return length_mod_; }
+ ConversionChar conv() const { return conv_; }
+
+ // Returns the specified width. If width is unspecfied, it returns a negative
+ // value.
+ int width() const { return width_; }
+ // Returns the specified precision. If precision is unspecfied, it returns a
+ // negative value.
+ int precision() const { return precision_; }
+
+ void set_flags(Flags f) { flags_ = f; }
+ void set_length_mod(LengthMod lm) { length_mod_ = lm; }
+ void set_conv(ConversionChar c) { conv_ = c; }
+ void set_width(int w) { width_ = w; }
+ void set_precision(int p) { precision_ = p; }
+ void set_left(bool b) { flags_.left = b; }
+
+ private:
+ Flags flags_;
+ LengthMod length_mod_;
+ ConversionChar conv_;
+ int width_;
+ int precision_;
+};
+
+constexpr uint64_t ConversionCharToConvValue(char conv) {
+ return
+#define CONV_SET_CASE(c) \
+ conv == #c[0] ? (uint64_t{1} << (1 + ConversionChar::Id::c)):
+ ABSL_CONVERSION_CHARS_EXPAND_(CONV_SET_CASE, )
+#undef CONV_SET_CASE
+ conv == '*'
+ ? 1
+ : 0;
+}
+
+enum class Conv : uint64_t {
+#define CONV_SET_CASE(c) c = ConversionCharToConvValue(#c[0]),
+ ABSL_CONVERSION_CHARS_EXPAND_(CONV_SET_CASE, )
+#undef CONV_SET_CASE
+
+ // Used for width/precision '*' specification.
+ star = ConversionCharToConvValue('*'),
+
+ // Some predefined values:
+ integral = d | i | u | o | x | X,
+ floating = a | e | f | g | A | E | F | G,
+ numeric = integral | floating,
+ string = s, // absl:ignore(std::string)
+ pointer = p
+};
+
+// Type safe OR operator.
+// We need this for two reasons:
+// 1. operator| on enums makes them decay to integers and the result is an
+// integer. We need the result to stay as an enum.
+// 2. We use "enum class" which would not work even if we accepted the decay.
+constexpr Conv operator|(Conv a, Conv b) {
+ return Conv(static_cast<uint64_t>(a) | static_cast<uint64_t>(b));
+}
+
+// Get a conversion with a single character in it.
+constexpr Conv ConversionCharToConv(char c) {
+ return Conv(ConversionCharToConvValue(c));
+}
+
+// Checks whether `c` exists in `set`.
+constexpr bool Contains(Conv set, char c) {
+ return (static_cast<uint64_t>(set) & ConversionCharToConvValue(c)) != 0;
+}
+
+// Checks whether all the characters in `c` are contained in `set`
+constexpr bool Contains(Conv set, Conv c) {
+ return (static_cast<uint64_t>(set) & static_cast<uint64_t>(c)) ==
+ static_cast<uint64_t>(c);
+}
+
+// Return type of the AbslFormatConvert() functions.
+// The Conv template parameter is used to inform the framework of what
+// conversion characters are supported by that AbslFormatConvert routine.
+template <Conv C>
+struct ConvertResult {
+ static constexpr Conv kConv = C;
+ bool value;
+};
+template <Conv C>
+constexpr Conv ConvertResult<C>::kConv;
+
+// Return capacity - used, clipped to a minimum of 0.
+inline size_t Excess(size_t used, size_t capacity) {
+ return used < capacity ? capacity - used : 0;
+}
+
+} // namespace str_format_internal
+
+} // namespace absl
+
+#endif // ABSL_STRINGS_STR_FORMAT_EXTENSION_H_
diff --git a/absl/strings/internal/str_format/extension_test.cc b/absl/strings/internal/str_format/extension_test.cc
new file mode 100644
index 00000000..224fc923
--- /dev/null
+++ b/absl/strings/internal/str_format/extension_test.cc
@@ -0,0 +1,65 @@
+//
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+//
+
+#include "absl/strings/internal/str_format/extension.h"
+
+#include <random>
+#include <string>
+#include "absl/strings/str_format.h"
+
+#include "gtest/gtest.h"
+
+namespace {
+
+std::string MakeRandomString(size_t len) {
+ std::random_device rd;
+ std::mt19937 gen(rd());
+ std::uniform_int_distribution<> dis('a', 'z');
+ std::string s(len, '0');
+ for (char& c : s) {
+ c = dis(gen);
+ }
+ return s;
+}
+
+TEST(FormatExtensionTest, SinkAppendSubstring) {
+ for (size_t chunk_size : {1, 10, 100, 1000, 10000}) {
+ std::string expected, actual;
+ absl::str_format_internal::FormatSinkImpl sink(&actual);
+ for (size_t chunks = 0; chunks < 10; ++chunks) {
+ std::string rand = MakeRandomString(chunk_size);
+ expected += rand;
+ sink.Append(rand);
+ }
+ sink.Flush();
+ EXPECT_EQ(actual, expected);
+ }
+}
+
+TEST(FormatExtensionTest, SinkAppendChars) {
+ for (size_t chunk_size : {1, 10, 100, 1000, 10000}) {
+ std::string expected, actual;
+ absl::str_format_internal::FormatSinkImpl sink(&actual);
+ for (size_t chunks = 0; chunks < 10; ++chunks) {
+ std::string rand = MakeRandomString(1);
+ expected.append(chunk_size, rand[0]);
+ sink.Append(chunk_size, rand[0]);
+ }
+ sink.Flush();
+ EXPECT_EQ(actual, expected);
+ }
+}
+} // namespace
diff --git a/absl/strings/internal/str_format/float_conversion.cc b/absl/strings/internal/str_format/float_conversion.cc
new file mode 100644
index 00000000..37952b46
--- /dev/null
+++ b/absl/strings/internal/str_format/float_conversion.cc
@@ -0,0 +1,476 @@
+#include "absl/strings/internal/str_format/float_conversion.h"
+
+#include <string.h>
+#include <algorithm>
+#include <cassert>
+#include <cmath>
+#include <string>
+
+namespace absl {
+namespace str_format_internal {
+
+namespace {
+
+char *CopyStringTo(string_view v, char *out) {
+ std::memcpy(out, v.data(), v.size());
+ return out + v.size();
+}
+
+template <typename Float>
+bool FallbackToSnprintf(const Float v, const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ int w = conv.width() >= 0 ? conv.width() : 0;
+ int p = conv.precision() >= 0 ? conv.precision() : -1;
+ char fmt[32];
+ {
+ char *fp = fmt;
+ *fp++ = '%';
+ fp = CopyStringTo(conv.flags().ToString(), fp);
+ fp = CopyStringTo("*.*", fp);
+ if (std::is_same<long double, Float>()) {
+ *fp++ = 'L';
+ }
+ *fp++ = conv.conv().Char();
+ *fp = 0;
+ assert(fp < fmt + sizeof(fmt));
+ }
+ std::string space(512, '\0');
+ string_view result;
+ while (true) {
+ int n = snprintf(&space[0], space.size(), fmt, w, p, v);
+ if (n < 0) return false;
+ if (static_cast<size_t>(n) < space.size()) {
+ result = string_view(space.data(), n);
+ break;
+ }
+ space.resize(n + 1);
+ }
+ sink->Append(result);
+ return true;
+}
+
+// 128-bits in decimal: ceil(128*log(2)/log(10))
+// or std::numeric_limits<__uint128_t>::digits10
+constexpr int kMaxFixedPrecision = 39;
+
+constexpr int kBufferLength = /*sign*/ 1 +
+ /*integer*/ kMaxFixedPrecision +
+ /*point*/ 1 +
+ /*fraction*/ kMaxFixedPrecision +
+ /*exponent e+123*/ 5;
+
+struct Buffer {
+ void push_front(char c) {
+ assert(begin > data);
+ *--begin = c;
+ }
+ void push_back(char c) {
+ assert(end < data + sizeof(data));
+ *end++ = c;
+ }
+ void pop_back() {
+ assert(begin < end);
+ --end;
+ }
+
+ char &back() {
+ assert(begin < end);
+ return end[-1];
+ }
+
+ char last_digit() const { return end[-1] == '.' ? end[-2] : end[-1]; }
+
+ int size() const { return static_cast<int>(end - begin); }
+
+ char data[kBufferLength];
+ char *begin;
+ char *end;
+};
+
+enum class FormatStyle { Fixed, Precision };
+
+// If the value is Inf or Nan, print it and return true.
+// Otherwise, return false.
+template <typename Float>
+bool ConvertNonNumericFloats(char sign_char, Float v,
+ const ConversionSpec &conv, FormatSinkImpl *sink) {
+ char text[4], *ptr = text;
+ if (sign_char) *ptr++ = sign_char;
+ if (std::isnan(v)) {
+ ptr = std::copy_n(conv.conv().upper() ? "NAN" : "nan", 3, ptr);
+ } else if (std::isinf(v)) {
+ ptr = std::copy_n(conv.conv().upper() ? "INF" : "inf", 3, ptr);
+ } else {
+ return false;
+ }
+
+ return sink->PutPaddedString(string_view(text, ptr - text), conv.width(), -1,
+ conv.flags().left);
+}
+
+// Round up the last digit of the value.
+// It will carry over and potentially overflow. 'exp' will be adjusted in that
+// case.
+template <FormatStyle mode>
+void RoundUp(Buffer *buffer, int *exp) {
+ char *p = &buffer->back();
+ while (p >= buffer->begin && (*p == '9' || *p == '.')) {
+ if (*p == '9') *p = '0';
+ --p;
+ }
+
+ if (p < buffer->begin) {
+ *p = '1';
+ buffer->begin = p;
+ if (mode == FormatStyle::Precision) {
+ std::swap(p[1], p[2]); // move the .
+ ++*exp;
+ buffer->pop_back();
+ }
+ } else {
+ ++*p;
+ }
+}
+
+void PrintExponent(int exp, char e, Buffer *out) {
+ out->push_back(e);
+ if (exp < 0) {
+ out->push_back('-');
+ exp = -exp;
+ } else {
+ out->push_back('+');
+ }
+ // Exponent digits.
+ if (exp > 99) {
+ out->push_back(exp / 100 + '0');
+ out->push_back(exp / 10 % 10 + '0');
+ out->push_back(exp % 10 + '0');
+ } else {
+ out->push_back(exp / 10 + '0');
+ out->push_back(exp % 10 + '0');
+ }
+}
+
+template <typename Float, typename Int>
+constexpr bool CanFitMantissa() {
+ return std::numeric_limits<Float>::digits <= std::numeric_limits<Int>::digits;
+}
+
+template <typename Float>
+struct Decomposed {
+ Float mantissa;
+ int exponent;
+};
+
+// Decompose the double into an integer mantissa and an exponent.
+template <typename Float>
+Decomposed<Float> Decompose(Float v) {
+ int exp;
+ Float m = std::frexp(v, &exp);
+ m = std::ldexp(m, std::numeric_limits<Float>::digits);
+ exp -= std::numeric_limits<Float>::digits;
+ return {m, exp};
+}
+
+// Print 'digits' as decimal.
+// In Fixed mode, we add a '.' at the end.
+// In Precision mode, we add a '.' after the first digit.
+template <FormatStyle mode, typename Int>
+int PrintIntegralDigits(Int digits, Buffer *out) {
+ int printed = 0;
+ if (digits) {
+ for (; digits; digits /= 10) out->push_front(digits % 10 + '0');
+ printed = out->size();
+ if (mode == FormatStyle::Precision) {
+ out->push_front(*out->begin);
+ out->begin[1] = '.';
+ } else {
+ out->push_back('.');
+ }
+ } else if (mode == FormatStyle::Fixed) {
+ out->push_front('0');
+ out->push_back('.');
+ printed = 1;
+ }
+ return printed;
+}
+
+// Back out 'extra_digits' digits and round up if necessary.
+bool RemoveExtraPrecision(int extra_digits, bool has_leftover_value,
+ Buffer *out, int *exp_out) {
+ if (extra_digits <= 0) return false;
+
+ // Back out the extra digits
+ out->end -= extra_digits;
+
+ bool needs_to_round_up = [&] {
+ // We look at the digit just past the end.
+ // There must be 'extra_digits' extra valid digits after end.
+ if (*out->end > '5') return true;
+ if (*out->end < '5') return false;
+ if (has_leftover_value || std::any_of(out->end + 1, out->end + extra_digits,
+ [](char c) { return c != '0'; }))
+ return true;
+
+ // Ends in ...50*, round to even.
+ return out->last_digit() % 2 == 1;
+ }();
+
+ if (needs_to_round_up) {
+ RoundUp<FormatStyle::Precision>(out, exp_out);
+ }
+ return true;
+}
+
+// Print the value into the buffer.
+// This will not include the exponent, which will be returned in 'exp_out' for
+// Precision mode.
+template <typename Int, typename Float, FormatStyle mode>
+bool FloatToBufferImpl(Int int_mantissa, int exp, int precision, Buffer *out,
+ int *exp_out) {
+ assert((CanFitMantissa<Float, Int>()));
+
+ const int int_bits = std::numeric_limits<Int>::digits;
+
+ // In precision mode, we start printing one char to the right because it will
+ // also include the '.'
+ // In fixed mode we put the dot afterwards on the right.
+ out->begin = out->end =
+ out->data + 1 + kMaxFixedPrecision + (mode == FormatStyle::Precision);
+
+ if (exp >= 0) {
+ if (std::numeric_limits<Float>::digits + exp > int_bits) {
+ // The value will overflow the Int
+ return false;
+ }
+ int digits_printed = PrintIntegralDigits<mode>(int_mantissa << exp, out);
+ int digits_to_zero_pad = precision;
+ if (mode == FormatStyle::Precision) {
+ *exp_out = digits_printed - 1;
+ digits_to_zero_pad -= digits_printed - 1;
+ if (RemoveExtraPrecision(-digits_to_zero_pad, false, out, exp_out)) {
+ return true;
+ }
+ }
+ for (; digits_to_zero_pad-- > 0;) out->push_back('0');
+ return true;
+ }
+
+ exp = -exp;
+ // We need at least 4 empty bits for the next decimal digit.
+ // We will multiply by 10.
+ if (exp > int_bits - 4) return false;
+
+ const Int mask = (Int{1} << exp) - 1;
+
+ // Print the integral part first.
+ int digits_printed = PrintIntegralDigits<mode>(int_mantissa >> exp, out);
+ int_mantissa &= mask;
+
+ int fractional_count = precision;
+ if (mode == FormatStyle::Precision) {
+ if (digits_printed == 0) {
+ // Find the first non-zero digit, when in Precision mode.
+ *exp_out = 0;
+ if (int_mantissa) {
+ while (int_mantissa <= mask) {
+ int_mantissa *= 10;
+ --*exp_out;
+ }
+ }
+ out->push_front(static_cast<char>(int_mantissa >> exp) + '0');
+ out->push_back('.');
+ int_mantissa &= mask;
+ } else {
+ // We already have a digit, and a '.'
+ *exp_out = digits_printed - 1;
+ fractional_count -= *exp_out;
+ if (RemoveExtraPrecision(-fractional_count, int_mantissa != 0, out,
+ exp_out)) {
+ // If we had enough digits, return right away.
+ // The code below will try to round again otherwise.
+ return true;
+ }
+ }
+ }
+
+ auto get_next_digit = [&] {
+ int_mantissa *= 10;
+ int digit = static_cast<int>(int_mantissa >> exp);
+ int_mantissa &= mask;
+ return digit;
+ };
+
+ // Print fractional_count more digits, if available.
+ for (; fractional_count > 0; --fractional_count) {
+ out->push_back(get_next_digit() + '0');
+ }
+
+ int next_digit = get_next_digit();
+ if (next_digit > 5 ||
+ (next_digit == 5 && (int_mantissa || out->last_digit() % 2 == 1))) {
+ RoundUp<mode>(out, exp_out);
+ }
+
+ return true;
+}
+
+template <FormatStyle mode, typename Float>
+bool FloatToBuffer(Decomposed<Float> decomposed, int precision, Buffer *out,
+ int *exp) {
+ if (precision > kMaxFixedPrecision) return false;
+
+ // Try with uint64_t.
+ if (CanFitMantissa<Float, std::uint64_t>() &&
+ FloatToBufferImpl<std::uint64_t, Float, mode>(
+ static_cast<std::uint64_t>(decomposed.mantissa),
+ static_cast<std::uint64_t>(decomposed.exponent), precision, out, exp))
+ return true;
+
+#if defined(__SIZEOF_INT128__)
+ // If that is not enough, try with __uint128_t.
+ return CanFitMantissa<Float, __uint128_t>() &&
+ FloatToBufferImpl<__uint128_t, Float, mode>(
+ static_cast<__uint128_t>(decomposed.mantissa),
+ static_cast<__uint128_t>(decomposed.exponent), precision, out,
+ exp);
+#endif
+ return false;
+}
+
+void WriteBufferToSink(char sign_char, string_view str,
+ const ConversionSpec &conv, FormatSinkImpl *sink) {
+ int left_spaces = 0, zeros = 0, right_spaces = 0;
+ int missing_chars =
+ conv.width() >= 0 ? std::max(conv.width() - static_cast<int>(str.size()) -
+ static_cast<int>(sign_char != 0),
+ 0)
+ : 0;
+ if (conv.flags().left) {
+ right_spaces = missing_chars;
+ } else if (conv.flags().zero) {
+ zeros = missing_chars;
+ } else {
+ left_spaces = missing_chars;
+ }
+
+ sink->Append(left_spaces, ' ');
+ if (sign_char) sink->Append(1, sign_char);
+ sink->Append(zeros, '0');
+ sink->Append(str);
+ sink->Append(right_spaces, ' ');
+}
+
+template <typename Float>
+bool FloatToSink(const Float v, const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ // Print the sign or the sign column.
+ Float abs_v = v;
+ char sign_char = 0;
+ if (std::signbit(abs_v)) {
+ sign_char = '-';
+ abs_v = -abs_v;
+ } else if (conv.flags().show_pos) {
+ sign_char = '+';
+ } else if (conv.flags().sign_col) {
+ sign_char = ' ';
+ }
+
+ // Print nan/inf.
+ if (ConvertNonNumericFloats(sign_char, abs_v, conv, sink)) {
+ return true;
+ }
+
+ int precision = conv.precision() < 0 ? 6 : conv.precision();
+
+ int exp = 0;
+
+ auto decomposed = Decompose(abs_v);
+
+ Buffer buffer;
+
+ switch (conv.conv().id()) {
+ case ConversionChar::f:
+ case ConversionChar::F:
+ if (!FloatToBuffer<FormatStyle::Fixed>(decomposed, precision, &buffer,
+ nullptr)) {
+ return FallbackToSnprintf(v, conv, sink);
+ }
+ if (!conv.flags().alt && buffer.back() == '.') buffer.pop_back();
+ break;
+
+ case ConversionChar::e:
+ case ConversionChar::E:
+ if (!FloatToBuffer<FormatStyle::Precision>(decomposed, precision, &buffer,
+ &exp)) {
+ return FallbackToSnprintf(v, conv, sink);
+ }
+ if (!conv.flags().alt && buffer.back() == '.') buffer.pop_back();
+ PrintExponent(exp, conv.conv().upper() ? 'E' : 'e', &buffer);
+ break;
+
+ case ConversionChar::g:
+ case ConversionChar::G:
+ precision = std::max(0, precision - 1);
+ if (!FloatToBuffer<FormatStyle::Precision>(decomposed, precision, &buffer,
+ &exp)) {
+ return FallbackToSnprintf(v, conv, sink);
+ }
+ if (precision + 1 > exp && exp >= -4) {
+ if (exp < 0) {
+ // Have 1.23456, needs 0.00123456
+ // Move the first digit
+ buffer.begin[1] = *buffer.begin;
+ // Add some zeros
+ for (; exp < -1; ++exp) *buffer.begin-- = '0';
+ *buffer.begin-- = '.';
+ *buffer.begin = '0';
+ } else if (exp > 0) {
+ // Have 1.23456, needs 1234.56
+ // Move the '.' exp positions to the right.
+ std::rotate(buffer.begin + 1, buffer.begin + 2,
+ buffer.begin + exp + 2);
+ }
+ exp = 0;
+ }
+ if (!conv.flags().alt) {
+ while (buffer.back() == '0') buffer.pop_back();
+ if (buffer.back() == '.') buffer.pop_back();
+ }
+ if (exp) PrintExponent(exp, conv.conv().upper() ? 'E' : 'e', &buffer);
+ break;
+
+ case ConversionChar::a:
+ case ConversionChar::A:
+ return FallbackToSnprintf(v, conv, sink);
+
+ default:
+ return false;
+ }
+
+ WriteBufferToSink(sign_char,
+ string_view(buffer.begin, buffer.end - buffer.begin), conv,
+ sink);
+
+ return true;
+}
+
+} // namespace
+
+bool ConvertFloatImpl(long double v, const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ return FloatToSink(v, conv, sink);
+}
+
+bool ConvertFloatImpl(float v, const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ return FloatToSink(v, conv, sink);
+}
+
+bool ConvertFloatImpl(double v, const ConversionSpec &conv,
+ FormatSinkImpl *sink) {
+ return FloatToSink(v, conv, sink);
+}
+
+} // namespace str_format_internal
+} // namespace absl
diff --git a/absl/strings/internal/str_format/float_conversion.h b/absl/strings/internal/str_format/float_conversion.h
new file mode 100644
index 00000000..8ba5566d
--- /dev/null
+++ b/absl/strings/internal/str_format/float_conversion.h
@@ -0,0 +1,21 @@
+#ifndef ABSL_STRINGS_INTERNAL_STR_FORMAT_FLOAT_CONVERSION_H_
+#define ABSL_STRINGS_INTERNAL_STR_FORMAT_FLOAT_CONVERSION_H_
+
+#include "absl/strings/internal/str_format/extension.h"
+
+namespace absl {
+namespace str_format_internal {
+
+bool ConvertFloatImpl(float v, const ConversionSpec &conv,
+ FormatSinkImpl *sink);
+
+bool ConvertFloatImpl(double v, const ConversionSpec &conv,
+ FormatSinkImpl *sink);
+
+bool ConvertFloatImpl(long double v, const ConversionSpec &conv,
+ FormatSinkImpl *sink);
+
+} // namespace str_format_internal
+} // namespace absl
+
+#endif // ABSL_STRINGS_INTERNAL_STR_FORMAT_FLOAT_CONVERSION_H_
diff --git a/absl/strings/internal/str_format/output.cc b/absl/strings/internal/str_format/output.cc
new file mode 100644
index 00000000..5c3795b7
--- /dev/null
+++ b/absl/strings/internal/str_format/output.cc
@@ -0,0 +1,47 @@
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/strings/internal/str_format/output.h"
+
+#include <errno.h>
+#include <cstring>
+
+namespace absl {
+namespace str_format_internal {
+
+void BufferRawSink::Write(string_view v) {
+ size_t to_write = std::min(v.size(), size_);
+ std::memcpy(buffer_, v.data(), to_write);
+ buffer_ += to_write;
+ size_ -= to_write;
+ total_written_ += v.size();
+}
+
+void FILERawSink::Write(string_view v) {
+ while (!v.empty() && !error_) {
+ if (size_t result = std::fwrite(v.data(), 1, v.size(), output_)) {
+ // Some progress was made.
+ count_ += result;
+ v.remove_prefix(result);
+ } else {
+ // Some error occurred.
+ if (errno != EINTR) {
+ error_ = errno;
+ }
+ }
+ }
+}
+
+} // namespace str_format_internal
+} // namespace absl
diff --git a/absl/strings/internal/str_format/output.h b/absl/strings/internal/str_format/output.h
new file mode 100644
index 00000000..3b0aa5e7
--- /dev/null
+++ b/absl/strings/internal/str_format/output.h
@@ -0,0 +1,101 @@
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+//
+// Output extension hooks for the Format library.
+// `internal::InvokeFlush` calls the appropriate flush function for the
+// specified output argument.
+// `BufferRawSink` is a simple output sink for a char buffer. Used by SnprintF.
+// `FILERawSink` is a std::FILE* based sink. Used by PrintF and FprintF.
+
+#ifndef ABSL_STRINGS_INTERNAL_STR_FORMAT_OUTPUT_H_
+#define ABSL_STRINGS_INTERNAL_STR_FORMAT_OUTPUT_H_
+
+#include <cstdio>
+#include <ostream>
+#include <string>
+
+#include "absl/base/port.h"
+#include "absl/strings/string_view.h"
+
+class Cord;
+
+namespace absl {
+namespace str_format_internal {
+
+// RawSink implementation that writes into a char* buffer.
+// It will not overflow the buffer, but will keep the total count of chars
+// that would have been written.
+class BufferRawSink {
+ public:
+ BufferRawSink(char* buffer, size_t size) : buffer_(buffer), size_(size) {}
+
+ size_t total_written() const { return total_written_; }
+ void Write(string_view v);
+
+ private:
+ char* buffer_;
+ size_t size_;
+ size_t total_written_ = 0;
+};
+
+// RawSink implementation that writes into a FILE*.
+// It keeps track of the total number of bytes written and any error encountered
+// during the writes.
+class FILERawSink {
+ public:
+ explicit FILERawSink(std::FILE* output) : output_(output) {}
+
+ void Write(string_view v);
+
+ size_t count() const { return count_; }
+ int error() const { return error_; }
+
+ private:
+ std::FILE* output_;
+ int error_ = 0;
+ size_t count_ = 0;
+};
+
+// Provide RawSink integration with common types from the STL.
+inline void AbslFormatFlush(std::string* out, string_view s) {
+ out->append(s.begin(), s.size());
+}
+inline void AbslFormatFlush(std::ostream* out, string_view s) {
+ out->write(s.begin(), s.size());
+}
+
+template <class AbslCord, typename = typename std::enable_if<
+ std::is_same<AbslCord, ::Cord>::value>::type>
+inline void AbslFormatFlush(AbslCord* out, string_view s) {
+ out->Append(s);
+}
+
+inline void AbslFormatFlush(FILERawSink* sink, string_view v) {
+ sink->Write(v);
+}
+
+inline void AbslFormatFlush(BufferRawSink* sink, string_view v) {
+ sink->Write(v);
+}
+
+template <typename T>
+auto InvokeFlush(T* out, string_view s)
+ -> decltype(str_format_internal::AbslFormatFlush(out, s)) {
+ str_format_internal::AbslFormatFlush(out, s);
+}
+
+} // namespace str_format_internal
+} // namespace absl
+
+#endif // ABSL_STRINGS_INTERNAL_STR_FORMAT_OUTPUT_H_
diff --git a/absl/strings/internal/str_format/output_test.cc b/absl/strings/internal/str_format/output_test.cc
new file mode 100644
index 00000000..cc3c6155
--- /dev/null
+++ b/absl/strings/internal/str_format/output_test.cc
@@ -0,0 +1,78 @@
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/strings/internal/str_format/output.h"
+
+#include <sstream>
+#include <string>
+
+
+#include "gmock/gmock.h"
+#include "gtest/gtest.h"
+
+namespace absl {
+namespace {
+
+TEST(InvokeFlush, String) {
+ std::string str = "ABC";
+ str_format_internal::InvokeFlush(&str, "DEF");
+ EXPECT_EQ(str, "ABCDEF");
+
+#if UTIL_FORMAT_HAS_GLOBAL_STRING
+ std::string str2 = "ABC";
+ str_format_internal::InvokeFlush(&str2, "DEF");
+ EXPECT_EQ(str2, "ABCDEF");
+#endif // UTIL_FORMAT_HAS_GLOBAL_STRING
+}
+
+TEST(InvokeFlush, Stream) {
+ std::stringstream str;
+ str << "ABC";
+ str_format_internal::InvokeFlush(&str, "DEF");
+ EXPECT_EQ(str.str(), "ABCDEF");
+}
+
+TEST(BufferRawSink, Limits) {
+ char buf[16];
+ {
+ std::fill(std::begin(buf), std::end(buf), 'x');
+ str_format_internal::BufferRawSink bufsink(buf, sizeof(buf) - 1);
+ str_format_internal::InvokeFlush(&bufsink, "Hello World237");
+ EXPECT_EQ(std::string(buf, sizeof(buf)), "Hello World237xx");
+ }
+ {
+ std::fill(std::begin(buf), std::end(buf), 'x');
+ str_format_internal::BufferRawSink bufsink(buf, sizeof(buf) - 1);
+ str_format_internal::InvokeFlush(&bufsink, "Hello World237237");
+ EXPECT_EQ(std::string(buf, sizeof(buf)), "Hello World2372x");
+ }
+ {
+ std::fill(std::begin(buf), std::end(buf), 'x');
+ str_format_internal::BufferRawSink bufsink(buf, sizeof(buf) - 1);
+ str_format_internal::InvokeFlush(&bufsink, "Hello World");
+ str_format_internal::InvokeFlush(&bufsink, "237");
+ EXPECT_EQ(std::string(buf, sizeof(buf)), "Hello World237xx");
+ }
+ {
+ std::fill(std::begin(buf), std::end(buf), 'x');
+ str_format_internal::BufferRawSink bufsink(buf, sizeof(buf) - 1);
+ str_format_internal::InvokeFlush(&bufsink, "Hello World");
+ str_format_internal::InvokeFlush(&bufsink, "237237");
+ EXPECT_EQ(std::string(buf, sizeof(buf)), "Hello World2372x");
+ }
+}
+
+} // namespace
+} // namespace absl
+
diff --git a/absl/strings/internal/str_format/parser.cc b/absl/strings/internal/str_format/parser.cc
new file mode 100644
index 00000000..10114f48
--- /dev/null
+++ b/absl/strings/internal/str_format/parser.cc
@@ -0,0 +1,294 @@
+#include "absl/strings/internal/str_format/parser.h"
+
+#include <assert.h>
+#include <string.h>
+#include <wchar.h>
+#include <cctype>
+#include <cstdint>
+
+#include <algorithm>
+#include <initializer_list>
+#include <limits>
+#include <ostream>
+#include <string>
+#include <unordered_set>
+
+namespace absl {
+namespace str_format_internal {
+namespace {
+
+bool CheckFastPathSetting(const UnboundConversion& conv) {
+ bool should_be_basic = !conv.flags.left && //
+ !conv.flags.show_pos && //
+ !conv.flags.sign_col && //
+ !conv.flags.alt && //
+ !conv.flags.zero && //
+ (conv.width.value() == -1) &&
+ (conv.precision.value() == -1);
+ if (should_be_basic != conv.flags.basic) {
+ fprintf(stderr,
+ "basic=%d left=%d show_pos=%d sign_col=%d alt=%d zero=%d "
+ "width=%d precision=%d\n",
+ conv.flags.basic, conv.flags.left, conv.flags.show_pos,
+ conv.flags.sign_col, conv.flags.alt, conv.flags.zero,
+ conv.width.value(), conv.precision.value());
+ }
+ return should_be_basic == conv.flags.basic;
+}
+
+// Keep a single table for all the conversion chars and length modifiers.
+// We invert the length modifiers to make them negative so that we can easily
+// test for them.
+// Everything else is `none`, which is a negative constant.
+using CC = ConversionChar::Id;
+using LM = LengthMod::Id;
+static constexpr std::int8_t none = -128;
+static constexpr std::int8_t kIds[] = {
+ none, none, none, none, none, none, none, none, // 00-07
+ none, none, none, none, none, none, none, none, // 08-0f
+ none, none, none, none, none, none, none, none, // 10-17
+ none, none, none, none, none, none, none, none, // 18-1f
+ none, none, none, none, none, none, none, none, // 20-27
+ none, none, none, none, none, none, none, none, // 28-2f
+ none, none, none, none, none, none, none, none, // 30-37
+ none, none, none, none, none, none, none, none, // 38-3f
+ none, CC::A, none, CC::C, none, CC::E, CC::F, CC::G, // @ABCDEFG
+ none, none, none, none, ~LM::L, none, none, none, // HIJKLMNO
+ none, none, none, CC::S, none, none, none, none, // PQRSTUVW
+ CC::X, none, none, none, none, none, none, none, // XYZ[\]^_
+ none, CC::a, none, CC::c, CC::d, CC::e, CC::f, CC::g, // `abcdefg
+ ~LM::h, CC::i, ~LM::j, none, ~LM::l, none, CC::n, CC::o, // hijklmno
+ CC::p, ~LM::q, none, CC::s, ~LM::t, CC::u, none, none, // pqrstuvw
+ CC::x, none, ~LM::z, none, none, none, none, none, // xyz{|}~!
+ none, none, none, none, none, none, none, none, // 80-87
+ none, none, none, none, none, none, none, none, // 88-8f
+ none, none, none, none, none, none, none, none, // 90-97
+ none, none, none, none, none, none, none, none, // 98-9f
+ none, none, none, none, none, none, none, none, // a0-a7
+ none, none, none, none, none, none, none, none, // a8-af
+ none, none, none, none, none, none, none, none, // b0-b7
+ none, none, none, none, none, none, none, none, // b8-bf
+ none, none, none, none, none, none, none, none, // c0-c7
+ none, none, none, none, none, none, none, none, // c8-cf
+ none, none, none, none, none, none, none, none, // d0-d7
+ none, none, none, none, none, none, none, none, // d8-df
+ none, none, none, none, none, none, none, none, // e0-e7
+ none, none, none, none, none, none, none, none, // e8-ef
+ none, none, none, none, none, none, none, none, // f0-f7
+ none, none, none, none, none, none, none, none, // f8-ff
+};
+
+template <bool is_positional>
+bool ConsumeConversion(string_view *src, UnboundConversion *conv,
+ int *next_arg) {
+ const char *pos = src->begin();
+ const char *const end = src->end();
+ char c;
+ // Read the next char into `c` and update `pos`. Reads '\0' if at end.
+ const auto get_char = [&] { c = pos == end ? '\0' : *pos++; };
+
+ const auto parse_digits = [&] {
+ int digits = c - '0';
+ // We do not want to overflow `digits` so we consume at most digits10-1
+ // digits. If there are more digits the parsing will fail later on when the
+ // digit doesn't match the expected characters.
+ int num_digits = std::numeric_limits<int>::digits10 - 2;
+ for (get_char(); num_digits && std::isdigit(c); get_char()) {
+ --num_digits;
+ digits = 10 * digits + c - '0';
+ }
+ return digits;
+ };
+
+ if (is_positional) {
+ get_char();
+ if (c < '1' || c > '9') return false;
+ conv->arg_position = parse_digits();
+ assert(conv->arg_position > 0);
+ if (c != '$') return false;
+ }
+
+ get_char();
+
+ // We should start with the basic flag on.
+ assert(conv->flags.basic);
+
+ // Any non alpha character makes this conversion not basic.
+ // This includes flags (-+ #0), width (1-9, *) or precision (.).
+ // All conversion characters and length modifiers are alpha characters.
+ if (c < 'A') {
+ conv->flags.basic = false;
+
+ for (; c <= '0'; get_char()) {
+ switch (c) {
+ case '-':
+ conv->flags.left = true;
+ continue;
+ case '+':
+ conv->flags.show_pos = true;
+ continue;
+ case ' ':
+ conv->flags.sign_col = true;
+ continue;
+ case '#':
+ conv->flags.alt = true;
+ continue;
+ case '0':
+ conv->flags.zero = true;
+ continue;
+ }
+ break;
+ }
+
+ if (c <= '9') {
+ if (c >= '0') {
+ int maybe_width = parse_digits();
+ if (!is_positional && c == '$') {
+ if (*next_arg != 0) return false;
+ // Positional conversion.
+ *next_arg = -1;
+ conv->flags = Flags();
+ conv->flags.basic = true;
+ return ConsumeConversion<true>(src, conv, next_arg);
+ }
+ conv->width.set_value(maybe_width);
+ } else if (c == '*') {
+ get_char();
+ if (is_positional) {
+ if (c < '1' || c > '9') return false;
+ conv->width.set_from_arg(parse_digits());
+ if (c != '$') return false;
+ get_char();
+ } else {
+ conv->width.set_from_arg(++*next_arg);
+ }
+ }
+ }
+
+ if (c == '.') {
+ get_char();
+ if (std::isdigit(c)) {
+ conv->precision.set_value(parse_digits());
+ } else if (c == '*') {
+ get_char();
+ if (is_positional) {
+ if (c < '1' || c > '9') return false;
+ conv->precision.set_from_arg(parse_digits());
+ if (c != '$') return false;
+ get_char();
+ } else {
+ conv->precision.set_from_arg(++*next_arg);
+ }
+ } else {
+ conv->precision.set_value(0);
+ }
+ }
+ }
+
+ std::int8_t id = kIds[static_cast<unsigned char>(c)];
+
+ if (id < 0) {
+ if (id == none) return false;
+
+ // It is a length modifier.
+ using str_format_internal::LengthMod;
+ LengthMod length_mod = LengthMod::FromId(static_cast<LM>(~id));
+ get_char();
+ if (c == 'h' && length_mod.id() == LengthMod::h) {
+ conv->length_mod = LengthMod::FromId(LengthMod::hh);
+ get_char();
+ } else if (c == 'l' && length_mod.id() == LengthMod::l) {
+ conv->length_mod = LengthMod::FromId(LengthMod::ll);
+ get_char();
+ } else {
+ conv->length_mod = length_mod;
+ }
+ id = kIds[static_cast<unsigned char>(c)];
+ if (id < 0) return false;
+ }
+
+ assert(CheckFastPathSetting(*conv));
+ (void)(&CheckFastPathSetting);
+
+ conv->conv = ConversionChar::FromId(static_cast<CC>(id));
+ if (!is_positional) conv->arg_position = ++*next_arg;
+ *src = string_view(pos, end - pos);
+ return true;
+}
+
+} // namespace
+
+bool ConsumeUnboundConversion(string_view *src, UnboundConversion *conv,
+ int *next_arg) {
+ if (*next_arg < 0) return ConsumeConversion<true>(src, conv, next_arg);
+ return ConsumeConversion<false>(src, conv, next_arg);
+}
+
+struct ParsedFormatBase::ParsedFormatConsumer {
+ explicit ParsedFormatConsumer(ParsedFormatBase *parsedformat)
+ : parsed(parsedformat), data_pos(parsedformat->data_.get()) {}
+
+ bool Append(string_view s) {
+ if (s.empty()) return true;
+
+ size_t text_end = AppendText(s);
+
+ if (!parsed->items_.empty() && !parsed->items_.back().is_conversion) {
+ // Let's extend the existing text run.
+ parsed->items_.back().text_end = text_end;
+ } else {
+ // Let's make a new text run.
+ parsed->items_.push_back({false, text_end, {}});
+ }
+ return true;
+ }
+
+ bool ConvertOne(const UnboundConversion &conv, string_view s) {
+ size_t text_end = AppendText(s);
+ parsed->items_.push_back({true, text_end, conv});
+ return true;
+ }
+
+ size_t AppendText(string_view s) {
+ memcpy(data_pos, s.data(), s.size());
+ data_pos += s.size();
+ return static_cast<size_t>(data_pos - parsed->data_.get());
+ }
+
+ ParsedFormatBase *parsed;
+ char* data_pos;
+};
+
+ParsedFormatBase::ParsedFormatBase(string_view format, bool allow_ignored,
+ std::initializer_list<Conv> convs)
+ : data_(format.empty() ? nullptr : new char[format.size()]) {
+ has_error_ = !ParseFormatString(format, ParsedFormatConsumer(this)) ||
+ !MatchesConversions(allow_ignored, convs);
+}
+
+bool ParsedFormatBase::MatchesConversions(
+ bool allow_ignored, std::initializer_list<Conv> convs) const {
+ std::unordered_set<int> used;
+ auto add_if_valid_conv = [&](int pos, char c) {
+ if (static_cast<size_t>(pos) > convs.size() ||
+ !Contains(convs.begin()[pos - 1], c))
+ return false;
+ used.insert(pos);
+ return true;
+ };
+ for (const ConversionItem &item : items_) {
+ if (!item.is_conversion) continue;
+ auto &conv = item.conv;
+ if (conv.precision.is_from_arg() &&
+ !add_if_valid_conv(conv.precision.get_from_arg(), '*'))
+ return false;
+ if (conv.width.is_from_arg() &&
+ !add_if_valid_conv(conv.width.get_from_arg(), '*'))
+ return false;
+ if (!add_if_valid_conv(conv.arg_position, conv.conv.Char())) return false;
+ }
+ return used.size() == convs.size() || allow_ignored;
+}
+
+} // namespace str_format_internal
+} // namespace absl
diff --git a/absl/strings/internal/str_format/parser.h b/absl/strings/internal/str_format/parser.h
new file mode 100644
index 00000000..5bebc955
--- /dev/null
+++ b/absl/strings/internal/str_format/parser.h
@@ -0,0 +1,291 @@
+#ifndef ABSL_STRINGS_INTERNAL_STR_FORMAT_PARSER_H_
+#define ABSL_STRINGS_INTERNAL_STR_FORMAT_PARSER_H_
+
+#include <limits.h>
+#include <stddef.h>
+#include <stdlib.h>
+
+#include <cassert>
+#include <initializer_list>
+#include <iosfwd>
+#include <iterator>
+#include <memory>
+#include <vector>
+
+#include "absl/strings/internal/str_format/checker.h"
+#include "absl/strings/internal/str_format/extension.h"
+
+namespace absl {
+namespace str_format_internal {
+
+// The analyzed properties of a single specified conversion.
+struct UnboundConversion {
+ UnboundConversion()
+ : flags() /* This is required to zero all the fields of flags. */ {
+ flags.basic = true;
+ }
+
+ class InputValue {
+ public:
+ void set_value(int value) {
+ assert(value >= 0);
+ value_ = value;
+ }
+ int value() const { return value_; }
+
+ // Marks the value as "from arg". aka the '*' format.
+ // Requires `value >= 1`.
+ // When set, is_from_arg() return true and get_from_arg() returns the
+ // original value.
+ // `value()`'s return value is unspecfied in this state.
+ void set_from_arg(int value) {
+ assert(value > 0);
+ value_ = -value - 1;
+ }
+ bool is_from_arg() const { return value_ < -1; }
+ int get_from_arg() const {
+ assert(is_from_arg());
+ return -value_ - 1;
+ }
+
+ private:
+ int value_ = -1;
+ };
+
+ // No need to initialize. It will always be set in the parser.
+ int arg_position;
+
+ InputValue width;
+ InputValue precision;
+
+ Flags flags;
+ LengthMod length_mod;
+ ConversionChar conv;
+};
+
+// Consume conversion spec prefix (not including '%') of '*src' if valid.
+// Examples of valid specs would be e.g.: "s", "d", "-12.6f".
+// If valid, the front of src is advanced such that src becomes the
+// part following the conversion spec, and the spec part is broken down and
+// returned in 'conv'.
+// If invalid, returns false and leaves 'src' unmodified.
+// For example:
+// Given "d9", returns "d", and leaves src="9",
+// Given "!", returns "" and leaves src="!".
+bool ConsumeUnboundConversion(string_view* src, UnboundConversion* conv,
+ int* next_arg);
+
+// Parse the format std::string provided in 'src' and pass the identified items into
+// 'consumer'.
+// Text runs will be passed by calling
+// Consumer::Append(string_view);
+// ConversionItems will be passed by calling
+// Consumer::ConvertOne(UnboundConversion, string_view);
+// In the case of ConvertOne, the string_view that is passed is the
+// portion of the format std::string corresponding to the conversion, not including
+// the leading %. On success, it returns true. On failure, it stops and returns
+// false.
+template <typename Consumer>
+bool ParseFormatString(string_view src, Consumer consumer) {
+ int next_arg = 0;
+ while (!src.empty()) {
+ const char* percent =
+ static_cast<const char*>(memchr(src.begin(), '%', src.size()));
+ if (!percent) {
+ // We found the last substring.
+ return consumer.Append(src);
+ }
+ // We found a percent, so push the text run then process the percent.
+ size_t percent_loc = percent - src.data();
+ if (!consumer.Append(string_view(src.data(), percent_loc))) return false;
+ if (percent + 1 >= src.end()) return false;
+
+ UnboundConversion conv;
+
+ switch (percent[1]) {
+ case '%':
+ if (!consumer.Append("%")) return false;
+ src.remove_prefix(percent_loc + 2);
+ continue;
+
+#define PARSER_CASE(ch) \
+ case #ch[0]: \
+ src.remove_prefix(percent_loc + 2); \
+ conv.conv = ConversionChar::FromId(ConversionChar::ch); \
+ conv.arg_position = ++next_arg; \
+ break;
+ ABSL_CONVERSION_CHARS_EXPAND_(PARSER_CASE, );
+#undef PARSER_CASE
+
+ default:
+ src.remove_prefix(percent_loc + 1);
+ if (!ConsumeUnboundConversion(&src, &conv, &next_arg)) return false;
+ break;
+ }
+ if (next_arg == 0) {
+ // This indicates an error in the format std::string.
+ // The only way to get next_arg == 0 is to have a positional argument
+ // first which sets next_arg to -1 and then a non-positional argument
+ // which does ++next_arg.
+ // Checking here seems to be the cheapeast place to do it.
+ return false;
+ }
+ if (!consumer.ConvertOne(
+ conv, string_view(percent + 1, src.data() - (percent + 1)))) {
+ return false;
+ }
+ }
+ return true;
+}
+
+// Always returns true, or fails to compile in a constexpr context if s does not
+// point to a constexpr char array.
+constexpr bool EnsureConstexpr(string_view s) {
+ return s.empty() || s[0] == s[0];
+}
+
+class ParsedFormatBase {
+ public:
+ explicit ParsedFormatBase(string_view format, bool allow_ignored,
+ std::initializer_list<Conv> convs);
+
+ ParsedFormatBase(const ParsedFormatBase& other) { *this = other; }
+
+ ParsedFormatBase(ParsedFormatBase&& other) { *this = std::move(other); }
+
+ ParsedFormatBase& operator=(const ParsedFormatBase& other) {
+ if (this == &other) return *this;
+ has_error_ = other.has_error_;
+ items_ = other.items_;
+ size_t text_size = items_.empty() ? 0 : items_.back().text_end;
+ data_.reset(new char[text_size]);
+ memcpy(data_.get(), other.data_.get(), text_size);
+ return *this;
+ }
+
+ ParsedFormatBase& operator=(ParsedFormatBase&& other) {
+ if (this == &other) return *this;
+ has_error_ = other.has_error_;
+ data_ = std::move(other.data_);
+ items_ = std::move(other.items_);
+ // Reset the vector to make sure the invariants hold.
+ other.items_.clear();
+ return *this;
+ }
+
+ template <typename Consumer>
+ bool ProcessFormat(Consumer consumer) const {
+ const char* const base = data_.get();
+ string_view text(base, 0);
+ for (const auto& item : items_) {
+ text = string_view(text.end(), (base + item.text_end) - text.end());
+ if (item.is_conversion) {
+ if (!consumer.ConvertOne(item.conv, text)) return false;
+ } else {
+ if (!consumer.Append(text)) return false;
+ }
+ }
+ return !has_error_;
+ }
+
+ bool has_error() const { return has_error_; }
+
+ private:
+ // Returns whether the conversions match and if !allow_ignored it verifies
+ // that all conversions are used by the format.
+ bool MatchesConversions(bool allow_ignored,
+ std::initializer_list<Conv> convs) const;
+
+ struct ParsedFormatConsumer;
+
+ struct ConversionItem {
+ bool is_conversion;
+ // Points to the past-the-end location of this element in the data_ array.
+ size_t text_end;
+ UnboundConversion conv;
+ };
+
+ bool has_error_;
+ std::unique_ptr<char[]> data_;
+ std::vector<ConversionItem> items_;
+};
+
+
+// A value type representing a preparsed format. These can be created, copied
+// around, and reused to speed up formatting loops.
+// The user must specify through the template arguments the conversion
+// characters used in the format. This will be checked at compile time.
+//
+// This class uses Conv enum values to specify each argument.
+// This allows for more flexibility as you can specify multiple possible
+// conversion characters for each argument.
+// ParsedFormat<char...> is a simplified alias for when the user only
+// needs to specify a single conversion character for each argument.
+//
+// Example:
+// // Extended format supports multiple characters per argument:
+// using MyFormat = ExtendedParsedFormat<Conv::d | Conv::x>;
+// MyFormat GetFormat(bool use_hex) {
+// if (use_hex) return MyFormat("foo %x bar");
+// return MyFormat("foo %d bar");
+// }
+// // 'format' can be used with any value that supports 'd' and 'x',
+// // like `int`.
+// auto format = GetFormat(use_hex);
+// value = StringF(format, i);
+//
+// This class also supports runtime format checking with the ::New() and
+// ::NewAllowIgnored() factory functions.
+// This is the only API that allows the user to pass a runtime specified format
+// std::string. These factory functions will return NULL if the format does not match
+// the conversions requested by the user.
+template <str_format_internal::Conv... C>
+class ExtendedParsedFormat : public str_format_internal::ParsedFormatBase {
+ public:
+ explicit ExtendedParsedFormat(string_view format)
+#if ABSL_INTERNAL_ENABLE_FORMAT_CHECKER
+ __attribute__((
+ enable_if(str_format_internal::EnsureConstexpr(format),
+ "Format std::string is not constexpr."),
+ enable_if(str_format_internal::ValidFormatImpl<C...>(format),
+ "Format specified does not match the template arguments.")))
+#endif // ABSL_INTERNAL_ENABLE_FORMAT_CHECKER
+ : ExtendedParsedFormat(format, false) {
+ }
+
+ // ExtendedParsedFormat factory function.
+ // The user still has to specify the conversion characters, but they will not
+ // be checked at compile time. Instead, it will be checked at runtime.
+ // This delays the checking to runtime, but allows the user to pass
+ // dynamically sourced formats.
+ // It returns NULL if the format does not match the conversion characters.
+ // The user is responsible for checking the return value before using it.
+ //
+ // The 'New' variant will check that all the specified arguments are being
+ // consumed by the format and return NULL if any argument is being ignored.
+ // The 'NewAllowIgnored' variant will not verify this and will allow formats
+ // that ignore arguments.
+ static std::unique_ptr<ExtendedParsedFormat> New(string_view format) {
+ return New(format, false);
+ }
+ static std::unique_ptr<ExtendedParsedFormat> NewAllowIgnored(
+ string_view format) {
+ return New(format, true);
+ }
+
+ private:
+ static std::unique_ptr<ExtendedParsedFormat> New(string_view format,
+ bool allow_ignored) {
+ std::unique_ptr<ExtendedParsedFormat> conv(
+ new ExtendedParsedFormat(format, allow_ignored));
+ if (conv->has_error()) return nullptr;
+ return conv;
+ }
+
+ ExtendedParsedFormat(string_view s, bool allow_ignored)
+ : ParsedFormatBase(s, allow_ignored, {C...}) {}
+};
+} // namespace str_format_internal
+} // namespace absl
+
+#endif // ABSL_STRINGS_INTERNAL_STR_FORMAT_PARSER_H_
diff --git a/absl/strings/internal/str_format/parser_test.cc b/absl/strings/internal/str_format/parser_test.cc
new file mode 100644
index 00000000..e698020b
--- /dev/null
+++ b/absl/strings/internal/str_format/parser_test.cc
@@ -0,0 +1,379 @@
+#include "absl/strings/internal/str_format/parser.h"
+
+#include <string.h>
+#include "gtest/gtest.h"
+#include "absl/base/macros.h"
+
+namespace absl {
+namespace str_format_internal {
+
+namespace {
+
+TEST(LengthModTest, Names) {
+ struct Expectation {
+ int line;
+ LengthMod::Id id;
+ const char *name;
+ };
+ const Expectation kExpect[] = {
+ {__LINE__, LengthMod::none, "" },
+ {__LINE__, LengthMod::h, "h" },
+ {__LINE__, LengthMod::hh, "hh"},
+ {__LINE__, LengthMod::l, "l" },
+ {__LINE__, LengthMod::ll, "ll"},
+ {__LINE__, LengthMod::L, "L" },
+ {__LINE__, LengthMod::j, "j" },
+ {__LINE__, LengthMod::z, "z" },
+ {__LINE__, LengthMod::t, "t" },
+ {__LINE__, LengthMod::q, "q" },
+ };
+ EXPECT_EQ(ABSL_ARRAYSIZE(kExpect), LengthMod::kNumValues);
+ for (auto e : kExpect) {
+ SCOPED_TRACE(e.line);
+ LengthMod mod = LengthMod::FromId(e.id);
+ EXPECT_EQ(e.id, mod.id());
+ EXPECT_EQ(e.name, mod.name());
+ }
+}
+
+TEST(ConversionCharTest, Names) {
+ struct Expectation {
+ ConversionChar::Id id;
+ char name;
+ };
+ // clang-format off
+ const Expectation kExpect[] = {
+#define X(c) {ConversionChar::c, #c[0]}
+ X(c), X(C), X(s), X(S), // text
+ X(d), X(i), X(o), X(u), X(x), X(X), // int
+ X(f), X(F), X(e), X(E), X(g), X(G), X(a), X(A), // float
+ X(n), X(p), // misc
+#undef X
+ {ConversionChar::none, '\0'},
+ };
+ // clang-format on
+ EXPECT_EQ(ABSL_ARRAYSIZE(kExpect), ConversionChar::kNumValues);
+ for (auto e : kExpect) {
+ SCOPED_TRACE(e.name);
+ ConversionChar v = ConversionChar::FromId(e.id);
+ EXPECT_EQ(e.id, v.id());
+ EXPECT_EQ(e.name, v.Char());
+ }
+}
+
+class ConsumeUnboundConversionTest : public ::testing::Test {
+ public:
+ typedef UnboundConversion Props;
+ string_view Consume(string_view* src) {
+ int next = 0;
+ const char* prev_begin = src->begin();
+ o = UnboundConversion(); // refresh
+ ConsumeUnboundConversion(src, &o, &next);
+ return {prev_begin, static_cast<size_t>(src->begin() - prev_begin)};
+ }
+
+ bool Run(const char *fmt, bool force_positional = false) {
+ string_view src = fmt;
+ int next = force_positional ? -1 : 0;
+ o = UnboundConversion(); // refresh
+ return ConsumeUnboundConversion(&src, &o, &next) && src.empty();
+ }
+ UnboundConversion o;
+};
+
+TEST_F(ConsumeUnboundConversionTest, ConsumeSpecification) {
+ struct Expectation {
+ int line;
+ const char *src;
+ const char *out;
+ const char *src_post;
+ };
+ const Expectation kExpect[] = {
+ {__LINE__, "", "", "" },
+ {__LINE__, "b", "", "b" }, // 'b' is invalid
+ {__LINE__, "ba", "", "ba"}, // 'b' is invalid
+ {__LINE__, "l", "", "l" }, // just length mod isn't okay
+ {__LINE__, "d", "d", "" }, // basic
+ {__LINE__, "d ", "d", " " }, // leave suffix
+ {__LINE__, "dd", "d", "d" }, // don't be greedy
+ {__LINE__, "d9", "d", "9" }, // leave non-space suffix
+ {__LINE__, "dzz", "d", "zz"}, // length mod as suffix
+ {__LINE__, "1$*2$d", "1$*2$d", "" }, // arg indexing and * allowed.
+ {__LINE__, "0-14.3hhd", "0-14.3hhd", ""}, // precision, width
+ {__LINE__, " 0-+#14.3hhd", " 0-+#14.3hhd", ""}, // flags
+ };
+ for (const auto& e : kExpect) {
+ SCOPED_TRACE(e.line);
+ string_view src = e.src;
+ EXPECT_EQ(e.src, src);
+ string_view out = Consume(&src);
+ EXPECT_EQ(e.out, out);
+ EXPECT_EQ(e.src_post, src);
+ }
+}
+
+TEST_F(ConsumeUnboundConversionTest, BasicConversion) {
+ EXPECT_FALSE(Run(""));
+ EXPECT_FALSE(Run("z"));
+
+ EXPECT_FALSE(Run("dd")); // no excess allowed
+
+ EXPECT_TRUE(Run("d"));
+ EXPECT_EQ('d', o.conv.Char());
+ EXPECT_FALSE(o.width.is_from_arg());
+ EXPECT_LT(o.width.value(), 0);
+ EXPECT_FALSE(o.precision.is_from_arg());
+ EXPECT_LT(o.precision.value(), 0);
+ EXPECT_EQ(1, o.arg_position);
+ EXPECT_EQ(LengthMod::none, o.length_mod.id());
+}
+
+TEST_F(ConsumeUnboundConversionTest, ArgPosition) {
+ EXPECT_TRUE(Run("d"));
+ EXPECT_EQ(1, o.arg_position);
+ EXPECT_TRUE(Run("3$d"));
+ EXPECT_EQ(3, o.arg_position);
+ EXPECT_TRUE(Run("1$d"));
+ EXPECT_EQ(1, o.arg_position);
+ EXPECT_TRUE(Run("1$d", true));
+ EXPECT_EQ(1, o.arg_position);
+ EXPECT_TRUE(Run("123$d"));
+ EXPECT_EQ(123, o.arg_position);
+ EXPECT_TRUE(Run("123$d", true));
+ EXPECT_EQ(123, o.arg_position);
+ EXPECT_TRUE(Run("10$d"));
+ EXPECT_EQ(10, o.arg_position);
+ EXPECT_TRUE(Run("10$d", true));
+ EXPECT_EQ(10, o.arg_position);
+
+ // Position can't be zero.
+ EXPECT_FALSE(Run("0$d"));
+ EXPECT_FALSE(Run("0$d", true));
+ EXPECT_FALSE(Run("1$*0$d"));
+ EXPECT_FALSE(Run("1$.*0$d"));
+
+ // Position can't start with a zero digit at all. That is not a 'decimal'.
+ EXPECT_FALSE(Run("01$p"));
+ EXPECT_FALSE(Run("01$p", true));
+ EXPECT_FALSE(Run("1$*01$p"));
+ EXPECT_FALSE(Run("1$.*01$p"));
+}
+
+TEST_F(ConsumeUnboundConversionTest, WidthAndPrecision) {
+ EXPECT_TRUE(Run("14d"));
+ EXPECT_EQ('d', o.conv.Char());
+ EXPECT_FALSE(o.width.is_from_arg());
+ EXPECT_EQ(14, o.width.value());
+ EXPECT_FALSE(o.precision.is_from_arg());
+ EXPECT_LT(o.precision.value(), 0);
+
+ EXPECT_TRUE(Run("14.d"));
+ EXPECT_FALSE(o.width.is_from_arg());
+ EXPECT_FALSE(o.precision.is_from_arg());
+ EXPECT_EQ(14, o.width.value());
+ EXPECT_EQ(0, o.precision.value());
+
+ EXPECT_TRUE(Run(".d"));
+ EXPECT_FALSE(o.width.is_from_arg());
+ EXPECT_LT(o.width.value(), 0);
+ EXPECT_FALSE(o.precision.is_from_arg());
+ EXPECT_EQ(0, o.precision.value());
+
+ EXPECT_TRUE(Run(".5d"));
+ EXPECT_FALSE(o.width.is_from_arg());
+ EXPECT_LT(o.width.value(), 0);
+ EXPECT_FALSE(o.precision.is_from_arg());
+ EXPECT_EQ(5, o.precision.value());
+
+ EXPECT_TRUE(Run(".0d"));
+ EXPECT_FALSE(o.width.is_from_arg());
+ EXPECT_LT(o.width.value(), 0);
+ EXPECT_FALSE(o.precision.is_from_arg());
+ EXPECT_EQ(0, o.precision.value());
+
+ EXPECT_TRUE(Run("14.5d"));
+ EXPECT_FALSE(o.width.is_from_arg());
+ EXPECT_FALSE(o.precision.is_from_arg());
+ EXPECT_EQ(14, o.width.value());
+ EXPECT_EQ(5, o.precision.value());
+
+ EXPECT_TRUE(Run("*.*d"));
+ EXPECT_TRUE(o.width.is_from_arg());
+ EXPECT_EQ(1, o.width.get_from_arg());
+ EXPECT_TRUE(o.precision.is_from_arg());
+ EXPECT_EQ(2, o.precision.get_from_arg());
+ EXPECT_EQ(3, o.arg_position);
+
+ EXPECT_TRUE(Run("*d"));
+ EXPECT_TRUE(o.width.is_from_arg());
+ EXPECT_EQ(1, o.width.get_from_arg());
+ EXPECT_FALSE(o.precision.is_from_arg());
+ EXPECT_LT(o.precision.value(), 0);
+ EXPECT_EQ(2, o.arg_position);
+
+ EXPECT_TRUE(Run(".*d"));
+ EXPECT_FALSE(o.width.is_from_arg());
+ EXPECT_LT(o.width.value(), 0);
+ EXPECT_TRUE(o.precision.is_from_arg());
+ EXPECT_EQ(1, o.precision.get_from_arg());
+ EXPECT_EQ(2, o.arg_position);
+
+ // mixed implicit and explicit: didn't specify arg position.
+ EXPECT_FALSE(Run("*23$.*34$d"));
+
+ EXPECT_TRUE(Run("12$*23$.*34$d"));
+ EXPECT_EQ(12, o.arg_position);
+ EXPECT_TRUE(o.width.is_from_arg());
+ EXPECT_EQ(23, o.width.get_from_arg());
+ EXPECT_TRUE(o.precision.is_from_arg());
+ EXPECT_EQ(34, o.precision.get_from_arg());
+
+ EXPECT_TRUE(Run("2$*5$.*9$d"));
+ EXPECT_EQ(2, o.arg_position);
+ EXPECT_TRUE(o.width.is_from_arg());
+ EXPECT_EQ(5, o.width.get_from_arg());
+ EXPECT_TRUE(o.precision.is_from_arg());
+ EXPECT_EQ(9, o.precision.get_from_arg());
+
+ EXPECT_FALSE(Run(".*0$d")) << "no arg 0";
+}
+
+TEST_F(ConsumeUnboundConversionTest, Flags) {
+ static const char kAllFlags[] = "-+ #0";
+ static const int kNumFlags = ABSL_ARRAYSIZE(kAllFlags) - 1;
+ for (int rev = 0; rev < 2; ++rev) {
+ for (int i = 0; i < 1 << kNumFlags; ++i) {
+ std::string fmt;
+ for (int k = 0; k < kNumFlags; ++k)
+ if ((i >> k) & 1) fmt += kAllFlags[k];
+ // flag order shouldn't matter
+ if (rev == 1) { std::reverse(fmt.begin(), fmt.end()); }
+ fmt += 'd';
+ SCOPED_TRACE(fmt);
+ EXPECT_TRUE(Run(fmt.c_str()));
+ EXPECT_EQ(fmt.find('-') == std::string::npos, !o.flags.left);
+ EXPECT_EQ(fmt.find('+') == std::string::npos, !o.flags.show_pos);
+ EXPECT_EQ(fmt.find(' ') == std::string::npos, !o.flags.sign_col);
+ EXPECT_EQ(fmt.find('#') == std::string::npos, !o.flags.alt);
+ EXPECT_EQ(fmt.find('0') == std::string::npos, !o.flags.zero);
+ }
+ }
+}
+
+TEST_F(ConsumeUnboundConversionTest, BasicFlag) {
+ // Flag is on
+ for (const char* fmt : {"d", "llx", "G", "1$X"}) {
+ SCOPED_TRACE(fmt);
+ EXPECT_TRUE(Run(fmt));
+ EXPECT_TRUE(o.flags.basic);
+ }
+
+ // Flag is off
+ for (const char* fmt : {"3d", ".llx", "-G", "1$#X"}) {
+ SCOPED_TRACE(fmt);
+ EXPECT_TRUE(Run(fmt));
+ EXPECT_FALSE(o.flags.basic);
+ }
+}
+
+struct SummarizeConsumer {
+ std::string* out;
+ explicit SummarizeConsumer(std::string* out) : out(out) {}
+
+ bool Append(string_view s) {
+ *out += "[" + std::string(s) + "]";
+ return true;
+ }
+
+ bool ConvertOne(const UnboundConversion& conv, string_view s) {
+ *out += "{";
+ *out += std::string(s);
+ *out += ":";
+ *out += std::to_string(conv.arg_position) + "$";
+ if (conv.width.is_from_arg()) {
+ *out += std::to_string(conv.width.get_from_arg()) + "$*";
+ }
+ if (conv.precision.is_from_arg()) {
+ *out += "." + std::to_string(conv.precision.get_from_arg()) + "$*";
+ }
+ *out += conv.conv.Char();
+ *out += "}";
+ return true;
+ }
+};
+
+std::string SummarizeParsedFormat(const ParsedFormatBase& pc) {
+ std::string out;
+ if (!pc.ProcessFormat(SummarizeConsumer(&out))) out += "!";
+ return out;
+}
+
+class ParsedFormatTest : public testing::Test {};
+
+TEST_F(ParsedFormatTest, ValueSemantics) {
+ ParsedFormatBase p1({}, true, {}); // empty format
+ EXPECT_EQ("", SummarizeParsedFormat(p1));
+
+ ParsedFormatBase p2 = p1; // copy construct (empty)
+ EXPECT_EQ(SummarizeParsedFormat(p1), SummarizeParsedFormat(p2));
+
+ p1 = ParsedFormatBase("hello%s", true, {Conv::s}); // move assign
+ EXPECT_EQ("[hello]{s:1$s}", SummarizeParsedFormat(p1));
+
+ ParsedFormatBase p3 = p1; // copy construct (nonempty)
+ EXPECT_EQ(SummarizeParsedFormat(p1), SummarizeParsedFormat(p3));
+
+ using std::swap;
+ swap(p1, p2);
+ EXPECT_EQ("", SummarizeParsedFormat(p1));
+ EXPECT_EQ("[hello]{s:1$s}", SummarizeParsedFormat(p2));
+ swap(p1, p2); // undo
+
+ p2 = p1; // copy assign
+ EXPECT_EQ(SummarizeParsedFormat(p1), SummarizeParsedFormat(p2));
+}
+
+struct ExpectParse {
+ const char* in;
+ std::initializer_list<Conv> conv_set;
+ const char* out;
+};
+
+TEST_F(ParsedFormatTest, Parsing) {
+ // Parse should be equivalent to that obtained by ConversionParseIterator.
+ // No need to retest the parsing edge cases here.
+ const ExpectParse kExpect[] = {
+ {"", {}, ""},
+ {"ab", {}, "[ab]"},
+ {"a%d", {Conv::d}, "[a]{d:1$d}"},
+ {"a%+d", {Conv::d}, "[a]{+d:1$d}"},
+ {"a% d", {Conv::d}, "[a]{ d:1$d}"},
+ {"a%b %d", {}, "[a]!"}, // stop after error
+ };
+ for (const auto& e : kExpect) {
+ SCOPED_TRACE(e.in);
+ EXPECT_EQ(e.out,
+ SummarizeParsedFormat(ParsedFormatBase(e.in, false, e.conv_set)));
+ }
+}
+
+TEST_F(ParsedFormatTest, ParsingFlagOrder) {
+ const ExpectParse kExpect[] = {
+ {"a%+ 0d", {Conv::d}, "[a]{+ 0d:1$d}"},
+ {"a%+0 d", {Conv::d}, "[a]{+0 d:1$d}"},
+ {"a%0+ d", {Conv::d}, "[a]{0+ d:1$d}"},
+ {"a% +0d", {Conv::d}, "[a]{ +0d:1$d}"},
+ {"a%0 +d", {Conv::d}, "[a]{0 +d:1$d}"},
+ {"a% 0+d", {Conv::d}, "[a]{ 0+d:1$d}"},
+ {"a%+ 0+d", {Conv::d}, "[a]{+ 0+d:1$d}"},
+ };
+ for (const auto& e : kExpect) {
+ SCOPED_TRACE(e.in);
+ EXPECT_EQ(e.out,
+ SummarizeParsedFormat(ParsedFormatBase(e.in, false, e.conv_set)));
+ }
+}
+
+} // namespace
+} // namespace str_format_internal
+} // namespace absl
diff --git a/absl/strings/internal/str_split_internal.h b/absl/strings/internal/str_split_internal.h
index a1b10f3a..9cf0833f 100644
--- a/absl/strings/internal/str_split_internal.h
+++ b/absl/strings/internal/str_split_internal.h
@@ -228,14 +228,31 @@ struct IsInitializerList
// compiled in C++11 will get an error due to ambiguous conversion paths (in
// C++11 std::vector<T>::operator= is overloaded to take either a std::vector<T>
// or an std::initializer_list<T>).
+
+template <typename C, bool has_value_type, bool has_mapped_type>
+struct SplitterIsConvertibleToImpl : std::false_type {};
+
+template <typename C>
+struct SplitterIsConvertibleToImpl<C, true, false>
+ : std::is_constructible<typename C::value_type, absl::string_view> {};
+
+template <typename C>
+struct SplitterIsConvertibleToImpl<C, true, true>
+ : absl::conjunction<
+ std::is_constructible<typename C::key_type, absl::string_view>,
+ std::is_constructible<typename C::mapped_type, absl::string_view>> {};
+
template <typename C>
struct SplitterIsConvertibleTo
- : std::enable_if<
+ : SplitterIsConvertibleToImpl<
+ C,
#ifdef _GLIBCXX_DEBUG
!IsStrictlyBaseOfAndConvertibleToSTLContainer<C>::value &&
#endif // _GLIBCXX_DEBUG
- !IsInitializerList<C>::value && HasValueType<C>::value &&
- HasConstIterator<C>::value> {
+ !IsInitializerList<
+ typename std::remove_reference<C>::type>::value &&
+ HasValueType<C>::value && HasConstIterator<C>::value,
+ HasMappedType<C>::value> {
};
// This class implements the range that is returned by absl::StrSplit(). This
@@ -281,7 +298,8 @@ class Splitter {
// An implicit conversion operator that is restricted to only those containers
// that the splitter is convertible to.
template <typename Container,
- typename OnlyIf = typename SplitterIsConvertibleTo<Container>::type>
+ typename = typename std::enable_if<
+ SplitterIsConvertibleTo<Container>::value>::type>
operator Container() const { // NOLINT(runtime/explicit)
return ConvertToContainer<Container, typename Container::value_type,
HasMappedType<Container>::value>()(*this);
diff --git a/absl/strings/numbers.cc b/absl/strings/numbers.cc
index 68ef7999..f842ed85 100644
--- a/absl/strings/numbers.cc
+++ b/absl/strings/numbers.cc
@@ -32,6 +32,7 @@
#include "absl/base/internal/raw_logging.h"
#include "absl/strings/ascii.h"
+#include "absl/strings/charconv.h"
#include "absl/strings/internal/bits.h"
#include "absl/strings/internal/memutil.h"
#include "absl/strings/str_cat.h"
@@ -40,51 +41,54 @@ namespace absl {
bool SimpleAtof(absl::string_view str, float* value) {
*value = 0.0;
- if (str.empty()) return false;
- char buf[32];
- std::unique_ptr<char[]> bigbuf;
- char* ptr = buf;
- if (str.size() > sizeof(buf) - 1) {
- bigbuf.reset(new char[str.size() + 1]);
- ptr = bigbuf.get();
- }
- memcpy(ptr, str.data(), str.size());
- ptr[str.size()] = '\0';
-
- char* endptr;
- *value = strtof(ptr, &endptr);
- if (endptr != ptr) {
- while (absl::ascii_isspace(*endptr)) ++endptr;
- }
- // Ignore range errors from strtod/strtof.
- // The values it returns on underflow and
- // overflow are the right fallback in a
- // robust setting.
- return *ptr != '\0' && *endptr == '\0';
+ str = StripAsciiWhitespace(str);
+ if (!str.empty() && str[0] == '+') {
+ str.remove_prefix(1);
+ }
+ auto result = absl::from_chars(str.data(), str.data() + str.size(), *value);
+ if (result.ec == std::errc::invalid_argument) {
+ return false;
+ }
+ if (result.ptr != str.data() + str.size()) {
+ // not all non-whitespace characters consumed
+ return false;
+ }
+ // from_chars() with DR 3801's current wording will return max() on
+ // overflow. SimpleAtof returns infinity instead.
+ if (result.ec == std::errc::result_out_of_range) {
+ if (*value > 1.0) {
+ *value = std::numeric_limits<float>::infinity();
+ } else if (*value < -1.0) {
+ *value = -std::numeric_limits<float>::infinity();
+ }
+ }
+ return true;
}
bool SimpleAtod(absl::string_view str, double* value) {
*value = 0.0;
- if (str.empty()) return false;
- char buf[32];
- std::unique_ptr<char[]> bigbuf;
- char* ptr = buf;
- if (str.size() > sizeof(buf) - 1) {
- bigbuf.reset(new char[str.size() + 1]);
- ptr = bigbuf.get();
- }
- memcpy(ptr, str.data(), str.size());
- ptr[str.size()] = '\0';
-
- char* endptr;
- *value = strtod(ptr, &endptr);
- if (endptr != ptr) {
- while (absl::ascii_isspace(*endptr)) ++endptr;
- }
- // Ignore range errors from strtod. The values it
- // returns on underflow and overflow are the right
- // fallback in a robust setting.
- return *ptr != '\0' && *endptr == '\0';
+ str = StripAsciiWhitespace(str);
+ if (!str.empty() && str[0] == '+') {
+ str.remove_prefix(1);
+ }
+ auto result = absl::from_chars(str.data(), str.data() + str.size(), *value);
+ if (result.ec == std::errc::invalid_argument) {
+ return false;
+ }
+ if (result.ptr != str.data() + str.size()) {
+ // not all non-whitespace characters consumed
+ return false;
+ }
+ // from_chars() with DR 3801's current wording will return max() on
+ // overflow. SimpleAtod returns infinity instead.
+ if (result.ec == std::errc::result_out_of_range) {
+ if (*value > 1.0) {
+ *value = std::numeric_limits<double>::infinity();
+ } else if (*value < -1.0) {
+ *value = -std::numeric_limits<double>::infinity();
+ }
+ }
+ return true;
}
namespace {
diff --git a/absl/strings/numbers_benchmark.cc b/absl/strings/numbers_benchmark.cc
new file mode 100644
index 00000000..8ef650b9
--- /dev/null
+++ b/absl/strings/numbers_benchmark.cc
@@ -0,0 +1,263 @@
+// Copyright 2018 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include <cstdint>
+#include <random>
+#include <string>
+#include <type_traits>
+#include <vector>
+
+#include "benchmark/benchmark.h"
+#include "absl/base/internal/raw_logging.h"
+#include "absl/strings/numbers.h"
+
+namespace {
+
+template <typename T>
+void BM_FastIntToBuffer(benchmark::State& state) {
+ const int inc = state.range(0);
+ char buf[absl::numbers_internal::kFastToBufferSize];
+ // Use the unsigned type to increment to take advantage of well-defined
+ // modular arithmetic.
+ typename std::make_unsigned<T>::type x = 0;
+ for (auto _ : state) {
+ absl::numbers_internal::FastIntToBuffer(static_cast<T>(x), buf);
+ x += inc;
+ }
+}
+BENCHMARK_TEMPLATE(BM_FastIntToBuffer, int32_t)->Range(0, 1 << 15);
+BENCHMARK_TEMPLATE(BM_FastIntToBuffer, int64_t)->Range(0, 1 << 30);
+
+// Creates an integer that would be printed as `num_digits` repeated 7s in the
+// given `base`. `base` must be greater than or equal to 8.
+int64_t RepeatedSevens(int num_digits, int base) {
+ ABSL_RAW_CHECK(base >= 8, "");
+ int64_t num = 7;
+ while (--num_digits) num = base * num + 7;
+ return num;
+}
+
+void BM_safe_strto32_string(benchmark::State& state) {
+ const int digits = state.range(0);
+ const int base = state.range(1);
+ std::string str(digits, '7'); // valid in octal, decimal and hex
+ int32_t value = 0;
+ for (auto _ : state) {
+ benchmark::DoNotOptimize(
+ absl::numbers_internal::safe_strto32_base(str, &value, base));
+ }
+ ABSL_RAW_CHECK(value == RepeatedSevens(digits, base), "");
+}
+BENCHMARK(BM_safe_strto32_string)
+ ->ArgPair(1, 8)
+ ->ArgPair(1, 10)
+ ->ArgPair(1, 16)
+ ->ArgPair(2, 8)
+ ->ArgPair(2, 10)
+ ->ArgPair(2, 16)
+ ->ArgPair(4, 8)
+ ->ArgPair(4, 10)
+ ->ArgPair(4, 16)
+ ->ArgPair(8, 8)
+ ->ArgPair(8, 10)
+ ->ArgPair(8, 16)
+ ->ArgPair(10, 8)
+ ->ArgPair(9, 10);
+
+void BM_safe_strto64_string(benchmark::State& state) {
+ const int digits = state.range(0);
+ const int base = state.range(1);
+ std::string str(digits, '7'); // valid in octal, decimal and hex
+ int64_t value = 0;
+ for (auto _ : state) {
+ benchmark::DoNotOptimize(
+ absl::numbers_internal::safe_strto64_base(str, &value, base));
+ }
+ ABSL_RAW_CHECK(value == RepeatedSevens(digits, base), "");
+}
+BENCHMARK(BM_safe_strto64_string)
+ ->ArgPair(1, 8)
+ ->ArgPair(1, 10)
+ ->ArgPair(1, 16)
+ ->ArgPair(2, 8)
+ ->ArgPair(2, 10)
+ ->ArgPair(2, 16)
+ ->ArgPair(4, 8)
+ ->ArgPair(4, 10)
+ ->ArgPair(4, 16)
+ ->ArgPair(8, 8)
+ ->ArgPair(8, 10)
+ ->ArgPair(8, 16)
+ ->ArgPair(16, 8)
+ ->ArgPair(16, 10)
+ ->ArgPair(16, 16);
+
+void BM_safe_strtou32_string(benchmark::State& state) {
+ const int digits = state.range(0);
+ const int base = state.range(1);
+ std::string str(digits, '7'); // valid in octal, decimal and hex
+ uint32_t value = 0;
+ for (auto _ : state) {
+ benchmark::DoNotOptimize(
+ absl::numbers_internal::safe_strtou32_base(str, &value, base));
+ }
+ ABSL_RAW_CHECK(value == RepeatedSevens(digits, base), "");
+}
+BENCHMARK(BM_safe_strtou32_string)
+ ->ArgPair(1, 8)
+ ->ArgPair(1, 10)
+ ->ArgPair(1, 16)
+ ->ArgPair(2, 8)
+ ->ArgPair(2, 10)
+ ->ArgPair(2, 16)
+ ->ArgPair(4, 8)
+ ->ArgPair(4, 10)
+ ->ArgPair(4, 16)
+ ->ArgPair(8, 8)
+ ->ArgPair(8, 10)
+ ->ArgPair(8, 16)
+ ->ArgPair(10, 8)
+ ->ArgPair(9, 10);
+
+void BM_safe_strtou64_string(benchmark::State& state) {
+ const int digits = state.range(0);
+ const int base = state.range(1);
+ std::string str(digits, '7'); // valid in octal, decimal and hex
+ uint64_t value = 0;
+ for (auto _ : state) {
+ benchmark::DoNotOptimize(
+ absl::numbers_internal::safe_strtou64_base(str, &value, base));
+ }
+ ABSL_RAW_CHECK(value == RepeatedSevens(digits, base), "");
+}
+BENCHMARK(BM_safe_strtou64_string)
+ ->ArgPair(1, 8)
+ ->ArgPair(1, 10)
+ ->ArgPair(1, 16)
+ ->ArgPair(2, 8)
+ ->ArgPair(2, 10)
+ ->ArgPair(2, 16)
+ ->ArgPair(4, 8)
+ ->ArgPair(4, 10)
+ ->ArgPair(4, 16)
+ ->ArgPair(8, 8)
+ ->ArgPair(8, 10)
+ ->ArgPair(8, 16)
+ ->ArgPair(16, 8)
+ ->ArgPair(16, 10)
+ ->ArgPair(16, 16);
+
+// Returns a vector of `num_strings` strings. Each std::string represents a
+// floating point number with `num_digits` digits before the decimal point and
+// another `num_digits` digits after.
+std::vector<std::string> MakeFloatStrings(int num_strings, int num_digits) {
+ // For convenience, use a random number generator to generate the test data.
+ // We don't actually need random properties, so use a fixed seed.
+ std::minstd_rand0 rng(1);
+ std::uniform_int_distribution<int> random_digit('0', '9');
+
+ std::vector<std::string> float_strings(num_strings);
+ for (std::string& s : float_strings) {
+ s.reserve(2 * num_digits + 1);
+ for (int i = 0; i < num_digits; ++i) {
+ s.push_back(static_cast<char>(random_digit(rng)));
+ }
+ s.push_back('.');
+ for (int i = 0; i < num_digits; ++i) {
+ s.push_back(static_cast<char>(random_digit(rng)));
+ }
+ }
+ return float_strings;
+}
+
+template <typename StringType>
+StringType GetStringAs(const std::string& s) {
+ return static_cast<StringType>(s);
+}
+template <>
+const char* GetStringAs<const char*>(const std::string& s) {
+ return s.c_str();
+}
+
+template <typename StringType>
+std::vector<StringType> GetStringsAs(const std::vector<std::string>& strings) {
+ std::vector<StringType> result;
+ result.reserve(strings.size());
+ for (const std::string& s : strings) {
+ result.push_back(GetStringAs<StringType>(s));
+ }
+ return result;
+}
+
+template <typename T>
+void BM_SimpleAtof(benchmark::State& state) {
+ const int num_strings = state.range(0);
+ const int num_digits = state.range(1);
+ std::vector<std::string> backing_strings =
+ MakeFloatStrings(num_strings, num_digits);
+ std::vector<T> inputs = GetStringsAs<T>(backing_strings);
+ float value;
+ for (auto _ : state) {
+ for (const T& input : inputs) {
+ benchmark::DoNotOptimize(absl::SimpleAtof(input, &value));
+ }
+ }
+}
+BENCHMARK_TEMPLATE(BM_SimpleAtof, absl::string_view)
+ ->ArgPair(10, 1)
+ ->ArgPair(10, 2)
+ ->ArgPair(10, 4)
+ ->ArgPair(10, 8);
+BENCHMARK_TEMPLATE(BM_SimpleAtof, const char*)
+ ->ArgPair(10, 1)
+ ->ArgPair(10, 2)
+ ->ArgPair(10, 4)
+ ->ArgPair(10, 8);
+BENCHMARK_TEMPLATE(BM_SimpleAtof, std::string)
+ ->ArgPair(10, 1)
+ ->ArgPair(10, 2)
+ ->ArgPair(10, 4)
+ ->ArgPair(10, 8);
+
+template <typename T>
+void BM_SimpleAtod(benchmark::State& state) {
+ const int num_strings = state.range(0);
+ const int num_digits = state.range(1);
+ std::vector<std::string> backing_strings =
+ MakeFloatStrings(num_strings, num_digits);
+ std::vector<T> inputs = GetStringsAs<T>(backing_strings);
+ double value;
+ for (auto _ : state) {
+ for (const T& input : inputs) {
+ benchmark::DoNotOptimize(absl::SimpleAtod(input, &value));
+ }
+ }
+}
+BENCHMARK_TEMPLATE(BM_SimpleAtod, absl::string_view)
+ ->ArgPair(10, 1)
+ ->ArgPair(10, 2)
+ ->ArgPair(10, 4)
+ ->ArgPair(10, 8);
+BENCHMARK_TEMPLATE(BM_SimpleAtod, const char*)
+ ->ArgPair(10, 1)
+ ->ArgPair(10, 2)
+ ->ArgPair(10, 4)
+ ->ArgPair(10, 8);
+BENCHMARK_TEMPLATE(BM_SimpleAtod, std::string)
+ ->ArgPair(10, 1)
+ ->ArgPair(10, 2)
+ ->ArgPair(10, 4)
+ ->ArgPair(10, 8);
+
+} // namespace
diff --git a/absl/strings/str_format.h b/absl/strings/str_format.h
new file mode 100644
index 00000000..70a811b7
--- /dev/null
+++ b/absl/strings/str_format.h
@@ -0,0 +1,512 @@
+//
+// Copyright 2018 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+//
+// -----------------------------------------------------------------------------
+// File: str_format.h
+// -----------------------------------------------------------------------------
+//
+// The `str_format` library is a typesafe replacement for the family of
+// `printf()` std::string formatting routines within the `<cstdio>` standard library
+// header. Like the `printf` family, the `str_format` uses a "format string" to
+// perform argument substitutions based on types.
+//
+// Example:
+//
+// std::string s = absl::StrFormat("%s %s You have $%d!", "Hello", name, dollars);
+//
+// The library consists of the following basic utilities:
+//
+// * `absl::StrFormat()`, a type-safe replacement for `std::sprintf()`, to
+// write a format std::string to a `string` value.
+// * `absl::StrAppendFormat()` to append a format std::string to a `string`
+// * `absl::StreamFormat()` to more efficiently write a format std::string to a
+// stream, such as`std::cout`.
+// * `absl::PrintF()`, `absl::FPrintF()` and `absl::SNPrintF()` as
+// replacements for `std::printf()`, `std::fprintf()` and `std::snprintf()`.
+//
+// Note: a version of `std::sprintf()` is not supported as it is
+// generally unsafe due to buffer overflows.
+//
+// Additionally, you can provide a format std::string (and its associated arguments)
+// using one of the following abstractions:
+//
+// * A `FormatSpec` class template fully encapsulates a format std::string and its
+// type arguments and is usually provided to `str_format` functions as a
+// variadic argument of type `FormatSpec<Arg...>`. The `FormatSpec<Args...>`
+// template is evaluated at compile-time, providing type safety.
+// * A `ParsedFormat` instance, which encapsulates a specific, pre-compiled
+// format std::string for a specific set of type(s), and which can be passed
+// between API boundaries. (The `FormatSpec` type should not be used
+// directly.)
+//
+// The `str_format` library provides the ability to output its format strings to
+// arbitrary sink types:
+//
+// * A generic `Format()` function to write outputs to arbitrary sink types,
+// which must implement a `RawSinkFormat` interface. (See
+// `str_format_sink.h` for more information.)
+//
+// * A `FormatUntyped()` function that is similar to `Format()` except it is
+// loosely typed. `FormatUntyped()` is not a template and does not perform
+// any compile-time checking of the format std::string; instead, it returns a
+// boolean from a runtime check.
+//
+// In addition, the `str_format` library provides extension points for
+// augmenting formatting to new types. These extensions are fully documented
+// within the `str_format_extension.h` header file.
+#ifndef ABSL_STRINGS_STR_FORMAT_H_
+#define ABSL_STRINGS_STR_FORMAT_H_
+
+#include <cstdio>
+#include <string>
+
+#include "absl/strings/internal/str_format/arg.h" // IWYU pragma: export
+#include "absl/strings/internal/str_format/bind.h" // IWYU pragma: export
+#include "absl/strings/internal/str_format/checker.h" // IWYU pragma: export
+#include "absl/strings/internal/str_format/extension.h" // IWYU pragma: export
+#include "absl/strings/internal/str_format/parser.h" // IWYU pragma: export
+
+namespace absl {
+
+// UntypedFormatSpec
+//
+// A type-erased class that can be used directly within untyped API entry
+// points. An `UntypedFormatSpec` is specifically used as an argument to
+// `FormatUntyped()`.
+//
+// Example:
+//
+// absl::UntypedFormatSpec format("%d");
+// std::string out;
+// CHECK(absl::FormatUntyped(&out, format, {absl::FormatArg(1)}));
+class UntypedFormatSpec {
+ public:
+ UntypedFormatSpec() = delete;
+ UntypedFormatSpec(const UntypedFormatSpec&) = delete;
+ UntypedFormatSpec& operator=(const UntypedFormatSpec&) = delete;
+
+ explicit UntypedFormatSpec(string_view s) : spec_(s) {}
+
+ protected:
+ explicit UntypedFormatSpec(const str_format_internal::ParsedFormatBase* pc)
+ : spec_(pc) {}
+
+ private:
+ friend str_format_internal::UntypedFormatSpecImpl;
+ str_format_internal::UntypedFormatSpecImpl spec_;
+};
+
+// FormatStreamed()
+//
+// Takes a streamable argument and returns an object that can print it
+// with '%s'. Allows printing of types that have an `operator<<` but no
+// intrinsic type support within `StrFormat()` itself.
+//
+// Example:
+//
+// absl::StrFormat("%s", absl::FormatStreamed(obj));
+template <typename T>
+str_format_internal::StreamedWrapper<T> FormatStreamed(const T& v) {
+ return str_format_internal::StreamedWrapper<T>(v);
+}
+
+// FormatCountCapture
+//
+// This class provides a way to safely wrap `StrFormat()` captures of `%n`
+// conversions, which denote the number of characters written by a formatting
+// operation to this point, into an integer value.
+//
+// This wrapper is designed to allow safe usage of `%n` within `StrFormat(); in
+// the `printf()` family of functions, `%n` is not safe to use, as the `int *`
+// buffer can be used to capture arbitrary data.
+//
+// Example:
+//
+// int n = 0;
+// std::string s = absl::StrFormat("%s%d%n", "hello", 123,
+// absl::FormatCountCapture(&n));
+// EXPECT_EQ(8, n);
+class FormatCountCapture {
+ public:
+ explicit FormatCountCapture(int* p) : p_(p) {}
+
+ private:
+ // FormatCountCaptureHelper is used to define FormatConvertImpl() for this
+ // class.
+ friend struct str_format_internal::FormatCountCaptureHelper;
+ // Unused() is here because of the false positive from -Wunused-private-field
+ // p_ is used in the templated function of the friend FormatCountCaptureHelper
+ // class.
+ int* Unused() { return p_; }
+ int* p_;
+};
+
+// FormatSpec
+//
+// The `FormatSpec` type defines the makeup of a format std::string within the
+// `str_format` library. You should not need to use or manipulate this type
+// directly. A `FormatSpec` is a variadic class template that is evaluated at
+// compile-time, according to the format std::string and arguments that are passed
+// to it.
+//
+// For a `FormatSpec` to be valid at compile-time, it must be provided as
+// either:
+//
+// * A `constexpr` literal or `absl::string_view`, which is how it most often
+// used.
+// * A `ParsedFormat` instantiation, which ensures the format std::string is
+// valid before use. (See below.)
+//
+// Example:
+//
+// // Provided as a std::string literal.
+// absl::StrFormat("Welcome to %s, Number %d!", "The Village", 6);
+//
+// // Provided as a constexpr absl::string_view.
+// constexpr absl::string_view formatString = "Welcome to %s, Number %d!";
+// absl::StrFormat(formatString, "The Village", 6);
+//
+// // Provided as a pre-compiled ParsedFormat object.
+// // Note that this example is useful only for illustration purposes.
+// absl::ParsedFormat<'s', 'd'> formatString("Welcome to %s, Number %d!");
+// absl::StrFormat(formatString, "TheVillage", 6);
+//
+// A format std::string generally follows the POSIX syntax as used within the POSIX
+// `printf` specification.
+//
+// (See http://pubs.opengroup.org/onlinepubs/9699919799/utilities/printf.html.)
+//
+// In specific, the `FormatSpec` supports the following type specifiers:
+// * `c` for characters
+// * `s` for strings
+// * `d` or `i` for integers
+// * `o` for unsigned integer conversions into octal
+// * `x` or `X` for unsigned integer conversions into hex
+// * `u` for unsigned integers
+// * `f` or `F` for floating point values into decimal notation
+// * `e` or `E` for floating point values into exponential notation
+// * `a` or `A` for floating point values into hex exponential notation
+// * `g` or `G` for floating point values into decimal or exponential
+// notation based on their precision
+// * `p` for pointer address values
+// * `n` for the special case of writing out the number of characters
+// written to this point. The resulting value must be captured within an
+// `absl::FormatCountCapture` type.
+//
+// NOTE: `o`, `x\X` and `u` will convert signed values to their unsigned
+// counterpart before formatting.
+//
+// Examples:
+// "%c", 'a' -> "a"
+// "%c", 32 -> " "
+// "%s", "C" -> "C"
+// "%s", std::string("C++") -> "C++"
+// "%d", -10 -> "-10"
+// "%o", 10 -> "12"
+// "%x", 16 -> "10"
+// "%f", 123456789 -> "123456789.000000"
+// "%e", .01 -> "1.00000e-2"
+// "%a", -3.0 -> "-0x1.8p+1"
+// "%g", .01 -> "1e-2"
+// "%p", *int -> "0x7ffdeb6ad2a4"
+//
+// int n = 0;
+// std::string s = absl::StrFormat(
+// "%s%d%n", "hello", 123, absl::FormatCountCapture(&n));
+// EXPECT_EQ(8, n);
+//
+// The `FormatSpec` intrinsically supports all of these fundamental C++ types:
+//
+// * Characters: `char`, `signed char`, `unsigned char`
+// * Integers: `int`, `short`, `unsigned short`, `unsigned`, `long`,
+// `unsigned long`, `long long`, `unsigned long long`
+// * Floating-point: `float`, `double`, `long double`
+//
+// However, in the `str_format` library, a format conversion specifies a broader
+// C++ conceptual category instead of an exact type. For example, `%s` binds to
+// any std::string-like argument, so `std::string`, `absl::string_view`, and
+// `const char*` are all accepted. Likewise, `%d` accepts any integer-like
+// argument, etc.
+
+template <typename... Args>
+using FormatSpec =
+ typename str_format_internal::FormatSpecDeductionBarrier<Args...>::type;
+
+// ParsedFormat
+//
+// A `ParsedFormat` is a class template representing a preparsed `FormatSpec`,
+// with template arguments specifying the conversion characters used within the
+// format std::string. Such characters must be valid format type specifiers, and
+// these type specifiers are checked at compile-time.
+//
+// Instances of `ParsedFormat` can be created, copied, and reused to speed up
+// formatting loops. A `ParsedFormat` may either be constructed statically, or
+// dynamically through its `New()` factory function, which only constructs a
+// runtime object if the format is valid at that time.
+//
+// Example:
+//
+// // Verified at compile time.
+// absl::ParsedFormat<'s', 'd'> formatString("Welcome to %s, Number %d!");
+// absl::StrFormat(formatString, "TheVillage", 6);
+//
+// // Verified at runtime.
+// auto format_runtime = absl::ParsedFormat<'d'>::New(format_string);
+// if (format_runtime) {
+// value = absl::StrFormat(*format_runtime, i);
+// } else {
+// ... error case ...
+// }
+template <char... Conv>
+using ParsedFormat = str_format_internal::ExtendedParsedFormat<
+ str_format_internal::ConversionCharToConv(Conv)...>;
+
+// StrFormat()
+//
+// Returns a `string` given a `printf()`-style format std::string and zero or more
+// additional arguments. Use it as you would `sprintf()`. `StrFormat()` is the
+// primary formatting function within the `str_format` library, and should be
+// used in most cases where you need type-safe conversion of types into
+// formatted strings.
+//
+// The format std::string generally consists of ordinary character data along with
+// one or more format conversion specifiers (denoted by the `%` character).
+// Ordinary character data is returned unchanged into the result std::string, while
+// each conversion specification performs a type substitution from
+// `StrFormat()`'s other arguments. See the comments for `FormatSpec` for full
+// information on the makeup of this format std::string.
+//
+// Example:
+//
+// std::string s = absl::StrFormat(
+// "Welcome to %s, Number %d!", "The Village", 6);
+// EXPECT_EQ("Welcome to The Village, Number 6!", s);
+//
+// Returns an empty std::string in case of error.
+template <typename... Args>
+ABSL_MUST_USE_RESULT std::string StrFormat(const FormatSpec<Args...>& format,
+ const Args&... args) {
+ return str_format_internal::FormatPack(
+ str_format_internal::UntypedFormatSpecImpl::Extract(format),
+ {str_format_internal::FormatArgImpl(args)...});
+}
+
+// StrAppendFormat()
+//
+// Appends to a `dst` std::string given a format std::string, and zero or more additional
+// arguments, returning `*dst` as a convenience for chaining purposes. Appends
+// nothing in case of error (but possibly alters its capacity).
+//
+// Example:
+//
+// std::string orig("For example PI is approximately ");
+// std::cout << StrAppendFormat(&orig, "%12.6f", 3.14);
+template <typename... Args>
+std::string& StrAppendFormat(std::string* dst, const FormatSpec<Args...>& format,
+ const Args&... args) {
+ return str_format_internal::AppendPack(
+ dst, str_format_internal::UntypedFormatSpecImpl::Extract(format),
+ {str_format_internal::FormatArgImpl(args)...});
+}
+
+// StreamFormat()
+//
+// Writes to an output stream given a format std::string and zero or more arguments,
+// generally in a manner that is more efficient than streaming the result of
+// `absl:: StrFormat()`. The returned object must be streamed before the full
+// expression ends.
+//
+// Example:
+//
+// std::cout << StreamFormat("%12.6f", 3.14);
+template <typename... Args>
+ABSL_MUST_USE_RESULT str_format_internal::Streamable StreamFormat(
+ const FormatSpec<Args...>& format, const Args&... args) {
+ return str_format_internal::Streamable(
+ str_format_internal::UntypedFormatSpecImpl::Extract(format),
+ {str_format_internal::FormatArgImpl(args)...});
+}
+
+// PrintF()
+//
+// Writes to stdout given a format std::string and zero or more arguments. This
+// function is functionally equivalent to `std::printf()` (and type-safe);
+// prefer `absl::PrintF()` over `std::printf()`.
+//
+// Example:
+//
+// std::string_view s = "Ulaanbaatar";
+// absl::PrintF("The capital of Mongolia is %s", s);
+//
+// Outputs: "The capital of Mongolia is Ulaanbaatar"
+//
+template <typename... Args>
+int PrintF(const FormatSpec<Args...>& format, const Args&... args) {
+ return str_format_internal::FprintF(
+ stdout, str_format_internal::UntypedFormatSpecImpl::Extract(format),
+ {str_format_internal::FormatArgImpl(args)...});
+}
+
+// FPrintF()
+//
+// Writes to a file given a format std::string and zero or more arguments. This
+// function is functionally equivalent to `std::fprintf()` (and type-safe);
+// prefer `absl::FPrintF()` over `std::fprintf()`.
+//
+// Example:
+//
+// std::string_view s = "Ulaanbaatar";
+// absl::FPrintF("The capital of Mongolia is %s", s);
+//
+// Outputs: "The capital of Mongolia is Ulaanbaatar"
+//
+template <typename... Args>
+int FPrintF(std::FILE* output, const FormatSpec<Args...>& format,
+ const Args&... args) {
+ return str_format_internal::FprintF(
+ output, str_format_internal::UntypedFormatSpecImpl::Extract(format),
+ {str_format_internal::FormatArgImpl(args)...});
+}
+
+// SNPrintF()
+//
+// Writes to a sized buffer given a format std::string and zero or more arguments.
+// This function is functionally equivalent to `std::snprintf()` (and
+// type-safe); prefer `absl::SNPrintF()` over `std::snprintf()`.
+//
+// Example:
+//
+// std::string_view s = "Ulaanbaatar";
+// char output[128];
+// absl::SNPrintF(output, sizeof(output),
+// "The capital of Mongolia is %s", s);
+//
+// Post-condition: output == "The capital of Mongolia is Ulaanbaatar"
+//
+template <typename... Args>
+int SNPrintF(char* output, std::size_t size, const FormatSpec<Args...>& format,
+ const Args&... args) {
+ return str_format_internal::SnprintF(
+ output, size, str_format_internal::UntypedFormatSpecImpl::Extract(format),
+ {str_format_internal::FormatArgImpl(args)...});
+}
+
+// -----------------------------------------------------------------------------
+// Custom Output Formatting Functions
+// -----------------------------------------------------------------------------
+
+// FormatRawSink
+//
+// FormatRawSink is a type erased wrapper around arbitrary sink objects
+// specifically used as an argument to `Format()`.
+// FormatRawSink does not own the passed sink object. The passed object must
+// outlive the FormatRawSink.
+class FormatRawSink {
+ public:
+ // Implicitly convert from any type that provides the hook function as
+ // described above.
+ template <typename T,
+ typename = typename std::enable_if<std::is_constructible<
+ str_format_internal::FormatRawSinkImpl, T*>::value>::type>
+ FormatRawSink(T* raw) // NOLINT
+ : sink_(raw) {}
+
+ private:
+ friend str_format_internal::FormatRawSinkImpl;
+ str_format_internal::FormatRawSinkImpl sink_;
+};
+
+// Format()
+//
+// Writes a formatted std::string to an arbitrary sink object (implementing the
+// `absl::FormatRawSink` interface), using a format std::string and zero or more
+// additional arguments.
+//
+// By default, `string` and `std::ostream` are supported as destination objects.
+//
+// `absl::Format()` is a generic version of `absl::StrFormat(), for custom
+// sinks. The format std::string, like format strings for `StrFormat()`, is checked
+// at compile-time.
+//
+// On failure, this function returns `false` and the state of the sink is
+// unspecified.
+template <typename... Args>
+bool Format(FormatRawSink raw_sink, const FormatSpec<Args...>& format,
+ const Args&... args) {
+ return str_format_internal::FormatUntyped(
+ str_format_internal::FormatRawSinkImpl::Extract(raw_sink),
+ str_format_internal::UntypedFormatSpecImpl::Extract(format),
+ {str_format_internal::FormatArgImpl(args)...});
+}
+
+// FormatArg
+//
+// A type-erased handle to a format argument specifically used as an argument to
+// `FormatUntyped()`. You may construct `FormatArg` by passing
+// reference-to-const of any printable type. `FormatArg` is both copyable and
+// assignable. The source data must outlive the `FormatArg` instance. See
+// example below.
+//
+using FormatArg = str_format_internal::FormatArgImpl;
+
+// FormatUntyped()
+//
+// Writes a formatted std::string to an arbitrary sink object (implementing the
+// `absl::FormatRawSink` interface), using an `UntypedFormatSpec` and zero or
+// more additional arguments.
+//
+// This function acts as the most generic formatting function in the
+// `str_format` library. The caller provides a raw sink, an unchecked format
+// std::string, and (usually) a runtime specified list of arguments; no compile-time
+// checking of formatting is performed within this function. As a result, a
+// caller should check the return value to verify that no error occurred.
+// On failure, this function returns `false` and the state of the sink is
+// unspecified.
+//
+// The arguments are provided in an `absl::Span<const absl::FormatArg>`.
+// Each `absl::FormatArg` object binds to a single argument and keeps a
+// reference to it. The values used to create the `FormatArg` objects must
+// outlive this function call. (See `str_format_arg.h` for information on
+// the `FormatArg` class.)_
+//
+// Example:
+//
+// std::optional<std::string> FormatDynamic(const std::string& in_format,
+// const vector<std::string>& in_args) {
+// std::string out;
+// std::vector<absl::FormatArg> args;
+// for (const auto& v : in_args) {
+// // It is important that 'v' is a reference to the objects in in_args.
+// // The values we pass to FormatArg must outlive the call to
+// // FormatUntyped.
+// args.emplace_back(v);
+// }
+// absl::UntypedFormatSpec format(in_format);
+// if (!absl::FormatUntyped(&out, format, args)) {
+// return std::nullopt;
+// }
+// return std::move(out);
+// }
+//
+ABSL_MUST_USE_RESULT inline bool FormatUntyped(
+ FormatRawSink raw_sink, const UntypedFormatSpec& format,
+ absl::Span<const FormatArg> args) {
+ return str_format_internal::FormatUntyped(
+ str_format_internal::FormatRawSinkImpl::Extract(raw_sink),
+ str_format_internal::UntypedFormatSpecImpl::Extract(format), args);
+}
+
+} // namespace absl
+#endif // ABSL_STRINGS_STR_FORMAT_H_
diff --git a/absl/strings/str_format_test.cc b/absl/strings/str_format_test.cc
new file mode 100644
index 00000000..fed75faf
--- /dev/null
+++ b/absl/strings/str_format_test.cc
@@ -0,0 +1,603 @@
+
+#include <cstdarg>
+#include <cstdint>
+#include <cstdio>
+#include <string>
+
+#include "gmock/gmock.h"
+#include "gtest/gtest.h"
+#include "absl/strings/str_format.h"
+#include "absl/strings/string_view.h"
+
+namespace absl {
+namespace {
+using str_format_internal::FormatArgImpl;
+
+class FormatEntryPointTest : public ::testing::Test { };
+
+TEST_F(FormatEntryPointTest, Format) {
+ std::string sink;
+ EXPECT_TRUE(Format(&sink, "A format %d", 123));
+ EXPECT_EQ("A format 123", sink);
+ sink.clear();
+
+ ParsedFormat<'d'> pc("A format %d");
+ EXPECT_TRUE(Format(&sink, pc, 123));
+ EXPECT_EQ("A format 123", sink);
+}
+TEST_F(FormatEntryPointTest, UntypedFormat) {
+ constexpr const char* formats[] = {
+ "",
+ "a",
+ "%80d",
+#if !defined(_MSC_VER) && !defined(__ANDROID__)
+ // MSVC and Android don't support positional syntax.
+ "complicated multipart %% %1$d format %1$0999d",
+#endif // _MSC_VER
+ };
+ for (const char* fmt : formats) {
+ std::string actual;
+ int i = 123;
+ FormatArgImpl arg_123(i);
+ absl::Span<const FormatArgImpl> args(&arg_123, 1);
+ UntypedFormatSpec format(fmt);
+
+ EXPECT_TRUE(FormatUntyped(&actual, format, args));
+ char buf[4096]{};
+ snprintf(buf, sizeof(buf), fmt, 123);
+ EXPECT_EQ(
+ str_format_internal::FormatPack(
+ str_format_internal::UntypedFormatSpecImpl::Extract(format), args),
+ buf);
+ EXPECT_EQ(actual, buf);
+ }
+ // The internal version works with a preparsed format.
+ ParsedFormat<'d'> pc("A format %d");
+ int i = 345;
+ FormatArg arg(i);
+ std::string out;
+ EXPECT_TRUE(str_format_internal::FormatUntyped(
+ &out, str_format_internal::UntypedFormatSpecImpl(&pc), {&arg, 1}));
+ EXPECT_EQ("A format 345", out);
+}
+
+TEST_F(FormatEntryPointTest, StringFormat) {
+ EXPECT_EQ("123", StrFormat("%d", 123));
+ constexpr absl::string_view view("=%d=", 4);
+ EXPECT_EQ("=123=", StrFormat(view, 123));
+}
+
+TEST_F(FormatEntryPointTest, AppendFormat) {
+ std::string s;
+ std::string& r = StrAppendFormat(&s, "%d", 123);
+ EXPECT_EQ(&s, &r); // should be same object
+ EXPECT_EQ("123", r);
+}
+
+TEST_F(FormatEntryPointTest, AppendFormatFail) {
+ std::string s = "orig";
+
+ UntypedFormatSpec format(" more %d");
+ FormatArgImpl arg("not an int");
+
+ EXPECT_EQ("orig",
+ str_format_internal::AppendPack(
+ &s, str_format_internal::UntypedFormatSpecImpl::Extract(format),
+ {&arg, 1}));
+}
+
+
+TEST_F(FormatEntryPointTest, ManyArgs) {
+ EXPECT_EQ("24", StrFormat("%24$d", 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13,
+ 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24));
+ EXPECT_EQ("60", StrFormat("%60$d", 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13,
+ 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26,
+ 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39,
+ 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52,
+ 53, 54, 55, 56, 57, 58, 59, 60));
+}
+
+TEST_F(FormatEntryPointTest, Preparsed) {
+ ParsedFormat<'d'> pc("%d");
+ EXPECT_EQ("123", StrFormat(pc, 123));
+ // rvalue ok?
+ EXPECT_EQ("123", StrFormat(ParsedFormat<'d'>("%d"), 123));
+ constexpr absl::string_view view("=%d=", 4);
+ EXPECT_EQ("=123=", StrFormat(ParsedFormat<'d'>(view), 123));
+}
+
+TEST_F(FormatEntryPointTest, FormatCountCapture) {
+ int n = 0;
+ EXPECT_EQ("", StrFormat("%n", FormatCountCapture(&n)));
+ EXPECT_EQ(0, n);
+ EXPECT_EQ("123", StrFormat("%d%n", 123, FormatCountCapture(&n)));
+ EXPECT_EQ(3, n);
+}
+
+TEST_F(FormatEntryPointTest, FormatCountCaptureWrongType) {
+ // Should reject int*.
+ int n = 0;
+ UntypedFormatSpec format("%d%n");
+ int i = 123, *ip = &n;
+ FormatArgImpl args[2] = {FormatArgImpl(i), FormatArgImpl(ip)};
+
+ EXPECT_EQ("", str_format_internal::FormatPack(
+ str_format_internal::UntypedFormatSpecImpl::Extract(format),
+ absl::MakeSpan(args)));
+}
+
+TEST_F(FormatEntryPointTest, FormatCountCaptureMultiple) {
+ int n1 = 0;
+ int n2 = 0;
+ EXPECT_EQ(" 1 2",
+ StrFormat("%5d%n%10d%n", 1, FormatCountCapture(&n1), 2,
+ FormatCountCapture(&n2)));
+ EXPECT_EQ(5, n1);
+ EXPECT_EQ(15, n2);
+}
+
+TEST_F(FormatEntryPointTest, FormatCountCaptureExample) {
+ int n;
+ std::string s;
+ StrAppendFormat(&s, "%s: %n%s\n", "(1,1)", FormatCountCapture(&n), "(1,2)");
+ StrAppendFormat(&s, "%*s%s\n", n, "", "(2,2)");
+ EXPECT_EQ(7, n);
+ EXPECT_EQ(
+ "(1,1): (1,2)\n"
+ " (2,2)\n",
+ s);
+}
+
+TEST_F(FormatEntryPointTest, Stream) {
+ const std::string formats[] = {
+ "",
+ "a",
+ "%80d",
+#if !defined(_MSC_VER) && !defined(__ANDROID__)
+ // MSVC doesn't support positional syntax.
+ "complicated multipart %% %1$d format %1$080d",
+#endif // _MSC_VER
+ };
+ std::string buf(4096, '\0');
+ for (const auto& fmt : formats) {
+ const auto parsed = ParsedFormat<'d'>::NewAllowIgnored(fmt);
+ std::ostringstream oss;
+ oss << StreamFormat(*parsed, 123);
+ int fmt_result = snprintf(&*buf.begin(), buf.size(), fmt.c_str(), 123);
+ ASSERT_TRUE(oss) << fmt;
+ ASSERT_TRUE(fmt_result >= 0 && static_cast<size_t>(fmt_result) < buf.size())
+ << fmt_result;
+ EXPECT_EQ(buf.c_str(), oss.str());
+ }
+}
+
+TEST_F(FormatEntryPointTest, StreamOk) {
+ std::ostringstream oss;
+ oss << StreamFormat("hello %d", 123);
+ EXPECT_EQ("hello 123", oss.str());
+ EXPECT_TRUE(oss.good());
+}
+
+TEST_F(FormatEntryPointTest, StreamFail) {
+ std::ostringstream oss;
+ UntypedFormatSpec format("hello %d");
+ FormatArgImpl arg("non-numeric");
+ oss << str_format_internal::Streamable(
+ str_format_internal::UntypedFormatSpecImpl::Extract(format), {&arg, 1});
+ EXPECT_EQ("hello ", oss.str()); // partial write
+ EXPECT_TRUE(oss.fail());
+}
+
+std::string WithSnprintf(const char* fmt, ...) {
+ std::string buf;
+ buf.resize(128);
+ va_list va;
+ va_start(va, fmt);
+ int r = vsnprintf(&*buf.begin(), buf.size(), fmt, va);
+ va_end(va);
+ EXPECT_GE(r, 0);
+ EXPECT_LT(r, buf.size());
+ buf.resize(r);
+ return buf;
+}
+
+TEST_F(FormatEntryPointTest, FloatPrecisionArg) {
+ // Test that positional parameters for width and precision
+ // are indexed to precede the value.
+ // Also sanity check the same formats against snprintf.
+ EXPECT_EQ("0.1", StrFormat("%.1f", 0.1));
+ EXPECT_EQ("0.1", WithSnprintf("%.1f", 0.1));
+ EXPECT_EQ(" 0.1", StrFormat("%*.1f", 5, 0.1));
+ EXPECT_EQ(" 0.1", WithSnprintf("%*.1f", 5, 0.1));
+ EXPECT_EQ("0.1", StrFormat("%.*f", 1, 0.1));
+ EXPECT_EQ("0.1", WithSnprintf("%.*f", 1, 0.1));
+ EXPECT_EQ(" 0.1", StrFormat("%*.*f", 5, 1, 0.1));
+ EXPECT_EQ(" 0.1", WithSnprintf("%*.*f", 5, 1, 0.1));
+}
+namespace streamed_test {
+struct X {};
+std::ostream& operator<<(std::ostream& os, const X&) {
+ return os << "X";
+}
+} // streamed_test
+
+TEST_F(FormatEntryPointTest, FormatStreamed) {
+ EXPECT_EQ("123", StrFormat("%s", FormatStreamed(123)));
+ EXPECT_EQ(" 123", StrFormat("%5s", FormatStreamed(123)));
+ EXPECT_EQ("123 ", StrFormat("%-5s", FormatStreamed(123)));
+ EXPECT_EQ("X", StrFormat("%s", FormatStreamed(streamed_test::X())));
+ EXPECT_EQ("123", StrFormat("%s", FormatStreamed(StreamFormat("%d", 123))));
+}
+
+// Helper class that creates a temporary file and exposes a FILE* to it.
+// It will close the file on destruction.
+class TempFile {
+ public:
+ TempFile() : file_(std::tmpfile()) {}
+ ~TempFile() { std::fclose(file_); }
+
+ std::FILE* file() const { return file_; }
+
+ // Read the file into a std::string.
+ std::string ReadFile() {
+ std::fseek(file_, 0, SEEK_END);
+ int size = std::ftell(file_);
+ std::rewind(file_);
+ std::string str(2 * size, ' ');
+ int read_bytes = std::fread(&str[0], 1, str.size(), file_);
+ EXPECT_EQ(read_bytes, size);
+ str.resize(read_bytes);
+ EXPECT_TRUE(std::feof(file_));
+ return str;
+ }
+
+ private:
+ std::FILE* file_;
+};
+
+TEST_F(FormatEntryPointTest, FPrintF) {
+ TempFile tmp;
+ int result =
+ FPrintF(tmp.file(), "STRING: %s NUMBER: %010d", std::string("ABC"), -19);
+ EXPECT_EQ(result, 30);
+ EXPECT_EQ(tmp.ReadFile(), "STRING: ABC NUMBER: -000000019");
+}
+
+TEST_F(FormatEntryPointTest, FPrintFError) {
+ errno = 0;
+ int result = FPrintF(stdin, "ABC");
+ EXPECT_LT(result, 0);
+ EXPECT_EQ(errno, EBADF);
+}
+
+#if __GNUC__
+TEST_F(FormatEntryPointTest, FprintfTooLarge) {
+ std::FILE* f = std::fopen("/dev/null", "w");
+ int width = 2000000000;
+ errno = 0;
+ int result = FPrintF(f, "%*d %*d", width, 0, width, 0);
+ EXPECT_LT(result, 0);
+ EXPECT_EQ(errno, EFBIG);
+ std::fclose(f);
+}
+
+TEST_F(FormatEntryPointTest, PrintF) {
+ int stdout_tmp = dup(STDOUT_FILENO);
+
+ TempFile tmp;
+ std::fflush(stdout);
+ dup2(fileno(tmp.file()), STDOUT_FILENO);
+
+ int result = PrintF("STRING: %s NUMBER: %010d", std::string("ABC"), -19);
+
+ std::fflush(stdout);
+ dup2(stdout_tmp, STDOUT_FILENO);
+ close(stdout_tmp);
+
+ EXPECT_EQ(result, 30);
+ EXPECT_EQ(tmp.ReadFile(), "STRING: ABC NUMBER: -000000019");
+}
+#endif // __GNUC__
+
+TEST_F(FormatEntryPointTest, SNPrintF) {
+ char buffer[16];
+ int result =
+ SNPrintF(buffer, sizeof(buffer), "STRING: %s", std::string("ABC"));
+ EXPECT_EQ(result, 11);
+ EXPECT_EQ(std::string(buffer), "STRING: ABC");
+
+ result = SNPrintF(buffer, sizeof(buffer), "NUMBER: %d", 123456);
+ EXPECT_EQ(result, 14);
+ EXPECT_EQ(std::string(buffer), "NUMBER: 123456");
+
+ result = SNPrintF(buffer, sizeof(buffer), "NUMBER: %d", 1234567);
+ EXPECT_EQ(result, 15);
+ EXPECT_EQ(std::string(buffer), "NUMBER: 1234567");
+
+ result = SNPrintF(buffer, sizeof(buffer), "NUMBER: %d", 12345678);
+ EXPECT_EQ(result, 16);
+ EXPECT_EQ(std::string(buffer), "NUMBER: 1234567");
+
+ result = SNPrintF(buffer, sizeof(buffer), "NUMBER: %d", 123456789);
+ EXPECT_EQ(result, 17);
+ EXPECT_EQ(std::string(buffer), "NUMBER: 1234567");
+
+ result = SNPrintF(nullptr, 0, "Just checking the %s of the output.", "size");
+ EXPECT_EQ(result, 37);
+}
+
+TEST(StrFormat, BehavesAsDocumented) {
+ std::string s = absl::StrFormat("%s, %d!", "Hello", 123);
+ EXPECT_EQ("Hello, 123!", s);
+ // The format of a replacement is
+ // '%'[position][flags][width['.'precision]][length_modifier][format]
+ EXPECT_EQ(absl::StrFormat("%1$+3.2Lf", 1.1), "+1.10");
+ // Text conversion:
+ // "c" - Character. Eg: 'a' -> "A", 20 -> " "
+ EXPECT_EQ(StrFormat("%c", 'a'), "a");
+ EXPECT_EQ(StrFormat("%c", 0x20), " ");
+ // Formats char and integral types: int, long, uint64_t, etc.
+ EXPECT_EQ(StrFormat("%c", int{'a'}), "a");
+ EXPECT_EQ(StrFormat("%c", long{'a'}), "a"); // NOLINT
+ EXPECT_EQ(StrFormat("%c", uint64_t{'a'}), "a");
+ // "s" - std::string Eg: "C" -> "C", std::string("C++") -> "C++"
+ // Formats std::string, char*, string_view, and Cord.
+ EXPECT_EQ(StrFormat("%s", "C"), "C");
+ EXPECT_EQ(StrFormat("%s", std::string("C++")), "C++");
+ EXPECT_EQ(StrFormat("%s", string_view("view")), "view");
+ // Integral Conversion
+ // These format integral types: char, int, long, uint64_t, etc.
+ EXPECT_EQ(StrFormat("%d", char{10}), "10");
+ EXPECT_EQ(StrFormat("%d", int{10}), "10");
+ EXPECT_EQ(StrFormat("%d", long{10}), "10"); // NOLINT
+ EXPECT_EQ(StrFormat("%d", uint64_t{10}), "10");
+ // d,i - signed decimal Eg: -10 -> "-10"
+ EXPECT_EQ(StrFormat("%d", -10), "-10");
+ EXPECT_EQ(StrFormat("%i", -10), "-10");
+ // o - octal Eg: 10 -> "12"
+ EXPECT_EQ(StrFormat("%o", 10), "12");
+ // u - unsigned decimal Eg: 10 -> "10"
+ EXPECT_EQ(StrFormat("%u", 10), "10");
+ // x/X - lower,upper case hex Eg: 10 -> "a"/"A"
+ EXPECT_EQ(StrFormat("%x", 10), "a");
+ EXPECT_EQ(StrFormat("%X", 10), "A");
+ // Floating-point, with upper/lower-case output.
+ // These format floating points types: float, double, long double, etc.
+ EXPECT_EQ(StrFormat("%.1f", float{1}), "1.0");
+ EXPECT_EQ(StrFormat("%.1f", double{1}), "1.0");
+ const long double long_double = 1.0;
+ EXPECT_EQ(StrFormat("%.1f", long_double), "1.0");
+ // These also format integral types: char, int, long, uint64_t, etc.:
+ EXPECT_EQ(StrFormat("%.1f", char{1}), "1.0");
+ EXPECT_EQ(StrFormat("%.1f", int{1}), "1.0");
+ EXPECT_EQ(StrFormat("%.1f", long{1}), "1.0"); // NOLINT
+ EXPECT_EQ(StrFormat("%.1f", uint64_t{1}), "1.0");
+ // f/F - decimal. Eg: 123456789 -> "123456789.000000"
+ EXPECT_EQ(StrFormat("%f", 123456789), "123456789.000000");
+ EXPECT_EQ(StrFormat("%F", 123456789), "123456789.000000");
+ // e/E - exponentiated Eg: .01 -> "1.00000e-2"/"1.00000E-2"
+ EXPECT_EQ(StrFormat("%e", .01), "1.000000e-02");
+ EXPECT_EQ(StrFormat("%E", .01), "1.000000E-02");
+ // g/G - exponentiate to fit Eg: .01 -> "0.01", 1e10 ->"1e+10"/"1E+10"
+ EXPECT_EQ(StrFormat("%g", .01), "0.01");
+ EXPECT_EQ(StrFormat("%g", 1e10), "1e+10");
+ EXPECT_EQ(StrFormat("%G", 1e10), "1E+10");
+ // a/A - lower,upper case hex Eg: -3.0 -> "-0x1.8p+1"/"-0X1.8P+1"
+
+// On Android platform <=21, there is a regression in hexfloat formatting.
+#if !defined(__ANDROID_API__) || __ANDROID_API__ > 21
+ EXPECT_EQ(StrFormat("%.1a", -3.0), "-0x1.8p+1"); // .1 to fix MSVC output
+ EXPECT_EQ(StrFormat("%.1A", -3.0), "-0X1.8P+1"); // .1 to fix MSVC output
+#endif
+
+ // Other conversion
+ int64_t value = 0x7ffdeb6;
+ auto ptr_value = static_cast<uintptr_t>(value);
+ const int& something = *reinterpret_cast<const int*>(ptr_value);
+ EXPECT_EQ(StrFormat("%p", &something), StrFormat("0x%x", ptr_value));
+
+ // Output widths are supported, with optional flags.
+ EXPECT_EQ(StrFormat("%3d", 1), " 1");
+ EXPECT_EQ(StrFormat("%3d", 123456), "123456");
+ EXPECT_EQ(StrFormat("%06.2f", 1.234), "001.23");
+ EXPECT_EQ(StrFormat("%+d", 1), "+1");
+ EXPECT_EQ(StrFormat("% d", 1), " 1");
+ EXPECT_EQ(StrFormat("%-4d", -1), "-1 ");
+ EXPECT_EQ(StrFormat("%#o", 10), "012");
+ EXPECT_EQ(StrFormat("%#x", 15), "0xf");
+ EXPECT_EQ(StrFormat("%04d", 8), "0008");
+ // Posix positional substitution.
+ EXPECT_EQ(absl::StrFormat("%2$s, %3$s, %1$s!", "vici", "veni", "vidi"),
+ "veni, vidi, vici!");
+ // Length modifiers are ignored.
+ EXPECT_EQ(StrFormat("%hhd", int{1}), "1");
+ EXPECT_EQ(StrFormat("%hd", int{1}), "1");
+ EXPECT_EQ(StrFormat("%ld", int{1}), "1");
+ EXPECT_EQ(StrFormat("%lld", int{1}), "1");
+ EXPECT_EQ(StrFormat("%Ld", int{1}), "1");
+ EXPECT_EQ(StrFormat("%jd", int{1}), "1");
+ EXPECT_EQ(StrFormat("%zd", int{1}), "1");
+ EXPECT_EQ(StrFormat("%td", int{1}), "1");
+ EXPECT_EQ(StrFormat("%qd", int{1}), "1");
+}
+
+using str_format_internal::ExtendedParsedFormat;
+using str_format_internal::ParsedFormatBase;
+
+struct SummarizeConsumer {
+ std::string* out;
+ explicit SummarizeConsumer(std::string* out) : out(out) {}
+
+ bool Append(string_view s) {
+ *out += "[" + std::string(s) + "]";
+ return true;
+ }
+
+ bool ConvertOne(const str_format_internal::UnboundConversion& conv,
+ string_view s) {
+ *out += "{";
+ *out += std::string(s);
+ *out += ":";
+ *out += std::to_string(conv.arg_position) + "$";
+ if (conv.width.is_from_arg()) {
+ *out += std::to_string(conv.width.get_from_arg()) + "$*";
+ }
+ if (conv.precision.is_from_arg()) {
+ *out += "." + std::to_string(conv.precision.get_from_arg()) + "$*";
+ }
+ *out += conv.conv.Char();
+ *out += "}";
+ return true;
+ }
+};
+
+std::string SummarizeParsedFormat(const ParsedFormatBase& pc) {
+ std::string out;
+ if (!pc.ProcessFormat(SummarizeConsumer(&out))) out += "!";
+ return out;
+}
+
+class ParsedFormatTest : public testing::Test {};
+
+TEST_F(ParsedFormatTest, SimpleChecked) {
+ EXPECT_EQ("[ABC]{d:1$d}[DEF]",
+ SummarizeParsedFormat(ParsedFormat<'d'>("ABC%dDEF")));
+ EXPECT_EQ("{s:1$s}[FFF]{d:2$d}[ZZZ]{f:3$f}",
+ SummarizeParsedFormat(ParsedFormat<'s', 'd', 'f'>("%sFFF%dZZZ%f")));
+ EXPECT_EQ("{s:1$s}[ ]{.*d:3$.2$*d}",
+ SummarizeParsedFormat(ParsedFormat<'s', '*', 'd'>("%s %.*d")));
+}
+
+TEST_F(ParsedFormatTest, SimpleUncheckedCorrect) {
+ auto f = ParsedFormat<'d'>::New("ABC%dDEF");
+ ASSERT_TRUE(f);
+ EXPECT_EQ("[ABC]{d:1$d}[DEF]", SummarizeParsedFormat(*f));
+
+ std::string format = "%sFFF%dZZZ%f";
+ auto f2 = ParsedFormat<'s', 'd', 'f'>::New(format);
+
+ ASSERT_TRUE(f2);
+ EXPECT_EQ("{s:1$s}[FFF]{d:2$d}[ZZZ]{f:3$f}", SummarizeParsedFormat(*f2));
+
+ f2 = ParsedFormat<'s', 'd', 'f'>::New("%s %d %f");
+
+ ASSERT_TRUE(f2);
+ EXPECT_EQ("{s:1$s}[ ]{d:2$d}[ ]{f:3$f}", SummarizeParsedFormat(*f2));
+
+ auto star = ParsedFormat<'*', 'd'>::New("%*d");
+ ASSERT_TRUE(star);
+ EXPECT_EQ("{*d:2$1$*d}", SummarizeParsedFormat(*star));
+
+ auto dollar = ParsedFormat<'d', 's'>::New("%2$s %1$d");
+ ASSERT_TRUE(dollar);
+ EXPECT_EQ("{2$s:2$s}[ ]{1$d:1$d}", SummarizeParsedFormat(*dollar));
+ // with reuse
+ dollar = ParsedFormat<'d', 's'>::New("%2$s %1$d %1$d");
+ ASSERT_TRUE(dollar);
+ EXPECT_EQ("{2$s:2$s}[ ]{1$d:1$d}[ ]{1$d:1$d}",
+ SummarizeParsedFormat(*dollar));
+}
+
+TEST_F(ParsedFormatTest, SimpleUncheckedIgnoredArgs) {
+ EXPECT_FALSE((ParsedFormat<'d', 's'>::New("ABC")));
+ EXPECT_FALSE((ParsedFormat<'d', 's'>::New("%dABC")));
+ EXPECT_FALSE((ParsedFormat<'d', 's'>::New("ABC%2$s")));
+ auto f = ParsedFormat<'d', 's'>::NewAllowIgnored("ABC");
+ ASSERT_TRUE(f);
+ EXPECT_EQ("[ABC]", SummarizeParsedFormat(*f));
+ f = ParsedFormat<'d', 's'>::NewAllowIgnored("%dABC");
+ ASSERT_TRUE(f);
+ EXPECT_EQ("{d:1$d}[ABC]", SummarizeParsedFormat(*f));
+ f = ParsedFormat<'d', 's'>::NewAllowIgnored("ABC%2$s");
+ ASSERT_TRUE(f);
+ EXPECT_EQ("[ABC]{2$s:2$s}", SummarizeParsedFormat(*f));
+}
+
+TEST_F(ParsedFormatTest, SimpleUncheckedUnsupported) {
+ EXPECT_FALSE(ParsedFormat<'d'>::New("%1$d %1$x"));
+ EXPECT_FALSE(ParsedFormat<'x'>::New("%1$d %1$x"));
+}
+
+TEST_F(ParsedFormatTest, SimpleUncheckedIncorrect) {
+ EXPECT_FALSE(ParsedFormat<'d'>::New(""));
+
+ EXPECT_FALSE(ParsedFormat<'d'>::New("ABC%dDEF%d"));
+
+ std::string format = "%sFFF%dZZZ%f";
+ EXPECT_FALSE((ParsedFormat<'s', 'd', 'g'>::New(format)));
+}
+
+using str_format_internal::Conv;
+
+TEST_F(ParsedFormatTest, UncheckedCorrect) {
+ auto f = ExtendedParsedFormat<Conv::d>::New("ABC%dDEF");
+ ASSERT_TRUE(f);
+ EXPECT_EQ("[ABC]{d:1$d}[DEF]", SummarizeParsedFormat(*f));
+
+ std::string format = "%sFFF%dZZZ%f";
+ auto f2 =
+ ExtendedParsedFormat<Conv::string, Conv::d, Conv::floating>::New(format);
+
+ ASSERT_TRUE(f2);
+ EXPECT_EQ("{s:1$s}[FFF]{d:2$d}[ZZZ]{f:3$f}", SummarizeParsedFormat(*f2));
+
+ f2 = ExtendedParsedFormat<Conv::string, Conv::d, Conv::floating>::New(
+ "%s %d %f");
+
+ ASSERT_TRUE(f2);
+ EXPECT_EQ("{s:1$s}[ ]{d:2$d}[ ]{f:3$f}", SummarizeParsedFormat(*f2));
+
+ auto star = ExtendedParsedFormat<Conv::star, Conv::d>::New("%*d");
+ ASSERT_TRUE(star);
+ EXPECT_EQ("{*d:2$1$*d}", SummarizeParsedFormat(*star));
+
+ auto dollar = ExtendedParsedFormat<Conv::d, Conv::s>::New("%2$s %1$d");
+ ASSERT_TRUE(dollar);
+ EXPECT_EQ("{2$s:2$s}[ ]{1$d:1$d}", SummarizeParsedFormat(*dollar));
+ // with reuse
+ dollar = ExtendedParsedFormat<Conv::d, Conv::s>::New("%2$s %1$d %1$d");
+ ASSERT_TRUE(dollar);
+ EXPECT_EQ("{2$s:2$s}[ ]{1$d:1$d}[ ]{1$d:1$d}",
+ SummarizeParsedFormat(*dollar));
+}
+
+TEST_F(ParsedFormatTest, UncheckedIgnoredArgs) {
+ EXPECT_FALSE((ExtendedParsedFormat<Conv::d, Conv::s>::New("ABC")));
+ EXPECT_FALSE((ExtendedParsedFormat<Conv::d, Conv::s>::New("%dABC")));
+ EXPECT_FALSE((ExtendedParsedFormat<Conv::d, Conv::s>::New("ABC%2$s")));
+ auto f = ExtendedParsedFormat<Conv::d, Conv::s>::NewAllowIgnored("ABC");
+ ASSERT_TRUE(f);
+ EXPECT_EQ("[ABC]", SummarizeParsedFormat(*f));
+ f = ExtendedParsedFormat<Conv::d, Conv::s>::NewAllowIgnored("%dABC");
+ ASSERT_TRUE(f);
+ EXPECT_EQ("{d:1$d}[ABC]", SummarizeParsedFormat(*f));
+ f = ExtendedParsedFormat<Conv::d, Conv::s>::NewAllowIgnored("ABC%2$s");
+ ASSERT_TRUE(f);
+ EXPECT_EQ("[ABC]{2$s:2$s}", SummarizeParsedFormat(*f));
+}
+
+TEST_F(ParsedFormatTest, UncheckedMultipleTypes) {
+ auto dx = ExtendedParsedFormat<Conv::d | Conv::x>::New("%1$d %1$x");
+ EXPECT_TRUE(dx);
+ EXPECT_EQ("{1$d:1$d}[ ]{1$x:1$x}", SummarizeParsedFormat(*dx));
+
+ dx = ExtendedParsedFormat<Conv::d | Conv::x>::New("%1$d");
+ EXPECT_TRUE(dx);
+ EXPECT_EQ("{1$d:1$d}", SummarizeParsedFormat(*dx));
+}
+
+TEST_F(ParsedFormatTest, UncheckedIncorrect) {
+ EXPECT_FALSE(ExtendedParsedFormat<Conv::d>::New(""));
+
+ EXPECT_FALSE(ExtendedParsedFormat<Conv::d>::New("ABC%dDEF%d"));
+
+ std::string format = "%sFFF%dZZZ%f";
+ EXPECT_FALSE((ExtendedParsedFormat<Conv::s, Conv::d, Conv::g>::New(format)));
+}
+
+TEST_F(ParsedFormatTest, RegressionMixPositional) {
+ EXPECT_FALSE((ExtendedParsedFormat<Conv::d, Conv::o>::New("%1$d %o")));
+}
+
+} // namespace
+} // namespace absl
diff --git a/absl/strings/str_split.h b/absl/strings/str_split.h
index 1f089b93..9a7be2b0 100644
--- a/absl/strings/str_split.h
+++ b/absl/strings/str_split.h
@@ -373,11 +373,11 @@ struct SkipWhitespace {
// StrSplit()
//
-// Splits a given `std::string` based on the provided `Delimiter` object,
-// returning the elements within the type specified by the caller. Optionally,
-// you may also pass a `Predicate` to `StrSplit()` indicating whether to include
-// or exclude the resulting element within the final result set. (See the
-// overviews for Delimiters and Predicates above.)
+// Splits a given std::string based on the provided `Delimiter` object, returning the
+// elements within the type specified by the caller. Optionally, you may pass a
+// `Predicate` to `StrSplit()` indicating whether to include or exclude the
+// resulting element within the final result set. (See the overviews for
+// Delimiters and Predicates above.)
//
// Example:
//
diff --git a/absl/strings/str_split_test.cc b/absl/strings/str_split_test.cc
index c172a762..c6898863 100644
--- a/absl/strings/str_split_test.cc
+++ b/absl/strings/str_split_test.cc
@@ -37,6 +37,34 @@ using ::testing::ElementsAre;
using ::testing::Pair;
using ::testing::UnorderedElementsAre;
+TEST(Split, TraitsTest) {
+ static_assert(!absl::strings_internal::SplitterIsConvertibleTo<int>::value,
+ "");
+ static_assert(!absl::strings_internal::SplitterIsConvertibleTo<std::string>::value,
+ "");
+ static_assert(absl::strings_internal::SplitterIsConvertibleTo<
+ std::vector<std::string>>::value,
+ "");
+ static_assert(
+ !absl::strings_internal::SplitterIsConvertibleTo<std::vector<int>>::value,
+ "");
+ static_assert(absl::strings_internal::SplitterIsConvertibleTo<
+ std::vector<absl::string_view>>::value,
+ "");
+ static_assert(absl::strings_internal::SplitterIsConvertibleTo<
+ std::map<std::string, std::string>>::value,
+ "");
+ static_assert(absl::strings_internal::SplitterIsConvertibleTo<
+ std::map<absl::string_view, absl::string_view>>::value,
+ "");
+ static_assert(!absl::strings_internal::SplitterIsConvertibleTo<
+ std::map<int, std::string>>::value,
+ "");
+ static_assert(!absl::strings_internal::SplitterIsConvertibleTo<
+ std::map<std::string, int>>::value,
+ "");
+}
+
// This tests the overall split API, which is made up of the absl::StrSplit()
// function and the Delimiter objects in the absl:: namespace.
// This TEST macro is outside of any namespace to require full specification of
diff --git a/absl/synchronization/BUILD.bazel b/absl/synchronization/BUILD.bazel
index 123536ea..8d302e01 100644
--- a/absl/synchronization/BUILD.bazel
+++ b/absl/synchronization/BUILD.bazel
@@ -149,12 +149,6 @@ cc_test(
size = "large",
srcs = ["mutex_test.cc"],
copts = ABSL_TEST_COPTS,
- tags = [
- "no_test_android_arm",
- "no_test_android_arm64",
- "no_test_android_x86",
- "no_test_loonix", # Too slow.
- ],
deps = [
":synchronization",
":thread_pool",
@@ -231,6 +225,7 @@ cc_test(
"//absl:windows": [],
"//conditions:default": ["-pthread"],
}),
+ tags = ["no_test_ios_x86_64"],
deps = [
":synchronization",
"//absl/base",
diff --git a/absl/synchronization/mutex.h b/absl/synchronization/mutex.h
index 840b9d6b..4d9e0312 100644
--- a/absl/synchronization/mutex.h
+++ b/absl/synchronization/mutex.h
@@ -24,7 +24,7 @@
// Unlike a `std::mutex`, the Abseil `Mutex` provides the following additional
// features:
// * Conditional predicates intrinsic to the `Mutex` object
-// * Reader/writer locks, in addition to standard exclusive/writer locks
+// * Shared/reader locks, in addition to standard exclusive/writer locks
// * Deadlock detection and debug support.
//
// The following helper classes are also defined within this file:
@@ -290,7 +290,7 @@ class LOCKABLE Mutex {
// Mutex::ReaderLockWhen()
// Mutex::WriterLockWhen()
//
- // Blocks until simultaneously both `cond` is `true` and this` Mutex` can
+ // Blocks until simultaneously both `cond` is `true` and this `Mutex` can
// be acquired, then atomically acquires this `Mutex`. `LockWhen()` is
// logically equivalent to `*Lock(); Await();` though they may have different
// performance characteristics.
diff --git a/absl/synchronization/mutex_test.cc b/absl/synchronization/mutex_test.cc
index 53b93784..b2820e20 100644
--- a/absl/synchronization/mutex_test.cc
+++ b/absl/synchronization/mutex_test.cc
@@ -29,6 +29,7 @@
#include <vector>
#include "gtest/gtest.h"
+#include "absl/base/attributes.h"
#include "absl/base/internal/raw_logging.h"
#include "absl/base/internal/sysinfo.h"
#include "absl/memory/memory.h"
@@ -54,8 +55,8 @@ CreateDefaultPool() {
// Hack to schedule a function to run on a thread pool thread after a
// duration has elapsed.
static void ScheduleAfter(absl::synchronization_internal::ThreadPool *tp,
- const std::function<void()> &func,
- absl::Duration after) {
+ absl::Duration after,
+ const std::function<void()> &func) {
tp->Schedule([func, after] {
absl::SleepFor(after);
func();
@@ -1150,249 +1151,369 @@ TEST(Mutex, DeadlockIdBug) NO_THREAD_SAFETY_ANALYSIS {
// and so never expires/passes, and one that will expire/pass in the near
// future.
-// Encapsulate a Mutex-protected bool with its associated Condition/CondVar.
-class Cond {
- public:
- explicit Cond(bool use_deadline) : use_deadline_(use_deadline), c_(&b_) {}
-
- void Set(bool v) {
- absl::MutexLock lock(&mu_);
- b_ = v;
+static absl::Duration TimeoutTestAllowedSchedulingDelay() {
+ // Note: we use a function here because Microsoft Visual Studio fails to
+ // properly initialize constexpr static absl::Duration variables.
+ return absl::Milliseconds(150);
+}
+
+// Returns true if `actual_delay` is close enough to `expected_delay` to pass
+// the timeouts/deadlines test. Otherwise, logs warnings and returns false.
+ABSL_MUST_USE_RESULT
+static bool DelayIsWithinBounds(absl::Duration expected_delay,
+ absl::Duration actual_delay) {
+ bool pass = true;
+ // Do not allow the observed delay to be less than expected. This may occur
+ // in practice due to clock skew or when the synchronization primitives use a
+ // different clock than absl::Now(), but these cases should be handled by the
+ // the retry mechanism in each TimeoutTest.
+ if (actual_delay < expected_delay) {
+ ABSL_RAW_LOG(WARNING,
+ "Actual delay %s was too short, expected %s (difference %s)",
+ absl::FormatDuration(actual_delay).c_str(),
+ absl::FormatDuration(expected_delay).c_str(),
+ absl::FormatDuration(actual_delay - expected_delay).c_str());
+ pass = false;
}
-
- bool AwaitWithTimeout(absl::Duration timeout) {
- absl::MutexLock lock(&mu_);
- return use_deadline_ ? mu_.AwaitWithDeadline(c_, absl::Now() + timeout)
- : mu_.AwaitWithTimeout(c_, timeout);
+ // If the expected delay is <= zero then allow a small error tolerance, since
+ // we do not expect context switches to occur during test execution.
+ // Otherwise, thread scheduling delays may be substantial in rare cases, so
+ // tolerate up to kTimeoutTestAllowedSchedulingDelay of error.
+ absl::Duration tolerance = expected_delay <= absl::ZeroDuration()
+ ? absl::Milliseconds(10)
+ : TimeoutTestAllowedSchedulingDelay();
+ if (actual_delay > expected_delay + tolerance) {
+ ABSL_RAW_LOG(WARNING,
+ "Actual delay %s was too long, expected %s (difference %s)",
+ absl::FormatDuration(actual_delay).c_str(),
+ absl::FormatDuration(expected_delay).c_str(),
+ absl::FormatDuration(actual_delay - expected_delay).c_str());
+ pass = false;
}
+ return pass;
+}
+
+// Parameters for TimeoutTest, below.
+struct TimeoutTestParam {
+ // The file and line number (used for logging purposes only).
+ const char *from_file;
+ int from_line;
+
+ // Should the absolute deadline API based on absl::Time be tested? If false,
+ // the relative deadline API based on absl::Duration is tested.
+ bool use_absolute_deadline;
+
+ // The deadline/timeout used when calling the API being tested
+ // (e.g. Mutex::LockWhenWithDeadline).
+ absl::Duration wait_timeout;
+
+ // The delay before the condition will be set true by the test code. If zero
+ // or negative, the condition is set true immediately (before calling the API
+ // being tested). Otherwise, if infinite, the condition is never set true.
+ // Otherwise a closure is scheduled for the future that sets the condition
+ // true.
+ absl::Duration satisfy_condition_delay;
+
+ // The expected result of the condition after the call to the API being
+ // tested. Generally `true` means the condition was true when the API returns,
+ // `false` indicates an expected timeout.
+ bool expected_result;
+
+ // The expected delay before the API under test returns. This is inherently
+ // flaky, so some slop is allowed (see `DelayIsWithinBounds` above), and the
+ // test keeps trying indefinitely until this constraint passes.
+ absl::Duration expected_delay;
+};
- bool LockWhenWithTimeout(absl::Duration timeout) {
- bool b = use_deadline_ ? mu_.LockWhenWithDeadline(c_, absl::Now() + timeout)
- : mu_.LockWhenWithTimeout(c_, timeout);
- mu_.Unlock();
- return b;
+// Print a `TimeoutTestParam` to a debug log.
+std::ostream &operator<<(std::ostream &os, const TimeoutTestParam &param) {
+ return os << "from: " << param.from_file << ":" << param.from_line
+ << " use_absolute_deadline: "
+ << (param.use_absolute_deadline ? "true" : "false")
+ << " wait_timeout: " << param.wait_timeout
+ << " satisfy_condition_delay: " << param.satisfy_condition_delay
+ << " expected_result: "
+ << (param.expected_result ? "true" : "false")
+ << " expected_delay: " << param.expected_delay;
+}
+
+std::string FormatString(const TimeoutTestParam &param) {
+ std::ostringstream os;
+ os << param;
+ return os.str();
+}
+
+// Like `thread::Executor::ScheduleAt` except:
+// a) Delays zero or negative are executed immediately in the current thread.
+// b) Infinite delays are never scheduled.
+// c) Calls this test's `ScheduleAt` helper instead of using `pool` directly.
+static void RunAfterDelay(absl::Duration delay,
+ absl::synchronization_internal::ThreadPool *pool,
+ const std::function<void()> &callback) {
+ if (delay <= absl::ZeroDuration()) {
+ callback(); // immediate
+ } else if (delay != absl::InfiniteDuration()) {
+ ScheduleAfter(pool, delay, callback);
}
+}
- bool ReaderLockWhenWithTimeout(absl::Duration timeout) {
- bool b = use_deadline_
- ? mu_.ReaderLockWhenWithDeadline(c_, absl::Now() + timeout)
- : mu_.ReaderLockWhenWithTimeout(c_, timeout);
- mu_.ReaderUnlock();
- return b;
- }
+class TimeoutTest : public ::testing::Test,
+ public ::testing::WithParamInterface<TimeoutTestParam> {};
- void Await() {
- absl::MutexLock lock(&mu_);
- mu_.Await(c_);
- }
+std::vector<TimeoutTestParam> MakeTimeoutTestParamValues() {
+ // The `finite` delay is a finite, relatively short, delay. We make it larger
+ // than our allowed scheduling delay (slop factor) to avoid confusion when
+ // diagnosing test failures. The other constants here have clear meanings.
+ const absl::Duration finite = 3 * TimeoutTestAllowedSchedulingDelay();
+ const absl::Duration never = absl::InfiniteDuration();
+ const absl::Duration negative = -absl::InfiniteDuration();
+ const absl::Duration immediate = absl::ZeroDuration();
- void Signal(bool v) {
- absl::MutexLock lock(&mu_);
- b_ = v;
- cv_.Signal();
+ // Every test case is run twice; once using the absolute deadline API and once
+ // using the relative timeout API.
+ std::vector<TimeoutTestParam> values;
+ for (bool use_absolute_deadline : {false, true}) {
+ // Tests with a negative timeout (deadline in the past), which should
+ // immediately return current state of the condition.
+
+ // The condition is already true:
+ values.push_back(TimeoutTestParam{
+ __FILE__, __LINE__, use_absolute_deadline,
+ negative, // wait_timeout
+ immediate, // satisfy_condition_delay
+ true, // expected_result
+ immediate, // expected_delay
+ });
+
+ // The condition becomes true, but the timeout has already expired:
+ values.push_back(TimeoutTestParam{
+ __FILE__, __LINE__, use_absolute_deadline,
+ negative, // wait_timeout
+ finite, // satisfy_condition_delay
+ false, // expected_result
+ immediate // expected_delay
+ });
+
+ // The condition never becomes true:
+ values.push_back(TimeoutTestParam{
+ __FILE__, __LINE__, use_absolute_deadline,
+ negative, // wait_timeout
+ never, // satisfy_condition_delay
+ false, // expected_result
+ immediate // expected_delay
+ });
+
+ // Tests with an infinite timeout (deadline in the infinite future), which
+ // should only return when the condition becomes true.
+
+ // The condition is already true:
+ values.push_back(TimeoutTestParam{
+ __FILE__, __LINE__, use_absolute_deadline,
+ never, // wait_timeout
+ immediate, // satisfy_condition_delay
+ true, // expected_result
+ immediate // expected_delay
+ });
+
+ // The condition becomes true before the (infinite) expiry:
+ values.push_back(TimeoutTestParam{
+ __FILE__, __LINE__, use_absolute_deadline,
+ never, // wait_timeout
+ finite, // satisfy_condition_delay
+ true, // expected_result
+ finite, // expected_delay
+ });
+
+ // Tests with a (small) finite timeout (deadline soon), with the condition
+ // becoming true both before and after its expiry.
+
+ // The condition is already true:
+ values.push_back(TimeoutTestParam{
+ __FILE__, __LINE__, use_absolute_deadline,
+ never, // wait_timeout
+ immediate, // satisfy_condition_delay
+ true, // expected_result
+ immediate // expected_delay
+ });
+
+ // The condition becomes true before the expiry:
+ values.push_back(TimeoutTestParam{
+ __FILE__, __LINE__, use_absolute_deadline,
+ finite * 2, // wait_timeout
+ finite, // satisfy_condition_delay
+ true, // expected_result
+ finite // expected_delay
+ });
+
+ // The condition becomes true, but the timeout has already expired:
+ values.push_back(TimeoutTestParam{
+ __FILE__, __LINE__, use_absolute_deadline,
+ finite, // wait_timeout
+ finite * 2, // satisfy_condition_delay
+ false, // expected_result
+ finite // expected_delay
+ });
+
+ // The condition never becomes true:
+ values.push_back(TimeoutTestParam{
+ __FILE__, __LINE__, use_absolute_deadline,
+ finite, // wait_timeout
+ never, // satisfy_condition_delay
+ false, // expected_result
+ finite // expected_delay
+ });
}
-
- bool WaitWithTimeout(absl::Duration timeout) {
- absl::MutexLock lock(&mu_);
- absl::Time deadline = absl::Now() + timeout;
- if (use_deadline_) {
- while (!b_ && !cv_.WaitWithDeadline(&mu_, deadline)) {
- }
- } else {
- while (!b_ && !cv_.WaitWithTimeout(&mu_, timeout)) {
- timeout = deadline - absl::Now(); // recompute timeout
- }
+ return values;
+}
+
+// Instantiate `TimeoutTest` with `MakeTimeoutTestParamValues()`.
+INSTANTIATE_TEST_CASE_P(All, TimeoutTest,
+ testing::ValuesIn(MakeTimeoutTestParamValues()));
+
+TEST_P(TimeoutTest, Await) {
+ const TimeoutTestParam params = GetParam();
+ ABSL_RAW_LOG(INFO, "Params: %s", FormatString(params).c_str());
+
+ // Because this test asserts bounds on scheduling delays it is flaky. To
+ // compensate it loops forever until it passes. Failures express as test
+ // timeouts, in which case the test log can be used to diagnose the issue.
+ for (int attempt = 1;; ++attempt) {
+ ABSL_RAW_LOG(INFO, "Attempt %d", attempt);
+
+ absl::Mutex mu;
+ bool value = false; // condition value (under mu)
+
+ std::unique_ptr<absl::synchronization_internal::ThreadPool> pool =
+ CreateDefaultPool();
+ RunAfterDelay(params.satisfy_condition_delay, pool.get(), [&] {
+ absl::MutexLock l(&mu);
+ value = true;
+ });
+
+ absl::MutexLock lock(&mu);
+ absl::Time start_time = absl::Now();
+ absl::Condition cond(&value);
+ bool result =
+ params.use_absolute_deadline
+ ? mu.AwaitWithDeadline(cond, start_time + params.wait_timeout)
+ : mu.AwaitWithTimeout(cond, params.wait_timeout);
+ if (DelayIsWithinBounds(params.expected_delay, absl::Now() - start_time)) {
+ EXPECT_EQ(params.expected_result, result);
+ break;
}
- return b_;
- }
-
- void Wait() {
- absl::MutexLock lock(&mu_);
- while (!b_) cv_.Wait(&mu_);
- }
-
- private:
- const bool use_deadline_;
-
- bool b_;
- absl::Condition c_;
- absl::CondVar cv_;
- absl::Mutex mu_;
-};
-
-class OperationTimer {
- public:
- OperationTimer() : start_(absl::Now()) {}
- absl::Duration Get() const { return absl::Now() - start_; }
-
- private:
- const absl::Time start_;
-};
-
-static void CheckResults(bool exp_result, bool act_result,
- absl::Duration exp_duration,
- absl::Duration act_duration) {
- ABSL_RAW_CHECK(exp_result == act_result, "CheckResults failed");
- // Allow for some worse-case scheduling delay and clock skew.
- if ((exp_duration - absl::Milliseconds(40) > act_duration) ||
- (exp_duration + absl::Milliseconds(150) < act_duration)) {
- ABSL_RAW_LOG(FATAL, "CheckResults failed: operation took %s, expected %s",
- absl::FormatDuration(act_duration).c_str(),
- absl::FormatDuration(exp_duration).c_str());
}
}
-static void TestAwaitTimeout(Cond *cp, absl::Duration timeout, bool exp_result,
- absl::Duration exp_duration) {
- OperationTimer t;
- bool act_result = cp->AwaitWithTimeout(timeout);
- CheckResults(exp_result, act_result, exp_duration, t.Get());
-}
-
-static void TestLockWhenTimeout(Cond *cp, absl::Duration timeout,
- bool exp_result, absl::Duration exp_duration) {
- OperationTimer t;
- bool act_result = cp->LockWhenWithTimeout(timeout);
- CheckResults(exp_result, act_result, exp_duration, t.Get());
-}
+TEST_P(TimeoutTest, LockWhen) {
+ const TimeoutTestParam params = GetParam();
+ ABSL_RAW_LOG(INFO, "Params: %s", FormatString(params).c_str());
+
+ // Because this test asserts bounds on scheduling delays it is flaky. To
+ // compensate it loops forever until it passes. Failures express as test
+ // timeouts, in which case the test log can be used to diagnose the issue.
+ for (int attempt = 1;; ++attempt) {
+ ABSL_RAW_LOG(INFO, "Attempt %d", attempt);
+
+ absl::Mutex mu;
+ bool value = false; // condition value (under mu)
+
+ std::unique_ptr<absl::synchronization_internal::ThreadPool> pool =
+ CreateDefaultPool();
+ RunAfterDelay(params.satisfy_condition_delay, pool.get(), [&] {
+ absl::MutexLock l(&mu);
+ value = true;
+ });
+
+ absl::Time start_time = absl::Now();
+ absl::Condition cond(&value);
+ bool result =
+ params.use_absolute_deadline
+ ? mu.LockWhenWithDeadline(cond, start_time + params.wait_timeout)
+ : mu.LockWhenWithTimeout(cond, params.wait_timeout);
+ mu.Unlock();
-static void TestReaderLockWhenTimeout(Cond *cp, absl::Duration timeout,
- bool exp_result,
- absl::Duration exp_duration) {
- OperationTimer t;
- bool act_result = cp->ReaderLockWhenWithTimeout(timeout);
- CheckResults(exp_result, act_result, exp_duration, t.Get());
+ if (DelayIsWithinBounds(params.expected_delay, absl::Now() - start_time)) {
+ EXPECT_EQ(params.expected_result, result);
+ break;
+ }
+ }
}
-static void TestWaitTimeout(Cond *cp, absl::Duration timeout, bool exp_result,
- absl::Duration exp_duration) {
- OperationTimer t;
- bool act_result = cp->WaitWithTimeout(timeout);
- CheckResults(exp_result, act_result, exp_duration, t.Get());
+TEST_P(TimeoutTest, ReaderLockWhen) {
+ const TimeoutTestParam params = GetParam();
+ ABSL_RAW_LOG(INFO, "Params: %s", FormatString(params).c_str());
+
+ // Because this test asserts bounds on scheduling delays it is flaky. To
+ // compensate it loops forever until it passes. Failures express as test
+ // timeouts, in which case the test log can be used to diagnose the issue.
+ for (int attempt = 0;; ++attempt) {
+ ABSL_RAW_LOG(INFO, "Attempt %d", attempt);
+
+ absl::Mutex mu;
+ bool value = false; // condition value (under mu)
+
+ std::unique_ptr<absl::synchronization_internal::ThreadPool> pool =
+ CreateDefaultPool();
+ RunAfterDelay(params.satisfy_condition_delay, pool.get(), [&] {
+ absl::MutexLock l(&mu);
+ value = true;
+ });
+
+ absl::Time start_time = absl::Now();
+ bool result =
+ params.use_absolute_deadline
+ ? mu.ReaderLockWhenWithDeadline(absl::Condition(&value),
+ start_time + params.wait_timeout)
+ : mu.ReaderLockWhenWithTimeout(absl::Condition(&value),
+ params.wait_timeout);
+ mu.ReaderUnlock();
+
+ if (DelayIsWithinBounds(params.expected_delay, absl::Now() - start_time)) {
+ EXPECT_EQ(params.expected_result, result);
+ break;
+ }
+ }
}
-// Tests with a negative timeout (deadline in the past), which should
-// immediately return the current state of the condition.
-static void TestNegativeTimeouts(absl::synchronization_internal::ThreadPool *tp,
- Cond *cp) {
- const absl::Duration negative = -absl::InfiniteDuration();
- const absl::Duration immediate = absl::ZeroDuration();
-
- // The condition is already true:
- cp->Set(true);
- TestAwaitTimeout(cp, negative, true, immediate);
- TestLockWhenTimeout(cp, negative, true, immediate);
- TestReaderLockWhenTimeout(cp, negative, true, immediate);
- TestWaitTimeout(cp, negative, true, immediate);
-
- // The condition becomes true, but the timeout has already expired:
- const absl::Duration delay = absl::Milliseconds(200);
- cp->Set(false);
- ScheduleAfter(tp, std::bind(&Cond::Set, cp, true), 3 * delay);
- TestAwaitTimeout(cp, negative, false, immediate);
- TestLockWhenTimeout(cp, negative, false, immediate);
- TestReaderLockWhenTimeout(cp, negative, false, immediate);
- cp->Await(); // wait for the scheduled Set() to complete
- cp->Set(false);
- ScheduleAfter(tp, std::bind(&Cond::Signal, cp, true), delay);
- TestWaitTimeout(cp, negative, false, immediate);
- cp->Wait(); // wait for the scheduled Signal() to complete
-
- // The condition never becomes true:
- cp->Set(false);
- TestAwaitTimeout(cp, negative, false, immediate);
- TestLockWhenTimeout(cp, negative, false, immediate);
- TestReaderLockWhenTimeout(cp, negative, false, immediate);
- TestWaitTimeout(cp, negative, false, immediate);
-}
-
-// Tests with an infinite timeout (deadline in the infinite future), which
-// should only return when the condition becomes true.
-static void TestInfiniteTimeouts(absl::synchronization_internal::ThreadPool *tp,
- Cond *cp) {
- const absl::Duration infinite = absl::InfiniteDuration();
- const absl::Duration immediate = absl::ZeroDuration();
-
- // The condition is already true:
- cp->Set(true);
- TestAwaitTimeout(cp, infinite, true, immediate);
- TestLockWhenTimeout(cp, infinite, true, immediate);
- TestReaderLockWhenTimeout(cp, infinite, true, immediate);
- TestWaitTimeout(cp, infinite, true, immediate);
-
- // The condition becomes true before the (infinite) expiry:
- const absl::Duration delay = absl::Milliseconds(200);
- cp->Set(false);
- ScheduleAfter(tp, std::bind(&Cond::Set, cp, true), delay);
- TestAwaitTimeout(cp, infinite, true, delay);
- cp->Set(false);
- ScheduleAfter(tp, std::bind(&Cond::Set, cp, true), delay);
- TestLockWhenTimeout(cp, infinite, true, delay);
- cp->Set(false);
- ScheduleAfter(tp, std::bind(&Cond::Set, cp, true), delay);
- TestReaderLockWhenTimeout(cp, infinite, true, delay);
- cp->Set(false);
- ScheduleAfter(tp, std::bind(&Cond::Signal, cp, true), delay);
- TestWaitTimeout(cp, infinite, true, delay);
-}
-
-// Tests with a (small) finite timeout (deadline soon), with the condition
-// becoming true both before and after its expiry.
-static void TestFiniteTimeouts(absl::synchronization_internal::ThreadPool *tp,
- Cond *cp) {
- const absl::Duration finite = absl::Milliseconds(400);
- const absl::Duration immediate = absl::ZeroDuration();
+TEST_P(TimeoutTest, Wait) {
+ const TimeoutTestParam params = GetParam();
+ ABSL_RAW_LOG(INFO, "Params: %s", FormatString(params).c_str());
+
+ // Because this test asserts bounds on scheduling delays it is flaky. To
+ // compensate it loops forever until it passes. Failures express as test
+ // timeouts, in which case the test log can be used to diagnose the issue.
+ for (int attempt = 0;; ++attempt) {
+ ABSL_RAW_LOG(INFO, "Attempt %d", attempt);
+
+ absl::Mutex mu;
+ bool value = false; // condition value (under mu)
+ absl::CondVar cv; // signals a change of `value`
+
+ std::unique_ptr<absl::synchronization_internal::ThreadPool> pool =
+ CreateDefaultPool();
+ RunAfterDelay(params.satisfy_condition_delay, pool.get(), [&] {
+ absl::MutexLock l(&mu);
+ value = true;
+ cv.Signal();
+ });
+
+ absl::MutexLock lock(&mu);
+ absl::Time start_time = absl::Now();
+ absl::Duration timeout = params.wait_timeout;
+ absl::Time deadline = start_time + timeout;
+ while (!value) {
+ if (params.use_absolute_deadline ? cv.WaitWithDeadline(&mu, deadline)
+ : cv.WaitWithTimeout(&mu, timeout)) {
+ break; // deadline/timeout exceeded
+ }
+ timeout = deadline - absl::Now(); // recompute
+ }
+ bool result = value; // note: `mu` is still held
- // The condition is already true:
- cp->Set(true);
- TestAwaitTimeout(cp, finite, true, immediate);
- TestLockWhenTimeout(cp, finite, true, immediate);
- TestReaderLockWhenTimeout(cp, finite, true, immediate);
- TestWaitTimeout(cp, finite, true, immediate);
-
- // The condition becomes true before the expiry:
- const absl::Duration delay1 = finite / 2;
- cp->Set(false);
- ScheduleAfter(tp, std::bind(&Cond::Set, cp, true), delay1);
- TestAwaitTimeout(cp, finite, true, delay1);
- cp->Set(false);
- ScheduleAfter(tp, std::bind(&Cond::Set, cp, true), delay1);
- TestLockWhenTimeout(cp, finite, true, delay1);
- cp->Set(false);
- ScheduleAfter(tp, std::bind(&Cond::Set, cp, true), delay1);
- TestReaderLockWhenTimeout(cp, finite, true, delay1);
- cp->Set(false);
- ScheduleAfter(tp, std::bind(&Cond::Signal, cp, true), delay1);
- TestWaitTimeout(cp, finite, true, delay1);
-
- // The condition becomes true, but the timeout has already expired:
- const absl::Duration delay2 = finite * 2;
- cp->Set(false);
- ScheduleAfter(tp, std::bind(&Cond::Set, cp, true), 3 * delay2);
- TestAwaitTimeout(cp, finite, false, finite);
- TestLockWhenTimeout(cp, finite, false, finite);
- TestReaderLockWhenTimeout(cp, finite, false, finite);
- cp->Await(); // wait for the scheduled Set() to complete
- cp->Set(false);
- ScheduleAfter(tp, std::bind(&Cond::Signal, cp, true), delay2);
- TestWaitTimeout(cp, finite, false, finite);
- cp->Wait(); // wait for the scheduled Signal() to complete
-
- // The condition never becomes true:
- cp->Set(false);
- TestAwaitTimeout(cp, finite, false, finite);
- TestLockWhenTimeout(cp, finite, false, finite);
- TestReaderLockWhenTimeout(cp, finite, false, finite);
- TestWaitTimeout(cp, finite, false, finite);
-}
-
-TEST(Mutex, Timeouts) {
- auto tp = CreateDefaultPool();
- for (bool use_deadline : {false, true}) {
- Cond cond(use_deadline);
- TestNegativeTimeouts(tp.get(), &cond);
- TestInfiniteTimeouts(tp.get(), &cond);
- TestFiniteTimeouts(tp.get(), &cond);
+ if (DelayIsWithinBounds(params.expected_delay, absl::Now() - start_time)) {
+ EXPECT_EQ(params.expected_result, result);
+ break;
+ }
}
}
diff --git a/absl/time/BUILD.bazel b/absl/time/BUILD.bazel
index fe55fe1f..e793da87 100644
--- a/absl/time/BUILD.bazel
+++ b/absl/time/BUILD.bazel
@@ -44,6 +44,7 @@ cc_library(
"//absl/base",
"//absl/base:core_headers",
"//absl/numeric:int128",
+ "//absl/strings",
"//absl/time/internal/cctz:civil_time",
"//absl/time/internal/cctz:time_zone",
],
@@ -80,9 +81,6 @@ cc_test(
"time_zone_test.cc",
],
copts = ABSL_TEST_COPTS,
- tags = [
- "no_test_loonix",
- ],
deps = [
":test_util",
":time",
diff --git a/absl/time/CMakeLists.txt b/absl/time/CMakeLists.txt
index 72bb4d25..06272364 100644
--- a/absl/time/CMakeLists.txt
+++ b/absl/time/CMakeLists.txt
@@ -53,7 +53,7 @@ list(APPEND TIME_SRC
${TIME_PUBLIC_HEADERS}
${TIME_INTERNAL_HEADERS}
)
-set(TIME_PUBLIC_LIBRARIES absl::base absl::stacktrace absl::int128)
+set(TIME_PUBLIC_LIBRARIES absl::base absl::stacktrace absl::int128 absl::strings)
absl_library(
TARGET
diff --git a/absl/time/clock_test.cc b/absl/time/clock_test.cc
index f143c036..707166d0 100644
--- a/absl/time/clock_test.cc
+++ b/absl/time/clock_test.cc
@@ -35,36 +35,84 @@ TEST(Time, Now) {
EXPECT_GE(after, now);
}
-TEST(SleepForTest, BasicSanity) {
- absl::Duration sleep_time = absl::Milliseconds(2500);
- absl::Time start = absl::Now();
- absl::SleepFor(sleep_time);
- absl::Time end = absl::Now();
- EXPECT_LE(sleep_time - absl::Milliseconds(100), end - start);
- EXPECT_GE(sleep_time + absl::Milliseconds(200), end - start);
-}
+enum class AlarmPolicy { kWithoutAlarm, kWithAlarm };
-#ifdef ABSL_HAVE_ALARM
-// Helper for test SleepFor.
+#if defined(ABSL_HAVE_ALARM)
bool alarm_handler_invoked = false;
+
void AlarmHandler(int signo) {
ASSERT_EQ(signo, SIGALRM);
alarm_handler_invoked = true;
}
+#endif
+
+// Does SleepFor(d) take between lower_bound and upper_bound at least
+// once between now and (now + timeout)? If requested (and supported),
+// add an alarm for the middle of the sleep period and expect it to fire.
+bool SleepForBounded(absl::Duration d, absl::Duration lower_bound,
+ absl::Duration upper_bound, absl::Duration timeout,
+ AlarmPolicy alarm_policy, int* attempts) {
+ const absl::Time deadline = absl::Now() + timeout;
+ while (absl::Now() < deadline) {
+#if defined(ABSL_HAVE_ALARM)
+ sig_t old_alarm = SIG_DFL;
+ if (alarm_policy == AlarmPolicy::kWithAlarm) {
+ alarm_handler_invoked = false;
+ old_alarm = signal(SIGALRM, AlarmHandler);
+ alarm(absl::ToInt64Seconds(d / 2));
+ }
+#else
+ EXPECT_EQ(alarm_policy, AlarmPolicy::kWithoutAlarm);
+#endif
+ ++*attempts;
+ absl::Time start = absl::Now();
+ absl::SleepFor(d);
+ absl::Duration actual = absl::Now() - start;
+#if defined(ABSL_HAVE_ALARM)
+ if (alarm_policy == AlarmPolicy::kWithAlarm) {
+ signal(SIGALRM, old_alarm);
+ if (!alarm_handler_invoked) continue;
+ }
+#endif
+ if (lower_bound <= actual && actual <= upper_bound) {
+ return true; // yes, the SleepFor() was correctly bounded
+ }
+ }
+ return false;
+}
-TEST(SleepForTest, AlarmSupport) {
- alarm_handler_invoked = false;
- sig_t old_alarm = signal(SIGALRM, AlarmHandler);
- alarm(2);
- absl::Duration sleep_time = absl::Milliseconds(3500);
- absl::Time start = absl::Now();
- absl::SleepFor(sleep_time);
- absl::Time end = absl::Now();
- EXPECT_TRUE(alarm_handler_invoked);
- EXPECT_LE(sleep_time - absl::Milliseconds(100), end - start);
- EXPECT_GE(sleep_time + absl::Milliseconds(200), end - start);
- signal(SIGALRM, old_alarm);
+testing::AssertionResult AssertSleepForBounded(absl::Duration d,
+ absl::Duration early,
+ absl::Duration late,
+ absl::Duration timeout,
+ AlarmPolicy alarm_policy) {
+ const absl::Duration lower_bound = d - early;
+ const absl::Duration upper_bound = d + late;
+ int attempts = 0;
+ if (SleepForBounded(d, lower_bound, upper_bound, timeout, alarm_policy,
+ &attempts)) {
+ return testing::AssertionSuccess();
+ }
+ return testing::AssertionFailure()
+ << "SleepFor(" << d << ") did not return within [" << lower_bound
+ << ":" << upper_bound << "] in " << attempts << " attempt"
+ << (attempts == 1 ? "" : "s") << " over " << timeout
+ << (alarm_policy == AlarmPolicy::kWithAlarm ? " with" : " without")
+ << " an alarm";
+}
+
+// Tests that SleepFor() returns neither too early nor too late.
+TEST(SleepFor, Bounded) {
+ const absl::Duration d = absl::Milliseconds(2500);
+ const absl::Duration early = absl::Milliseconds(100);
+ const absl::Duration late = absl::Milliseconds(300);
+ const absl::Duration timeout = 48 * d;
+ EXPECT_TRUE(AssertSleepForBounded(d, early, late, timeout,
+ AlarmPolicy::kWithoutAlarm));
+#if defined(ABSL_HAVE_ALARM)
+ EXPECT_TRUE(AssertSleepForBounded(d, early, late, timeout,
+ AlarmPolicy::kWithAlarm));
+#endif
}
-#endif // ABSL_HAVE_ALARM
} // namespace
diff --git a/absl/time/duration.cc b/absl/time/duration.cc
index 82b4d989..c13fa79b 100644
--- a/absl/time/duration.cc
+++ b/absl/time/duration.cc
@@ -896,8 +896,7 @@ bool ParseDuration(const std::string& dur_string, Duration* d) {
return true;
}
-// TODO(absl-team): Remove once dependencies are removed.
-bool ParseFlag(const std::string& text, Duration* dst, std::string* /* err */) {
+bool ParseFlag(const std::string& text, Duration* dst, std::string* ) {
return ParseDuration(text, dst);
}
diff --git a/absl/time/format.cc b/absl/time/format.cc
index 5dc01bda..e98e60a3 100644
--- a/absl/time/format.cc
+++ b/absl/time/format.cc
@@ -34,15 +34,13 @@ namespace {
const char kInfiniteFutureStr[] = "infinite-future";
const char kInfinitePastStr[] = "infinite-past";
-using cctz_sec = cctz::time_point<cctz::sys_seconds>;
-using cctz_fem = cctz::detail::femtoseconds;
struct cctz_parts {
- cctz_sec sec;
- cctz_fem fem;
+ cctz::time_point<cctz::seconds> sec;
+ cctz::detail::femtoseconds fem;
};
-inline cctz_sec unix_epoch() {
- return std::chrono::time_point_cast<cctz::sys_seconds>(
+inline cctz::time_point<cctz::seconds> unix_epoch() {
+ return std::chrono::time_point_cast<cctz::seconds>(
std::chrono::system_clock::from_time_t(0));
}
@@ -53,8 +51,8 @@ cctz_parts Split(absl::Time t) {
const auto d = time_internal::ToUnixDuration(t);
const int64_t rep_hi = time_internal::GetRepHi(d);
const int64_t rep_lo = time_internal::GetRepLo(d);
- const auto sec = unix_epoch() + cctz::sys_seconds(rep_hi);
- const auto fem = cctz_fem(rep_lo * (1000 * 1000 / 4));
+ const auto sec = unix_epoch() + cctz::seconds(rep_hi);
+ const auto fem = cctz::detail::femtoseconds(rep_lo * (1000 * 1000 / 4));
return {sec, fem};
}
@@ -129,7 +127,6 @@ bool ParseTime(const std::string& format, const std::string& input, absl::TimeZo
return b;
}
-// TODO(absl-team): Remove once dependencies are removed.
// Functions required to support absl::Time flags.
bool ParseFlag(const std::string& text, absl::Time* t, std::string* error) {
return absl::ParseTime(RFC3339_full, text, absl::UTCTimeZone(), t, error);
diff --git a/absl/time/internal/cctz/include/cctz/civil_time_detail.h b/absl/time/internal/cctz/include/cctz/civil_time_detail.h
index d52eddcd..2362a4f4 100644
--- a/absl/time/internal/cctz/include/cctz/civil_time_detail.h
+++ b/absl/time/internal/cctz/include/cctz/civil_time_detail.h
@@ -403,20 +403,16 @@ class civil_time {
}
// Binary arithmetic operators.
- inline friend CONSTEXPR_M civil_time operator+(civil_time a,
- diff_t n) noexcept {
+ friend CONSTEXPR_F civil_time operator+(civil_time a, diff_t n) noexcept {
return a += n;
}
- inline friend CONSTEXPR_M civil_time operator+(diff_t n,
- civil_time a) noexcept {
+ friend CONSTEXPR_F civil_time operator+(diff_t n, civil_time a) noexcept {
return a += n;
}
- inline friend CONSTEXPR_M civil_time operator-(civil_time a,
- diff_t n) noexcept {
+ friend CONSTEXPR_F civil_time operator-(civil_time a, diff_t n) noexcept {
return a -= n;
}
- inline friend CONSTEXPR_M diff_t operator-(const civil_time& lhs,
- const civil_time& rhs) noexcept {
+ friend CONSTEXPR_F diff_t operator-(civil_time lhs, civil_time rhs) noexcept {
return difference(T{}, lhs.f_, rhs.f_);
}
@@ -434,8 +430,8 @@ class civil_time {
// Disallows difference between differently aligned types.
// auto n = civil_day(...) - civil_hour(...); // would be confusing.
-template <typename Tag1, typename Tag2>
-CONSTEXPR_F diff_t operator-(civil_time<Tag1>, civil_time<Tag2>) = delete;
+template <typename T, typename U>
+CONSTEXPR_F diff_t operator-(civil_time<T>, civil_time<U>) = delete;
using civil_year = civil_time<year_tag>;
using civil_month = civil_time<month_tag>;
diff --git a/absl/time/internal/cctz/include/cctz/time_zone.h b/absl/time/internal/cctz/include/cctz/time_zone.h
index 31abc2c4..0b9764ea 100644
--- a/absl/time/internal/cctz/include/cctz/time_zone.h
+++ b/absl/time/internal/cctz/include/cctz/time_zone.h
@@ -34,23 +34,24 @@ namespace cctz {
// Convenience aliases. Not intended as public API points.
template <typename D>
using time_point = std::chrono::time_point<std::chrono::system_clock, D>;
-using sys_seconds = std::chrono::duration<std::int_fast64_t>;
+using seconds = std::chrono::duration<std::int_fast64_t>;
+using sys_seconds = seconds; // Deprecated. Use cctz::seconds instead.
namespace detail {
template <typename D>
-inline std::pair<time_point<sys_seconds>, D>
+inline std::pair<time_point<seconds>, D>
split_seconds(const time_point<D>& tp) {
- auto sec = std::chrono::time_point_cast<sys_seconds>(tp);
+ auto sec = std::chrono::time_point_cast<seconds>(tp);
auto sub = tp - sec;
if (sub.count() < 0) {
- sec -= sys_seconds(1);
- sub += sys_seconds(1);
+ sec -= seconds(1);
+ sub += seconds(1);
}
return {sec, std::chrono::duration_cast<D>(sub)};
}
-inline std::pair<time_point<sys_seconds>, sys_seconds>
-split_seconds(const time_point<sys_seconds>& tp) {
- return {tp, sys_seconds(0)};
+inline std::pair<time_point<seconds>, seconds>
+split_seconds(const time_point<seconds>& tp) {
+ return {tp, seconds::zero()};
}
} // namespace detail
@@ -99,7 +100,7 @@ class time_zone {
bool is_dst; // is offset non-standard?
const char* abbr; // time-zone abbreviation (e.g., "PST")
};
- absolute_lookup lookup(const time_point<sys_seconds>& tp) const;
+ absolute_lookup lookup(const time_point<seconds>& tp) const;
template <typename D>
absolute_lookup lookup(const time_point<D>& tp) const {
return lookup(detail::split_seconds(tp).first);
@@ -118,9 +119,9 @@ class time_zone {
// of the given civil-time argument, and the pre, trans, and post
// members will give the absolute time answers using the pre-transition
// offset, the transition point itself, and the post-transition offset,
- // respectively (all three times are equal if kind == UNIQUE). If any
+ // respectively (all three times are equal if kind == UNIQUE). If any
// of these three absolute times is outside the representable range of a
- // time_point<sys_seconds> the field is set to its maximum/minimum value.
+ // time_point<seconds> the field is set to its maximum/minimum value.
//
// Example:
// cctz::time_zone lax;
@@ -152,23 +153,85 @@ class time_zone {
SKIPPED, // the civil time did not exist (pre >= trans > post)
REPEATED, // the civil time was ambiguous (pre < trans <= post)
} kind;
- time_point<sys_seconds> pre; // uses the pre-transition offset
- time_point<sys_seconds> trans; // instant of civil-offset change
- time_point<sys_seconds> post; // uses the post-transition offset
+ time_point<seconds> pre; // uses the pre-transition offset
+ time_point<seconds> trans; // instant of civil-offset change
+ time_point<seconds> post; // uses the post-transition offset
};
civil_lookup lookup(const civil_second& cs) const;
+ // Finds the time of the next/previous offset change in this time zone.
+ //
+ // By definition, next_transition(tp, &trans) returns false when tp has
+ // its maximum value, and prev_transition(tp, &trans) returns false
+ // when tp has its minimum value. If the zone has no transitions, the
+ // result will also be false no matter what the argument.
+ //
+ // Otherwise, when tp has its minimum value, next_transition(tp, &trans)
+ // returns true and sets trans to the first recorded transition. Chains
+ // of calls to next_transition()/prev_transition() will eventually return
+ // false, but it is unspecified exactly when next_transition(tp, &trans)
+ // jumps to false, or what time is set by prev_transition(tp, &trans) for
+ // a very distant tp.
+ //
+ // Note: Enumeration of time-zone transitions is for informational purposes
+ // only. Modern time-related code should not care about when offset changes
+ // occur.
+ //
+ // Example:
+ // cctz::time_zone nyc;
+ // if (!cctz::load_time_zone("America/New_York", &nyc)) { ... }
+ // const auto now = std::chrono::system_clock::now();
+ // auto tp = cctz::time_point<cctz::seconds>::min();
+ // cctz::time_zone::civil_transition trans;
+ // while (tp <= now && nyc.next_transition(tp, &trans)) {
+ // // transition: trans.from -> trans.to
+ // tp = nyc.lookup(trans.to).trans;
+ // }
+ struct civil_transition {
+ civil_second from; // the civil time we jump from
+ civil_second to; // the civil time we jump to
+ };
+ bool next_transition(const time_point<seconds>& tp,
+ civil_transition* trans) const;
+ template <typename D>
+ bool next_transition(const time_point<D>& tp,
+ civil_transition* trans) const {
+ return next_transition(detail::split_seconds(tp).first, trans);
+ }
+ bool prev_transition(const time_point<seconds>& tp,
+ civil_transition* trans) const;
+ template <typename D>
+ bool prev_transition(const time_point<D>& tp,
+ civil_transition* trans) const {
+ return prev_transition(detail::split_seconds(tp).first, trans);
+ }
+
+ // version() and description() provide additional information about the
+ // time zone. The content of each of the returned strings is unspecified,
+ // however, when the IANA Time Zone Database is the underlying data source
+ // the version() std::string will be in the familar form (e.g, "2018e") or
+ // empty when unavailable.
+ //
+ // Note: These functions are for informational or testing purposes only.
+ std::string version() const; // empty when unknown
+ std::string description() const;
+
+ // Relational operators.
+ friend bool operator==(time_zone lhs, time_zone rhs) {
+ return &lhs.effective_impl() == &rhs.effective_impl();
+ }
+ friend bool operator!=(time_zone lhs, time_zone rhs) {
+ return !(lhs == rhs);
+ }
+
class Impl;
private:
explicit time_zone(const Impl* impl) : impl_(impl) {}
+ const Impl& effective_impl() const; // handles implicit UTC
const Impl* impl_;
};
-// Relational operators.
-bool operator==(time_zone lhs, time_zone rhs);
-inline bool operator!=(time_zone lhs, time_zone rhs) { return !(lhs == rhs); }
-
// Loads the named time zone. May perform I/O on the initial load.
// If the name is invalid, or some other kind of error occurs, returns
// false and "*tz" is set to the UTC time zone.
@@ -180,9 +243,10 @@ time_zone utc_time_zone();
// Returns a time zone that is a fixed offset (seconds east) from UTC.
// Note: If the absolute value of the offset is greater than 24 hours
// you'll get UTC (i.e., zero offset) instead.
-time_zone fixed_time_zone(const sys_seconds& offset);
+time_zone fixed_time_zone(const seconds& offset);
// Returns a time zone representing the local time zone. Falls back to UTC.
+// Note: local_time_zone.name() may only be something like "localtime".
time_zone local_time_zone();
// Returns the civil time (cctz::civil_second) within the given time zone at
@@ -199,8 +263,8 @@ inline civil_second convert(const time_point<D>& tp, const time_zone& tz) {
// it was either repeated or non-existent), then the returned time_point is
// the best estimate that preserves relative order. That is, this function
// guarantees that if cs1 < cs2, then convert(cs1, tz) <= convert(cs2, tz).
-inline time_point<sys_seconds> convert(const civil_second& cs,
- const time_zone& tz) {
+inline time_point<seconds> convert(const civil_second& cs,
+ const time_zone& tz) {
const time_zone::civil_lookup cl = tz.lookup(cs);
if (cl.kind == time_zone::civil_lookup::SKIPPED) return cl.trans;
return cl.pre;
@@ -208,10 +272,10 @@ inline time_point<sys_seconds> convert(const civil_second& cs,
namespace detail {
using femtoseconds = std::chrono::duration<std::int_fast64_t, std::femto>;
-std::string format(const std::string&, const time_point<sys_seconds>&,
+std::string format(const std::string&, const time_point<seconds>&,
const femtoseconds&, const time_zone&);
bool parse(const std::string&, const std::string&, const time_zone&,
- time_point<sys_seconds>*, femtoseconds*, std::string* err = nullptr);
+ time_point<seconds>*, femtoseconds*, std::string* err = nullptr);
} // namespace detail
// Formats the given time_point in the given cctz::time_zone according to
@@ -226,7 +290,7 @@ bool parse(const std::string&, const std::string&, const time_zone&,
// - %E*f - Fractional seconds with full precision (a literal '*')
// - %E4Y - Four-character years (-999 ... -001, 0000, 0001 ... 9999)
//
-// Note that %E0S behaves like %S, and %E0f produces no characters. In
+// Note that %E0S behaves like %S, and %E0f produces no characters. In
// contrast %E*f always produces at least one digit, which may be '0'.
//
// Note that %Y produces as many characters as it takes to fully render the
@@ -253,7 +317,7 @@ inline std::string format(const std::string& fmt, const time_point<D>& tp,
// Parses an input std::string according to the provided format std::string and
// returns the corresponding time_point. Uses strftime()-like formatting
// options, with the same extensions as cctz::format(), but with the
-// exceptions that %E#S is interpreted as %E*S, and %E#f as %E*f. %Ez
+// exceptions that %E#S is interpreted as %E*S, and %E#f as %E*f. %Ez
// and %E*z also accept the same inputs.
//
// %Y consumes as many numeric characters as it can, so the matching data
@@ -298,7 +362,7 @@ inline std::string format(const std::string& fmt, const time_point<D>& tp,
template <typename D>
inline bool parse(const std::string& fmt, const std::string& input,
const time_zone& tz, time_point<D>* tpp) {
- time_point<sys_seconds> sec;
+ time_point<seconds> sec;
detail::femtoseconds fs;
const bool b = detail::parse(fmt, input, tz, &sec, &fs);
if (b) {
diff --git a/absl/time/internal/cctz/include/cctz/zone_info_source.h b/absl/time/internal/cctz/include/cctz/zone_info_source.h
index 4d9d8f87..20a76979 100644
--- a/absl/time/internal/cctz/include/cctz/zone_info_source.h
+++ b/absl/time/internal/cctz/include/cctz/zone_info_source.h
@@ -31,6 +31,11 @@ class ZoneInfoSource {
virtual std::size_t Read(void* ptr, std::size_t size) = 0; // like fread()
virtual int Skip(std::size_t offset) = 0; // like fseek()
+
+ // Until the zoneinfo data supports versioning information, we provide
+ // a way for a ZoneInfoSource to indicate it out-of-band. The default
+ // implementation returns an empty std::string.
+ virtual std::string Version() const;
};
} // namespace cctz
diff --git a/absl/time/internal/cctz/src/cctz_benchmark.cc b/absl/time/internal/cctz/src/cctz_benchmark.cc
index f13cb4ee..c97df78c 100644
--- a/absl/time/internal/cctz/src/cctz_benchmark.cc
+++ b/absl/time/internal/cctz/src/cctz_benchmark.cc
@@ -754,23 +754,21 @@ void BM_Zone_LoadAllTimeZonesCached(benchmark::State& state) {
}
BENCHMARK(BM_Zone_LoadAllTimeZonesCached);
-void BM_Zone_TimeZoneImplGetImplicit(benchmark::State& state) {
+void BM_Zone_TimeZoneEqualityImplicit(benchmark::State& state) {
cctz::time_zone tz; // implicit UTC
- cctz::time_zone::Impl::get(tz);
while (state.KeepRunning()) {
- cctz::time_zone::Impl::get(tz);
+ benchmark::DoNotOptimize(tz == tz);
}
}
-BENCHMARK(BM_Zone_TimeZoneImplGetImplicit);
+BENCHMARK(BM_Zone_TimeZoneEqualityImplicit);
-void BM_Zone_TimeZoneImplGetExplicit(benchmark::State& state) {
+void BM_Zone_TimeZoneEqualityExplicit(benchmark::State& state) {
cctz::time_zone tz = cctz::utc_time_zone(); // explicit UTC
- cctz::time_zone::Impl::get(tz);
while (state.KeepRunning()) {
- cctz::time_zone::Impl::get(tz);
+ benchmark::DoNotOptimize(tz == tz);
}
}
-BENCHMARK(BM_Zone_TimeZoneImplGetExplicit);
+BENCHMARK(BM_Zone_TimeZoneEqualityExplicit);
void BM_Zone_UTCTimeZone(benchmark::State& state) {
cctz::time_zone tz;
diff --git a/absl/time/internal/cctz/src/time_zone_fixed.cc b/absl/time/internal/cctz/src/time_zone_fixed.cc
index 65eba356..598b08fd 100644
--- a/absl/time/internal/cctz/src/time_zone_fixed.cc
+++ b/absl/time/internal/cctz/src/time_zone_fixed.cc
@@ -42,9 +42,9 @@ int Parse02d(const char* p) {
} // namespace
-bool FixedOffsetFromName(const std::string& name, sys_seconds* offset) {
+bool FixedOffsetFromName(const std::string& name, seconds* offset) {
if (name.compare(0, std::string::npos, "UTC", 3) == 0) {
- *offset = sys_seconds::zero();
+ *offset = seconds::zero();
return true;
}
@@ -69,12 +69,12 @@ bool FixedOffsetFromName(const std::string& name, sys_seconds* offset) {
secs += ((hours * 60) + mins) * 60;
if (secs > 24 * 60 * 60) return false; // outside supported offset range
- *offset = sys_seconds(secs * (np[0] == '-' ? -1 : 1)); // "-" means west
+ *offset = seconds(secs * (np[0] == '-' ? -1 : 1)); // "-" means west
return true;
}
-std::string FixedOffsetToName(const sys_seconds& offset) {
- if (offset == sys_seconds::zero()) return "UTC";
+std::string FixedOffsetToName(const seconds& offset) {
+ if (offset == seconds::zero()) return "UTC";
if (offset < std::chrono::hours(-24) || offset > std::chrono::hours(24)) {
// We don't support fixed-offset zones more than 24 hours
// away from UTC to avoid complications in rendering such
@@ -101,7 +101,7 @@ std::string FixedOffsetToName(const sys_seconds& offset) {
return buf;
}
-std::string FixedOffsetToAbbr(const sys_seconds& offset) {
+std::string FixedOffsetToAbbr(const seconds& offset) {
std::string abbr = FixedOffsetToName(offset);
const std::size_t prefix_len = sizeof(kFixedOffsetPrefix) - 1;
if (abbr.size() == prefix_len + 9) { // <prefix>+99:99:99
diff --git a/absl/time/internal/cctz/src/time_zone_fixed.h b/absl/time/internal/cctz/src/time_zone_fixed.h
index 7c9d11db..489b857d 100644
--- a/absl/time/internal/cctz/src/time_zone_fixed.h
+++ b/absl/time/internal/cctz/src/time_zone_fixed.h
@@ -38,9 +38,9 @@ namespace cctz {
// Note: FixedOffsetFromName() fails on syntax errors or when the parsed
// offset exceeds 24 hours. FixedOffsetToName() and FixedOffsetToAbbr()
// both produce "UTC" when the argument offset exceeds 24 hours.
-bool FixedOffsetFromName(const std::string& name, sys_seconds* offset);
-std::string FixedOffsetToName(const sys_seconds& offset);
-std::string FixedOffsetToAbbr(const sys_seconds& offset);
+bool FixedOffsetFromName(const std::string& name, seconds* offset);
+std::string FixedOffsetToName(const seconds& offset);
+std::string FixedOffsetToAbbr(const seconds& offset);
} // namespace cctz
} // namespace time_internal
diff --git a/absl/time/internal/cctz/src/time_zone_format.cc b/absl/time/internal/cctz/src/time_zone_format.cc
index 6d5ccba1..1b023848 100644
--- a/absl/time/internal/cctz/src/time_zone_format.cc
+++ b/absl/time/internal/cctz/src/time_zone_format.cc
@@ -141,6 +141,9 @@ char* Format02d(char* ep, int v) {
// Formats a UTC offset, like +00:00.
char* FormatOffset(char* ep, int offset, const char* mode) {
+ // TODO: Follow the RFC3339 "Unknown Local Offset Convention" and
+ // generate a "negative zero" when we're formatting a zero offset
+ // as the result of a failed load_time_zone().
char sign = '+';
if (offset < 0) {
offset = -offset; // bounded by 24h so no overflow
@@ -277,7 +280,7 @@ const std::int_fast64_t kExp10[kDigits10_64 + 1] = {
// not support the tm_gmtoff and tm_zone extensions to std::tm.
//
// Requires that zero() <= fs < seconds(1).
-std::string format(const std::string& format, const time_point<sys_seconds>& tp,
+std::string format(const std::string& format, const time_point<seconds>& tp,
const detail::femtoseconds& fs, const time_zone& tz) {
std::string result;
result.reserve(format.size()); // A reasonable guess for the result size.
@@ -555,7 +558,7 @@ const char* ParseTM(const char* dp, const char* fmt, std::tm* tm) {
// We also handle the %z specifier to accommodate platforms that do not
// support the tm_gmtoff extension to std::tm. %Z is parsed but ignored.
bool parse(const std::string& format, const std::string& input,
- const time_zone& tz, time_point<sys_seconds>* sec,
+ const time_zone& tz, time_point<seconds>* sec,
detail::femtoseconds* fs, std::string* err) {
// The unparsed input.
const char* data = input.c_str(); // NUL terminated
@@ -822,15 +825,15 @@ bool parse(const std::string& format, const std::string& input,
const auto tp = ptz.lookup(cs).pre;
// Checks for overflow/underflow and returns an error as necessary.
- if (tp == time_point<sys_seconds>::max()) {
- const auto al = ptz.lookup(time_point<sys_seconds>::max());
+ if (tp == time_point<seconds>::max()) {
+ const auto al = ptz.lookup(time_point<seconds>::max());
if (cs > al.cs) {
if (err != nullptr) *err = "Out-of-range field";
return false;
}
}
- if (tp == time_point<sys_seconds>::min()) {
- const auto al = ptz.lookup(time_point<sys_seconds>::min());
+ if (tp == time_point<seconds>::min()) {
+ const auto al = ptz.lookup(time_point<seconds>::min());
if (cs < al.cs) {
if (err != nullptr) *err = "Out-of-range field";
return false;
diff --git a/absl/time/internal/cctz/src/time_zone_format_test.cc b/absl/time/internal/cctz/src/time_zone_format_test.cc
index 7d5b02ad..a90dda76 100644
--- a/absl/time/internal/cctz/src/time_zone_format_test.cc
+++ b/absl/time/internal/cctz/src/time_zone_format_test.cc
@@ -23,15 +23,7 @@
#include "gmock/gmock.h"
#include "gtest/gtest.h"
-using std::chrono::time_point_cast;
-using std::chrono::system_clock;
-using std::chrono::nanoseconds;
-using std::chrono::microseconds;
-using std::chrono::milliseconds;
-using std::chrono::seconds;
-using std::chrono::minutes;
-using std::chrono::hours;
-using testing::HasSubstr;
+namespace chrono = std::chrono;
namespace absl {
namespace time_internal {
@@ -72,6 +64,17 @@ void TestFormatSpecifier(time_point<D> tp, time_zone tz, const std::string& fmt,
EXPECT_EQ("xxx " + ans + " yyy", format("xxx " + fmt + " yyy", tp, tz));
}
+// These tests sometimes run on platforms that have zoneinfo data so old
+// that the transition we are attempting to check does not exist, most
+// notably Android emulators. Fortunately, AndroidZoneInfoSource supports
+// time_zone::version() so, in cases where we've learned that it matters,
+// we can make the check conditionally.
+int VersionCmp(time_zone tz, const std::string& target) {
+ std::string version = tz.version();
+ if (version.empty() && !target.empty()) return 1; // unknown > known
+ return version.compare(target);
+}
+
} // namespace
//
@@ -81,33 +84,36 @@ void TestFormatSpecifier(time_point<D> tp, time_zone tz, const std::string& fmt,
TEST(Format, TimePointResolution) {
const char kFmt[] = "%H:%M:%E*S";
const time_zone utc = utc_time_zone();
- const time_point<nanoseconds> t0 = system_clock::from_time_t(1420167845) +
- milliseconds(123) + microseconds(456) +
- nanoseconds(789);
- EXPECT_EQ("03:04:05.123456789",
- format(kFmt, time_point_cast<nanoseconds>(t0), utc));
- EXPECT_EQ("03:04:05.123456",
- format(kFmt, time_point_cast<microseconds>(t0), utc));
- EXPECT_EQ("03:04:05.123",
- format(kFmt, time_point_cast<milliseconds>(t0), utc));
+ const time_point<chrono::nanoseconds> t0 =
+ chrono::system_clock::from_time_t(1420167845) +
+ chrono::milliseconds(123) + chrono::microseconds(456) +
+ chrono::nanoseconds(789);
+ EXPECT_EQ(
+ "03:04:05.123456789",
+ format(kFmt, chrono::time_point_cast<chrono::nanoseconds>(t0), utc));
+ EXPECT_EQ(
+ "03:04:05.123456",
+ format(kFmt, chrono::time_point_cast<chrono::microseconds>(t0), utc));
+ EXPECT_EQ(
+ "03:04:05.123",
+ format(kFmt, chrono::time_point_cast<chrono::milliseconds>(t0), utc));
EXPECT_EQ("03:04:05",
- format(kFmt, time_point_cast<seconds>(t0), utc));
+ format(kFmt, chrono::time_point_cast<chrono::seconds>(t0), utc));
EXPECT_EQ("03:04:05",
- format(kFmt, time_point_cast<sys_seconds>(t0), utc));
+ format(kFmt, chrono::time_point_cast<absl::time_internal::cctz::seconds>(t0), utc));
EXPECT_EQ("03:04:00",
- format(kFmt, time_point_cast<minutes>(t0), utc));
+ format(kFmt, chrono::time_point_cast<chrono::minutes>(t0), utc));
EXPECT_EQ("03:00:00",
- format(kFmt, time_point_cast<hours>(t0), utc));
+ format(kFmt, chrono::time_point_cast<chrono::hours>(t0), utc));
}
TEST(Format, TimePointExtendedResolution) {
const char kFmt[] = "%H:%M:%E*S";
const time_zone utc = utc_time_zone();
- const time_point<sys_seconds> tp =
- std::chrono::time_point_cast<sys_seconds>(
- std::chrono::system_clock::from_time_t(0)) +
- std::chrono::hours(12) + std::chrono::minutes(34) +
- std::chrono::seconds(56);
+ const time_point<absl::time_internal::cctz::seconds> tp =
+ chrono::time_point_cast<absl::time_internal::cctz::seconds>(
+ chrono::system_clock::from_time_t(0)) +
+ chrono::hours(12) + chrono::minutes(34) + chrono::seconds(56);
EXPECT_EQ(
"12:34:56.123456789012345",
@@ -132,7 +138,7 @@ TEST(Format, TimePointExtendedResolution) {
TEST(Format, Basics) {
time_zone tz = utc_time_zone();
- time_point<nanoseconds> tp = system_clock::from_time_t(0);
+ time_point<chrono::nanoseconds> tp = chrono::system_clock::from_time_t(0);
// Starts with a couple basic edge cases.
EXPECT_EQ("", format("", tp, tz));
@@ -145,8 +151,9 @@ TEST(Format, Basics) {
std::string bigger(100000, 'x');
EXPECT_EQ(bigger, format(bigger, tp, tz));
- tp += hours(13) + minutes(4) + seconds(5);
- tp += milliseconds(6) + microseconds(7) + nanoseconds(8);
+ tp += chrono::hours(13) + chrono::minutes(4) + chrono::seconds(5);
+ tp += chrono::milliseconds(6) + chrono::microseconds(7) +
+ chrono::nanoseconds(8);
EXPECT_EQ("1970-01-01", format("%Y-%m-%d", tp, tz));
EXPECT_EQ("13:04:05", format("%H:%M:%S", tp, tz));
EXPECT_EQ("13:04:05.006", format("%H:%M:%E3S", tp, tz));
@@ -156,7 +163,7 @@ TEST(Format, Basics) {
TEST(Format, PosixConversions) {
const time_zone tz = utc_time_zone();
- auto tp = system_clock::from_time_t(0);
+ auto tp = chrono::system_clock::from_time_t(0);
TestFormatSpecifier(tp, tz, "%d", "01");
TestFormatSpecifier(tp, tz, "%e", " 1"); // extension but internal support
@@ -196,7 +203,7 @@ TEST(Format, PosixConversions) {
TEST(Format, LocaleSpecific) {
const time_zone tz = utc_time_zone();
- auto tp = system_clock::from_time_t(0);
+ auto tp = chrono::system_clock::from_time_t(0);
TestFormatSpecifier(tp, tz, "%a", "Thu");
TestFormatSpecifier(tp, tz, "%A", "Thursday");
@@ -205,8 +212,8 @@ TEST(Format, LocaleSpecific) {
// %c should at least produce the numeric year and time-of-day.
const std::string s = format("%c", tp, utc_time_zone());
- EXPECT_THAT(s, HasSubstr("1970"));
- EXPECT_THAT(s, HasSubstr("00:00:00"));
+ EXPECT_THAT(s, testing::HasSubstr("1970"));
+ EXPECT_THAT(s, testing::HasSubstr("00:00:00"));
TestFormatSpecifier(tp, tz, "%p", "AM");
TestFormatSpecifier(tp, tz, "%x", "01/01/70");
@@ -245,7 +252,7 @@ TEST(Format, LocaleSpecific) {
TEST(Format, Escaping) {
const time_zone tz = utc_time_zone();
- auto tp = system_clock::from_time_t(0);
+ auto tp = chrono::system_clock::from_time_t(0);
TestFormatSpecifier(tp, tz, "%%", "%");
TestFormatSpecifier(tp, tz, "%%a", "%a");
@@ -266,8 +273,8 @@ TEST(Format, ExtendedSeconds) {
const time_zone tz = utc_time_zone();
// No subseconds.
- time_point<nanoseconds> tp = system_clock::from_time_t(0);
- tp += seconds(5);
+ time_point<chrono::nanoseconds> tp = chrono::system_clock::from_time_t(0);
+ tp += chrono::seconds(5);
EXPECT_EQ("05", format("%E*S", tp, tz));
EXPECT_EQ("05", format("%E0S", tp, tz));
EXPECT_EQ("05.0", format("%E1S", tp, tz));
@@ -287,7 +294,8 @@ TEST(Format, ExtendedSeconds) {
EXPECT_EQ("05.000000000000000", format("%E15S", tp, tz));
// With subseconds.
- tp += milliseconds(6) + microseconds(7) + nanoseconds(8);
+ tp += chrono::milliseconds(6) + chrono::microseconds(7) +
+ chrono::nanoseconds(8);
EXPECT_EQ("05.006007008", format("%E*S", tp, tz));
EXPECT_EQ("05", format("%E0S", tp, tz));
EXPECT_EQ("05.0", format("%E1S", tp, tz));
@@ -307,17 +315,18 @@ TEST(Format, ExtendedSeconds) {
EXPECT_EQ("05.006007008000000", format("%E15S", tp, tz));
// Times before the Unix epoch.
- tp = system_clock::from_time_t(0) + microseconds(-1);
+ tp = chrono::system_clock::from_time_t(0) + chrono::microseconds(-1);
EXPECT_EQ("1969-12-31 23:59:59.999999",
format("%Y-%m-%d %H:%M:%E*S", tp, tz));
// Here is a "%E*S" case we got wrong for a while. While the first
// instant below is correctly rendered as "...:07.333304", the second
// one used to appear as "...:07.33330499999999999".
- tp = system_clock::from_time_t(0) + microseconds(1395024427333304);
+ tp = chrono::system_clock::from_time_t(0) +
+ chrono::microseconds(1395024427333304);
EXPECT_EQ("2014-03-17 02:47:07.333304",
format("%Y-%m-%d %H:%M:%E*S", tp, tz));
- tp += microseconds(1);
+ tp += chrono::microseconds(1);
EXPECT_EQ("2014-03-17 02:47:07.333305",
format("%Y-%m-%d %H:%M:%E*S", tp, tz));
}
@@ -326,8 +335,8 @@ TEST(Format, ExtendedSubeconds) {
const time_zone tz = utc_time_zone();
// No subseconds.
- time_point<nanoseconds> tp = system_clock::from_time_t(0);
- tp += seconds(5);
+ time_point<chrono::nanoseconds> tp = chrono::system_clock::from_time_t(0);
+ tp += chrono::seconds(5);
EXPECT_EQ("0", format("%E*f", tp, tz));
EXPECT_EQ("", format("%E0f", tp, tz));
EXPECT_EQ("0", format("%E1f", tp, tz));
@@ -347,7 +356,8 @@ TEST(Format, ExtendedSubeconds) {
EXPECT_EQ("000000000000000", format("%E15f", tp, tz));
// With subseconds.
- tp += milliseconds(6) + microseconds(7) + nanoseconds(8);
+ tp += chrono::milliseconds(6) + chrono::microseconds(7) +
+ chrono::nanoseconds(8);
EXPECT_EQ("006007008", format("%E*f", tp, tz));
EXPECT_EQ("", format("%E0f", tp, tz));
EXPECT_EQ("0", format("%E1f", tp, tz));
@@ -367,17 +377,18 @@ TEST(Format, ExtendedSubeconds) {
EXPECT_EQ("006007008000000", format("%E15f", tp, tz));
// Times before the Unix epoch.
- tp = system_clock::from_time_t(0) + microseconds(-1);
+ tp = chrono::system_clock::from_time_t(0) + chrono::microseconds(-1);
EXPECT_EQ("1969-12-31 23:59:59.999999",
format("%Y-%m-%d %H:%M:%S.%E*f", tp, tz));
// Here is a "%E*S" case we got wrong for a while. While the first
// instant below is correctly rendered as "...:07.333304", the second
// one used to appear as "...:07.33330499999999999".
- tp = system_clock::from_time_t(0) + microseconds(1395024427333304);
+ tp = chrono::system_clock::from_time_t(0) +
+ chrono::microseconds(1395024427333304);
EXPECT_EQ("2014-03-17 02:47:07.333304",
format("%Y-%m-%d %H:%M:%S.%E*f", tp, tz));
- tp += microseconds(1);
+ tp += chrono::microseconds(1);
EXPECT_EQ("2014-03-17 02:47:07.333305",
format("%Y-%m-%d %H:%M:%S.%E*f", tp, tz));
}
@@ -392,8 +403,8 @@ TEST(Format, CompareExtendSecondsVsSubseconds) {
auto fmt_B = [](const std::string& prec) { return "%S.%E" + prec + "f"; };
// No subseconds:
- time_point<nanoseconds> tp = system_clock::from_time_t(0);
- tp += seconds(5);
+ time_point<chrono::nanoseconds> tp = chrono::system_clock::from_time_t(0);
+ tp += chrono::seconds(5);
// ... %E*S and %S.%E*f are different.
EXPECT_EQ("05", format(fmt_A("*"), tp, tz));
EXPECT_EQ("05.0", format(fmt_B("*"), tp, tz));
@@ -409,7 +420,8 @@ TEST(Format, CompareExtendSecondsVsSubseconds) {
// With subseconds:
// ... %E*S and %S.%E*f are the same.
- tp += milliseconds(6) + microseconds(7) + nanoseconds(8);
+ tp += chrono::milliseconds(6) + chrono::microseconds(7) +
+ chrono::nanoseconds(8);
EXPECT_EQ("05.006007008", format(fmt_A("*"), tp, tz));
EXPECT_EQ("05.006007008", format(fmt_B("*"), tp, tz));
// ... %E0S and %S.%E0f are different.
@@ -424,7 +436,7 @@ TEST(Format, CompareExtendSecondsVsSubseconds) {
}
TEST(Format, ExtendedOffset) {
- auto tp = system_clock::from_time_t(0);
+ auto tp = chrono::system_clock::from_time_t(0);
time_zone tz = utc_time_zone();
TestFormatSpecifier(tp, tz, "%Ez", "+00:00");
@@ -446,30 +458,28 @@ TEST(Format, ExtendedOffset) {
TEST(Format, ExtendedSecondOffset) {
const time_zone utc = utc_time_zone();
- time_point<seconds> tp;
+ time_point<chrono::seconds> tp;
time_zone tz;
EXPECT_TRUE(load_time_zone("America/New_York", &tz));
tp = convert(civil_second(1883, 11, 18, 16, 59, 59), utc);
if (tz.lookup(tp).offset == -5 * 60 * 60) {
- // We're likely dealing with zoneinfo that doesn't support really old
- // timestamps, so America/New_York never looks to be on local mean time.
+ // It looks like the tzdata is only 32 bit (probably macOS),
+ // which bottoms out at 1901-12-13T20:45:52+00:00.
} else {
TestFormatSpecifier(tp, tz, "%E*z", "-04:56:02");
TestFormatSpecifier(tp, tz, "%Ez", "-04:56");
}
- tp += seconds(1);
+ tp += chrono::seconds(1);
TestFormatSpecifier(tp, tz, "%E*z", "-05:00:00");
EXPECT_TRUE(load_time_zone("Europe/Moscow", &tz));
tp = convert(civil_second(1919, 6, 30, 23, 59, 59), utc);
-#if defined(__ANDROID__) && __ANDROID_API__ < 25
- // Only Android 'N'.1 and beyond have this tz2016g transition.
-#else
- TestFormatSpecifier(tp, tz, "%E*z", "+04:31:19");
- TestFormatSpecifier(tp, tz, "%Ez", "+04:31");
-#endif
- tp += seconds(1);
+ if (VersionCmp(tz, "2016g") >= 0) {
+ TestFormatSpecifier(tp, tz, "%E*z", "+04:31:19");
+ TestFormatSpecifier(tp, tz, "%Ez", "+04:31");
+ }
+ tp += chrono::seconds(1);
TestFormatSpecifier(tp, tz, "%E*z", "+04:00:00");
}
@@ -510,44 +520,44 @@ TEST(Format, RFC3339Format) {
time_zone tz;
EXPECT_TRUE(load_time_zone("America/Los_Angeles", &tz));
- time_point<nanoseconds> tp =
+ time_point<chrono::nanoseconds> tp =
convert(civil_second(1977, 6, 28, 9, 8, 7), tz);
EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_full, tp, tz));
EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
- tp += milliseconds(100);
+ tp += chrono::milliseconds(100);
EXPECT_EQ("1977-06-28T09:08:07.1-07:00", format(RFC3339_full, tp, tz));
EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
- tp += milliseconds(20);
+ tp += chrono::milliseconds(20);
EXPECT_EQ("1977-06-28T09:08:07.12-07:00", format(RFC3339_full, tp, tz));
EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
- tp += milliseconds(3);
+ tp += chrono::milliseconds(3);
EXPECT_EQ("1977-06-28T09:08:07.123-07:00", format(RFC3339_full, tp, tz));
EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
- tp += microseconds(400);
+ tp += chrono::microseconds(400);
EXPECT_EQ("1977-06-28T09:08:07.1234-07:00", format(RFC3339_full, tp, tz));
EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
- tp += microseconds(50);
+ tp += chrono::microseconds(50);
EXPECT_EQ("1977-06-28T09:08:07.12345-07:00", format(RFC3339_full, tp, tz));
EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
- tp += microseconds(6);
+ tp += chrono::microseconds(6);
EXPECT_EQ("1977-06-28T09:08:07.123456-07:00", format(RFC3339_full, tp, tz));
EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
- tp += nanoseconds(700);
+ tp += chrono::nanoseconds(700);
EXPECT_EQ("1977-06-28T09:08:07.1234567-07:00", format(RFC3339_full, tp, tz));
EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
- tp += nanoseconds(80);
+ tp += chrono::nanoseconds(80);
EXPECT_EQ("1977-06-28T09:08:07.12345678-07:00", format(RFC3339_full, tp, tz));
EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
- tp += nanoseconds(9);
+ tp += chrono::nanoseconds(9);
EXPECT_EQ("1977-06-28T09:08:07.123456789-07:00",
format(RFC3339_full, tp, tz));
EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
@@ -570,13 +580,13 @@ TEST(Parse, TimePointResolution) {
const char kFmt[] = "%H:%M:%E*S";
const time_zone utc = utc_time_zone();
- time_point<nanoseconds> tp_ns;
+ time_point<chrono::nanoseconds> tp_ns;
EXPECT_TRUE(parse(kFmt, "03:04:05.123456789", utc, &tp_ns));
EXPECT_EQ("03:04:05.123456789", format(kFmt, tp_ns, utc));
EXPECT_TRUE(parse(kFmt, "03:04:05.123456", utc, &tp_ns));
EXPECT_EQ("03:04:05.123456", format(kFmt, tp_ns, utc));
- time_point<microseconds> tp_us;
+ time_point<chrono::microseconds> tp_us;
EXPECT_TRUE(parse(kFmt, "03:04:05.123456789", utc, &tp_us));
EXPECT_EQ("03:04:05.123456", format(kFmt, tp_us, utc));
EXPECT_TRUE(parse(kFmt, "03:04:05.123456", utc, &tp_us));
@@ -584,7 +594,7 @@ TEST(Parse, TimePointResolution) {
EXPECT_TRUE(parse(kFmt, "03:04:05.123", utc, &tp_us));
EXPECT_EQ("03:04:05.123", format(kFmt, tp_us, utc));
- time_point<milliseconds> tp_ms;
+ time_point<chrono::milliseconds> tp_ms;
EXPECT_TRUE(parse(kFmt, "03:04:05.123456", utc, &tp_ms));
EXPECT_EQ("03:04:05.123", format(kFmt, tp_ms, utc));
EXPECT_TRUE(parse(kFmt, "03:04:05.123", utc, &tp_ms));
@@ -592,17 +602,17 @@ TEST(Parse, TimePointResolution) {
EXPECT_TRUE(parse(kFmt, "03:04:05", utc, &tp_ms));
EXPECT_EQ("03:04:05", format(kFmt, tp_ms, utc));
- time_point<seconds> tp_s;
+ time_point<chrono::seconds> tp_s;
EXPECT_TRUE(parse(kFmt, "03:04:05.123", utc, &tp_s));
EXPECT_EQ("03:04:05", format(kFmt, tp_s, utc));
EXPECT_TRUE(parse(kFmt, "03:04:05", utc, &tp_s));
EXPECT_EQ("03:04:05", format(kFmt, tp_s, utc));
- time_point<minutes> tp_m;
+ time_point<chrono::minutes> tp_m;
EXPECT_TRUE(parse(kFmt, "03:04:05", utc, &tp_m));
EXPECT_EQ("03:04:00", format(kFmt, tp_m, utc));
- time_point<hours> tp_h;
+ time_point<chrono::hours> tp_h;
EXPECT_TRUE(parse(kFmt, "03:04:05", utc, &tp_h));
EXPECT_EQ("03:00:00", format(kFmt, tp_h, utc));
}
@@ -611,7 +621,7 @@ TEST(Parse, TimePointExtendedResolution) {
const char kFmt[] = "%H:%M:%E*S";
const time_zone utc = utc_time_zone();
- time_point<sys_seconds> tp;
+ time_point<absl::time_internal::cctz::seconds> tp;
detail::femtoseconds fs;
EXPECT_TRUE(detail::parse(kFmt, "12:34:56.123456789012345", utc, &tp, &fs));
EXPECT_EQ("12:34:56.123456789012345", detail::format(kFmt, tp, fs, utc));
@@ -629,11 +639,12 @@ TEST(Parse, TimePointExtendedResolution) {
TEST(Parse, Basics) {
time_zone tz = utc_time_zone();
- time_point<nanoseconds> tp = system_clock::from_time_t(1234567890);
+ time_point<chrono::nanoseconds> tp =
+ chrono::system_clock::from_time_t(1234567890);
// Simple edge cases.
EXPECT_TRUE(parse("", "", tz, &tp));
- EXPECT_EQ(system_clock::from_time_t(0), tp); // everything defaulted
+ EXPECT_EQ(chrono::system_clock::from_time_t(0), tp); // everything defaulted
EXPECT_TRUE(parse(" ", " ", tz, &tp));
EXPECT_TRUE(parse(" ", " ", tz, &tp));
EXPECT_TRUE(parse("x", "x", tz, &tp));
@@ -647,7 +658,7 @@ TEST(Parse, Basics) {
TEST(Parse, WithTimeZone) {
time_zone tz;
EXPECT_TRUE(load_time_zone("America/Los_Angeles", &tz));
- time_point<nanoseconds> tp;
+ time_point<chrono::nanoseconds> tp;
// We can parse a std::string without a UTC offset if we supply a timezone.
EXPECT_TRUE(parse("%Y-%m-%d %H:%M:%S", "2013-06-28 19:08:09", tz, &tp));
@@ -672,7 +683,7 @@ TEST(Parse, WithTimeZone) {
TEST(Parse, LeapSecond) {
time_zone tz;
EXPECT_TRUE(load_time_zone("America/Los_Angeles", &tz));
- time_point<nanoseconds> tp;
+ time_point<chrono::nanoseconds> tp;
// ":59" -> ":59"
EXPECT_TRUE(parse(RFC3339_full, "2013-06-28T07:08:59-08:00", tz, &tp));
@@ -696,7 +707,7 @@ TEST(Parse, LeapSecond) {
TEST(Parse, ErrorCases) {
const time_zone tz = utc_time_zone();
- auto tp = system_clock::from_time_t(0);
+ auto tp = chrono::system_clock::from_time_t(0);
// Illegal trailing data.
EXPECT_FALSE(parse("%S", "123", tz, &tp));
@@ -739,7 +750,7 @@ TEST(Parse, ErrorCases) {
TEST(Parse, PosixConversions) {
time_zone tz = utc_time_zone();
- auto tp = system_clock::from_time_t(0);
+ auto tp = chrono::system_clock::from_time_t(0);
const auto reset = convert(civil_second(1977, 6, 28, 9, 8, 7), tz);
tp = reset;
@@ -828,14 +839,14 @@ TEST(Parse, PosixConversions) {
tp = reset;
EXPECT_TRUE(parse("%s", "1234567890", tz, &tp));
- EXPECT_EQ(system_clock::from_time_t(1234567890), tp);
+ EXPECT_EQ(chrono::system_clock::from_time_t(1234567890), tp);
// %s conversion, like %z/%Ez, pays no heed to the optional zone.
time_zone lax;
EXPECT_TRUE(load_time_zone("America/Los_Angeles", &lax));
tp = reset;
EXPECT_TRUE(parse("%s", "1234567890", lax, &tp));
- EXPECT_EQ(system_clock::from_time_t(1234567890), tp);
+ EXPECT_EQ(chrono::system_clock::from_time_t(1234567890), tp);
// This is most important when the time has the same YMDhms
// breakdown in the zone as some other time. For example, ...
@@ -843,16 +854,16 @@ TEST(Parse, PosixConversions) {
// 1414920600 in US/Pacific -> Sun Nov 2 01:30:00 2014 (PST)
tp = reset;
EXPECT_TRUE(parse("%s", "1414917000", lax, &tp));
- EXPECT_EQ(system_clock::from_time_t(1414917000), tp);
+ EXPECT_EQ(chrono::system_clock::from_time_t(1414917000), tp);
tp = reset;
EXPECT_TRUE(parse("%s", "1414920600", lax, &tp));
- EXPECT_EQ(system_clock::from_time_t(1414920600), tp);
+ EXPECT_EQ(chrono::system_clock::from_time_t(1414920600), tp);
#endif
}
TEST(Parse, LocaleSpecific) {
time_zone tz = utc_time_zone();
- auto tp = system_clock::from_time_t(0);
+ auto tp = chrono::system_clock::from_time_t(0);
const auto reset = convert(civil_second(1977, 6, 28, 9, 8, 7), tz);
// %a is parsed but ignored.
@@ -983,7 +994,8 @@ TEST(Parse, LocaleSpecific) {
TEST(Parse, ExtendedSeconds) {
const time_zone tz = utc_time_zone();
- const time_point<nanoseconds> unix_epoch = system_clock::from_time_t(0);
+ const time_point<chrono::nanoseconds> unix_epoch =
+ chrono::system_clock::from_time_t(0);
// All %E<prec>S cases are treated the same as %E*S on input.
auto precisions = {"*", "0", "1", "2", "3", "4", "5", "6", "7",
@@ -991,47 +1003,47 @@ TEST(Parse, ExtendedSeconds) {
for (const std::string& prec : precisions) {
const std::string fmt = "%E" + prec + "S";
SCOPED_TRACE(fmt);
- time_point<nanoseconds> tp = unix_epoch;
+ time_point<chrono::nanoseconds> tp = unix_epoch;
EXPECT_TRUE(parse(fmt, "5", tz, &tp));
- EXPECT_EQ(unix_epoch + seconds(5), tp);
+ EXPECT_EQ(unix_epoch + chrono::seconds(5), tp);
tp = unix_epoch;
EXPECT_TRUE(parse(fmt, "05", tz, &tp));
- EXPECT_EQ(unix_epoch + seconds(5), tp);
+ EXPECT_EQ(unix_epoch + chrono::seconds(5), tp);
tp = unix_epoch;
EXPECT_TRUE(parse(fmt, "05.0", tz, &tp));
- EXPECT_EQ(unix_epoch + seconds(5), tp);
+ EXPECT_EQ(unix_epoch + chrono::seconds(5), tp);
tp = unix_epoch;
EXPECT_TRUE(parse(fmt, "05.00", tz, &tp));
- EXPECT_EQ(unix_epoch + seconds(5), tp);
+ EXPECT_EQ(unix_epoch + chrono::seconds(5), tp);
tp = unix_epoch;
EXPECT_TRUE(parse(fmt, "05.6", tz, &tp));
- EXPECT_EQ(unix_epoch + seconds(5) + milliseconds(600), tp);
+ EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(600), tp);
tp = unix_epoch;
EXPECT_TRUE(parse(fmt, "05.60", tz, &tp));
- EXPECT_EQ(unix_epoch + seconds(5) + milliseconds(600), tp);
+ EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(600), tp);
tp = unix_epoch;
EXPECT_TRUE(parse(fmt, "05.600", tz, &tp));
- EXPECT_EQ(unix_epoch + seconds(5) + milliseconds(600), tp);
+ EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(600), tp);
tp = unix_epoch;
EXPECT_TRUE(parse(fmt, "05.67", tz, &tp));
- EXPECT_EQ(unix_epoch + seconds(5) + milliseconds(670), tp);
+ EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(670), tp);
tp = unix_epoch;
EXPECT_TRUE(parse(fmt, "05.670", tz, &tp));
- EXPECT_EQ(unix_epoch + seconds(5) + milliseconds(670), tp);
+ EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(670), tp);
tp = unix_epoch;
EXPECT_TRUE(parse(fmt, "05.678", tz, &tp));
- EXPECT_EQ(unix_epoch + seconds(5) + milliseconds(678), tp);
+ EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(678), tp);
}
// Here is a "%E*S" case we got wrong for a while. The fractional
// part of the first instant is less than 2^31 and was correctly
// parsed, while the second (and any subsecond field >=2^31) failed.
- time_point<nanoseconds> tp = unix_epoch;
+ time_point<chrono::nanoseconds> tp = unix_epoch;
EXPECT_TRUE(parse("%E*S", "0.2147483647", tz, &tp));
- EXPECT_EQ(unix_epoch + nanoseconds(214748364), tp);
+ EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
tp = unix_epoch;
EXPECT_TRUE(parse("%E*S", "0.2147483648", tz, &tp));
- EXPECT_EQ(unix_epoch + nanoseconds(214748364), tp);
+ EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
// We should also be able to specify long strings of digits far
// beyond the current resolution and have them convert the same way.
@@ -1039,18 +1051,18 @@ TEST(Parse, ExtendedSeconds) {
EXPECT_TRUE(parse(
"%E*S", "0.214748364801234567890123456789012345678901234567890123456789",
tz, &tp));
- EXPECT_EQ(unix_epoch + nanoseconds(214748364), tp);
+ EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
}
TEST(Parse, ExtendedSecondsScan) {
const time_zone tz = utc_time_zone();
- time_point<nanoseconds> tp;
+ time_point<chrono::nanoseconds> tp;
for (int ms = 0; ms < 1000; ms += 111) {
for (int us = 0; us < 1000; us += 27) {
const int micros = ms * 1000 + us;
for (int ns = 0; ns < 1000; ns += 9) {
- const auto expected =
- system_clock::from_time_t(0) + nanoseconds(micros * 1000 + ns);
+ const auto expected = chrono::system_clock::from_time_t(0) +
+ chrono::nanoseconds(micros * 1000 + ns);
std::ostringstream oss;
oss << "0." << std::setfill('0') << std::setw(3);
oss << ms << std::setw(3) << us << std::setw(3) << ns;
@@ -1064,7 +1076,8 @@ TEST(Parse, ExtendedSecondsScan) {
TEST(Parse, ExtendedSubeconds) {
const time_zone tz = utc_time_zone();
- const time_point<nanoseconds> unix_epoch = system_clock::from_time_t(0);
+ const time_point<chrono::nanoseconds> unix_epoch =
+ chrono::system_clock::from_time_t(0);
// All %E<prec>f cases are treated the same as %E*f on input.
auto precisions = {"*", "0", "1", "2", "3", "4", "5", "6", "7",
@@ -1072,41 +1085,42 @@ TEST(Parse, ExtendedSubeconds) {
for (const std::string& prec : precisions) {
const std::string fmt = "%E" + prec + "f";
SCOPED_TRACE(fmt);
- time_point<nanoseconds> tp = unix_epoch - seconds(1);
+ time_point<chrono::nanoseconds> tp = unix_epoch - chrono::seconds(1);
EXPECT_TRUE(parse(fmt, "", tz, &tp));
EXPECT_EQ(unix_epoch, tp);
tp = unix_epoch;
EXPECT_TRUE(parse(fmt, "6", tz, &tp));
- EXPECT_EQ(unix_epoch + milliseconds(600), tp);
+ EXPECT_EQ(unix_epoch + chrono::milliseconds(600), tp);
tp = unix_epoch;
EXPECT_TRUE(parse(fmt, "60", tz, &tp));
- EXPECT_EQ(unix_epoch + milliseconds(600), tp);
+ EXPECT_EQ(unix_epoch + chrono::milliseconds(600), tp);
tp = unix_epoch;
EXPECT_TRUE(parse(fmt, "600", tz, &tp));
- EXPECT_EQ(unix_epoch + milliseconds(600), tp);
+ EXPECT_EQ(unix_epoch + chrono::milliseconds(600), tp);
tp = unix_epoch;
EXPECT_TRUE(parse(fmt, "67", tz, &tp));
- EXPECT_EQ(unix_epoch + milliseconds(670), tp);
+ EXPECT_EQ(unix_epoch + chrono::milliseconds(670), tp);
tp = unix_epoch;
EXPECT_TRUE(parse(fmt, "670", tz, &tp));
- EXPECT_EQ(unix_epoch + milliseconds(670), tp);
+ EXPECT_EQ(unix_epoch + chrono::milliseconds(670), tp);
tp = unix_epoch;
EXPECT_TRUE(parse(fmt, "678", tz, &tp));
- EXPECT_EQ(unix_epoch + milliseconds(678), tp);
+ EXPECT_EQ(unix_epoch + chrono::milliseconds(678), tp);
tp = unix_epoch;
EXPECT_TRUE(parse(fmt, "6789", tz, &tp));
- EXPECT_EQ(unix_epoch + milliseconds(678) + microseconds(900), tp);
+ EXPECT_EQ(
+ unix_epoch + chrono::milliseconds(678) + chrono::microseconds(900), tp);
}
// Here is a "%E*f" case we got wrong for a while. The fractional
// part of the first instant is less than 2^31 and was correctly
// parsed, while the second (and any subsecond field >=2^31) failed.
- time_point<nanoseconds> tp = unix_epoch;
+ time_point<chrono::nanoseconds> tp = unix_epoch;
EXPECT_TRUE(parse("%E*f", "2147483647", tz, &tp));
- EXPECT_EQ(unix_epoch + nanoseconds(214748364), tp);
+ EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
tp = unix_epoch;
EXPECT_TRUE(parse("%E*f", "2147483648", tz, &tp));
- EXPECT_EQ(unix_epoch + nanoseconds(214748364), tp);
+ EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
// We should also be able to specify long strings of digits far
// beyond the current resolution and have them convert the same way.
@@ -1114,11 +1128,11 @@ TEST(Parse, ExtendedSubeconds) {
EXPECT_TRUE(parse(
"%E*f", "214748364801234567890123456789012345678901234567890123456789",
tz, &tp));
- EXPECT_EQ(unix_epoch + nanoseconds(214748364), tp);
+ EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
}
TEST(Parse, ExtendedSubecondsScan) {
- time_point<nanoseconds> tp;
+ time_point<chrono::nanoseconds> tp;
const time_zone tz = utc_time_zone();
for (int ms = 0; ms < 1000; ms += 111) {
for (int us = 0; us < 1000; us += 27) {
@@ -1128,14 +1142,14 @@ TEST(Parse, ExtendedSubecondsScan) {
oss << std::setfill('0') << std::setw(3) << ms;
oss << std::setw(3) << us << std::setw(3) << ns;
const std::string nanos = oss.str();
- const auto expected =
- system_clock::from_time_t(0) + nanoseconds(micros * 1000 + ns);
+ const auto expected = chrono::system_clock::from_time_t(0) +
+ chrono::nanoseconds(micros * 1000 + ns);
for (int ps = 0; ps < 1000; ps += 250) {
std::ostringstream oss;
oss << std::setfill('0') << std::setw(3) << ps;
const std::string input = nanos + oss.str() + "999";
EXPECT_TRUE(parse("%E*f", input, tz, &tp));
- EXPECT_EQ(expected + nanoseconds(ps) / 1000, tp) << input;
+ EXPECT_EQ(expected + chrono::nanoseconds(ps) / 1000, tp) << input;
}
}
}
@@ -1144,7 +1158,7 @@ TEST(Parse, ExtendedSubecondsScan) {
TEST(Parse, ExtendedOffset) {
const time_zone utc = utc_time_zone();
- time_point<sys_seconds> tp;
+ time_point<absl::time_internal::cctz::seconds> tp;
// %z against +-HHMM.
EXPECT_TRUE(parse("%z", "+0000", utc, &tp));
@@ -1194,7 +1208,7 @@ TEST(Parse, ExtendedOffset) {
TEST(Parse, ExtendedSecondOffset) {
const time_zone utc = utc_time_zone();
- time_point<sys_seconds> tp;
+ time_point<absl::time_internal::cctz::seconds> tp;
// %Ez against +-HH:MM:SS.
EXPECT_TRUE(parse("%Ez", "+00:00:00", utc, &tp));
@@ -1263,7 +1277,7 @@ TEST(Parse, ExtendedSecondOffset) {
TEST(Parse, ExtendedYears) {
const time_zone utc = utc_time_zone();
const char e4y_fmt[] = "%E4Y%m%d"; // no separators
- time_point<sys_seconds> tp;
+ time_point<absl::time_internal::cctz::seconds> tp;
// %E4Y consumes exactly four chars, including any sign.
EXPECT_TRUE(parse(e4y_fmt, "-9991127", utc, &tp));
@@ -1294,45 +1308,45 @@ TEST(Parse, ExtendedYears) {
TEST(Parse, RFC3339Format) {
const time_zone tz = utc_time_zone();
- time_point<nanoseconds> tp;
+ time_point<chrono::nanoseconds> tp;
EXPECT_TRUE(parse(RFC3339_sec, "2014-02-12T20:21:00+00:00", tz, &tp));
ExpectTime(tp, tz, 2014, 2, 12, 20, 21, 0, 0, false, "UTC");
// Check that %Ez also accepts "Z" as a synonym for "+00:00".
- time_point<nanoseconds> tp2;
+ time_point<chrono::nanoseconds> tp2;
EXPECT_TRUE(parse(RFC3339_sec, "2014-02-12T20:21:00Z", tz, &tp2));
EXPECT_EQ(tp, tp2);
}
TEST(Parse, MaxRange) {
const time_zone utc = utc_time_zone();
- time_point<sys_seconds> tp;
+ time_point<absl::time_internal::cctz::seconds> tp;
// tests the upper limit using +00:00 offset
EXPECT_TRUE(
parse(RFC3339_sec, "292277026596-12-04T15:30:07+00:00", utc, &tp));
- EXPECT_EQ(tp, time_point<sys_seconds>::max());
+ EXPECT_EQ(tp, time_point<absl::time_internal::cctz::seconds>::max());
EXPECT_FALSE(
parse(RFC3339_sec, "292277026596-12-04T15:30:08+00:00", utc, &tp));
// tests the upper limit using -01:00 offset
EXPECT_TRUE(
parse(RFC3339_sec, "292277026596-12-04T14:30:07-01:00", utc, &tp));
- EXPECT_EQ(tp, time_point<sys_seconds>::max());
+ EXPECT_EQ(tp, time_point<absl::time_internal::cctz::seconds>::max());
EXPECT_FALSE(
parse(RFC3339_sec, "292277026596-12-04T15:30:07-01:00", utc, &tp));
// tests the lower limit using +00:00 offset
EXPECT_TRUE(
parse(RFC3339_sec, "-292277022657-01-27T08:29:52+00:00", utc, &tp));
- EXPECT_EQ(tp, time_point<sys_seconds>::min());
+ EXPECT_EQ(tp, time_point<absl::time_internal::cctz::seconds>::min());
EXPECT_FALSE(
parse(RFC3339_sec, "-292277022657-01-27T08:29:51+00:00", utc, &tp));
// tests the lower limit using +01:00 offset
EXPECT_TRUE(
parse(RFC3339_sec, "-292277022657-01-27T09:29:52+01:00", utc, &tp));
- EXPECT_EQ(tp, time_point<sys_seconds>::min());
+ EXPECT_EQ(tp, time_point<absl::time_internal::cctz::seconds>::min());
EXPECT_FALSE(
parse(RFC3339_sec, "-292277022657-01-27T08:29:51+01:00", utc, &tp));
@@ -1355,11 +1369,11 @@ TEST(FormatParse, RoundTrip) {
time_zone lax;
EXPECT_TRUE(load_time_zone("America/Los_Angeles", &lax));
const auto in = convert(civil_second(1977, 6, 28, 9, 8, 7), lax);
- const auto subseconds = nanoseconds(654321);
+ const auto subseconds = chrono::nanoseconds(654321);
// RFC3339, which renders subseconds.
{
- time_point<nanoseconds> out;
+ time_point<chrono::nanoseconds> out;
const std::string s = format(RFC3339_full, in + subseconds, lax);
EXPECT_TRUE(parse(RFC3339_full, s, lax, &out)) << s;
EXPECT_EQ(in + subseconds, out); // RFC3339_full includes %Ez
@@ -1367,7 +1381,7 @@ TEST(FormatParse, RoundTrip) {
// RFC1123, which only does whole seconds.
{
- time_point<nanoseconds> out;
+ time_point<chrono::nanoseconds> out;
const std::string s = format(RFC1123_full, in, lax);
EXPECT_TRUE(parse(RFC1123_full, s, lax, &out)) << s;
EXPECT_EQ(in, out); // RFC1123_full includes %z
@@ -1380,7 +1394,7 @@ TEST(FormatParse, RoundTrip) {
// Even though we don't know what %c will produce, it should roundtrip,
// but only in the 0-offset timezone.
{
- time_point<nanoseconds> out;
+ time_point<chrono::nanoseconds> out;
time_zone utc = utc_time_zone();
const std::string s = format("%c", in, utc);
EXPECT_TRUE(parse("%c", s, utc, &out)) << s;
@@ -1391,18 +1405,18 @@ TEST(FormatParse, RoundTrip) {
TEST(FormatParse, RoundTripDistantFuture) {
const time_zone utc = utc_time_zone();
- const time_point<sys_seconds> in = time_point<sys_seconds>::max();
+ const time_point<absl::time_internal::cctz::seconds> in = time_point<absl::time_internal::cctz::seconds>::max();
const std::string s = format(RFC3339_full, in, utc);
- time_point<sys_seconds> out;
+ time_point<absl::time_internal::cctz::seconds> out;
EXPECT_TRUE(parse(RFC3339_full, s, utc, &out)) << s;
EXPECT_EQ(in, out);
}
TEST(FormatParse, RoundTripDistantPast) {
const time_zone utc = utc_time_zone();
- const time_point<sys_seconds> in = time_point<sys_seconds>::min();
+ const time_point<absl::time_internal::cctz::seconds> in = time_point<absl::time_internal::cctz::seconds>::min();
const std::string s = format(RFC3339_full, in, utc);
- time_point<sys_seconds> out;
+ time_point<absl::time_internal::cctz::seconds> out;
EXPECT_TRUE(parse(RFC3339_full, s, utc, &out)) << s;
EXPECT_EQ(in, out);
}
diff --git a/absl/time/internal/cctz/src/time_zone_if.h b/absl/time/internal/cctz/src/time_zone_if.h
index ce4da1b7..e4bd3866 100644
--- a/absl/time/internal/cctz/src/time_zone_if.h
+++ b/absl/time/internal/cctz/src/time_zone_if.h
@@ -37,30 +37,32 @@ class TimeZoneIf {
virtual ~TimeZoneIf();
virtual time_zone::absolute_lookup BreakTime(
- const time_point<sys_seconds>& tp) const = 0;
+ const time_point<seconds>& tp) const = 0;
virtual time_zone::civil_lookup MakeTime(
const civil_second& cs) const = 0;
+ virtual bool NextTransition(const time_point<seconds>& tp,
+ time_zone::civil_transition* trans) const = 0;
+ virtual bool PrevTransition(const time_point<seconds>& tp,
+ time_zone::civil_transition* trans) const = 0;
+
+ virtual std::string Version() const = 0;
virtual std::string Description() const = 0;
- virtual bool NextTransition(time_point<sys_seconds>* tp) const = 0;
- virtual bool PrevTransition(time_point<sys_seconds>* tp) const = 0;
protected:
TimeZoneIf() {}
};
-// Convert between time_point<sys_seconds> and a count of seconds since
-// the Unix epoch. We assume that the std::chrono::system_clock and the
+// Convert between time_point<seconds> and a count of seconds since the
+// Unix epoch. We assume that the std::chrono::system_clock and the
// Unix clock are second aligned, but not that they share an epoch.
-inline std::int_fast64_t ToUnixSeconds(const time_point<sys_seconds>& tp) {
- return (tp - std::chrono::time_point_cast<sys_seconds>(
- std::chrono::system_clock::from_time_t(0)))
- .count();
+inline std::int_fast64_t ToUnixSeconds(const time_point<seconds>& tp) {
+ return (tp - std::chrono::time_point_cast<seconds>(
+ std::chrono::system_clock::from_time_t(0))).count();
}
-inline time_point<sys_seconds> FromUnixSeconds(std::int_fast64_t t) {
- return std::chrono::time_point_cast<sys_seconds>(
- std::chrono::system_clock::from_time_t(0)) +
- sys_seconds(t);
+inline time_point<seconds> FromUnixSeconds(std::int_fast64_t t) {
+ return std::chrono::time_point_cast<seconds>(
+ std::chrono::system_clock::from_time_t(0)) + seconds(t);
}
} // namespace cctz
diff --git a/absl/time/internal/cctz/src/time_zone_impl.cc b/absl/time/internal/cctz/src/time_zone_impl.cc
index b3f635f7..3062ccd3 100644
--- a/absl/time/internal/cctz/src/time_zone_impl.cc
+++ b/absl/time/internal/cctz/src/time_zone_impl.cc
@@ -45,8 +45,8 @@ bool time_zone::Impl::LoadTimeZone(const std::string& name, time_zone* tz) {
const time_zone::Impl* const utc_impl = UTCImpl();
// First check for UTC (which is never a key in time_zone_map).
- auto offset = sys_seconds::zero();
- if (FixedOffsetFromName(name, &offset) && offset == sys_seconds::zero()) {
+ auto offset = seconds::zero();
+ if (FixedOffsetFromName(name, &offset) && offset == seconds::zero()) {
*tz = time_zone(utc_impl);
return true;
}
@@ -83,15 +83,6 @@ bool time_zone::Impl::LoadTimeZone(const std::string& name, time_zone* tz) {
return impl != utc_impl;
}
-const time_zone::Impl& time_zone::Impl::get(const time_zone& tz) {
- if (tz.impl_ == nullptr) {
- // Dereferencing an implicit-UTC time_zone is expected to be
- // rare, so we don't mind paying a small synchronization cost.
- return *UTCImpl();
- }
- return *tz.impl_;
-}
-
void time_zone::Impl::ClearTimeZoneMapTestOnly() {
std::lock_guard<std::mutex> lock(time_zone_mutex);
if (time_zone_map != nullptr) {
diff --git a/absl/time/internal/cctz/src/time_zone_impl.h b/absl/time/internal/cctz/src/time_zone_impl.h
index 2c1c30b6..14965ef5 100644
--- a/absl/time/internal/cctz/src/time_zone_impl.h
+++ b/absl/time/internal/cctz/src/time_zone_impl.h
@@ -37,19 +37,18 @@ class time_zone::Impl {
// some other kind of error occurs. Note that loading "UTC" never fails.
static bool LoadTimeZone(const std::string& name, time_zone* tz);
- // Dereferences the time_zone to obtain its Impl.
- static const time_zone::Impl& get(const time_zone& tz);
-
// Clears the map of cached time zones. Primarily for use in benchmarks
// that gauge the performance of loading/parsing the time-zone data.
static void ClearTimeZoneMapTestOnly();
// The primary key is the time-zone ID (e.g., "America/New_York").
- const std::string& name() const { return name_; }
+ const std::string& Name() const {
+ // TODO: It would nice if the zoneinfo data included the zone name.
+ return name_;
+ }
// Breaks a time_point down to civil-time components in this time zone.
- time_zone::absolute_lookup BreakTime(
- const time_point<sys_seconds>& tp) const {
+ time_zone::absolute_lookup BreakTime(const time_point<seconds>& tp) const {
return zone_->BreakTime(tp);
}
@@ -60,28 +59,22 @@ class time_zone::Impl {
return zone_->MakeTime(cs);
}
- // Returns an implementation-specific description of this time zone.
- std::string Description() const { return zone_->Description(); }
-
// Finds the time of the next/previous offset change in this time zone.
- //
- // By definition, NextTransition(&tp) returns false when tp has its
- // maximum value, and PrevTransition(&tp) returns false when tp has its
- // mimimum value. If the zone has no transitions, the result will also
- // be false no matter what the argument.
- //
- // Otherwise, when tp has its mimimum value, NextTransition(&tp) returns
- // true and sets tp to the first recorded transition. Chains of calls
- // to NextTransition()/PrevTransition() will eventually return false,
- // but it is unspecified exactly when NextTransition(&tp) jumps to false,
- // or what time is set by PrevTransition(&tp) for a very distant tp.
- bool NextTransition(time_point<sys_seconds>* tp) const {
- return zone_->NextTransition(tp);
+ bool NextTransition(const time_point<seconds>& tp,
+ time_zone::civil_transition* trans) const {
+ return zone_->NextTransition(tp, trans);
}
- bool PrevTransition(time_point<sys_seconds>* tp) const {
- return zone_->PrevTransition(tp);
+ bool PrevTransition(const time_point<seconds>& tp,
+ time_zone::civil_transition* trans) const {
+ return zone_->PrevTransition(tp, trans);
}
+ // Returns an implementation-defined version std::string for this time zone.
+ std::string Version() const { return zone_->Version(); }
+
+ // Returns an implementation-defined description of this time zone.
+ std::string Description() const { return zone_->Description(); }
+
private:
explicit Impl(const std::string& name);
static const Impl* UTCImpl();
diff --git a/absl/time/internal/cctz/src/time_zone_info.cc b/absl/time/internal/cctz/src/time_zone_info.cc
index 20bba28b..bf73635d 100644
--- a/absl/time/internal/cctz/src/time_zone_info.cc
+++ b/absl/time/internal/cctz/src/time_zone_info.cc
@@ -140,7 +140,7 @@ std::int_fast64_t TransOffset(bool leap_year, int jan1_weekday,
return (days * kSecsPerDay) + pt.time.offset;
}
-inline time_zone::civil_lookup MakeUnique(const time_point<sys_seconds>& tp) {
+inline time_zone::civil_lookup MakeUnique(const time_point<seconds>& tp) {
time_zone::civil_lookup cl;
cl.kind = time_zone::civil_lookup::UNIQUE;
cl.pre = cl.trans = cl.post = tp;
@@ -179,21 +179,20 @@ inline civil_second YearShift(const civil_second& cs, year_t shift) {
} // namespace
// What (no leap-seconds) UTC+seconds zoneinfo would look like.
-bool TimeZoneInfo::ResetToBuiltinUTC(const sys_seconds& offset) {
+bool TimeZoneInfo::ResetToBuiltinUTC(const seconds& offset) {
transition_types_.resize(1);
TransitionType& tt(transition_types_.back());
tt.utc_offset = static_cast<std::int_least32_t>(offset.count());
tt.is_dst = false;
tt.abbr_index = 0;
- // We temporarily add some redundant, contemporary (2012 through 2021)
+ // We temporarily add some redundant, contemporary (2013 through 2023)
// transitions for performance reasons. See TimeZoneInfo::LocalTime().
// TODO: Fix the performance issue and remove the extra transitions.
transitions_.clear();
transitions_.reserve(12);
for (const std::int_fast64_t unix_time : {
-(1LL << 59), // BIG_BANG
- 1325376000LL, // 2012-01-01T00:00:00+00:00
1356998400LL, // 2013-01-01T00:00:00+00:00
1388534400LL, // 2014-01-01T00:00:00+00:00
1420070400LL, // 2015-01-01T00:00:00+00:00
@@ -203,6 +202,8 @@ bool TimeZoneInfo::ResetToBuiltinUTC(const sys_seconds& offset) {
1546300800LL, // 2019-01-01T00:00:00+00:00
1577836800LL, // 2020-01-01T00:00:00+00:00
1609459200LL, // 2021-01-01T00:00:00+00:00
+ 1640995200LL, // 2022-01-01T00:00:00+00:00
+ 1672531200LL, // 2023-01-01T00:00:00+00:00
2147483647LL, // 2^31 - 1
}) {
Transition& tr(*transitions_.emplace(transitions_.end()));
@@ -218,8 +219,8 @@ bool TimeZoneInfo::ResetToBuiltinUTC(const sys_seconds& offset) {
future_spec_.clear(); // never needed for a fixed-offset zone
extended_ = false;
- tt.civil_max = LocalTime(sys_seconds::max().count(), tt).cs;
- tt.civil_min = LocalTime(sys_seconds::min().count(), tt).cs;
+ tt.civil_max = LocalTime(seconds::max().count(), tt).cs;
+ tt.civil_min = LocalTime(seconds::min().count(), tt).cs;
transitions_.shrink_to_fit();
return true;
@@ -519,6 +520,13 @@ bool TimeZoneInfo::Load(const std::string& name, ZoneInfoSource* zip) {
// We don't check for EOF so that we're forwards compatible.
+ // If we did not find version information during the standard loading
+ // process (as of tzh_version '3' that is unsupported), then ask the
+ // ZoneInfoSource for any out-of-bound version std::string it may be privy to.
+ if (version_.empty()) {
+ version_ = zip->Version();
+ }
+
// Trim redundant transitions. zic may have added these to work around
// differences between the glibc and reference implementations (see
// zic.c:dontmerge) and the Qt library (see zic.c:WORK_AROUND_QTBUG_53071).
@@ -565,10 +573,10 @@ bool TimeZoneInfo::Load(const std::string& name, ZoneInfoSource* zip) {
}
// Compute the maximum/minimum civil times that can be converted to a
- // time_point<sys_seconds> for each of the zone's transition types.
+ // time_point<seconds> for each of the zone's transition types.
for (auto& tt : transition_types_) {
- tt.civil_max = LocalTime(sys_seconds::max().count(), tt).cs;
- tt.civil_min = LocalTime(sys_seconds::min().count(), tt).cs;
+ tt.civil_max = LocalTime(seconds::max().count(), tt).cs;
+ tt.civil_min = LocalTime(seconds::min().count(), tt).cs;
}
transitions_.shrink_to_fit();
@@ -605,6 +613,10 @@ class FileZoneInfoSource : public ZoneInfoSource {
if (rc == 0) len_ -= offset;
return rc;
}
+ std::string Version() const override {
+ // TODO: It would nice if the zoneinfo data included the tzdb version.
+ return std::string();
+ }
protected:
explicit FileZoneInfoSource(
@@ -654,14 +666,15 @@ std::unique_ptr<ZoneInfoSource> FileZoneInfoSource::Open(
return std::unique_ptr<ZoneInfoSource>(new FileZoneInfoSource(fp, length));
}
-#if defined(__ANDROID__)
class AndroidZoneInfoSource : public FileZoneInfoSource {
public:
static std::unique_ptr<ZoneInfoSource> Open(const std::string& name);
+ std::string Version() const override { return version_; }
private:
- explicit AndroidZoneInfoSource(FILE* fp, std::size_t len)
- : FileZoneInfoSource(fp, len) {}
+ explicit AndroidZoneInfoSource(FILE* fp, std::size_t len, const char* vers)
+ : FileZoneInfoSource(fp, len), version_(vers) {}
+ std::string version_;
};
std::unique_ptr<ZoneInfoSource> AndroidZoneInfoSource::Open(
@@ -669,6 +682,7 @@ std::unique_ptr<ZoneInfoSource> AndroidZoneInfoSource::Open(
// Use of the "file:" prefix is intended for testing purposes only.
if (name.compare(0, 5, "file:") == 0) return Open(name.substr(5));
+#if defined(__ANDROID__)
// See Android's libc/tzcode/bionic.cpp for additional information.
for (const char* tzdata : {"/data/misc/zoneinfo/current/tzdata",
"/system/usr/share/zoneinfo/tzdata"}) {
@@ -678,6 +692,7 @@ std::unique_ptr<ZoneInfoSource> AndroidZoneInfoSource::Open(
char hbuf[24]; // covers header.zonetab_offset too
if (fread(hbuf, 1, sizeof(hbuf), fp.get()) != sizeof(hbuf)) continue;
if (strncmp(hbuf, "tzdata", 6) != 0) continue;
+ const char* vers = (hbuf[11] == '\0') ? hbuf + 6 : "";
const std::int_fast32_t index_offset = Decode32(hbuf + 12);
const std::int_fast32_t data_offset = Decode32(hbuf + 16);
if (index_offset < 0 || data_offset < index_offset) continue;
@@ -698,13 +713,13 @@ std::unique_ptr<ZoneInfoSource> AndroidZoneInfoSource::Open(
if (strcmp(name.c_str(), ebuf) == 0) {
if (fseek(fp.get(), static_cast<long>(start), SEEK_SET) != 0) break;
return std::unique_ptr<ZoneInfoSource>(new AndroidZoneInfoSource(
- fp.release(), static_cast<std::size_t>(length)));
+ fp.release(), static_cast<std::size_t>(length), vers));
}
}
}
+#endif // __ANDROID__
return nullptr;
}
-#endif
} // namespace
@@ -713,7 +728,7 @@ bool TimeZoneInfo::Load(const std::string& name) {
// zone never fails because the simple, fixed-offset state can be
// internally generated. Note that this depends on our choice to not
// accept leap-second encoded ("right") zoneinfo.
- auto offset = sys_seconds::zero();
+ auto offset = seconds::zero();
if (FixedOffsetFromName(name, &offset)) {
return ResetToBuiltinUTC(offset);
}
@@ -722,9 +737,7 @@ bool TimeZoneInfo::Load(const std::string& name) {
auto zip = cctz_extension::zone_info_source_factory(
name, [](const std::string& name) -> std::unique_ptr<ZoneInfoSource> {
if (auto zip = FileZoneInfoSource::Open(name)) return zip;
-#if defined(__ANDROID__)
if (auto zip = AndroidZoneInfoSource::Open(name)) return zip;
-#endif
return nullptr;
});
return zip != nullptr && Load(name, zip.get());
@@ -755,14 +768,14 @@ time_zone::civil_lookup TimeZoneInfo::TimeLocal(const civil_second& cs,
year_t c4_shift) const {
assert(last_year_ - 400 < cs.year() && cs.year() <= last_year_);
time_zone::civil_lookup cl = MakeTime(cs);
- if (c4_shift > sys_seconds::max().count() / kSecsPer400Years) {
- cl.pre = cl.trans = cl.post = time_point<sys_seconds>::max();
+ if (c4_shift > seconds::max().count() / kSecsPer400Years) {
+ cl.pre = cl.trans = cl.post = time_point<seconds>::max();
} else {
- const auto offset = sys_seconds(c4_shift * kSecsPer400Years);
- const auto limit = time_point<sys_seconds>::max() - offset;
+ const auto offset = seconds(c4_shift * kSecsPer400Years);
+ const auto limit = time_point<seconds>::max() - offset;
for (auto* tp : {&cl.pre, &cl.trans, &cl.post}) {
if (*tp > limit) {
- *tp = time_point<sys_seconds>::max();
+ *tp = time_point<seconds>::max();
} else {
*tp += offset;
}
@@ -772,7 +785,7 @@ time_zone::civil_lookup TimeZoneInfo::TimeLocal(const civil_second& cs,
}
time_zone::absolute_lookup TimeZoneInfo::BreakTime(
- const time_point<sys_seconds>& tp) const {
+ const time_point<seconds>& tp) const {
std::int_fast64_t unix_time = ToUnixSeconds(tp);
const std::size_t timecnt = transitions_.size();
assert(timecnt != 0); // We always add a transition.
@@ -788,7 +801,7 @@ time_zone::absolute_lookup TimeZoneInfo::BreakTime(
const std::int_fast64_t diff =
unix_time - transitions_[timecnt - 1].unix_time;
const year_t shift = diff / kSecsPer400Years + 1;
- const auto d = sys_seconds(shift * kSecsPer400Years);
+ const auto d = seconds(shift * kSecsPer400Years);
time_zone::absolute_lookup al = BreakTime(tp - d);
al.cs = YearShift(al.cs, shift * 400);
return al;
@@ -847,7 +860,7 @@ time_zone::civil_lookup TimeZoneInfo::MakeTime(const civil_second& cs) const {
if (tr->prev_civil_sec >= cs) {
// Before first transition, so use the default offset.
const TransitionType& tt(transition_types_[default_transition_type_]);
- if (cs < tt.civil_min) return MakeUnique(time_point<sys_seconds>::min());
+ if (cs < tt.civil_min) return MakeUnique(time_point<seconds>::min());
return MakeUnique(cs - (civil_second() + tt.utc_offset));
}
// tr->prev_civil_sec < cs < tr->civil_sec
@@ -864,7 +877,7 @@ time_zone::civil_lookup TimeZoneInfo::MakeTime(const civil_second& cs) const {
return TimeLocal(YearShift(cs, shift * -400), shift);
}
const TransitionType& tt(transition_types_[tr->type_index]);
- if (cs > tt.civil_max) return MakeUnique(time_point<sys_seconds>::max());
+ if (cs > tt.civil_max) return MakeUnique(time_point<seconds>::max());
return MakeUnique(tr->unix_time + (cs - tr->civil_sec));
}
// tr->civil_sec <= cs <= tr->prev_civil_sec
@@ -885,17 +898,20 @@ time_zone::civil_lookup TimeZoneInfo::MakeTime(const civil_second& cs) const {
return MakeUnique(tr->unix_time + (cs - tr->civil_sec));
}
+std::string TimeZoneInfo::Version() const {
+ return version_;
+}
+
std::string TimeZoneInfo::Description() const {
std::ostringstream oss;
- // TODO: It would nice if the zoneinfo data included the zone name.
- // TODO: It would nice if the zoneinfo data included the tzdb version.
oss << "#trans=" << transitions_.size();
oss << " #types=" << transition_types_.size();
oss << " spec='" << future_spec_ << "'";
return oss.str();
}
-bool TimeZoneInfo::NextTransition(time_point<sys_seconds>* tp) const {
+bool TimeZoneInfo::NextTransition(const time_point<seconds>& tp,
+ time_zone::civil_transition* trans) const {
if (transitions_.empty()) return false;
const Transition* begin = &transitions_[0];
const Transition* end = begin + transitions_.size();
@@ -904,22 +920,24 @@ bool TimeZoneInfo::NextTransition(time_point<sys_seconds>* tp) const {
// really a sentinel, not a transition. See tz/zic.c.
++begin;
}
- std::int_fast64_t unix_time = ToUnixSeconds(*tp);
+ std::int_fast64_t unix_time = ToUnixSeconds(tp);
const Transition target = { unix_time };
const Transition* tr = std::upper_bound(begin, end, target,
Transition::ByUnixTime());
- if (tr != begin) { // skip no-op transitions
- for (; tr != end; ++tr) {
- if (!EquivTransitions(tr[-1].type_index, tr[0].type_index)) break;
- }
+ for (; tr != end; ++tr) { // skip no-op transitions
+ std::uint_fast8_t prev_type_index =
+ (tr == begin) ? default_transition_type_ : tr[-1].type_index;
+ if (!EquivTransitions(prev_type_index, tr[0].type_index)) break;
}
// When tr == end we return false, ignoring future_spec_.
if (tr == end) return false;
- *tp = FromUnixSeconds(tr->unix_time);
+ trans->from = tr->prev_civil_sec + 1;
+ trans->to = tr->civil_sec;
return true;
}
-bool TimeZoneInfo::PrevTransition(time_point<sys_seconds>* tp) const {
+bool TimeZoneInfo::PrevTransition(const time_point<seconds>& tp,
+ time_zone::civil_transition* trans) const {
if (transitions_.empty()) return false;
const Transition* begin = &transitions_[0];
const Transition* end = begin + transitions_.size();
@@ -928,11 +946,12 @@ bool TimeZoneInfo::PrevTransition(time_point<sys_seconds>* tp) const {
// really a sentinel, not a transition. See tz/zic.c.
++begin;
}
- std::int_fast64_t unix_time = ToUnixSeconds(*tp);
- if (FromUnixSeconds(unix_time) != *tp) {
+ std::int_fast64_t unix_time = ToUnixSeconds(tp);
+ if (FromUnixSeconds(unix_time) != tp) {
if (unix_time == std::numeric_limits<std::int_fast64_t>::max()) {
if (end == begin) return false; // Ignore future_spec_.
- *tp = FromUnixSeconds((--end)->unix_time);
+ trans->from = (--end)->prev_civil_sec + 1;
+ trans->to = end->civil_sec;
return true;
}
unix_time += 1; // ceils
@@ -940,14 +959,15 @@ bool TimeZoneInfo::PrevTransition(time_point<sys_seconds>* tp) const {
const Transition target = { unix_time };
const Transition* tr = std::lower_bound(begin, end, target,
Transition::ByUnixTime());
- if (tr != begin) { // skip no-op transitions
- for (; tr - 1 != begin; --tr) {
- if (!EquivTransitions(tr[-2].type_index, tr[-1].type_index)) break;
- }
+ for (; tr != begin; --tr) { // skip no-op transitions
+ std::uint_fast8_t prev_type_index =
+ (tr - 1 == begin) ? default_transition_type_ : tr[-2].type_index;
+ if (!EquivTransitions(prev_type_index, tr[-1].type_index)) break;
}
// When tr == end we return the "last" transition, ignoring future_spec_.
if (tr == begin) return false;
- *tp = FromUnixSeconds((--tr)->unix_time);
+ trans->from = (--tr)->prev_civil_sec + 1;
+ trans->to = tr->civil_sec;
return true;
}
diff --git a/absl/time/internal/cctz/src/time_zone_info.h b/absl/time/internal/cctz/src/time_zone_info.h
index b4d1696b..958e9b6b 100644
--- a/absl/time/internal/cctz/src/time_zone_info.h
+++ b/absl/time/internal/cctz/src/time_zone_info.h
@@ -71,12 +71,15 @@ class TimeZoneInfo : public TimeZoneIf {
// TimeZoneIf implementations.
time_zone::absolute_lookup BreakTime(
- const time_point<sys_seconds>& tp) const override;
+ const time_point<seconds>& tp) const override;
time_zone::civil_lookup MakeTime(
const civil_second& cs) const override;
+ bool NextTransition(const time_point<seconds>& tp,
+ time_zone::civil_transition* trans) const override;
+ bool PrevTransition(const time_point<seconds>& tp,
+ time_zone::civil_transition* trans) const override;
+ std::string Version() const override;
std::string Description() const override;
- bool NextTransition(time_point<sys_seconds>* tp) const override;
- bool PrevTransition(time_point<sys_seconds>* tp) const override;
private:
struct Header { // counts of:
@@ -98,7 +101,7 @@ class TimeZoneInfo : public TimeZoneIf {
std::uint_fast8_t tt2_index) const;
void ExtendTransitions(const std::string& name, const Header& hdr);
- bool ResetToBuiltinUTC(const sys_seconds& offset);
+ bool ResetToBuiltinUTC(const seconds& offset);
bool Load(const std::string& name, ZoneInfoSource* zip);
// Helpers for BreakTime() and MakeTime().
@@ -114,6 +117,7 @@ class TimeZoneInfo : public TimeZoneIf {
std::uint_fast8_t default_transition_type_; // for before first transition
std::string abbreviations_; // all the NUL-terminated abbreviations
+ std::string version_; // the tzdata version if available
std::string future_spec_; // for after the last zic transition
bool extended_; // future_spec_ was used to generate transitions
year_t last_year_; // the final year of the generated transitions
diff --git a/absl/time/internal/cctz/src/time_zone_libc.cc b/absl/time/internal/cctz/src/time_zone_libc.cc
index b0b56a52..074c8d0a 100644
--- a/absl/time/internal/cctz/src/time_zone_libc.cc
+++ b/absl/time/internal/cctz/src/time_zone_libc.cc
@@ -91,7 +91,7 @@ TimeZoneLibC::TimeZoneLibC(const std::string& name)
: local_(name == "localtime") {}
time_zone::absolute_lookup TimeZoneLibC::BreakTime(
- const time_point<sys_seconds>& tp) const {
+ const time_point<seconds>& tp) const {
time_zone::absolute_lookup al;
std::time_t t = ToUnixSeconds(tp);
std::tm tm;
@@ -139,16 +139,22 @@ time_zone::civil_lookup TimeZoneLibC::MakeTime(const civil_second& cs) const {
return cl;
}
-std::string TimeZoneLibC::Description() const {
- return local_ ? "localtime" : "UTC";
+bool TimeZoneLibC::NextTransition(const time_point<seconds>& tp,
+ time_zone::civil_transition* trans) const {
+ return false;
}
-bool TimeZoneLibC::NextTransition(time_point<sys_seconds>* tp) const {
+bool TimeZoneLibC::PrevTransition(const time_point<seconds>& tp,
+ time_zone::civil_transition* trans) const {
return false;
}
-bool TimeZoneLibC::PrevTransition(time_point<sys_seconds>* tp) const {
- return false;
+std::string TimeZoneLibC::Version() const {
+ return std::string(); // unknown
+}
+
+std::string TimeZoneLibC::Description() const {
+ return local_ ? "localtime" : "UTC";
}
} // namespace cctz
diff --git a/absl/time/internal/cctz/src/time_zone_libc.h b/absl/time/internal/cctz/src/time_zone_libc.h
index 41f7dde2..4e40c61a 100644
--- a/absl/time/internal/cctz/src/time_zone_libc.h
+++ b/absl/time/internal/cctz/src/time_zone_libc.h
@@ -32,12 +32,15 @@ class TimeZoneLibC : public TimeZoneIf {
// TimeZoneIf implementations.
time_zone::absolute_lookup BreakTime(
- const time_point<sys_seconds>& tp) const override;
+ const time_point<seconds>& tp) const override;
time_zone::civil_lookup MakeTime(
const civil_second& cs) const override;
+ bool NextTransition(const time_point<seconds>& tp,
+ time_zone::civil_transition* trans) const override;
+ bool PrevTransition(const time_point<seconds>& tp,
+ time_zone::civil_transition* trans) const override;
+ std::string Version() const override;
std::string Description() const override;
- bool NextTransition(time_point<sys_seconds>* tp) const override;
- bool PrevTransition(time_point<sys_seconds>* tp) const override;
private:
const bool local_; // localtime or UTC
diff --git a/absl/time/internal/cctz/src/time_zone_lookup.cc b/absl/time/internal/cctz/src/time_zone_lookup.cc
index d549d862..f2d151e4 100644
--- a/absl/time/internal/cctz/src/time_zone_lookup.cc
+++ b/absl/time/internal/cctz/src/time_zone_lookup.cc
@@ -61,20 +61,43 @@ int __system_property_get(const char* name, char* value) {
#endif
std::string time_zone::name() const {
- return time_zone::Impl::get(*this).name();
+ return effective_impl().Name();
}
time_zone::absolute_lookup time_zone::lookup(
- const time_point<sys_seconds>& tp) const {
- return time_zone::Impl::get(*this).BreakTime(tp);
+ const time_point<seconds>& tp) const {
+ return effective_impl().BreakTime(tp);
}
time_zone::civil_lookup time_zone::lookup(const civil_second& cs) const {
- return time_zone::Impl::get(*this).MakeTime(cs);
+ return effective_impl().MakeTime(cs);
}
-bool operator==(time_zone lhs, time_zone rhs) {
- return &time_zone::Impl::get(lhs) == &time_zone::Impl::get(rhs);
+bool time_zone::next_transition(const time_point<seconds>& tp,
+ civil_transition* trans) const {
+ return effective_impl().NextTransition(tp, trans);
+}
+
+bool time_zone::prev_transition(const time_point<seconds>& tp,
+ civil_transition* trans) const {
+ return effective_impl().PrevTransition(tp, trans);
+}
+
+std::string time_zone::version() const {
+ return effective_impl().Version();
+}
+
+std::string time_zone::description() const {
+ return effective_impl().Description();
+}
+
+const time_zone::Impl& time_zone::effective_impl() const {
+ if (impl_ == nullptr) {
+ // Dereferencing an implicit-UTC time_zone is expected to be
+ // rare, so we don't mind paying a small synchronization cost.
+ return *time_zone::Impl::UTC().impl_;
+ }
+ return *impl_;
}
bool load_time_zone(const std::string& name, time_zone* tz) {
@@ -85,7 +108,7 @@ time_zone utc_time_zone() {
return time_zone::Impl::UTC(); // avoid name lookup
}
-time_zone fixed_time_zone(const sys_seconds& offset) {
+time_zone fixed_time_zone(const seconds& offset) {
time_zone tz;
load_time_zone(FixedOffsetToName(offset), &tz);
return tz;
diff --git a/absl/time/internal/cctz/src/time_zone_lookup_test.cc b/absl/time/internal/cctz/src/time_zone_lookup_test.cc
index 06b172a8..551292fb 100644
--- a/absl/time/internal/cctz/src/time_zone_lookup_test.cc
+++ b/absl/time/internal/cctz/src/time_zone_lookup_test.cc
@@ -24,14 +24,7 @@
#include "absl/time/internal/cctz/include/cctz/civil_time.h"
#include "gtest/gtest.h"
-using std::chrono::time_point_cast;
-using std::chrono::system_clock;
-using std::chrono::nanoseconds;
-using std::chrono::microseconds;
-using std::chrono::milliseconds;
-using std::chrono::seconds;
-using std::chrono::minutes;
-using std::chrono::hours;
+namespace chrono = std::chrono;
namespace absl {
namespace time_internal {
@@ -658,6 +651,17 @@ time_zone LoadZone(const std::string& name) {
/* EXPECT_STREQ(zone, al.abbr); */ \
} while (0)
+// These tests sometimes run on platforms that have zoneinfo data so old
+// that the transition we are attempting to check does not exist, most
+// notably Android emulators. Fortunately, AndroidZoneInfoSource supports
+// time_zone::version() so, in cases where we've learned that it matters,
+// we can make the check conditionally.
+int VersionCmp(time_zone tz, const std::string& target) {
+ std::string version = tz.version();
+ if (version.empty() && !target.empty()) return 1; // unknown > known
+ return version.compare(target);
+}
+
} // namespace
TEST(TimeZones, LoadZonesConcurrently) {
@@ -715,13 +719,13 @@ TEST(TimeZone, NamedTimeZones) {
EXPECT_EQ("America/New_York", nyc.name());
const time_zone syd = LoadZone("Australia/Sydney");
EXPECT_EQ("Australia/Sydney", syd.name());
- const time_zone fixed0 = fixed_time_zone(sys_seconds::zero());
+ const time_zone fixed0 = fixed_time_zone(absl::time_internal::cctz::seconds::zero());
EXPECT_EQ("UTC", fixed0.name());
- const time_zone fixed_pos =
- fixed_time_zone(hours(3) + minutes(25) + seconds(45));
+ const time_zone fixed_pos = fixed_time_zone(
+ chrono::hours(3) + chrono::minutes(25) + chrono::seconds(45));
EXPECT_EQ("Fixed/UTC+03:25:45", fixed_pos.name());
- const time_zone fixed_neg =
- fixed_time_zone(-(hours(12) + minutes(34) + seconds(56)));
+ const time_zone fixed_neg = fixed_time_zone(
+ -(chrono::hours(12) + chrono::minutes(34) + chrono::seconds(56)));
EXPECT_EQ("Fixed/UTC-12:34:56", fixed_neg.name());
}
@@ -731,19 +735,19 @@ TEST(TimeZone, Failures) {
tz = LoadZone("America/Los_Angeles");
EXPECT_FALSE(load_time_zone("Invalid/TimeZone", &tz));
- EXPECT_EQ(system_clock::from_time_t(0),
+ EXPECT_EQ(chrono::system_clock::from_time_t(0),
convert(civil_second(1970, 1, 1, 0, 0, 0), tz)); // UTC
// Ensures that the load still fails on a subsequent attempt.
tz = LoadZone("America/Los_Angeles");
EXPECT_FALSE(load_time_zone("Invalid/TimeZone", &tz));
- EXPECT_EQ(system_clock::from_time_t(0),
+ EXPECT_EQ(chrono::system_clock::from_time_t(0),
convert(civil_second(1970, 1, 1, 0, 0, 0), tz)); // UTC
// Loading an empty std::string timezone should fail.
tz = LoadZone("America/Los_Angeles");
EXPECT_FALSE(load_time_zone("", &tz));
- EXPECT_EQ(system_clock::from_time_t(0),
+ EXPECT_EQ(chrono::system_clock::from_time_t(0),
convert(civil_second(1970, 1, 1, 0, 0, 0), tz)); // UTC
}
@@ -758,7 +762,7 @@ TEST(TimeZone, Equality) {
EXPECT_EQ(implicit_utc, explicit_utc);
EXPECT_EQ(implicit_utc.name(), explicit_utc.name());
- const time_zone fixed_zero = fixed_time_zone(sys_seconds::zero());
+ const time_zone fixed_zero = fixed_time_zone(absl::time_internal::cctz::seconds::zero());
EXPECT_EQ(fixed_zero, LoadZone(fixed_zero.name()));
EXPECT_EQ(fixed_zero, explicit_utc);
@@ -766,23 +770,25 @@ TEST(TimeZone, Equality) {
EXPECT_EQ(fixed_utc, LoadZone(fixed_utc.name()));
EXPECT_EQ(fixed_utc, explicit_utc);
- const time_zone fixed_pos =
- fixed_time_zone(hours(3) + minutes(25) + seconds(45));
+ const time_zone fixed_pos = fixed_time_zone(
+ chrono::hours(3) + chrono::minutes(25) + chrono::seconds(45));
EXPECT_EQ(fixed_pos, LoadZone(fixed_pos.name()));
EXPECT_NE(fixed_pos, explicit_utc);
- const time_zone fixed_neg =
- fixed_time_zone(-(hours(12) + minutes(34) + seconds(56)));
+ const time_zone fixed_neg = fixed_time_zone(
+ -(chrono::hours(12) + chrono::minutes(34) + chrono::seconds(56)));
EXPECT_EQ(fixed_neg, LoadZone(fixed_neg.name()));
EXPECT_NE(fixed_neg, explicit_utc);
- const time_zone fixed_lim = fixed_time_zone(hours(24));
+ const time_zone fixed_lim = fixed_time_zone(chrono::hours(24));
EXPECT_EQ(fixed_lim, LoadZone(fixed_lim.name()));
EXPECT_NE(fixed_lim, explicit_utc);
- const time_zone fixed_ovfl = fixed_time_zone(hours(24) + seconds(1));
+ const time_zone fixed_ovfl =
+ fixed_time_zone(chrono::hours(24) + chrono::seconds(1));
EXPECT_EQ(fixed_ovfl, LoadZone(fixed_ovfl.name()));
EXPECT_EQ(fixed_ovfl, explicit_utc);
- EXPECT_EQ(fixed_time_zone(seconds(1)), fixed_time_zone(seconds(1)));
+ EXPECT_EQ(fixed_time_zone(chrono::seconds(1)),
+ fixed_time_zone(chrono::seconds(1)));
const time_zone local = local_time_zone();
EXPECT_EQ(local, LoadZone(local.name()));
@@ -795,40 +801,43 @@ TEST(TimeZone, Equality) {
TEST(StdChronoTimePoint, TimeTAlignment) {
// Ensures that the Unix epoch and the system clock epoch are an integral
// number of seconds apart. This simplifies conversions to/from time_t.
- auto diff = system_clock::time_point() - system_clock::from_time_t(0);
- EXPECT_EQ(system_clock::time_point::duration::zero(), diff % seconds(1));
+ auto diff = chrono::system_clock::time_point() -
+ chrono::system_clock::from_time_t(0);
+ EXPECT_EQ(chrono::system_clock::time_point::duration::zero(),
+ diff % chrono::seconds(1));
}
TEST(BreakTime, TimePointResolution) {
const time_zone utc = utc_time_zone();
- const auto t0 = system_clock::from_time_t(0);
+ const auto t0 = chrono::system_clock::from_time_t(0);
- ExpectTime(time_point_cast<nanoseconds>(t0), utc,
+ ExpectTime(chrono::time_point_cast<chrono::nanoseconds>(t0), utc,
1970, 1, 1, 0, 0, 0, 0, false, "UTC");
- ExpectTime(time_point_cast<microseconds>(t0), utc,
+ ExpectTime(chrono::time_point_cast<chrono::microseconds>(t0), utc,
1970, 1, 1, 0, 0, 0, 0, false, "UTC");
- ExpectTime(time_point_cast<milliseconds>(t0), utc,
+ ExpectTime(chrono::time_point_cast<chrono::milliseconds>(t0), utc,
1970, 1, 1, 0, 0, 0, 0, false, "UTC");
- ExpectTime(time_point_cast<seconds>(t0), utc,
+ ExpectTime(chrono::time_point_cast<chrono::seconds>(t0), utc,
1970, 1, 1, 0, 0, 0, 0, false, "UTC");
- ExpectTime(time_point_cast<sys_seconds>(t0), utc,
+ ExpectTime(chrono::time_point_cast<absl::time_internal::cctz::seconds>(t0), utc,
1970, 1, 1, 0, 0, 0, 0, false, "UTC");
- ExpectTime(time_point_cast<minutes>(t0), utc,
+ ExpectTime(chrono::time_point_cast<chrono::minutes>(t0), utc,
1970, 1, 1, 0, 0, 0, 0, false, "UTC");
- ExpectTime(time_point_cast<hours>(t0), utc,
+ ExpectTime(chrono::time_point_cast<chrono::hours>(t0), utc,
1970, 1, 1, 0, 0, 0, 0, false, "UTC");
}
TEST(BreakTime, LocalTimeInUTC) {
const time_zone tz = utc_time_zone();
- const auto tp = system_clock::from_time_t(0);
+ const auto tp = chrono::system_clock::from_time_t(0);
ExpectTime(tp, tz, 1970, 1, 1, 0, 0, 0, 0, false, "UTC");
EXPECT_EQ(weekday::thursday, get_weekday(civil_day(convert(tp, tz))));
}
TEST(BreakTime, LocalTimeInUTCUnaligned) {
const time_zone tz = utc_time_zone();
- const auto tp = system_clock::from_time_t(0) - milliseconds(500);
+ const auto tp =
+ chrono::system_clock::from_time_t(0) - chrono::milliseconds(500);
ExpectTime(tp, tz, 1969, 12, 31, 23, 59, 59, 0, false, "UTC");
EXPECT_EQ(weekday::wednesday, get_weekday(civil_day(convert(tp, tz))));
}
@@ -836,15 +845,16 @@ TEST(BreakTime, LocalTimeInUTCUnaligned) {
TEST(BreakTime, LocalTimePosix) {
// See IEEE Std 1003.1-1988 B.2.3 General Terms, Epoch.
const time_zone tz = utc_time_zone();
- const auto tp = system_clock::from_time_t(536457599);
+ const auto tp = chrono::system_clock::from_time_t(536457599);
ExpectTime(tp, tz, 1986, 12, 31, 23, 59, 59, 0, false, "UTC");
EXPECT_EQ(weekday::wednesday, get_weekday(civil_day(convert(tp, tz))));
}
TEST(TimeZoneImpl, LocalTimeInFixed) {
- const sys_seconds offset = -(hours(8) + minutes(33) + seconds(47));
+ const absl::time_internal::cctz::seconds offset =
+ -(chrono::hours(8) + chrono::minutes(33) + chrono::seconds(47));
const time_zone tz = fixed_time_zone(offset);
- const auto tp = system_clock::from_time_t(0);
+ const auto tp = chrono::system_clock::from_time_t(0);
ExpectTime(tp, tz, 1969, 12, 31, 15, 26, 13, offset.count(), false,
"-083347");
EXPECT_EQ(weekday::wednesday, get_weekday(civil_day(convert(tp, tz))));
@@ -852,52 +862,52 @@ TEST(TimeZoneImpl, LocalTimeInFixed) {
TEST(BreakTime, LocalTimeInNewYork) {
const time_zone tz = LoadZone("America/New_York");
- const auto tp = system_clock::from_time_t(45);
+ const auto tp = chrono::system_clock::from_time_t(45);
ExpectTime(tp, tz, 1969, 12, 31, 19, 0, 45, -5 * 60 * 60, false, "EST");
EXPECT_EQ(weekday::wednesday, get_weekday(civil_day(convert(tp, tz))));
}
TEST(BreakTime, LocalTimeInMTV) {
const time_zone tz = LoadZone("America/Los_Angeles");
- const auto tp = system_clock::from_time_t(1380855729);
+ const auto tp = chrono::system_clock::from_time_t(1380855729);
ExpectTime(tp, tz, 2013, 10, 3, 20, 2, 9, -7 * 60 * 60, true, "PDT");
EXPECT_EQ(weekday::thursday, get_weekday(civil_day(convert(tp, tz))));
}
TEST(BreakTime, LocalTimeInSydney) {
const time_zone tz = LoadZone("Australia/Sydney");
- const auto tp = system_clock::from_time_t(90);
+ const auto tp = chrono::system_clock::from_time_t(90);
ExpectTime(tp, tz, 1970, 1, 1, 10, 1, 30, 10 * 60 * 60, false, "AEST");
EXPECT_EQ(weekday::thursday, get_weekday(civil_day(convert(tp, tz))));
}
TEST(MakeTime, TimePointResolution) {
const time_zone utc = utc_time_zone();
- const time_point<nanoseconds> tp_ns =
+ const time_point<chrono::nanoseconds> tp_ns =
convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
EXPECT_EQ("04:05", format("%M:%E*S", tp_ns, utc));
- const time_point<microseconds> tp_us =
+ const time_point<chrono::microseconds> tp_us =
convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
EXPECT_EQ("04:05", format("%M:%E*S", tp_us, utc));
- const time_point<milliseconds> tp_ms =
+ const time_point<chrono::milliseconds> tp_ms =
convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
EXPECT_EQ("04:05", format("%M:%E*S", tp_ms, utc));
- const time_point<seconds> tp_s =
+ const time_point<chrono::seconds> tp_s =
convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
EXPECT_EQ("04:05", format("%M:%E*S", tp_s, utc));
- const time_point<sys_seconds> tp_s64 =
+ const time_point<absl::time_internal::cctz::seconds> tp_s64 =
convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
EXPECT_EQ("04:05", format("%M:%E*S", tp_s64, utc));
- // These next two require time_point_cast because the conversion from a
- // resolution of seconds (the return value of convert()) to a coarser
- // resolution requires an explicit cast.
- const time_point<minutes> tp_m =
- time_point_cast<minutes>(
+ // These next two require chrono::time_point_cast because the conversion
+ // from a resolution of seconds (the return value of convert()) to a
+ // coarser resolution requires an explicit cast.
+ const time_point<chrono::minutes> tp_m =
+ chrono::time_point_cast<chrono::minutes>(
convert(civil_second(2015, 1, 2, 3, 4, 5), utc));
EXPECT_EQ("04:00", format("%M:%E*S", tp_m, utc));
- const time_point<hours> tp_h =
- time_point_cast<hours>(
+ const time_point<chrono::hours> tp_h =
+ chrono::time_point_cast<chrono::hours>(
convert(civil_second(2015, 1, 2, 3, 4, 5), utc));
EXPECT_EQ("00:00", format("%M:%E*S", tp_h, utc));
}
@@ -905,7 +915,7 @@ TEST(MakeTime, TimePointResolution) {
TEST(MakeTime, Normalization) {
const time_zone tz = LoadZone("America/New_York");
const auto tp = convert(civil_second(2009, 2, 13, 18, 31, 30), tz);
- EXPECT_EQ(system_clock::from_time_t(1234567890), tp);
+ EXPECT_EQ(chrono::system_clock::from_time_t(1234567890), tp);
// Now requests for the same time_point but with out-of-range fields.
EXPECT_EQ(tp, convert(civil_second(2008, 14, 13, 18, 31, 30), tz)); // month
@@ -919,67 +929,130 @@ TEST(MakeTime, Normalization) {
TEST(MakeTime, SysSecondsLimits) {
const char RFC3339[] = "%Y-%m-%dT%H:%M:%S%Ez";
const time_zone utc = utc_time_zone();
- const time_zone east = fixed_time_zone(hours(14));
- const time_zone west = fixed_time_zone(-hours(14));
- time_point<sys_seconds> tp;
+ const time_zone east = fixed_time_zone(chrono::hours(14));
+ const time_zone west = fixed_time_zone(-chrono::hours(14));
+ time_point<absl::time_internal::cctz::seconds> tp;
- // Approach the maximal time_point<sys_seconds> value from below.
+ // Approach the maximal time_point<cctz::seconds> value from below.
tp = convert(civil_second(292277026596, 12, 4, 15, 30, 6), utc);
EXPECT_EQ("292277026596-12-04T15:30:06+00:00", format(RFC3339, tp, utc));
tp = convert(civil_second(292277026596, 12, 4, 15, 30, 7), utc);
EXPECT_EQ("292277026596-12-04T15:30:07+00:00", format(RFC3339, tp, utc));
- EXPECT_EQ(time_point<sys_seconds>::max(), tp);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
tp = convert(civil_second(292277026596, 12, 4, 15, 30, 8), utc);
- EXPECT_EQ(time_point<sys_seconds>::max(), tp);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
tp = convert(civil_second::max(), utc);
- EXPECT_EQ(time_point<sys_seconds>::max(), tp);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
// Checks that we can also get the maximal value for a far-east zone.
tp = convert(civil_second(292277026596, 12, 5, 5, 30, 7), east);
EXPECT_EQ("292277026596-12-05T05:30:07+14:00", format(RFC3339, tp, east));
- EXPECT_EQ(time_point<sys_seconds>::max(), tp);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
tp = convert(civil_second(292277026596, 12, 5, 5, 30, 8), east);
- EXPECT_EQ(time_point<sys_seconds>::max(), tp);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
tp = convert(civil_second::max(), east);
- EXPECT_EQ(time_point<sys_seconds>::max(), tp);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
// Checks that we can also get the maximal value for a far-west zone.
tp = convert(civil_second(292277026596, 12, 4, 1, 30, 7), west);
EXPECT_EQ("292277026596-12-04T01:30:07-14:00", format(RFC3339, tp, west));
- EXPECT_EQ(time_point<sys_seconds>::max(), tp);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
tp = convert(civil_second(292277026596, 12, 4, 7, 30, 8), west);
- EXPECT_EQ(time_point<sys_seconds>::max(), tp);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
tp = convert(civil_second::max(), west);
- EXPECT_EQ(time_point<sys_seconds>::max(), tp);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
- // Approach the minimal time_point<sys_seconds> value from above.
+ // Approach the minimal time_point<cctz::seconds> value from above.
tp = convert(civil_second(-292277022657, 1, 27, 8, 29, 53), utc);
EXPECT_EQ("-292277022657-01-27T08:29:53+00:00", format(RFC3339, tp, utc));
tp = convert(civil_second(-292277022657, 1, 27, 8, 29, 52), utc);
EXPECT_EQ("-292277022657-01-27T08:29:52+00:00", format(RFC3339, tp, utc));
- EXPECT_EQ(time_point<sys_seconds>::min(), tp);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
tp = convert(civil_second(-292277022657, 1, 27, 8, 29, 51), utc);
- EXPECT_EQ(time_point<sys_seconds>::min(), tp);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
tp = convert(civil_second::min(), utc);
- EXPECT_EQ(time_point<sys_seconds>::min(), tp);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
// Checks that we can also get the minimal value for a far-east zone.
tp = convert(civil_second(-292277022657, 1, 27, 22, 29, 52), east);
EXPECT_EQ("-292277022657-01-27T22:29:52+14:00", format(RFC3339, tp, east));
- EXPECT_EQ(time_point<sys_seconds>::min(), tp);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
tp = convert(civil_second(-292277022657, 1, 27, 22, 29, 51), east);
- EXPECT_EQ(time_point<sys_seconds>::min(), tp);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
tp = convert(civil_second::min(), east);
- EXPECT_EQ(time_point<sys_seconds>::min(), tp);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
// Checks that we can also get the minimal value for a far-west zone.
tp = convert(civil_second(-292277022657, 1, 26, 18, 29, 52), west);
EXPECT_EQ("-292277022657-01-26T18:29:52-14:00", format(RFC3339, tp, west));
- EXPECT_EQ(time_point<sys_seconds>::min(), tp);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
tp = convert(civil_second(-292277022657, 1, 26, 18, 29, 51), west);
- EXPECT_EQ(time_point<sys_seconds>::min(), tp);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
tp = convert(civil_second::min(), west);
- EXPECT_EQ(time_point<sys_seconds>::min(), tp);
+ EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+}
+
+TEST(NextTransition, UTC) {
+ const auto tz = utc_time_zone();
+ time_zone::civil_transition trans;
+
+ auto tp = time_point<absl::time_internal::cctz::seconds>::min();
+ EXPECT_FALSE(tz.next_transition(tp, &trans));
+
+ tp = time_point<absl::time_internal::cctz::seconds>::max();
+ EXPECT_FALSE(tz.next_transition(tp, &trans));
+}
+
+TEST(PrevTransition, UTC) {
+ const auto tz = utc_time_zone();
+ time_zone::civil_transition trans;
+
+ auto tp = time_point<absl::time_internal::cctz::seconds>::max();
+ EXPECT_FALSE(tz.prev_transition(tp, &trans));
+
+ tp = time_point<absl::time_internal::cctz::seconds>::min();
+ EXPECT_FALSE(tz.prev_transition(tp, &trans));
+}
+
+TEST(NextTransition, AmericaNewYork) {
+ const auto tz = LoadZone("America/New_York");
+ time_zone::civil_transition trans;
+
+ auto tp = convert(civil_second(2018, 6, 30, 0, 0, 0), tz);
+ EXPECT_TRUE(tz.next_transition(tp, &trans));
+ EXPECT_EQ(civil_second(2018, 11, 4, 2, 0, 0), trans.from);
+ EXPECT_EQ(civil_second(2018, 11, 4, 1, 0, 0), trans.to);
+
+ tp = time_point<absl::time_internal::cctz::seconds>::max();
+ EXPECT_FALSE(tz.next_transition(tp, &trans));
+
+ tp = time_point<absl::time_internal::cctz::seconds>::min();
+ EXPECT_TRUE(tz.next_transition(tp, &trans));
+ if (trans.from == civil_second(1918, 3, 31, 2, 0, 0)) {
+ // It looks like the tzdata is only 32 bit (probably macOS),
+ // which bottoms out at 1901-12-13T20:45:52+00:00.
+ EXPECT_EQ(civil_second(1918, 3, 31, 3, 0, 0), trans.to);
+ } else {
+ EXPECT_EQ(civil_second(1883, 11, 18, 12, 3, 58), trans.from);
+ EXPECT_EQ(civil_second(1883, 11, 18, 12, 0, 0), trans.to);
+ }
+}
+
+TEST(PrevTransition, AmericaNewYork) {
+ const auto tz = LoadZone("America/New_York");
+ time_zone::civil_transition trans;
+
+ auto tp = convert(civil_second(2018, 6, 30, 0, 0, 0), tz);
+ EXPECT_TRUE(tz.prev_transition(tp, &trans));
+ EXPECT_EQ(civil_second(2018, 3, 11, 2, 0, 0), trans.from);
+ EXPECT_EQ(civil_second(2018, 3, 11, 3, 0, 0), trans.to);
+
+ tp = time_point<absl::time_internal::cctz::seconds>::min();
+ EXPECT_FALSE(tz.prev_transition(tp, &trans));
+
+ tp = time_point<absl::time_internal::cctz::seconds>::max();
+ EXPECT_TRUE(tz.prev_transition(tp, &trans));
+ // We have a transition but we don't know which one.
}
TEST(TimeZoneEdgeCase, AmericaNewYork) {
@@ -988,13 +1061,13 @@ TEST(TimeZoneEdgeCase, AmericaNewYork) {
// Spring 1:59:59 -> 3:00:00
auto tp = convert(civil_second(2013, 3, 10, 1, 59, 59), tz);
ExpectTime(tp, tz, 2013, 3, 10, 1, 59, 59, -5 * 3600, false, "EST");
- tp += seconds(1);
+ tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2013, 3, 10, 3, 0, 0, -4 * 3600, true, "EDT");
// Fall 1:59:59 -> 1:00:00
tp = convert(civil_second(2013, 11, 3, 1, 59, 59), tz);
ExpectTime(tp, tz, 2013, 11, 3, 1, 59, 59, -4 * 3600, true, "EDT");
- tp += seconds(1);
+ tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2013, 11, 3, 1, 0, 0, -5 * 3600, false, "EST");
}
@@ -1004,13 +1077,13 @@ TEST(TimeZoneEdgeCase, AmericaLosAngeles) {
// Spring 1:59:59 -> 3:00:00
auto tp = convert(civil_second(2013, 3, 10, 1, 59, 59), tz);
ExpectTime(tp, tz, 2013, 3, 10, 1, 59, 59, -8 * 3600, false, "PST");
- tp += seconds(1);
+ tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2013, 3, 10, 3, 0, 0, -7 * 3600, true, "PDT");
// Fall 1:59:59 -> 1:00:00
tp = convert(civil_second(2013, 11, 3, 1, 59, 59), tz);
ExpectTime(tp, tz, 2013, 11, 3, 1, 59, 59, -7 * 3600, true, "PDT");
- tp += seconds(1);
+ tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2013, 11, 3, 1, 0, 0, -8 * 3600, false, "PST");
}
@@ -1020,13 +1093,13 @@ TEST(TimeZoneEdgeCase, ArizonaNoTransition) {
// No transition in Spring.
auto tp = convert(civil_second(2013, 3, 10, 1, 59, 59), tz);
ExpectTime(tp, tz, 2013, 3, 10, 1, 59, 59, -7 * 3600, false, "MST");
- tp += seconds(1);
+ tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2013, 3, 10, 2, 0, 0, -7 * 3600, false, "MST");
// No transition in Fall.
tp = convert(civil_second(2013, 11, 3, 1, 59, 59), tz);
ExpectTime(tp, tz, 2013, 11, 3, 1, 59, 59, -7 * 3600, false, "MST");
- tp += seconds(1);
+ tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2013, 11, 3, 2, 0, 0, -7 * 3600, false, "MST");
}
@@ -1039,7 +1112,7 @@ TEST(TimeZoneEdgeCase, AsiaKathmandu) {
// 504901800 == Wed, 1 Jan 1986 00:15:00 +0545 (+0545)
auto tp = convert(civil_second(1985, 12, 31, 23, 59, 59), tz);
ExpectTime(tp, tz, 1985, 12, 31, 23, 59, 59, 5.5 * 3600, false, "+0530");
- tp += seconds(1);
+ tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 1986, 1, 1, 0, 15, 0, 5.75 * 3600, false, "+0545");
}
@@ -1052,14 +1125,14 @@ TEST(TimeZoneEdgeCase, PacificChatham) {
// 1365256800 == Sun, 7 Apr 2013 02:45:00 +1245 (+1245)
auto tp = convert(civil_second(2013, 4, 7, 3, 44, 59), tz);
ExpectTime(tp, tz, 2013, 4, 7, 3, 44, 59, 13.75 * 3600, true, "+1345");
- tp += seconds(1);
+ tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2013, 4, 7, 2, 45, 0, 12.75 * 3600, false, "+1245");
// 1380376799 == Sun, 29 Sep 2013 02:44:59 +1245 (+1245)
// 1380376800 == Sun, 29 Sep 2013 03:45:00 +1345 (+1345)
tp = convert(civil_second(2013, 9, 29, 2, 44, 59), tz);
ExpectTime(tp, tz, 2013, 9, 29, 2, 44, 59, 12.75 * 3600, false, "+1245");
- tp += seconds(1);
+ tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2013, 9, 29, 3, 45, 0, 13.75 * 3600, true, "+1345");
}
@@ -1072,14 +1145,14 @@ TEST(TimeZoneEdgeCase, AustraliaLordHowe) {
// 1365260400 == Sun, 7 Apr 2013 01:30:00 +1030 (+1030)
auto tp = convert(civil_second(2013, 4, 7, 1, 59, 59), tz);
ExpectTime(tp, tz, 2013, 4, 7, 1, 59, 59, 11 * 3600, true, "+11");
- tp += seconds(1);
+ tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2013, 4, 7, 1, 30, 0, 10.5 * 3600, false, "+1030");
// 1380986999 == Sun, 6 Oct 2013 01:59:59 +1030 (+1030)
// 1380987000 == Sun, 6 Oct 2013 02:30:00 +1100 (+11)
tp = convert(civil_second(2013, 10, 6, 1, 59, 59), tz);
ExpectTime(tp, tz, 2013, 10, 6, 1, 59, 59, 10.5 * 3600, false, "+1030");
- tp += seconds(1);
+ tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2013, 10, 6, 2, 30, 0, 11 * 3600, true, "+11");
}
@@ -1097,7 +1170,7 @@ TEST(TimeZoneEdgeCase, PacificApia) {
auto tp = convert(civil_second(2011, 12, 29, 23, 59, 59), tz);
ExpectTime(tp, tz, 2011, 12, 29, 23, 59, 59, -10 * 3600, true, "-10");
EXPECT_EQ(363, get_yearday(civil_day(convert(tp, tz))));
- tp += seconds(1);
+ tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2011, 12, 31, 0, 0, 0, 14 * 3600, true, "+14");
EXPECT_EQ(365, get_yearday(civil_day(convert(tp, tz))));
}
@@ -1105,35 +1178,31 @@ TEST(TimeZoneEdgeCase, PacificApia) {
TEST(TimeZoneEdgeCase, AfricaCairo) {
const time_zone tz = LoadZone("Africa/Cairo");
-#if defined(__ANDROID__) && __ANDROID_API__ < 21
- // Only Android 'L' and beyond have this tz2014c transition.
-#else
- // An interesting case of midnight not existing.
- //
- // 1400191199 == Thu, 15 May 2014 23:59:59 +0200 (EET)
- // 1400191200 == Fri, 16 May 2014 01:00:00 +0300 (EEST)
- auto tp = convert(civil_second(2014, 5, 15, 23, 59, 59), tz);
- ExpectTime(tp, tz, 2014, 5, 15, 23, 59, 59, 2 * 3600, false, "EET");
- tp += seconds(1);
- ExpectTime(tp, tz, 2014, 5, 16, 1, 0, 0, 3 * 3600, true, "EEST");
-#endif
+ if (VersionCmp(tz, "2014c") >= 0) {
+ // An interesting case of midnight not existing.
+ //
+ // 1400191199 == Thu, 15 May 2014 23:59:59 +0200 (EET)
+ // 1400191200 == Fri, 16 May 2014 01:00:00 +0300 (EEST)
+ auto tp = convert(civil_second(2014, 5, 15, 23, 59, 59), tz);
+ ExpectTime(tp, tz, 2014, 5, 15, 23, 59, 59, 2 * 3600, false, "EET");
+ tp += absl::time_internal::cctz::seconds(1);
+ ExpectTime(tp, tz, 2014, 5, 16, 1, 0, 0, 3 * 3600, true, "EEST");
+ }
}
TEST(TimeZoneEdgeCase, AfricaMonrovia) {
const time_zone tz = LoadZone("Africa/Monrovia");
-#if defined(__ANDROID__) && __ANDROID_API__ < 26
- // Only Android 'O' and beyond have this tz2017b transition.
-#else
- // Strange offset change -00:44:30 -> +00:00:00 (non-DST)
- //
- // 63593069 == Thu, 6 Jan 1972 23:59:59 -0044 (MMT)
- // 63593070 == Fri, 7 Jan 1972 00:44:30 +0000 (GMT)
- auto tp = convert(civil_second(1972, 1, 6, 23, 59, 59), tz);
- ExpectTime(tp, tz, 1972, 1, 6, 23, 59, 59, -44.5 * 60, false, "MMT");
- tp += seconds(1);
- ExpectTime(tp, tz, 1972, 1, 7, 0, 44, 30, 0 * 60, false, "GMT");
-#endif
+ if (VersionCmp(tz, "2017b") >= 0) {
+ // Strange offset change -00:44:30 -> +00:00:00 (non-DST)
+ //
+ // 63593069 == Thu, 6 Jan 1972 23:59:59 -0044 (MMT)
+ // 63593070 == Fri, 7 Jan 1972 00:44:30 +0000 (GMT)
+ auto tp = convert(civil_second(1972, 1, 6, 23, 59, 59), tz);
+ ExpectTime(tp, tz, 1972, 1, 6, 23, 59, 59, -44.5 * 60, false, "MMT");
+ tp += absl::time_internal::cctz::seconds(1);
+ ExpectTime(tp, tz, 1972, 1, 7, 0, 44, 30, 0 * 60, false, "GMT");
+ }
}
TEST(TimeZoneEdgeCase, AmericaJamaica) {
@@ -1145,30 +1214,31 @@ TEST(TimeZoneEdgeCase, AmericaJamaica) {
const time_zone tz = LoadZone("America/Jamaica");
// Before the first transition.
- auto tp = convert(civil_second(1889, 12, 31, 0, 0, 0), tz);
-#if AMERICA_JAMAICA_PRE_1913_OFFSET_FIX
- // Commit 907241e: Fix off-by-1 error for Jamaica and T&C before 1913.
- // Until that commit has made its way into a full release we avoid the
- // expectations on the -18430 offset below. TODO: Uncomment these.
- ExpectTime(tp, tz, 1889, 12, 31, 0, 0, 0, -18430, false,
- tz.lookup(tp).abbr);
-
- // Over the first (abbreviation-change only) transition.
- // -2524503170 == Tue, 31 Dec 1889 23:59:59 -0507 (LMT)
- // -2524503169 == Wed, 1 Jan 1890 00:00:00 -0507 (KMT)
- tp = convert(civil_second(1889, 12, 31, 23, 59, 59), tz);
- ExpectTime(tp, tz, 1889, 12, 31, 23, 59, 59, -18430, false,
- tz.lookup(tp).abbr);
- tp += seconds(1);
- ExpectTime(tp, tz, 1890, 1, 1, 0, 0, 0, -18430, false, "KMT");
-#endif
+ if (!tz.version().empty() && VersionCmp(tz, "2018d") >= 0) {
+ // We avoid the expectations on the -18430 offset below unless we are
+ // certain we have commit 907241e (Fix off-by-1 error for Jamaica and
+ // T&C before 1913) from 2018d. TODO: Remove the "version() not empty"
+ // part when 2018d is generally available from /usr/share/zoneinfo.
+ auto tp = convert(civil_second(1889, 12, 31, 0, 0, 0), tz);
+ ExpectTime(tp, tz, 1889, 12, 31, 0, 0, 0, -18430, false,
+ tz.lookup(tp).abbr);
+
+ // Over the first (abbreviation-change only) transition.
+ // -2524503170 == Tue, 31 Dec 1889 23:59:59 -0507 (LMT)
+ // -2524503169 == Wed, 1 Jan 1890 00:00:00 -0507 (KMT)
+ tp = convert(civil_second(1889, 12, 31, 23, 59, 59), tz);
+ ExpectTime(tp, tz, 1889, 12, 31, 23, 59, 59, -18430, false,
+ tz.lookup(tp).abbr);
+ tp += absl::time_internal::cctz::seconds(1);
+ ExpectTime(tp, tz, 1890, 1, 1, 0, 0, 0, -18430, false, "KMT");
+ }
// Over the last (DST) transition.
// 436341599 == Sun, 30 Oct 1983 01:59:59 -0400 (EDT)
// 436341600 == Sun, 30 Oct 1983 01:00:00 -0500 (EST)
- tp = convert(civil_second(1983, 10, 30, 1, 59, 59), tz);
+ auto tp = convert(civil_second(1983, 10, 30, 1, 59, 59), tz);
ExpectTime(tp, tz, 1983, 10, 30, 1, 59, 59, -4 * 3600, true, "EDT");
- tp += seconds(1);
+ tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 1983, 10, 30, 1, 0, 0, -5 * 3600, false, "EST");
// After the last transition.
@@ -1189,7 +1259,7 @@ TEST(TimeZoneEdgeCase, WET) {
// 228877200 == Sun, 3 Apr 1977 02:00:00 +0100 (WEST)
tp = convert(civil_second(1977, 4, 3, 0, 59, 59), tz);
ExpectTime(tp, tz, 1977, 4, 3, 0, 59, 59, 0, false, "WET");
- tp += seconds(1);
+ tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 1977, 4, 3, 2, 0, 0, 1 * 3600, true, "WEST");
// A non-existent time within the first transition.
@@ -1211,12 +1281,12 @@ TEST(TimeZoneEdgeCase, FixedOffsets) {
const time_zone gmtm5 = LoadZone("Etc/GMT+5"); // -0500
auto tp = convert(civil_second(1970, 1, 1, 0, 0, 0), gmtm5);
ExpectTime(tp, gmtm5, 1970, 1, 1, 0, 0, 0, -5 * 3600, false, "-05");
- EXPECT_EQ(system_clock::from_time_t(5 * 3600), tp);
+ EXPECT_EQ(chrono::system_clock::from_time_t(5 * 3600), tp);
const time_zone gmtp5 = LoadZone("Etc/GMT-5"); // +0500
tp = convert(civil_second(1970, 1, 1, 0, 0, 0), gmtp5);
ExpectTime(tp, gmtp5, 1970, 1, 1, 0, 0, 0, 5 * 3600, false, "+05");
- EXPECT_EQ(system_clock::from_time_t(-5 * 3600), tp);
+ EXPECT_EQ(chrono::system_clock::from_time_t(-5 * 3600), tp);
}
TEST(TimeZoneEdgeCase, NegativeYear) {
@@ -1225,7 +1295,7 @@ TEST(TimeZoneEdgeCase, NegativeYear) {
auto tp = convert(civil_second(0, 1, 1, 0, 0, 0), tz);
ExpectTime(tp, tz, 0, 1, 1, 0, 0, 0, 0 * 3600, false, "UTC");
EXPECT_EQ(weekday::saturday, get_weekday(civil_day(convert(tp, tz))));
- tp -= seconds(1);
+ tp -= absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, -1, 12, 31, 23, 59, 59, 0 * 3600, false, "UTC");
EXPECT_EQ(weekday::friday, get_weekday(civil_day(convert(tp, tz))));
}
@@ -1239,7 +1309,7 @@ TEST(TimeZoneEdgeCase, UTC32bitLimit) {
// 2147483648 == Tue, 19 Jan 2038 03:14:08 +0000 (UTC)
auto tp = convert(civil_second(2038, 1, 19, 3, 14, 7), tz);
ExpectTime(tp, tz, 2038, 1, 19, 3, 14, 7, 0 * 3600, false, "UTC");
- tp += seconds(1);
+ tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 2038, 1, 19, 3, 14, 8, 0 * 3600, false, "UTC");
}
@@ -1252,7 +1322,7 @@ TEST(TimeZoneEdgeCase, UTC5DigitYear) {
// 253402300800 == Sat, 1 Jan 1000 00:00:00 +0000 (UTC)
auto tp = convert(civil_second(9999, 12, 31, 23, 59, 59), tz);
ExpectTime(tp, tz, 9999, 12, 31, 23, 59, 59, 0 * 3600, false, "UTC");
- tp += seconds(1);
+ tp += absl::time_internal::cctz::seconds(1);
ExpectTime(tp, tz, 10000, 1, 1, 0, 0, 0, 0 * 3600, false, "UTC");
}
diff --git a/absl/time/internal/cctz/src/zone_info_source.cc b/absl/time/internal/cctz/src/zone_info_source.cc
index b77c0a58..bf2d2d2d 100644
--- a/absl/time/internal/cctz/src/zone_info_source.cc
+++ b/absl/time/internal/cctz/src/zone_info_source.cc
@@ -20,6 +20,7 @@ namespace cctz {
// Defined out-of-line to avoid emitting a weak vtable in all TUs.
ZoneInfoSource::~ZoneInfoSource() {}
+std::string ZoneInfoSource::Version() const { return std::string(); }
} // namespace cctz
} // namespace time_internal
@@ -60,9 +61,17 @@ ZoneInfoSourceFactory default_factory = DefaultFactory;
#else
#error Unsupported MSVC platform
#endif
-#else
+#else // _MSC_VER
+#if !defined(__has_attribute)
+#define __has_attribute(x) 0
+#endif
+#if __has_attribute(weak) || defined(__GNUC__)
ZoneInfoSourceFactory zone_info_source_factory
__attribute__((weak)) = DefaultFactory;
+#else
+// Make it a "strong" definition if we have no other choice.
+ZoneInfoSourceFactory zone_info_source_factory = DefaultFactory;
+#endif
#endif // _MSC_VER
} // namespace cctz_extension
diff --git a/absl/time/time.cc b/absl/time/time.cc
index 03720f62..71fd8ee6 100644
--- a/absl/time/time.cc
+++ b/absl/time/time.cc
@@ -44,8 +44,8 @@ namespace absl {
namespace {
-inline cctz::time_point<cctz::sys_seconds> unix_epoch() {
- return std::chrono::time_point_cast<cctz::sys_seconds>(
+inline cctz::time_point<cctz::seconds> unix_epoch() {
+ return std::chrono::time_point_cast<cctz::seconds>(
std::chrono::system_clock::from_time_t(0));
}
@@ -110,12 +110,12 @@ inline TimeConversion InfinitePastTimeConversion() {
// Makes a Time from sec, overflowing to InfiniteFuture/InfinitePast as
// necessary. If sec is min/max, then consult cs+tz to check for overlow.
-Time MakeTimeWithOverflow(const cctz::time_point<cctz::sys_seconds>& sec,
+Time MakeTimeWithOverflow(const cctz::time_point<cctz::seconds>& sec,
const cctz::civil_second& cs,
const cctz::time_zone& tz,
bool* normalized = nullptr) {
- const auto max = cctz::time_point<cctz::sys_seconds>::max();
- const auto min = cctz::time_point<cctz::sys_seconds>::min();
+ const auto max = cctz::time_point<cctz::seconds>::max();
+ const auto min = cctz::time_point<cctz::seconds>::min();
if (sec == max) {
const auto al = tz.lookup(max);
if (cs > al.cs) {
@@ -174,8 +174,7 @@ absl::Time::Breakdown Time::In(absl::TimeZone tz) const {
if (*this == absl::InfiniteFuture()) return absl::InfiniteFutureBreakdown();
if (*this == absl::InfinitePast()) return absl::InfinitePastBreakdown();
- const auto tp =
- unix_epoch() + cctz::sys_seconds(time_internal::GetRepHi(rep_));
+ const auto tp = unix_epoch() + cctz::seconds(time_internal::GetRepHi(rep_));
const auto al = cctz::time_zone(tz).lookup(tp);
const auto cs = al.cs;
const auto cd = cctz::civil_day(cs);
diff --git a/absl/time/time.h b/absl/time/time.h
index 99c12bbd..880fc783 100644
--- a/absl/time/time.h
+++ b/absl/time/time.h
@@ -50,7 +50,7 @@
#ifndef ABSL_TIME_TIME_H_
#define ABSL_TIME_TIME_H_
-#if !defined(_WIN32)
+#if !defined(_MSC_VER)
#include <sys/time.h>
#else
#include <winsock2.h>
@@ -64,6 +64,7 @@
#include <utility>
#include "absl/base/port.h" // Needed for string vs std::string
+#include "absl/strings/string_view.h"
#include "absl/time/internal/cctz/include/cctz/time_zone.h"
namespace absl {
@@ -491,9 +492,6 @@ inline std::ostream& operator<<(std::ostream& os, Duration d) {
// `ZeroDuration()`. Parses "inf" and "-inf" as +/- `InfiniteDuration()`.
bool ParseDuration(const std::string& dur_string, Duration* d);
-// Flag Support
-// TODO(absl-team): Remove once dependencies are removed.
-
// ParseFlag()
//
bool ParseFlag(const std::string& text, Duration* dst, std::string* error);
@@ -993,8 +991,6 @@ bool ParseTime(const std::string& format, const std::string& input, Time* time,
bool ParseTime(const std::string& format, const std::string& input, TimeZone tz,
Time* time, std::string* err);
-// TODO(absl-team): Remove once dependencies are removed.
-
// ParseFlag()
// UnparseFlag()
//
diff --git a/absl/time/time_zone_test.cc b/absl/time/time_zone_test.cc
index 7138560a..43d91904 100644
--- a/absl/time/time_zone_test.cc
+++ b/absl/time/time_zone_test.cc
@@ -59,7 +59,7 @@ TEST(TimeZone, DefaultTimeZones) {
TEST(TimeZone, FixedTimeZone) {
const absl::TimeZone tz = absl::FixedTimeZone(123);
- const cctz::time_zone cz = cctz::fixed_time_zone(cctz::sys_seconds(123));
+ const cctz::time_zone cz = cctz::fixed_time_zone(cctz::seconds(123));
EXPECT_EQ(tz, absl::TimeZone(cz));
}
diff --git a/absl/types/BUILD.bazel b/absl/types/BUILD.bazel
index 1fc4c098..096c119e 100644
--- a/absl/types/BUILD.bazel
+++ b/absl/types/BUILD.bazel
@@ -42,7 +42,10 @@ cc_library(
name = "bad_any_cast",
hdrs = ["bad_any_cast.h"],
copts = ABSL_DEFAULT_COPTS,
- deps = [":bad_any_cast_impl"],
+ deps = [
+ ":bad_any_cast_impl",
+ "//absl/base:config",
+ ],
)
cc_library(
@@ -248,6 +251,20 @@ cc_test(
)
cc_test(
+ name = "variant_benchmark",
+ srcs = [
+ "variant_benchmark.cc",
+ ],
+ copts = ABSL_TEST_COPTS,
+ tags = ["benchmark"],
+ deps = [
+ ":variant",
+ "//absl/utility",
+ "@com_github_google_benchmark//:benchmark_main",
+ ],
+)
+
+cc_test(
name = "variant_exception_safety_test",
size = "small",
srcs = [
diff --git a/absl/types/bad_any_cast.cc b/absl/types/bad_any_cast.cc
index c9b73300..2e2fd29a 100644
--- a/absl/types/bad_any_cast.cc
+++ b/absl/types/bad_any_cast.cc
@@ -14,6 +14,8 @@
#include "absl/types/bad_any_cast.h"
+#ifndef ABSL_HAVE_STD_ANY
+
#include <cstdlib>
#include "absl/base/config.h"
@@ -38,3 +40,5 @@ void ThrowBadAnyCast() {
} // namespace any_internal
} // namespace absl
+
+#endif // ABSL_HAVE_STD_ANY
diff --git a/absl/types/bad_any_cast.h b/absl/types/bad_any_cast.h
index 3b963077..60390132 100644
--- a/absl/types/bad_any_cast.h
+++ b/absl/types/bad_any_cast.h
@@ -23,6 +23,18 @@
#include <typeinfo>
+#include "absl/base/config.h"
+
+#ifdef ABSL_HAVE_STD_ANY
+
+#include <any>
+
+namespace absl {
+using std::bad_any_cast;
+} // namespace absl
+
+#else // ABSL_HAVE_STD_ANY
+
namespace absl {
// -----------------------------------------------------------------------------
@@ -54,4 +66,6 @@ namespace any_internal {
} // namespace any_internal
} // namespace absl
+#endif // ABSL_HAVE_STD_ANY
+
#endif // ABSL_TYPES_BAD_ANY_CAST_H_
diff --git a/absl/types/bad_optional_access.cc b/absl/types/bad_optional_access.cc
index 6bc67df7..55870776 100644
--- a/absl/types/bad_optional_access.cc
+++ b/absl/types/bad_optional_access.cc
@@ -14,6 +14,8 @@
#include "absl/types/bad_optional_access.h"
+#ifndef ABSL_HAVE_STD_OPTIONAL
+
#include <cstdlib>
#include "absl/base/config.h"
@@ -40,3 +42,5 @@ void throw_bad_optional_access() {
} // namespace optional_internal
} // namespace absl
+
+#endif // ABSL_HAVE_STD_OPTIONAL
diff --git a/absl/types/bad_optional_access.h b/absl/types/bad_optional_access.h
index e9aa8b83..c6c27460 100644
--- a/absl/types/bad_optional_access.h
+++ b/absl/types/bad_optional_access.h
@@ -23,6 +23,18 @@
#include <stdexcept>
+#include "absl/base/config.h"
+
+#ifdef ABSL_HAVE_STD_OPTIONAL
+
+#include <optional>
+
+namespace absl {
+using std::bad_optional_access;
+} // namespace absl
+
+#else // ABSL_HAVE_STD_OPTIONAL
+
namespace absl {
// -----------------------------------------------------------------------------
@@ -57,4 +69,6 @@ namespace optional_internal {
} // namespace optional_internal
} // namespace absl
+#endif // ABSL_HAVE_STD_OPTIONAL
+
#endif // ABSL_TYPES_BAD_OPTIONAL_ACCESS_H_
diff --git a/absl/types/bad_variant_access.cc b/absl/types/bad_variant_access.cc
index 817fd789..d27d7756 100644
--- a/absl/types/bad_variant_access.cc
+++ b/absl/types/bad_variant_access.cc
@@ -14,6 +14,8 @@
#include "absl/types/bad_variant_access.h"
+#ifndef ABSL_HAVE_STD_VARIANT
+
#include <cstdlib>
#include <stdexcept>
@@ -56,3 +58,5 @@ void Rethrow() {
} // namespace variant_internal
} // namespace absl
+
+#endif // ABSL_HAVE_STD_VARIANT
diff --git a/absl/types/bad_variant_access.h b/absl/types/bad_variant_access.h
index 67abe713..e7355a5a 100644
--- a/absl/types/bad_variant_access.h
+++ b/absl/types/bad_variant_access.h
@@ -23,6 +23,18 @@
#include <stdexcept>
+#include "absl/base/config.h"
+
+#ifdef ABSL_HAVE_STD_VARIANT
+
+#include <variant>
+
+namespace absl {
+using std::bad_variant_access;
+} // namespace absl
+
+#else // ABSL_HAVE_STD_VARIANT
+
namespace absl {
// -----------------------------------------------------------------------------
@@ -61,4 +73,6 @@ namespace variant_internal {
} // namespace variant_internal
} // namespace absl
+#endif // ABSL_HAVE_STD_VARIANT
+
#endif // ABSL_TYPES_BAD_VARIANT_ACCESS_H_
diff --git a/absl/types/internal/variant.h b/absl/types/internal/variant.h
index 61c56ddf..7db5e053 100644
--- a/absl/types/internal/variant.h
+++ b/absl/types/internal/variant.h
@@ -19,15 +19,19 @@
#ifndef ABSL_TYPES_variant_internal_H_
#define ABSL_TYPES_variant_internal_H_
+#include <cassert>
#include <cstddef>
+#include <cstdlib>
#include <memory>
#include <stdexcept>
#include <tuple>
#include <type_traits>
+#include "absl/base/config.h"
#include "absl/base/internal/identity.h"
#include "absl/base/internal/inline_variable.h"
#include "absl/base/internal/invoke.h"
+#include "absl/base/macros.h"
#include "absl/base/optimization.h"
#include "absl/meta/type_traits.h"
#include "absl/types/bad_variant_access.h"
@@ -119,6 +123,8 @@ using GiveQualsToT = typename GiveQualsTo<T, U>::type;
template <std::size_t I>
using SizeT = std::integral_constant<std::size_t, I>;
+using NPos = SizeT<variant_npos>;
+
template <class Variant, class T, class = void>
struct IndexOfConstructedType {};
@@ -248,19 +254,270 @@ struct MakeVisitationMatrix<ReturnType, FunctionObject,
ReturnType, FunctionObject, index_sequence<TailEndIndices...>,
absl::make_index_sequence<HeadEndIndex>, BoundIndices...> {};
-template <std::size_t... EndIndices, class Op, class... SizeT>
-VisitIndicesResultT<Op, SizeT...> visit_indices(Op&& op, SizeT... indices) {
- return AccessSimpleArray(
- MakeVisitationMatrix<VisitIndicesResultT<Op, SizeT...>, Op,
- index_sequence<(EndIndices + 1)...>>::Run(),
- (indices + 1)...)(absl::forward<Op>(op));
-}
+struct UnreachableSwitchCase {
+ template <class Op>
+ [[noreturn]] static VisitIndicesResultT<Op, std::size_t> Run(
+ Op&& /*ignored*/) {
+#if ABSL_HAVE_BUILTIN(__builtin_unreachable) || \
+ (defined(__GNUC__) && !defined(__clang__))
+ __builtin_unreachable();
+#elif defined(_MSC_VER)
+ __assume(false);
+#else
+ // Try to use assert of false being identified as an unreachable intrinsic.
+ // NOTE: We use assert directly to increase chances of exploiting an assume
+ // intrinsic.
+ assert(false); // NOLINT
+
+ // Hack to silence potential no return warning -- cause an infinite loop.
+ return Run(absl::forward<Op>(op));
+#endif // Checks for __builtin_unreachable
+ }
+};
+
+template <class Op, std::size_t I>
+struct ReachableSwitchCase {
+ static VisitIndicesResultT<Op, std::size_t> Run(Op&& op) {
+ return absl::base_internal::Invoke(absl::forward<Op>(op), SizeT<I>());
+ }
+};
+
+// The number 33 is just a guess at a reasonable maximum to our switch. It is
+// not based on any analysis. The reason it is a power of 2 plus 1 instead of a
+// power of 2 is because the number was picked to correspond to a power of 2
+// amount of "normal" alternatives, plus one for the possibility of the user
+// providing "monostate" in addition to the more natural alternatives.
+ABSL_INTERNAL_INLINE_CONSTEXPR(std::size_t, MaxUnrolledVisitCases, 33);
+
+// Note: The default-definition is for unreachable cases.
+template <bool IsReachable>
+struct PickCaseImpl {
+ template <class Op, std::size_t I>
+ using Apply = UnreachableSwitchCase;
+};
+
+template <>
+struct PickCaseImpl</*IsReachable =*/true> {
+ template <class Op, std::size_t I>
+ using Apply = ReachableSwitchCase<Op, I>;
+};
+
+// Note: This form of dance with template aliases is to make sure that we
+// instantiate a number of templates proportional to the number of variant
+// alternatives rather than a number of templates proportional to our
+// maximum unrolled amount of visitation cases (aliases are effectively
+// "free" whereas other template instantiations are costly).
+template <class Op, std::size_t I, std::size_t EndIndex>
+using PickCase = typename PickCaseImpl<(I < EndIndex)>::template Apply<Op, I>;
template <class ReturnType>
[[noreturn]] ReturnType TypedThrowBadVariantAccess() {
absl::variant_internal::ThrowBadVariantAccess();
}
+// Given N variant sizes, determine the number of cases there would need to be
+// in a single switch-statement that would cover every possibility in the
+// corresponding N-ary visit operation.
+template <std::size_t... NumAlternatives>
+struct NumCasesOfSwitch;
+
+template <std::size_t HeadNumAlternatives, std::size_t... TailNumAlternatives>
+struct NumCasesOfSwitch<HeadNumAlternatives, TailNumAlternatives...> {
+ static constexpr std::size_t value =
+ (HeadNumAlternatives + 1) *
+ NumCasesOfSwitch<TailNumAlternatives...>::value;
+};
+
+template <>
+struct NumCasesOfSwitch<> {
+ static constexpr std::size_t value = 1;
+};
+
+// A switch statement optimizes better than the table of function pointers.
+template <std::size_t EndIndex>
+struct VisitIndicesSwitch {
+ static_assert(EndIndex <= MaxUnrolledVisitCases,
+ "Maximum unrolled switch size exceeded.");
+
+ template <class Op>
+ static VisitIndicesResultT<Op, std::size_t> Run(Op&& op, std::size_t i) {
+ switch (i) {
+ case 0:
+ return PickCase<Op, 0, EndIndex>::Run(absl::forward<Op>(op));
+ case 1:
+ return PickCase<Op, 1, EndIndex>::Run(absl::forward<Op>(op));
+ case 2:
+ return PickCase<Op, 2, EndIndex>::Run(absl::forward<Op>(op));
+ case 3:
+ return PickCase<Op, 3, EndIndex>::Run(absl::forward<Op>(op));
+ case 4:
+ return PickCase<Op, 4, EndIndex>::Run(absl::forward<Op>(op));
+ case 5:
+ return PickCase<Op, 5, EndIndex>::Run(absl::forward<Op>(op));
+ case 6:
+ return PickCase<Op, 6, EndIndex>::Run(absl::forward<Op>(op));
+ case 7:
+ return PickCase<Op, 7, EndIndex>::Run(absl::forward<Op>(op));
+ case 8:
+ return PickCase<Op, 8, EndIndex>::Run(absl::forward<Op>(op));
+ case 9:
+ return PickCase<Op, 9, EndIndex>::Run(absl::forward<Op>(op));
+ case 10:
+ return PickCase<Op, 10, EndIndex>::Run(absl::forward<Op>(op));
+ case 11:
+ return PickCase<Op, 11, EndIndex>::Run(absl::forward<Op>(op));
+ case 12:
+ return PickCase<Op, 12, EndIndex>::Run(absl::forward<Op>(op));
+ case 13:
+ return PickCase<Op, 13, EndIndex>::Run(absl::forward<Op>(op));
+ case 14:
+ return PickCase<Op, 14, EndIndex>::Run(absl::forward<Op>(op));
+ case 15:
+ return PickCase<Op, 15, EndIndex>::Run(absl::forward<Op>(op));
+ case 16:
+ return PickCase<Op, 16, EndIndex>::Run(absl::forward<Op>(op));
+ case 17:
+ return PickCase<Op, 17, EndIndex>::Run(absl::forward<Op>(op));
+ case 18:
+ return PickCase<Op, 18, EndIndex>::Run(absl::forward<Op>(op));
+ case 19:
+ return PickCase<Op, 19, EndIndex>::Run(absl::forward<Op>(op));
+ case 20:
+ return PickCase<Op, 20, EndIndex>::Run(absl::forward<Op>(op));
+ case 21:
+ return PickCase<Op, 21, EndIndex>::Run(absl::forward<Op>(op));
+ case 22:
+ return PickCase<Op, 22, EndIndex>::Run(absl::forward<Op>(op));
+ case 23:
+ return PickCase<Op, 23, EndIndex>::Run(absl::forward<Op>(op));
+ case 24:
+ return PickCase<Op, 24, EndIndex>::Run(absl::forward<Op>(op));
+ case 25:
+ return PickCase<Op, 25, EndIndex>::Run(absl::forward<Op>(op));
+ case 26:
+ return PickCase<Op, 26, EndIndex>::Run(absl::forward<Op>(op));
+ case 27:
+ return PickCase<Op, 27, EndIndex>::Run(absl::forward<Op>(op));
+ case 28:
+ return PickCase<Op, 28, EndIndex>::Run(absl::forward<Op>(op));
+ case 29:
+ return PickCase<Op, 29, EndIndex>::Run(absl::forward<Op>(op));
+ case 30:
+ return PickCase<Op, 30, EndIndex>::Run(absl::forward<Op>(op));
+ case 31:
+ return PickCase<Op, 31, EndIndex>::Run(absl::forward<Op>(op));
+ case 32:
+ return PickCase<Op, 32, EndIndex>::Run(absl::forward<Op>(op));
+ default:
+ ABSL_ASSERT(i == variant_npos);
+ return absl::base_internal::Invoke(absl::forward<Op>(op), NPos());
+ }
+ }
+};
+
+template <std::size_t... EndIndices>
+struct VisitIndicesFallback {
+ template <class Op, class... SizeT>
+ static VisitIndicesResultT<Op, SizeT...> Run(Op&& op, SizeT... indices) {
+ return AccessSimpleArray(
+ MakeVisitationMatrix<VisitIndicesResultT<Op, SizeT...>, Op,
+ index_sequence<(EndIndices + 1)...>>::Run(),
+ (indices + 1)...)(absl::forward<Op>(op));
+ }
+};
+
+// Take an N-dimensional series of indices and convert them into a single index
+// without loss of information. The purpose of this is to be able to convert an
+// N-ary visit operation into a single switch statement.
+template <std::size_t...>
+struct FlattenIndices;
+
+template <std::size_t HeadSize, std::size_t... TailSize>
+struct FlattenIndices<HeadSize, TailSize...> {
+ template<class... SizeType>
+ static constexpr std::size_t Run(std::size_t head, SizeType... tail) {
+ return head + HeadSize * FlattenIndices<TailSize...>::Run(tail...);
+ }
+};
+
+template <>
+struct FlattenIndices<> {
+ static constexpr std::size_t Run() { return 0; }
+};
+
+// Take a single "flattened" index (flattened by FlattenIndices) and determine
+// the value of the index of one of the logically represented dimensions.
+template <std::size_t I, std::size_t IndexToGet, std::size_t HeadSize,
+ std::size_t... TailSize>
+struct UnflattenIndex {
+ static constexpr std::size_t value =
+ UnflattenIndex<I / HeadSize, IndexToGet - 1, TailSize...>::value;
+};
+
+template <std::size_t I, std::size_t HeadSize, std::size_t... TailSize>
+struct UnflattenIndex<I, 0, HeadSize, TailSize...> {
+ static constexpr std::size_t value = (I % HeadSize);
+};
+
+// The backend for converting an N-ary visit operation into a unary visit.
+template <class IndexSequence, std::size_t... EndIndices>
+struct VisitIndicesVariadicImpl;
+
+template <std::size_t... N, std::size_t... EndIndices>
+struct VisitIndicesVariadicImpl<absl::index_sequence<N...>, EndIndices...> {
+ // A type that can take an N-ary function object and converts it to a unary
+ // function object that takes a single, flattened index, and "unflattens" it
+ // into its individual dimensions when forwarding to the wrapped object.
+ template <class Op>
+ struct FlattenedOp {
+ template <std::size_t I>
+ VisitIndicesResultT<Op, decltype(EndIndices)...> operator()(
+ SizeT<I> /*index*/) && {
+ return base_internal::Invoke(
+ absl::forward<Op>(op),
+ SizeT<UnflattenIndex<I, N, (EndIndices + 1)...>::value -
+ std::size_t{1}>()...);
+ }
+
+ Op&& op;
+ };
+
+ template <class Op, class... SizeType>
+ static VisitIndicesResultT<Op, decltype(EndIndices)...> Run(
+ Op&& op, SizeType... i) {
+ return VisitIndicesSwitch<NumCasesOfSwitch<EndIndices...>::value>::Run(
+ FlattenedOp<Op>{absl::forward<Op>(op)},
+ FlattenIndices<(EndIndices + std::size_t{1})...>::Run(
+ (i + std::size_t{1})...));
+ }
+};
+
+template <std::size_t... EndIndices>
+struct VisitIndicesVariadic
+ : VisitIndicesVariadicImpl<absl::make_index_sequence<sizeof...(EndIndices)>,
+ EndIndices...> {};
+
+// This implementation will flatten N-ary visit operations into a single switch
+// statement when the number of cases would be less than our maximum specified
+// switch-statement size.
+// TODO(calabrese)
+// Based on benchmarks, determine whether the function table approach actually
+// does optimize better than a chain of switch statements and possibly update
+// the implementation accordingly. Also consider increasing the maximum switch
+// size.
+template <std::size_t... EndIndices>
+struct VisitIndices
+ : absl::conditional_t<(NumCasesOfSwitch<EndIndices...>::value <=
+ MaxUnrolledVisitCases),
+ VisitIndicesVariadic<EndIndices...>,
+ VisitIndicesFallback<EndIndices...>> {};
+
+template <std::size_t EndIndex>
+struct VisitIndices<EndIndex>
+ : absl::conditional_t<(EndIndex <= MaxUnrolledVisitCases),
+ VisitIndicesSwitch<EndIndex>,
+ VisitIndicesFallback<EndIndex>> {};
+
// Suppress bogus warning on MSVC: MSVC complains that the `reinterpret_cast`
// below is returning the address of a temporary or local object.
#ifdef _MSC_VER
@@ -270,8 +527,10 @@ template <class ReturnType>
// TODO(calabrese) std::launder
// TODO(calabrese) constexpr
+// NOTE: DO NOT REMOVE the `inline` keyword as it is necessary to work around a
+// MSVC bug. See https://github.com/abseil/abseil-cpp/issues/129 for details.
template <class Self, std::size_t I>
-VariantAccessResult<I, Self> AccessUnion(Self&& self, SizeT<I> /*i*/) {
+inline VariantAccessResult<I, Self> AccessUnion(Self&& self, SizeT<I> /*i*/) {
return reinterpret_cast<VariantAccessResult<I, Self>>(self);
}
@@ -313,19 +572,16 @@ struct VariantCoreAccess {
template <class Variant>
static void InitFrom(Variant& self, Variant&& other) { // NOLINT
- variant_internal::visit_indices<absl::variant_size<Variant>::value>(
+ VisitIndices<absl::variant_size<Variant>::value>::Run(
InitFromVisitor<Variant, Variant&&>{&self,
std::forward<Variant>(other)},
other.index());
self.index_ = other.index();
}
+ // Access a variant alternative, assuming the index is correct.
template <std::size_t I, class Variant>
static VariantAccessResult<I, Variant> Access(Variant&& self) {
- if (ABSL_PREDICT_FALSE(self.index_ != I)) {
- TypedThrowBadVariantAccess<VariantAccessResult<I, Variant>>();
- }
-
// This cast instead of invocation of AccessUnion with an rvalue is a
// workaround for msvc. Without this there is a runtime failure when dealing
// with rvalues.
@@ -334,6 +590,16 @@ struct VariantCoreAccess {
variant_internal::AccessUnion(self.state_, SizeT<I>()));
}
+ // Access a variant alternative, throwing if the index is incorrect.
+ template <std::size_t I, class Variant>
+ static VariantAccessResult<I, Variant> CheckedAccess(Variant&& self) {
+ if (ABSL_PREDICT_FALSE(self.index_ != I)) {
+ TypedThrowBadVariantAccess<VariantAccessResult<I, Variant>>();
+ }
+
+ return Access<I>(absl::forward<Variant>(self));
+ }
+
// The implementation of the move-assignment operation for a variant.
template <class VType>
struct MoveAssignVisitor {
@@ -841,49 +1107,40 @@ using EqualResult = decltype(std::declval<T>() == std::declval<T>());
template <class T>
using NotEqualResult = decltype(std::declval<T>() != std::declval<T>());
-template <class T>
-using HasLessThan = is_detected_convertible<bool, LessThanResult, T>;
-
-template <class T>
-using HasGreaterThan = is_detected_convertible<bool, GreaterThanResult, T>;
-
-template <class T>
-using HasLessThanOrEqual =
- is_detected_convertible<bool, LessThanOrEqualResult, T>;
-
-template <class T>
-using HasGreaterThanOrEqual =
- is_detected_convertible<bool, GreaterThanOrEqualResult, T>;
-
-template <class T>
-using HasEqual = is_detected_convertible<bool, EqualResult, T>;
-
-template <class T>
-using HasNotEqual = is_detected_convertible<bool, NotEqualResult, T>;
-
template <class... T>
-using RequireAllHaveEqualT =
- absl::enable_if_t<absl::conjunction<HasEqual<T>...>::value, bool>;
+using RequireAllHaveEqualT = absl::enable_if_t<
+ absl::conjunction<is_detected_convertible<bool, EqualResult, T>...>::value,
+ bool>;
template <class... T>
using RequireAllHaveNotEqualT =
- absl::enable_if_t<absl::conjunction<HasEqual<T>...>::value, bool>;
+ absl::enable_if_t<absl::conjunction<is_detected_convertible<
+ bool, NotEqualResult, T>...>::value,
+ bool>;
template <class... T>
using RequireAllHaveLessThanT =
- absl::enable_if_t<absl::conjunction<HasLessThan<T>...>::value, bool>;
+ absl::enable_if_t<absl::conjunction<is_detected_convertible<
+ bool, LessThanResult, T>...>::value,
+ bool>;
template <class... T>
using RequireAllHaveLessThanOrEqualT =
- absl::enable_if_t<absl::conjunction<HasLessThan<T>...>::value, bool>;
+ absl::enable_if_t<absl::conjunction<is_detected_convertible<
+ bool, LessThanOrEqualResult, T>...>::value,
+ bool>;
template <class... T>
using RequireAllHaveGreaterThanOrEqualT =
- absl::enable_if_t<absl::conjunction<HasLessThan<T>...>::value, bool>;
+ absl::enable_if_t<absl::conjunction<is_detected_convertible<
+ bool, GreaterThanOrEqualResult, T>...>::value,
+ bool>;
template <class... T>
using RequireAllHaveGreaterThanT =
- absl::enable_if_t<absl::conjunction<HasLessThan<T>...>::value, bool>;
+ absl::enable_if_t<absl::conjunction<is_detected_convertible<
+ bool, GreaterThanResult, T>...>::value,
+ bool>;
// Helper template containing implementations details of variant that can't go
// in the private section. For convenience, this takes the variant type as a
@@ -1049,9 +1306,7 @@ class VariantStateBaseDestructorNontrivial : protected VariantStateBase<T...> {
VariantStateBaseDestructorNontrivial* self;
};
- void destroy() {
- variant_internal::visit_indices<sizeof...(T)>(Destroyer{this}, index_);
- }
+ void destroy() { VisitIndices<sizeof...(T)>::Run(Destroyer{this}, index_); }
~VariantStateBaseDestructorNontrivial() { destroy(); }
@@ -1087,8 +1342,7 @@ class VariantMoveBaseNontrivial : protected VariantStateBaseDestructor<T...> {
VariantMoveBaseNontrivial(VariantMoveBaseNontrivial&& other) noexcept(
absl::conjunction<std::is_nothrow_move_constructible<T>...>::value)
: Base(NoopConstructorTag()) {
- variant_internal::visit_indices<sizeof...(T)>(Construct{this, &other},
- other.index_);
+ VisitIndices<sizeof...(T)>::Run(Construct{this, &other}, other.index_);
index_ = other.index_;
}
@@ -1131,8 +1385,7 @@ class VariantCopyBaseNontrivial : protected VariantMoveBase<T...> {
VariantCopyBaseNontrivial(VariantCopyBaseNontrivial const& other)
: Base(NoopConstructorTag()) {
- variant_internal::visit_indices<sizeof...(T)>(Construct{this, &other},
- other.index_);
+ VisitIndices<sizeof...(T)>::Run(Construct{this, &other}, other.index_);
index_ = other.index_;
}
@@ -1166,7 +1419,7 @@ class VariantMoveAssignBaseNontrivial : protected VariantCopyBase<T...> {
operator=(VariantMoveAssignBaseNontrivial&& other) noexcept(
absl::conjunction<std::is_nothrow_move_constructible<T>...,
std::is_nothrow_move_assignable<T>...>::value) {
- variant_internal::visit_indices<sizeof...(T)>(
+ VisitIndices<sizeof...(T)>::Run(
VariantCoreAccess::MakeMoveAssignVisitor(this, &other), other.index_);
return *this;
}
@@ -1195,7 +1448,7 @@ class VariantCopyAssignBaseNontrivial : protected VariantMoveAssignBase<T...> {
VariantCopyAssignBaseNontrivial& operator=(
const VariantCopyAssignBaseNontrivial& other) {
- variant_internal::visit_indices<sizeof...(T)>(
+ VisitIndices<sizeof...(T)>::Run(
VariantCoreAccess::MakeCopyAssignVisitor(this, other), other.index_);
return *this;
}
@@ -1336,7 +1589,7 @@ struct Swap {
template <std::size_t Wi>
void operator()(SizeT<Wi> /*w_i*/) {
if (v->index() == Wi) {
- visit_indices<sizeof...(Types)>(SwapSameIndex<Types...>{v, w}, Wi);
+ VisitIndices<sizeof...(Types)>::Run(SwapSameIndex<Types...>{v, w}, Wi);
} else {
generic_swap();
}
@@ -1370,11 +1623,10 @@ struct VariantHashBase<Variant,
if (var.valueless_by_exception()) {
return 239799884;
}
- size_t result =
- variant_internal::visit_indices<variant_size<Variant>::value>(
- PerformVisitation<VariantHashVisitor, const Variant&>{
- std::forward_as_tuple(var), VariantHashVisitor{}},
- var.index());
+ size_t result = VisitIndices<variant_size<Variant>::value>::Run(
+ PerformVisitation<VariantHashVisitor, const Variant&>{
+ std::forward_as_tuple(var), VariantHashVisitor{}},
+ var.index());
// Combine the index and the hash result in order to distinguish
// std::variant<int, int> holding the same value as different alternative.
return result ^ var.index();
diff --git a/absl/types/optional.h b/absl/types/optional.h
index 80a2d149..c837cdde 100644
--- a/absl/types/optional.h
+++ b/absl/types/optional.h
@@ -48,7 +48,7 @@ using std::optional;
using std::make_optional;
using std::nullopt_t;
using std::nullopt;
-}
+} // namespace absl
#else // ABSL_HAVE_STD_OPTIONAL
diff --git a/absl/types/variant.h b/absl/types/variant.h
index 7ae65abe..17e0634d 100644
--- a/absl/types/variant.h
+++ b/absl/types/variant.h
@@ -248,7 +248,7 @@ using variant_alternative_t = typename variant_alternative<I, T>::type;
//
// Example:
//
-// absl::variant<int, std::string> bar = 42;
+// absl::variant<int, std::string> foo = 42;
// if (absl::holds_alternative<int>(foo)) {
// std::cout << "The variant holds an integer";
// }
@@ -290,7 +290,7 @@ constexpr bool holds_alternative(const variant<Types...>& v) noexcept {
// Overload for getting a variant's lvalue by type.
template <class T, class... Types>
constexpr T& get(variant<Types...>& v) { // NOLINT
- return variant_internal::VariantCoreAccess::Access<
+ return variant_internal::VariantCoreAccess::CheckedAccess<
variant_internal::IndexOf<T, Types...>::value>(v);
}
@@ -298,14 +298,14 @@ constexpr T& get(variant<Types...>& v) { // NOLINT
// Note: `absl::move()` is required to allow use of constexpr in C++11.
template <class T, class... Types>
constexpr T&& get(variant<Types...>&& v) {
- return variant_internal::VariantCoreAccess::Access<
+ return variant_internal::VariantCoreAccess::CheckedAccess<
variant_internal::IndexOf<T, Types...>::value>(absl::move(v));
}
// Overload for getting a variant's const lvalue by type.
template <class T, class... Types>
constexpr const T& get(const variant<Types...>& v) {
- return variant_internal::VariantCoreAccess::Access<
+ return variant_internal::VariantCoreAccess::CheckedAccess<
variant_internal::IndexOf<T, Types...>::value>(v);
}
@@ -313,7 +313,7 @@ constexpr const T& get(const variant<Types...>& v) {
// Note: `absl::move()` is required to allow use of constexpr in C++11.
template <class T, class... Types>
constexpr const T&& get(const variant<Types...>&& v) {
- return variant_internal::VariantCoreAccess::Access<
+ return variant_internal::VariantCoreAccess::CheckedAccess<
variant_internal::IndexOf<T, Types...>::value>(absl::move(v));
}
@@ -321,7 +321,7 @@ constexpr const T&& get(const variant<Types...>&& v) {
template <std::size_t I, class... Types>
constexpr variant_alternative_t<I, variant<Types...>>& get(
variant<Types...>& v) { // NOLINT
- return variant_internal::VariantCoreAccess::Access<I>(v);
+ return variant_internal::VariantCoreAccess::CheckedAccess<I>(v);
}
// Overload for getting a variant's rvalue by index.
@@ -329,14 +329,14 @@ constexpr variant_alternative_t<I, variant<Types...>>& get(
template <std::size_t I, class... Types>
constexpr variant_alternative_t<I, variant<Types...>>&& get(
variant<Types...>&& v) {
- return variant_internal::VariantCoreAccess::Access<I>(absl::move(v));
+ return variant_internal::VariantCoreAccess::CheckedAccess<I>(absl::move(v));
}
// Overload for getting a variant's const lvalue by index.
template <std::size_t I, class... Types>
constexpr const variant_alternative_t<I, variant<Types...>>& get(
const variant<Types...>& v) {
- return variant_internal::VariantCoreAccess::Access<I>(v);
+ return variant_internal::VariantCoreAccess::CheckedAccess<I>(v);
}
// Overload for getting a variant's const rvalue by index.
@@ -344,7 +344,7 @@ constexpr const variant_alternative_t<I, variant<Types...>>& get(
template <std::size_t I, class... Types>
constexpr const variant_alternative_t<I, variant<Types...>>&& get(
const variant<Types...>&& v) {
- return variant_internal::VariantCoreAccess::Access<I>(absl::move(v));
+ return variant_internal::VariantCoreAccess::CheckedAccess<I>(absl::move(v));
}
// get_if()
@@ -362,8 +362,10 @@ constexpr const variant_alternative_t<I, variant<Types...>>&& get(
template <std::size_t I, class... Types>
constexpr absl::add_pointer_t<variant_alternative_t<I, variant<Types...>>>
get_if(variant<Types...>* v) noexcept {
- return (v != nullptr && v->index() == I) ? std::addressof(absl::get<I>(*v))
- : nullptr;
+ return (v != nullptr && v->index() == I)
+ ? std::addressof(
+ variant_internal::VariantCoreAccess::Access<I>(*v))
+ : nullptr;
}
// Overload for getting a pointer to the const value stored in the given
@@ -371,8 +373,10 @@ get_if(variant<Types...>* v) noexcept {
template <std::size_t I, class... Types>
constexpr absl::add_pointer_t<const variant_alternative_t<I, variant<Types...>>>
get_if(const variant<Types...>* v) noexcept {
- return (v != nullptr && v->index() == I) ? std::addressof(absl::get<I>(*v))
- : nullptr;
+ return (v != nullptr && v->index() == I)
+ ? std::addressof(
+ variant_internal::VariantCoreAccess::Access<I>(*v))
+ : nullptr;
}
// Overload for getting a pointer to the value stored in the given variant by
@@ -416,12 +420,12 @@ constexpr absl::add_pointer_t<const T> get_if(
template <typename Visitor, typename... Variants>
variant_internal::VisitResult<Visitor, Variants...> visit(Visitor&& vis,
Variants&&... vars) {
- return variant_internal::visit_indices<
- variant_size<absl::decay_t<Variants>>::value...>(
- variant_internal::PerformVisitation<Visitor, Variants...>{
- std::forward_as_tuple(absl::forward<Variants>(vars)...),
- absl::forward<Visitor>(vis)},
- vars.index()...);
+ return variant_internal::
+ VisitIndices<variant_size<absl::decay_t<Variants> >::value...>::Run(
+ variant_internal::PerformVisitation<Visitor, Variants...>{
+ std::forward_as_tuple(absl::forward<Variants>(vars)...),
+ absl::forward<Visitor>(vis)},
+ vars.index()...);
}
// monostate
@@ -445,12 +449,19 @@ constexpr bool operator!=(monostate, monostate) noexcept { return false; }
//------------------------------------------------------------------------------
template <typename T0, typename... Tn>
class variant<T0, Tn...> : private variant_internal::VariantBase<T0, Tn...> {
- static_assert(absl::conjunction<std::is_object<T0>, std::is_object<Tn>...,
- absl::negation<std::is_array<T0>>,
- absl::negation<std::is_array<Tn>>...,
- std::is_nothrow_destructible<T0>,
+ static_assert(absl::conjunction<std::is_object<T0>,
+ std::is_object<Tn>...>::value,
+ "Attempted to instantiate a variant containing a non-object "
+ "type.");
+ // Intentionally not qualifing `negation` with `absl::` to work around a bug
+ // in MSVC 2015 with inline namespace and variadic template.
+ static_assert(absl::conjunction<negation<std::is_array<T0> >,
+ negation<std::is_array<Tn> >...>::value,
+ "Attempted to instantiate a variant containing an array type.");
+ static_assert(absl::conjunction<std::is_nothrow_destructible<T0>,
std::is_nothrow_destructible<Tn>...>::value,
- "Attempted to instantiate a variant with an unsupported type.");
+ "Attempted to instantiate a variant containing a non-nothrow "
+ "destructible type.");
friend struct variant_internal::VariantCoreAccess;
@@ -573,7 +584,7 @@ class variant<T0, Tn...> : private variant_internal::VariantBase<T0, Tn...> {
variant& operator=(T&& t) noexcept(
std::is_nothrow_assignable<Tj&, T>::value&&
std::is_nothrow_constructible<Tj, T>::value) {
- variant_internal::visit_indices<sizeof...(Tn) + 1>(
+ variant_internal::VisitIndices<sizeof...(Tn) + 1>::Run(
variant_internal::VariantCoreAccess::MakeConversionAssignVisitor(
this, absl::forward<T>(t)),
index());
@@ -682,7 +693,7 @@ class variant<T0, Tn...> : private variant_internal::VariantBase<T0, Tn...> {
// true and `is_nothrow_swappable()` is same as `std::is_trivial()`.
void swap(variant& rhs) noexcept(
absl::conjunction<std::is_trivial<T0>, std::is_trivial<Tn>...>::value) {
- return variant_internal::visit_indices<sizeof...(Tn) + 1>(
+ return variant_internal::VisitIndices<sizeof...(Tn) + 1>::Run(
variant_internal::Swap<T0, Tn...>{this, &rhs}, rhs.index());
}
};
@@ -722,7 +733,7 @@ template <typename... Types>
constexpr variant_internal::RequireAllHaveEqualT<Types...> operator==(
const variant<Types...>& a, const variant<Types...>& b) {
return (a.index() == b.index()) &&
- variant_internal::visit_indices<sizeof...(Types)>(
+ variant_internal::VisitIndices<sizeof...(Types)>::Run(
variant_internal::EqualsOp<Types...>{&a, &b}, a.index());
}
@@ -731,7 +742,7 @@ template <typename... Types>
constexpr variant_internal::RequireAllHaveNotEqualT<Types...> operator!=(
const variant<Types...>& a, const variant<Types...>& b) {
return (a.index() != b.index()) ||
- variant_internal::visit_indices<sizeof...(Types)>(
+ variant_internal::VisitIndices<sizeof...(Types)>::Run(
variant_internal::NotEqualsOp<Types...>{&a, &b}, a.index());
}
@@ -741,7 +752,7 @@ constexpr variant_internal::RequireAllHaveLessThanT<Types...> operator<(
const variant<Types...>& a, const variant<Types...>& b) {
return (a.index() != b.index())
? (a.index() + 1) < (b.index() + 1)
- : variant_internal::visit_indices<sizeof...(Types)>(
+ : variant_internal::VisitIndices<sizeof...(Types)>::Run(
variant_internal::LessThanOp<Types...>{&a, &b}, a.index());
}
@@ -751,7 +762,7 @@ constexpr variant_internal::RequireAllHaveGreaterThanT<Types...> operator>(
const variant<Types...>& a, const variant<Types...>& b) {
return (a.index() != b.index())
? (a.index() + 1) > (b.index() + 1)
- : variant_internal::visit_indices<sizeof...(Types)>(
+ : variant_internal::VisitIndices<sizeof...(Types)>::Run(
variant_internal::GreaterThanOp<Types...>{&a, &b},
a.index());
}
@@ -762,7 +773,7 @@ constexpr variant_internal::RequireAllHaveLessThanOrEqualT<Types...> operator<=(
const variant<Types...>& a, const variant<Types...>& b) {
return (a.index() != b.index())
? (a.index() + 1) < (b.index() + 1)
- : variant_internal::visit_indices<sizeof...(Types)>(
+ : variant_internal::VisitIndices<sizeof...(Types)>::Run(
variant_internal::LessThanOrEqualsOp<Types...>{&a, &b},
a.index());
}
@@ -773,7 +784,7 @@ constexpr variant_internal::RequireAllHaveGreaterThanOrEqualT<Types...>
operator>=(const variant<Types...>& a, const variant<Types...>& b) {
return (a.index() != b.index())
? (a.index() + 1) > (b.index() + 1)
- : variant_internal::visit_indices<sizeof...(Types)>(
+ : variant_internal::VisitIndices<sizeof...(Types)>::Run(
variant_internal::GreaterThanOrEqualsOp<Types...>{&a, &b},
a.index());
}
diff --git a/absl/types/variant_benchmark.cc b/absl/types/variant_benchmark.cc
new file mode 100644
index 00000000..99658ac7
--- /dev/null
+++ b/absl/types/variant_benchmark.cc
@@ -0,0 +1,220 @@
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+// http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+// Unit tests for the variant template. The 'is' and 'IsEmpty' methods
+// of variant are not explicitly tested because they are used repeatedly
+// in building other tests. All other public variant methods should have
+// explicit tests.
+
+#include "absl/types/variant.h"
+
+#include <cstddef>
+#include <cstdlib>
+#include <string>
+#include <tuple>
+
+#include "benchmark/benchmark.h"
+#include "absl/utility/utility.h"
+
+namespace absl {
+namespace {
+
+template <std::size_t I>
+struct VariantAlternative {
+ char member;
+};
+
+template <class Indices>
+struct VariantOfAlternativesImpl;
+
+template <std::size_t... Indices>
+struct VariantOfAlternativesImpl<absl::index_sequence<Indices...>> {
+ using type = absl::variant<VariantAlternative<Indices>...>;
+};
+
+template <std::size_t NumAlternatives>
+using VariantOfAlternatives = typename VariantOfAlternativesImpl<
+ absl::make_index_sequence<NumAlternatives>>::type;
+
+struct Empty {};
+
+template <class... T>
+void Ignore(T...) noexcept {}
+
+template <class T>
+Empty DoNotOptimizeAndReturnEmpty(T&& arg) noexcept {
+ benchmark::DoNotOptimize(arg);
+ return {};
+}
+
+struct VisitorApplier {
+ struct Visitor {
+ template <class... T>
+ void operator()(T&&... args) const noexcept {
+ Ignore(DoNotOptimizeAndReturnEmpty(args)...);
+ }
+ };
+
+ template <class... Vars>
+ void operator()(const Vars&... vars) const noexcept {
+ absl::visit(Visitor(), vars...);
+ }
+};
+
+template <std::size_t NumIndices, std::size_t CurrIndex = NumIndices - 1>
+struct MakeWithIndex {
+ using Variant = VariantOfAlternatives<NumIndices>;
+
+ static Variant Run(std::size_t index) {
+ return index == CurrIndex
+ ? Variant(absl::in_place_index_t<CurrIndex>())
+ : MakeWithIndex<NumIndices, CurrIndex - 1>::Run(index);
+ }
+};
+
+template <std::size_t NumIndices>
+struct MakeWithIndex<NumIndices, 0> {
+ using Variant = VariantOfAlternatives<NumIndices>;
+
+ static Variant Run(std::size_t /*index*/) { return Variant(); }
+};
+
+template <std::size_t NumIndices, class Dimensions>
+struct MakeVariantTuple;
+
+template <class T, std::size_t /*I*/>
+using always_t = T;
+
+template <std::size_t NumIndices>
+VariantOfAlternatives<NumIndices> MakeVariant(std::size_t dimension,
+ std::size_t index) {
+ return dimension == 0
+ ? MakeWithIndex<NumIndices>::Run(index % NumIndices)
+ : MakeVariant<NumIndices>(dimension - 1, index / NumIndices);
+}
+
+template <std::size_t NumIndices, std::size_t... Dimensions>
+struct MakeVariantTuple<NumIndices, absl::index_sequence<Dimensions...>> {
+ using VariantTuple =
+ std::tuple<always_t<VariantOfAlternatives<NumIndices>, Dimensions>...>;
+
+ static VariantTuple Run(int index) {
+ return std::make_tuple(MakeVariant<NumIndices>(Dimensions, index)...);
+ }
+};
+
+constexpr std::size_t integral_pow(std::size_t base, std::size_t power) {
+ return power == 0 ? 1 : base * integral_pow(base, power - 1);
+}
+
+template <std::size_t End, std::size_t I = 0>
+struct VisitTestBody {
+ template <class Vars, class State>
+ static bool Run(Vars& vars, State& state) {
+ if (state.KeepRunning()) {
+ absl::apply(VisitorApplier(), vars[I]);
+ return VisitTestBody<End, I + 1>::Run(vars, state);
+ }
+ return false;
+ }
+};
+
+template <std::size_t End>
+struct VisitTestBody<End, End> {
+ template <class Vars, class State>
+ static bool Run(Vars& /*vars*/, State& /*state*/) {
+ return true;
+ }
+};
+
+// Visit operations where branch prediction is likely to give a boost.
+template <std::size_t NumIndices, std::size_t NumDimensions = 1>
+void BM_RedundantVisit(benchmark::State& state) {
+ auto vars =
+ MakeVariantTuple<NumIndices, absl::make_index_sequence<NumDimensions>>::
+ Run(static_cast<std::size_t>(state.range(0)));
+
+ for (auto _ : state) { // NOLINT
+ benchmark::DoNotOptimize(vars);
+ absl::apply(VisitorApplier(), vars);
+ }
+}
+
+// Visit operations where branch prediction is unlikely to give a boost.
+template <std::size_t NumIndices, std::size_t NumDimensions = 1>
+void BM_Visit(benchmark::State& state) {
+ constexpr std::size_t num_possibilities =
+ integral_pow(NumIndices, NumDimensions);
+
+ using VariantTupleMaker =
+ MakeVariantTuple<NumIndices, absl::make_index_sequence<NumDimensions>>;
+ using Tuple = typename VariantTupleMaker::VariantTuple;
+
+ Tuple vars[num_possibilities];
+ for (std::size_t i = 0; i < num_possibilities; ++i)
+ vars[i] = VariantTupleMaker::Run(i);
+
+ while (VisitTestBody<num_possibilities>::Run(vars, state)) {
+ }
+}
+
+// Visitation
+// Each visit is on a different variant with a different active alternative)
+
+// Unary visit
+BENCHMARK_TEMPLATE(BM_Visit, 1);
+BENCHMARK_TEMPLATE(BM_Visit, 2);
+BENCHMARK_TEMPLATE(BM_Visit, 3);
+BENCHMARK_TEMPLATE(BM_Visit, 4);
+BENCHMARK_TEMPLATE(BM_Visit, 5);
+BENCHMARK_TEMPLATE(BM_Visit, 6);
+BENCHMARK_TEMPLATE(BM_Visit, 7);
+BENCHMARK_TEMPLATE(BM_Visit, 8);
+BENCHMARK_TEMPLATE(BM_Visit, 16);
+BENCHMARK_TEMPLATE(BM_Visit, 32);
+BENCHMARK_TEMPLATE(BM_Visit, 64);
+
+// Binary visit
+BENCHMARK_TEMPLATE(BM_Visit, 1, 2);
+BENCHMARK_TEMPLATE(BM_Visit, 2, 2);
+BENCHMARK_TEMPLATE(BM_Visit, 3, 2);
+BENCHMARK_TEMPLATE(BM_Visit, 4, 2);
+BENCHMARK_TEMPLATE(BM_Visit, 5, 2);
+
+// Ternary visit
+BENCHMARK_TEMPLATE(BM_Visit, 1, 3);
+BENCHMARK_TEMPLATE(BM_Visit, 2, 3);
+BENCHMARK_TEMPLATE(BM_Visit, 3, 3);
+
+// Quaternary visit
+BENCHMARK_TEMPLATE(BM_Visit, 1, 4);
+BENCHMARK_TEMPLATE(BM_Visit, 2, 4);
+
+// Redundant Visitation
+// Each visit consistently has the same alternative active
+
+// Unary visit
+BENCHMARK_TEMPLATE(BM_RedundantVisit, 1)->Arg(0);
+BENCHMARK_TEMPLATE(BM_RedundantVisit, 2)->DenseRange(0, 1);
+BENCHMARK_TEMPLATE(BM_RedundantVisit, 8)->DenseRange(0, 7);
+
+// Binary visit
+BENCHMARK_TEMPLATE(BM_RedundantVisit, 1, 2)->Arg(0);
+BENCHMARK_TEMPLATE(BM_RedundantVisit, 2, 2)
+ ->DenseRange(0, integral_pow(2, 2) - 1);
+BENCHMARK_TEMPLATE(BM_RedundantVisit, 4, 2)
+ ->DenseRange(0, integral_pow(4, 2) - 1);
+
+} // namespace
+} // namespace absl